diff options
275 files changed, 33133 insertions, 3866 deletions
diff --git a/Makefile.am b/Makefile.am index 62169d2..9c27eda 100644 --- a/Makefile.am +++ b/Makefile.am @@ -1,16 +1,9 @@ -SUBDIRS = intl m4 po +SUBDIRS = compat geometry intl keycodes keymap m4 po rules semantics symbols types -xml_in_files = xfree86.xml.in -xml_DATA = $(xml_in_files:.xml.in=.xml) xkb.dtd - -@INTLTOOL_XML_RULE@ - -EXTRA_DIST= config.rpath mkinstalldirs config.rpath $(xml_in_files) $(xml_DATA) \ +EXTRA_DIST= config.rpath mkinstalldirs config.rpath \ autogen.sh \ xfree86_xkb_xml.spec \ xfree86_xkb_xml.spec.in \ intltool-extract.in intltool-merge.in intltool-update.in -xmldir = $(xkb_base)/rules - ACLOCAL_AMFLAGS = -I m4 @@ -1,2 +1,25 @@ -This is just a module containing xmlized directory of the -XKB configuration repository. At the moment, only xfree86. is maintainer here. +X Keyboard Extension +-------------------- + +The X Keyboard Extension essentially replaces the core protocol definition of +keyboard. The extension makes possible to clearly and explicitly specify most +aspects of keyboard behaviour on per-key basis and to more closely track the +logical and physical state of the keyboard. It also includes a number of +keyboard controls designed to make keyboards more accessible to people with +physical impairments. + +There are five types of components in the server database corresponing to five +xkb symbolic names: symbols, geometry, keycodes, compat and types which +determine the keyboard behaviour. These five components can combined together +into a resulting keyboard mapping using the 'rules' component. + +The complete specification can be found on +http://www.x-docs.org/XKB/XKBproto.pdf + +For XKB configuration information see 'README.config' file. + +For information how to further enhance XKB configuration see 'README.enhancing' +file. + + +$XFree86$ diff --git a/README.config b/README.config new file mode 100644 index 0000000..229049d --- /dev/null +++ b/README.config @@ -0,0 +1,198 @@ + The XKB Configuration Guide + + Kamil Toman, Ivan U. Pascal + + 25 November 2002 + + Abstract + + This document describes how to configure XFree86 XKB from a user's + point a few. It converts basic configuration syntax and gives also + a few examples. + +1. Overview + +The XKB configuration is decomposed into a number of components. Selecting +proper parts and combining them back you can achieve most of configurations +you might need. Unless you have a completely atypical keyboard you really +don't need to touch any of xkb configuration files. + +2. Selecting XKB Configuration + +The easiest and the most natural way how to specify a keyboard mapping is to +use rules component. As its name suggests it describes a number of general +rules how to combine all bits and pieces into a valid and useful keyboard +mapping. All you need to do is to select a suitable rules file and then to +feed it with a few parameters that will adjust the keyboard behaviour to ful- +fill your needs. + +The parameters are: + + o XkbRules - files of rules to be used for keyboard mapping composition + + o XkbModel - name of model of your keyboard type + + o XkbLayout - layout(s) you intend to use + + o XkbVariant - variant(s) of layout you intend to use + + o XkbOptions - extra xkb configuration options + +The proper rules file depends on your vendor. In reality, the commonest file +of rules is xfree86. For each rules file there is a description file named +<vendor-rules>.lst, for instance xfree86.lst which is located in xkb configu- +ration subdirectory rules (for example /etc/X11/xkb/rules). + +2.1 Basic Configuration + +Let's say you want to configure a PC style America keyboard with 104 keys as +described in xfree86.lst. It can be done by simply writing several lines from +below to you XFree86 configuration file (often found as /etc/X11/XF86Config-4 +or /etc/X11/XF86Config): + + Section "InputDevice" + Identifier "Keyboard1" + Driver "Keyboard" + + Option "XkbModel" "pc104" + Option "XkbLayout" "us" + Option "XKbOptions" "" + EndSection + +The values of parameters XkbModel and XkbLayout are really not surprising. +The parameters XkbOptions has been explicitly set to empty set of parameters. +The parameter XkbVariant has been left out. That means the default variant +named basic is loaded. + +Of course, this can be also done at runtime using utility setxkbmap. Shell +command loading the same keyboard mapping would look like: + + setxkbmap -rules xfree86 -model pc104 -layout us -option "" + +The configuration and the shell command would be very analogical for most +other layouts (internationalized mappings). + +2.2 Advanced Configuration + +Since XFree86 4.3.x you can use multi-layouts xkb configuration. What does +it mean? Basically it allows to load up to four different keyboard layouts at +a time. Each such layout would reside in its own group. The groups (unlike +complete keyboard remapping) can be switched very fast from one to another by +a combination of keys. + +Let's say you want to configure your new Logitech cordless desktop keyboard, +you intend to use three different layouts at the same time - us, czech and +german (in this order), and that you are used to Alt-Shift combination for +switching among them. + +Then the configuration snippet could look like this: + + Section "InputDevice" + Identifier "Keyboard1" + Driver "Keyboard" + + Option "XkbModel" "logicordless" + Option "XkbLayout" "us,cz,de" + Option "XKbOptions" "grp:alt_shift_toggle" + EndSection + +Of course, this can be also done at runtime using utility setxkbmap. Shell +command loading the same keyboard mapping would look like: + + setxkbmap -rules xfree86 -model logicordless -layout "us,cz,de" \ + -option "grp:alt_shift_toggle" + +2.3 Even More Advanced Configuration + +Okay, let's say you are more demanding. You do like the example above but you +want it to change a bit. Let's imagine you want the czech keyboard mapping to +use another variant but basic. The configuration snippet then changes into: + + Section "InputDevice" + Identifier "Keyboard1" + Driver "Keyboard" + + Option "XkbModel" "logicordless" + Option "XkbLayout" "us,cz,de" + Option "XkbVariant" ",bksl," + Option "XKbOptions" "grp:alt_shift_toggle" + EndSection + +That's seems tricky but it is not. The logic for settings of variants is the +same as for layouts, that means the first and the third variant settings are +left out (set to basic), the second is set to bksl (a special variant with an +enhanced definition of the backslash key). + +Analogically, the loading runtime will change to: + + setxkmap -rules xfree86 -model logicordless -layout "us,cz,de" \ + -variant ",bksl," -option "grp:alt_shift_toggle" + +2.4 Basic Global Options + +See rules/*.lst files. + +3. Direct XKB Configuration + +Generally, you can directly prescribe what configuration of each of basic xkb +components should be used to form the resulting keyboard mapping. This +method is rather "brute force". You precisely need to know the structure and +the meaning of all of used configuration components. + +This method also exposes all xkb configuration details directly into XFree86 +configuration file which is a not very fortunate fact. In rare occasions it +may be needed, though. So how does it work? + +3.1 Basic Components + +There are five basic components used to form a keyboard mapping: + + o key codes - a translation of the scan codes produced by the keyboard + into a suitable symbolic form + + o types - a specification of what various combinations of modifiers pro- + duce + + o key symbols - a translation of symbolic key codes into actual symbols + + o geometry - a description of physical keyboard geometry + + o compatibility maps - a specification of what action should each key pro- + duce in order to preserve compatibility with XKB-unware clients + +3.2 Example Configuration + +Look at the following example: + + Section "InputDevice" + Identifier "Keyboard0" + Driver "Keyboard" + + Option "XkbKeycodes" "xfree86" + Option "XkbTypes" "default" + Option "XkbSymbols" "en_US(pc104)+de+swapcaps" + Option "XkbGeometry" "pc(pc104)" + Option "XkbCompat" "basic+pc+iso9995" + EndSection + +This configuration sets the standard XFree86 default interpretation of key- +board keycodes, sets the default modificator types. The symbol table is com- +posed of extended US keyboard layout in its variant for pc keyboards with 104 +keys plus all keys for german layout are redefined respectively. Also the +logical meaning of Caps-lock and Control keys is swapped. The standard key- +board geometry (physical look) is set to pc style keyboard with 104 keys. The +compatibility map is set to allow basic shifting, to allow Alt keys to be +interpreted and also to allow iso9995 group shifting. + +4. Keymap XKB Configuration + +It is the formerly used way to configure xkb. The user included a special +keymap file which specified the direct xkb configuration. This method has +been obsoleted by previously described rules files which are far more flexi- +ble and allow simpler and more intuitive syntax. It is preserved merely for +compatibility reasons. Avoid using it if it is possible. + + Generated from XFree86: xc/programs/Xserver/hw/xfree86/doc/sgml/XKB-Config.sgml,v 1.4 dawes Exp $ + + +$XFree86: $ diff --git a/README.enhancing b/README.enhancing new file mode 100644 index 0000000..db78026 --- /dev/null +++ b/README.enhancing @@ -0,0 +1,511 @@ + How to further enhance XKB configuration + + Kamil Toman, Ivan U. Pascal + + 25 November 2002 + + Abstract + + This guide is aimed to relieve one's labour to create a new (inter- + nationalized) keyboard layout. Unlike other documents this guide + accents the keymap developer's point of view. + +1. Overview + +The developer of a new layout should read the xkb protocol specification (The +X Keyboard Extension: Protocol Specification <URL:http://www.x- +docs.org/XKB/XKBproto.pdf>) at least to clarify for himself some xkb-specific +terms used in this document and elsewhere in xkb configuration. Also it shows +wise to understand how the X server and a client digest their keyboard inputs +(with and without xkb). + +A useful source is also Ivan Pascal's text about xkb configuration +<URL:http://www.tsu.ru/~pascal/en/xkb> often referenced throughout this docu- +ment. + +Note that this document covers only enhancements which are to be made to +XFree86 version 4.3.x and above. + +2. The Basics + +At the startup (or at later at user's command) X server starts its xkb key- +board module extension and reads data from a compiled configuration file. + +This compiled configuration file is prepared by the program xkbcomp which +behaves altogether as an ordinary compiler (see man xkbcomp). Its input are +human readable xkb configuration files which are verified and then composed +into a useful xkb configuration. Users don't need to mess with xkbcomp them- +selves, for them it is invisible. Usually, it is started upon X server +startup. + +As you probably already know, the xkb configuration consists of five main +modules: + + Keycodes + Tables that defines translation from keyboard scan codes into + reasonable symbolic names, maximum, minimum legal keycodes, sym- + bolic aliases and description of physically present LED-indica- + tors. The primary sence of this component is to allow definitions + of maps of symbols (see below) to be independent of physical key- + board scancodes. There are two main naming conventions for sym- + bolic names (always four bytes long): + + o names which express some traditional meaning like <SPCE> + (stands for space bar) or + + o names which express some relative positioning on a key- + board, for example <AE01> (an exclamation mark on US key- + boards), on the right there are keys <AE02>, <AE03> etc. + + Types + Types describe how the produced key is changed by active modi- + fiers (like Shift, Control, Alt, ...). There are several prede- + fined types which cover most of used combinations. + + Compat + Compatibility component defines internal behaviour of modifiers. + Using compat component you can assign various actions (elabo- + rately described in xkb specification) to key events. This is + also the place where LED-indicators behaviour is defined. + + Symbols + For i18n purposes, this is the most important table. It defines + what values (=symbols) are assigned to what keycodes (represented + by their symbolic name, see above). There may be defined more + than one value for each key and then it depends on a key type and + on modifiers state (respective compat component) which value will + be the resulting one. + + Geometry + Geometry files aren't used by xkb itself but they may be used by + some external programs to depict a keyboard image. + +All these components have the files located in xkb configuration tree in sub- +directories with the same names (usually in /usr/lib/X11/xkb). + +3. Enhancing XKB Configuration + +Most of xkb enhancements concerns a need to define new output symbols for the +some input key events. In other words, a need to define a new symbol map (for +a new language, standard or just to feel more comfortable when typing text). + +What do you need to do? Generally, you have to define following things: + + o the map of symbols itself + + o the rules to allow users to select the new mapping + + o the description of the new layout + +First of all, it is good to go through existing layouts and to examine them +if there is something you could easily adjust to fit your needs. Even if +there is nothing similar you may get some ideas about basic concepts and used +tricks. + +3.1 Levels And Groups + +Since XFree86 4.3.0 you can use multi-layout concept of xkb configuration. +Though it is still in boundaries of xkb protocol and general ideas, the +keymap designer must obey new rules when creating new maps. In exchange we +get a more powerful and cleaner configuration system. + +Remember that it is the application which must decide which symbol matches +which keycode according to effective modifier state. The X server itself +sends only an input event message to. Of course, usually the general inter- +pretation is processed by Xlib, Xaw, Motif, Qt, Gtk and similar libraries. +The X server only supplies its mapping table (usually upon an application +startup). + +You can think of the X server's symbol table as of a irregular table where +each keycode has its row and where each combination of modifiers determines +exactly one column. The resulting cell then gives the proper symbolic value. +Not all keycodes need to bind different values for different combination of +modifiers. <ENTER> key, for instance, usually doesn't depend on any modi- +fiers so it its row has only one column defined. + +Note that in XKB there is no prior assumption that certain modifiers are +bound to certain columns. By editing proper files (see keytypes (section 4.2, +page 1)) this mapping can be changed as well. + +Unlike the original X protocol the XKB approach is far more flexible. It is +comfortable to add one additional XKB term - group. You can think of a group +as of a vector of columns per each keycode (naturally the dimension of this +vector may differ for different keycodes). What is it good for? The group is +not very useful unless you intend to use more than one logically different +set of symbols (like more than one alphabet) defined in a single mapping ta- +ble. But then, the group has a natural meaning - each symbol set has its own +group and changing it means selecting a different one. XKB approach allows +up to four different groups. The columns inside each group are called (shift) +levels. The X server knows the current group and reports it together with +modifier set and with a keycode in key events. + +To sum it up: + + o for each keycode XKB keyboard map contains up to four one-dimensional + tables - groups (logically different symbol sets) + + o for each group of a keycode XKB keyboard map contains some columns - + shift levels (values reached by combinations of Shift, Ctrl, Alt, ... + modifiers) + + o different keycodes can have different number of groups + + o different groups of one keycode can have different number of shift lev- + els + + o the current group number is tracked by X server + +It is clear that if you sanely define levels, groups and sanely bind modi- +fiers and associated actions you can have simultaneously loaded up to four +different symbol sets where each of them would reside in its own group. + +The multi-layout concept provides a facility to manipulate xkb groups and +symbol definitions in a way that allows almost arbitrary composition of pre- +defined symbol tables. To keep it fully functional you have to: + + o define all symbols only in the first group + + o (re)define any modifiers with extra care to avoid strange (anisometric) + behaviour + +4. Defining New Layouts + +See Some Words About XKB internals <URL:http://www.tsu.ru/~pas- +cal/en/xkb/internals.html> for explanation of used xkb terms and problems +addressed by XKB extension. + +See Common notes about XKB configuration files language +<URL:http://www.tsu.ru/~pascal/en/xkb/gram-common.html> for more precise +explanation of syntax of xkb configuration files. + +4.1 Predefined XKB Symbol Sets + +If you are about to define some European symbol map extension, you might want +to use on of four predefined latin alphabet layouts. + +Okay, let's assume you want extend an existing keymap and you want to over- +ride a few keys. Let's take a simple U.K. keyboard as an example (defined in +pc/gb): + + partial default alphanumeric_keys + xkb_symbols "basic" { + include "pc/latin" + + name[Group1]="Great Britain"; + + key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] }; + key <AE03> { [ 3, sterling, threesuperior, sterling ] }; + key <AC11> { [apostrophe, at, dead_circumflex, dead_caron] }; + key <TLDE> { [ grave, notsign, bar, bar ] }; + key <BKSL> { [numbersign, asciitilde, dead_grave, dead_breve ] }; + key <RALT> { type[Group1]="TWO_LEVEL", + [ ISO_Level3_Shift, Multi_key ] }; + + modifier_map Mod5 { <RALT> }; + }; + +It defines a new layout in basic variant as an extension of common latin +alphabet layout. The layout (symbol set) name is set to "Great Britain". +Then there are redefinitions of a few keycodes and a modifiers binding. As +you can see the number of shift levels is the same for <AE02>, <AE03>, +<AC11>, <TLDE> and <BKSL> keys but it differs from number of shift levels of +<RALT>. + +Note that the <RALT> key itself is a binding key for Mod5 and that it serves +like a shift modifier for LevelThree, together with Shift as a multi-key. It +is a good habit to respect this rule in a new similar layout. + +Okay, you could now define more variants of your new layout besides basic +simply by including (augmenting/overriding/...) the basic definition and +altering what may be needed. + +4.2 Key Types + +The differences in the number of columns (shift levels) are caused by a dif- +ferent types of keys (see the types definition in section basics). Most key- +codes have implicitly set the keytype in the included "pc/latin" file to +"FOUR_LEVEL_ALPHABETIC". The only exception is <RALT> keycode which is +explicitly set "TWO_LEVEL" keytype. + +All those names refer to pre-defined shift level schemes. Usually you can +choose a suitable shift level scheme from default types scheme list in proper +xkb component's subdirectory. + +The most used schemes are: + + ONE_LEVEL + The key does not depend on any modifiers. The symbol from first + level is always chosen. + + TWO_LEVEL + The key uses a modifier Shift and may have two possible values. + The second level may be chosen by Shift modifier. If Lock modi- + fier (usually Caps-lock) applies the symbol is further processed + using system-specific capitalization rules. If both Shift+Lock + modifier apply the symbol from the second level is taken and cap- + italization rules are applied (and usually have no effect). + + ALPHABETIC + The key uses modifiers Shift and Lock. It may have two possible + values. The second level may be chosen by Shift modifier. When + Lock modifier applies, the symbol from the first level is taken + and further processed using system-specific capitalization rules. + If both Shift+Lock modifier apply the symbol from the first level + is taken and no capitalization rules applied. This is often + called shift-cancels-caps behaviour. + + THREE_LEVEL + Is the same as TWO_LEVEL but it considers an extra modifier - + LevelThree which can be used to gain the symbol value from the + third level. If both Shift+LevelThree modifiers apply the value + from the third level is also taken. As in TWO_LEVEL, the Lock + modifier doesn't influence the resulting level. Only Shift and + LevelThree are taken into that consideration. If the Lock modi- + fier is active capitalization rules are applied on the resulting + symbol. + + FOUR_LEVEL + Is the same as THREE_LEVEL but unlike LEVEL_THREE if both + Shift+LevelThree modifiers apply the symbol is taken from the + fourth level. + + FOUR_LEVEL_ALPHABETIC + Is similar to FOUR_LEVEL but also defines shift-cancels-caps + behaviour as in ALPHABETIC. If Lock+LevelThree apply the symbol + from the third level is taken and the capitalization rules are + applied. If Lock+Shift+LevelThree apply the symbol from the + third level is taken and no capitalization rules are applied. + + KEYPAD + As the name suggest this scheme is primarily used for numeric + keypads. The scheme considers two modifiers - Shift and NumLock. + If none of modifiers applies the symbol from the first level is + taken. If either Shift or NumLock modifiers apply the symbol from + the second level is taken. If both Shift+NumLock modifiers apply + the symbol from the first level is taken. Again, shift-cancels- + caps variant. + + FOUR_LEVEL_KEYPAD + Is similar to KEYPAD scheme but considers also LevelThree modi- + fier. If LevelThree modifier applies the symbol from the third + level is taken. If Shift+LevelThree or NumLock+LevelThree apply + the symbol from the fourth level is taken. If all Shift+Num- + Lock+LevelThree modifiers apply the symbol from the third level + is taken. This also, shift-cancels-caps variant. + +Besides that, there are several schemes for special purposes: + + PC_BREAK + It is similar to TWO_LEVEL scheme but it considers the Control + modifier rather than Shift. That means, the symbol from the sec- + ond level is chosen by Control rather than by Shift. + + PC_SYSRQ + It is similar to TWO_LEVEL scheme but it considers the Alt modi- + fier rather than Shift. That means, the symbol from the second + level is chosen by Alt rather than by Shift. + + CTRL+ALT + The key uses modifiers Alt and Control. It may have two possible + values. If only one modifier (Alt or Control) applies the symbol + from the first level is chosen. Only if both Alt+Control modi- + fiers apply the symbol from the second level is chosen. + + SHIFT+ALT + The key uses modifiers Shift and Alt. It may have two possible + values. If only one modifier (Alt or Shift) applies the symbol + from the first level is chosen. Only if both Alt+Shift modifiers + apply the symbol from the second level is chosen. + +If needed, special caps schemes may be used. They redefine the standard +behaviour of all *ALPHABETIC types. The layouts (maps of symbols) with keys +defined in respective types then automatically change their behaviour accord- +ingly. Possible redefinitions are: + + o internal + + o internal_nocancel + + o shift + + o shift_nocancel + +None of these schemes should be used directly. They are defined merely for +'caps:' xkb options (used to globally change the layouts behaviour). + +Don't alter any of existing key types. If you need a different behaviour cre- +ate a new one. + +4.2.1 More On Definitions Of Types + +When the XKB software deals with a separate type description it gets a com- +plete list of modifiers that should be taken into account from the 'modi- +fiers=<list of modifiers>' list and expects that a set of 'map[<combination +of modifiers>]=<list of modifiers>' instructions that contain the mapping for +each combination of modifiers mentioned in that list. Modifiers that are not +explicitly listed are NOT taken into account when the resulting shift level +is computed. If some combination is omitted the program (subroutine) should +choose the first level for this combination (a quite reasonable behavior). + +Lets consider an example with two modifiers ModOne and ModTwo: + + type "..." { + modifiers = ModOne+ModTwo; + map[None] = Level1; + map[ModOne] = Level2; + }; + +In this case the map statements for ModTwo only and ModOne+ModTwo are omit- +ted. It means that if the ModTwo is active the subroutine can't found +explicit mapping for such combination an will use the default level i.e. +Level1. + +But in the case the type described as: + + type "..." { + modifiers = ModOne; + map[None] = Level1; + map[ModOne] = Level2; + }; + +the ModTwo will not be taken into account and the resulting level depends on +the ModOne state only. That means, ModTwo alone produces the Level1 but the +combination ModOne+ModTwo produces the Level2 as well as ModOne alone. + +What does it mean if the second modifier is the Lock? It means that in the +first case (the Lock itself is included in the list of modifiers but combina- +tions with this modifier aren't mentioned in the map statements) the internal +capitalization rules will be applied to the symbol from the first level. But +in the second case the capitalization will be applied to the symbol chosen +accordingly to he first modifier - and this can be the symbol from the first +as well as from the second level. + +Usually, all modifiers introduced in 'modifiers=<list of modifiers>' list are +used for shift level calculation and then discarded. Sometimes this is not +desirable. If you want to use a modifier for shift level calculation but you +don't want to discard it, you may list in 'preserve[<combination of modi- +fiers>]=<list of modifiers>'. That means, for a given combination all listed +modifiers will be preserved. If the Lock modifier is preserved then the +resulting symbol is passed to internal capitalization routine regardless +whether it has been used for a shift level calculation or not. + +Any key type description can use both real and virtual modifiers. Since real +modifiers always have standard names it is not necessary to explicitly +declare them. Virtual modifiers can have arbitrary names and can be declared +(prior using them) directly in key type definition: + + virtual_modifiers <comma-separated list of modifiers> ; + +as seen in for example basic, pc or mousekeys key type definitions. + +4.3 Rules + +Once you are finished with your symbol map you need to add it to rules file. +The rules file describes how all the five basic keycodes, types, compat, sym- +bols and geometry components should be composed to give a sensible resulting +xkb configuration. + +The main advantage of rules over formerly used keymaps is a possibility to +simply parameterize (once) fixed patterns of configurations and thus to ele- +gantly allow substitutions of various local configurations into predefined +templates. + +A pattern in a rules file (often located in /usr/lib/X11/xkb/rules) can be +parameterized with four other arguments: Model, Layout, Variant and Options. +For most cases parameters model and layout should be sufficient for choosing +a functional keyboard mapping. + +The rules file itself is composed of pattern lines and lines with rules. The +pattern line starts with an exclamation mark ('!') and describes how will the +xkb interpret the following lines (rules). A sample rules file looks like +this: + + ! model = keycodes + macintosh_old = macintosh + ... + * = xfree86 + + ! model = symbols + hp = +inet(%m) + microsoftpro = +inet(%m) + geniuscomfy = +inet(%m) + + ! model layout[1] = symbols + macintosh us = macintosh/us%(v[1]) + * * = pc/pc(%m)+pc/%l[1]%(v[1]) + + ! model layout[2] = symbols + macintosh us = +macintosh/us[2]%(v[2]):2 + * * = +pc/%l[2]%(v[2]):2 + + ! option = types + caps:internal = +caps(internal) + caps:internal_nocancel = +caps(internal_nocancel) + +Each rule defines what certain combination of values on the left side of +equal sign ('=') results in. For example a (keyboard) model macintosh_old +instructs xkb to take definitions of keycodes from file keycodes/macintosh +while the rest of models (represented by a wild card '*') instructs it to +take them from file keycodes/xfree86. The wild card represents all possible +values on the left side which were not found in any of the previous rules. +The more specialized (more complete) rules have higher precedence than gen- +eral ones, i.e. the more general rules supply reasonable default values. + +As you can see some lines contain substitution parameters - the parameters +preceded by the percent sign ('%'). The first alphabetical character after +the percent sign expands to the value which has been found on the left side. +For example +%l%(v) expands into +cz(bksl) if the respective values on the +left side were cz layout in its bksl variant. More, if the layout resp. vari- +ant parameter is followed by a pair of brackets ('[', ']') it means that xkb +should place the layout resp. variant into specified xkb group. If the brack- +ets are omitted the first group is the default value. + +So the second block of rules enhances symbol definitions for some particular +keyboard models with extra keys (for internet, multimedia, ...) . Other mod- +els are left intact. Similarly, the last block overrides some key type defi- +nitions, so the common global behaviour ''shift cancels caps'' or ''shift +doesn't cancel caps'' can be selected. The rest of rules produces special +symbols for each variant us layout of macintosh keyboard and standard pc sym- +bols in appropriate variants as a default. + +4.4 Descriptive Files of Rules + +Now you just need to add a detailed description to <rules>.xml description +file so the other users (and external programs which often parse this file) +know what is your work about. + +4.4.1 Old Descriptive Files + +The formerly used descriptive files were named <rules>.lst Its structure is +very simple and quite self descriptive but such simplicity had also some cav- +ities, for example there was no way how to describe local variants of layouts +and there were problems with the localization of descriptions. To preserve +compatibility with some older programs, new XML descriptive files can be con- +verted to old format '.lst'. + +For each parameter of rules file should be described its meaning. For the +rules file described above the .lst file could look like: + + ! model + pc104 Generic 104-key PC + microsoft Microsoft Natural + pc98 PC-98xx Series + macintosh Original Macintosh + ... + + ! layout + us U.S. English + cz Czech + de German + ... + + ! option + caps:internal uses internal capitalization. Shift cancels Caps + caps:internal_nocancel uses internal capitalization. Shift doesn't cancel Caps + +And that should be it. Enjoy creating your own xkb mapping. + + Generated from XFree86: xc/programs/Xserver/hw/xfree86/doc/sgml/XKB-Enhancing.sgml,v 1.2 dawes Exp $ + + +$XFree86: $ diff --git a/compat/.cvsignore b/compat/.cvsignore new file mode 100644 index 0000000..282522d --- /dev/null +++ b/compat/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/compat/Makefile.am b/compat/Makefile.am new file mode 100644 index 0000000..b667bd1 --- /dev/null +++ b/compat/Makefile.am @@ -0,0 +1,13 @@ +compat_DATA = \ +accessx basic complete \ +default group_led iso9995 \ +japan keypad leds \ +misc mousekeys norepeat \ +pc pc98 xfree86 \ +xtest README + +EXTRA_DIST= $(compat_DATA) + +compatdir = $(xkb_base)/compat + + diff --git a/compat/README b/compat/README new file mode 100644 index 0000000..fb84d71 --- /dev/null +++ b/compat/README @@ -0,0 +1,37 @@ +The core protocol interpretation of keyboard modifiers does not include direct +support for multiple keyboard groups, so XKB reports the effective keyboard +group to XKB-aware clients using some of reserved bits in the state field of +some core protocol events. This modified state field would not be interpreted +correctly by XKB-unaware clients, so XKB provides a group compatibility mapping +which remaps the keyboard group into a core modifier mask that has similar +effects, when possible. + +XKB maintains three compatibility state components that are used to make +XKB-unaware clients(*) work as well as possible: +- The compatibility state which corresponds to the effective modifier and + effective group state. +- The compatibility lookup state which is the core-protocol equivalent of the + lookup state. +- The compatibility grab state which is the nearest core-protocol equivalent + of the grab state. + +Compatibility state are essentially the corresponding XKB states, but with +keyboard group possibly encoded as one or more modifiers. + +Modifiers that correspond to each keyboard group are described in this +group compatibility map. + + +---- +(*) The implementation of XKB invisibly extends the X library to use the +keyboard extension if it is present. That means, clients that use library or +toolkit routines to interpret keyboard events automatically use all of XKB +features; clients that directly interpret the state field of core protocol +events or the keymap direcly may be affected by some of the XKB differences. +Thus most clients can take all advantages without modification but it also +means that XKB state can be reported to clients that have not explicitly +requested the keyboard extension. + + + +/* $XFree86$ */ diff --git a/compat/accessx b/compat/accessx new file mode 100644 index 0000000..3e4b461 --- /dev/null +++ b/compat/accessx @@ -0,0 +1,54 @@ +// $Xorg: accessx,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +default partial xkb_compatibility "basic" { + interpret AccessX_Enable { + action= LockControls(controls=AccessXKeys); + }; +}; + +partial xkb_compatibility "full" { + + interpret AccessX_Enable { + action= LockControls(controls=AccessXKeys); + }; + + interpret AccessX_Feedback_Enable { + action= LockControls(controls=AccessXFeedback); + }; + + interpret RepeatKeys_Enable { + action= LockControls(controls=RepeatKeys); + }; + + interpret SlowKeys_Enable { + action= LockControls(controls=SlowKeys); + }; + + interpret BounceKeys_Enable { + action= LockControls(controls=BounceKeys); + }; + + interpret StickyKeys_Enable { + action= LockControls(controls=StickyKeys); + }; + + interpret MouseKeys_Enable { + action= LockControls(controls=MouseKeys); + }; + + interpret MouseKeys_Accel_Enable { + action= LockControls(controls=MouseKeysAccel); + }; + + interpret Overlay1_Enable { + action= LockControls(controls=Overlay1); + }; + + interpret Overlay2_Enable { + action= LockControls(controls=Overlay2); + }; + + interpret AudibleBell_Enable { + action= LockControls(controls=AudibleBell); + }; +}; diff --git a/compat/basic b/compat/basic new file mode 100644 index 0000000..f369b0b --- /dev/null +++ b/compat/basic @@ -0,0 +1,59 @@ +// $Xorg: basic,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Minimal set of symbol interpretations to provide +// reasonable default behavior (Num lock, shift and +// caps lock and mode switch) and set up the +// automatic updating of common keyboard LEDs. + +// $XFree86: xc/programs/xkbcomp/compat/basic,v 1.2 2000/11/06 19:24:10 dawes Exp $ + +default xkb_compatibility "basic" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= LockMods(modifiers=Shift); + }; + + interpret Any+Lock { + action= LockMods(modifiers=Lock); + }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=+1); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + whichModState= Locked; + modifiers= Lock; + }; + indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff --git a/compat/complete b/compat/complete new file mode 100644 index 0000000..68f89c8 --- /dev/null +++ b/compat/complete @@ -0,0 +1,10 @@ +// $Xorg: complete,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "complete" { + include "basic" + augment "iso9995" + augment "mousekeys" + augment "accessx(full)" + augment "misc" + augment "xfree86" +}; + diff --git a/compat/default b/compat/default new file mode 100644 index 0000000..7cea0f8 --- /dev/null +++ b/compat/default @@ -0,0 +1,11 @@ +// $Xorg: default,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "default" { + include "basic" + augment "mousekeys" + augment "accessx(basic)" + augment "misc" + augment "iso9995" +// ??should be changed/renamed/removed +// augment "xfree86" + augment "japan" +}; diff --git a/compat/group_led b/compat/group_led new file mode 100644 index 0000000..0805fa6 --- /dev/null +++ b/compat/group_led @@ -0,0 +1,22 @@ +// $XFree86: xc/programs/xkbcomp/compat/group_led,v 1.1.2.2 1999/07/22 14:21:30 hohndel Exp $ +// This is a "default" compatibility with a small modification: +// an "Scroll Lock" LED now shows the active keyboard group +default xkb_compatibility "group_led" { + include "basic" + augment "mousekeys" + augment "accessx(basic)" + augment "misc" + augment "iso9995" + augment "japan" +// This is to make Mode_switch working even in group 2 + virtual_modifiers AltGr; + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=+1); + }; + indicator "Scroll Lock" { + allowExplicit; + groups= All-Group1; + }; +}; diff --git a/compat/iso9995 b/compat/iso9995 new file mode 100644 index 0000000..d513c1c --- /dev/null +++ b/compat/iso9995 @@ -0,0 +1,84 @@ +// $Xorg: iso9995,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Fairly complete set of symbol interpretations +// to provide reasonable default behavior + +// $XFree86: xc/programs/xkbcomp/compat/iso9995,v 1.3 2003/02/21 03:16:34 dawes Exp $ + +default partial xkb_compatibility "default" { + virtual_modifiers LevelThree,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret ISO_Lock+Any { + action= ISOLock(affect= all,modifiers=modMapMods); + }; + + interpret ISO_Level2_Latch+Shift { + useModMapMods= level1; + action= LatchMods(modifiers=Shift); + }; + + interpret ISO_Level3_Shift+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= SetMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Shift { + action= SetMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Latch+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= LatchMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Latch { + action= LatchMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Lock+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= LockMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Lock { + action= LockMods(modifiers=LevelThree); + }; + + interpret ISO_Group_Latch { + useModMapMods= level1; + virtualModifier= AltGr; + action= LatchGroup(group=2); + }; + + interpret ISO_Next_Group { + useModMapMods= level1; + virtualModifier= AltGr; + action= LockGroup(group=+1); + }; + + interpret ISO_Prev_Group { + useModMapMods= level1; + virtualModifier= AltGr; + action= LockGroup(group=-1); + }; + interpret ISO_First_Group { + action= LockGroup(group=1); + }; + + interpret ISO_Last_Group { + action= LockGroup(group=2); + }; + + indicator "Group 2" { + !allowExplicit; + groups= All-Group1; + }; +}; diff --git a/compat/japan b/compat/japan new file mode 100644 index 0000000..34bcc09 --- /dev/null +++ b/compat/japan @@ -0,0 +1,29 @@ +// $Xorg: japan,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Japanese keyboards need Eisu and Kana shift and +// lock keys, which are typically bound to the +// second shift level for some other modifier key. +// These interpretations disable the default +// interpretation (which would have these keys set +// the same modifier as the level one symbol). + +default partial xkb_compatibility "japan" { + + interpret.repeat= False; + + interpret Eisu_Shift+Lock { + action= NoAction(); + }; + + interpret Eisu_toggle+Lock { + action= NoAction(); + }; + + interpret Kana_Shift+Lock { + action= NoAction(); + }; + + interpret Kana_Lock+Lock { + action= NoAction(); + }; +}; diff --git a/compat/keypad b/compat/keypad new file mode 100644 index 0000000..469edec --- /dev/null +++ b/compat/keypad @@ -0,0 +1,60 @@ +// $Xorg: keypad,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Interpretations needed to implement the numeric keypad +// as an overlay instead of a modifier. + +partial hidden xkb_compatibility "overlay" { + include "keypad(overlay1)" +}; +partial hidden xkb_compatibility "overlay1" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Num_Lock { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + + indicator.allowExplicit= True; + indicator.driveskbd= True; + replace indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + controls= Overlay1; + }; + indicator.allowExplicit= True; +}; +partial hidden xkb_compatibility "overlay2" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Num_Lock { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay2); + }; + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + + indicator.allowExplicit= True; + indicator.driveskbd= True; + replace indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + controls= Overlay2; + }; + indicator.allowExplicit= True; +}; diff --git a/compat/leds b/compat/leds new file mode 100644 index 0000000..3d61606 --- /dev/null +++ b/compat/leds @@ -0,0 +1,24 @@ +// Use keyboard LEDs to show alternative group +// +// $XFree86$ + +partial xkb_compatibility "scroll" { + indicator "Scroll Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "num" { + indicator "Num Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "caps" { + indicator "Caps Lock" { + modifiers= None; + groups=All-group1; + }; +}; diff --git a/compat/misc b/compat/misc new file mode 100644 index 0000000..e1dbfd5 --- /dev/null +++ b/compat/misc @@ -0,0 +1,121 @@ +// $XdotOrg: xc/programs/xkbcomp/compat/misc,v 1.1.4.4 2004/03/05 13:41:28 eich Exp $ +// $Xorg: misc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +// +// +// +// $XFree86: xc/programs/xkbcomp/compat/misc,v 1.4 2003/05/15 13:31:57 pascal Exp $ + +default partial xkb_compatibility "misc" { + + virtual_modifiers Alt,Meta,Super,Hyper,ScrollLock; + + // Interpretations for some other useful keys + + interpret Terminate_Server { + action = Terminate(); + }; + + setMods.clearLocks= True; + + // Sets the "Alt" virtual modifier + + interpret Alt_L+Any { + useModMapMods= level1; + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_L { + action = SetMods(modifiers=Alt); + }; + + interpret Alt_R+Any { + useModMapMods= level1; + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_R { + action = SetMods(modifiers=Alt); + }; + + // Sets the "Meta" virtual modifier + + interpret Meta_L+Any { +// useModMapMods= level1; + virtualModifier= Meta; + action = SetMods(modifiers=modMapMods); + }; + + interpret Meta_L { + action = SetMods(modifiers=Meta); + }; + + interpret Meta_R+Any { + useModMapMods= level1; + virtualModifier= Meta; + action = SetMods(modifiers=modMapMods); + }; + + interpret Meta_R { + action = SetMods(modifiers=Alt); + }; + + // Sets the "Super" virtual modifier + + interpret Super_L+Any { +// useModMapMods= level1; + virtualModifier= Super; + action = SetMods(modifiers=modMapMods); + }; + + interpret Super_L { + action = SetMods(modifiers=Super); + }; + + interpret Super_R+Any { + useModMapMods= level1; + virtualModifier= Super; + action = SetMods(modifiers=modMapMods); + }; + + interpret Super_R { + action = SetMods(modifiers=Super); + }; + + // Sets the "Hyper" virtual modifier + + interpret Hyper_L+Any { +// useModMapMods= level1; + virtualModifier= Hyper; + action = SetMods(modifiers=modMapMods); + }; + + interpret Hyper_L { + action = SetMods(modifiers=Hyper); + }; + + interpret Hyper_R+Any { + useModMapMods= level1; + virtualModifier= Hyper; + action = SetMods(modifiers=modMapMods); + }; + + interpret Hyper_R { + action = SetMods(modifiers=Hyper); + }; + + // Sets the "ScrollLock" virtual modifier and + // makes it actually lock when pressed. Sets + // up a map for the scroll lock indicator. + interpret Scroll_Lock+Any { + virtualModifier= ScrollLock; + action = LockMods(modifiers=modMapMods); + }; + + indicator "Scroll Lock" { + allowExplicit; + whichModState= Locked; + modifiers= ScrollLock; + }; +}; diff --git a/compat/mousekeys b/compat/mousekeys new file mode 100644 index 0000000..6e9a208 --- /dev/null +++ b/compat/mousekeys @@ -0,0 +1,182 @@ + +// $Xorg: mousekeys,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Interpretations for arrow keys and a bunch of other +// common keysyms which make it possible to bind "mouse" +// keys using xmodmap and activate or deactivate them +// from the keyboard. + +default partial xkb_compatibility "mousekeys" { + + // Keypad actions. + // + interpret.repeat= True; + + interpret KP_1 { + action = MovePtr(x=-1,y= +1); + }; + interpret KP_End { + action = MovePtr(x=-1,y= +1); + }; + + interpret KP_2 { + action = MovePtr(x=+0,y= +1); + }; + interpret KP_Down { + action = MovePtr(x=+0,y= +1); + }; + + interpret KP_3 { + action = MovePtr(x=+1,y=+1); + }; + interpret KP_Next { + action = MovePtr(x=+1,y=+1); + }; + + interpret KP_4 { + action = MovePtr(x=-1,y=+0); + }; + interpret KP_Left { + action = MovePtr(x=-1,y=+0); + }; + + interpret KP_6 { + action = MovePtr(x=+1,y=+0); + }; + interpret KP_Right { + action = MovePtr(x=+1,y=+0); + }; + + interpret KP_7 { + action = MovePtr(x=-1,y=-1); + }; + interpret KP_Home { + action = MovePtr(x=-1,y=-1); + }; + + interpret KP_8 { + action = MovePtr(x=+0,y=-1); + }; + interpret KP_Up { + action = MovePtr(x=+0,y=-1); + }; + + interpret KP_9 { + action = MovePtr(x=+1,y=-1); + }; + interpret KP_Prior { + action = MovePtr(x=+1,y=-1); + }; + + interpret KP_5 { + action = PointerButton(button=default); + }; + interpret KP_Begin { + action = PointerButton(button=default); + }; + + interpret KP_F2 { + action = SetPtrDflt(affect=defaultButton,button=1); + }; + interpret KP_Divide { + action = SetPtrDflt(affect=defaultButton,button=1); + }; + + interpret KP_F3 { + action = SetPtrDflt(affect=defaultButton,button=2); + }; + interpret KP_Multiply { + action = SetPtrDflt(affect=defaultButton,button=2); + }; + + interpret KP_F4 { + action = SetPtrDflt(affect=defaultButton,button=3); + }; + interpret KP_Subtract { + action = SetPtrDflt(affect=defaultButton,button=3); + }; + + interpret KP_Separator { + action = PointerButton(button=default,count=2); + }; + interpret KP_Add { + action = PointerButton(button=default,count=2); + }; + + interpret KP_0 { + action = LockPointerButton(button=default,affect=lock); + }; + interpret KP_Insert { + action = LockPointerButton(button=default,affect=lock); + }; + + interpret KP_Decimal { + action = LockPointerButton(button=default,affect=unlock); + }; + interpret KP_Delete { + action = LockPointerButton(button=default,affect=unlock); + }; + + interpret.repeat= False; + + + // New Keysym Actions. + // + interpret Pointer_Button_Dflt { + action= PointerButton(button=default); + }; + interpret Pointer_Button1 { + action= PointerButton(button=1); + }; + interpret Pointer_Button2 { + action= PointerButton(button=2); + }; + interpret Pointer_Button3 { + action= PointerButton(button=3); + }; + interpret Pointer_DblClick_Dflt { + action= PointerButton(button=default,count=2); + }; + interpret Pointer_DblClick1 { + action= PointerButton(button=1,count=2); + }; + interpret Pointer_DblClick2 { + action= PointerButton(button=2,count=2); + }; + interpret Pointer_DblClick3 { + action= PointerButton(button=3,count=2); + }; + interpret Pointer_Drag_Dflt { + action= LockPointerButton(button=default); + }; + interpret Pointer_Drag1 { + action= LockPointerButton(button=1); + }; + interpret Pointer_Drag2 { + action= LockPointerButton(button=2); + }; + interpret Pointer_Drag3 { + action= LockPointerButton(button=3); + }; + + interpret Pointer_EnableKeys { + action= LockControls(controls=MouseKeys); + }; + interpret Pointer_Accelerate { + action= LockControls(controls=MouseKeysAccel); + }; + interpret Pointer_DfltBtnNext { + action= SetPtrDflt(affect=defaultButton,button= +1); + }; + interpret Pointer_DfltBtnPrev { + action= SetPtrDflt(affect=defaultButton,button= -1); + }; + + + // Allow an indicator for MouseKeys. + indicator "Mouse Keys" { +// !allowExplicit; + indicatorDrivesKeyboard; + controls= MouseKeys; + }; +}; diff --git a/compat/norepeat b/compat/norepeat new file mode 100644 index 0000000..07b0b7a --- /dev/null +++ b/compat/norepeat @@ -0,0 +1,11 @@ +// $Xorg: norepeat,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Put any otherwise normal keys that you don't want to repeat in +// this file + +default partial xkb_compatibility "norepeat" { + interpret Return { + action= NoAction(); + repeat= False; + }; +}; diff --git a/compat/pc b/compat/pc new file mode 100644 index 0000000..5ce7d76 --- /dev/null +++ b/compat/pc @@ -0,0 +1,18 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default partial xkb_compatibility "pc" { + + // Sets the "Alt" virtual modifier + + virtual_modifiers Alt; + + setMods.clearLocks= True; + interpret Alt_L+Any { + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_R+Any { + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; +}; diff --git a/compat/pc98 b/compat/pc98 new file mode 100644 index 0000000..23f3f79 --- /dev/null +++ b/compat/pc98 @@ -0,0 +1,62 @@ +// $Xorg: pc98,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/compat/pc98,v 3.1 1997/10/26 13:25:33 dawes Exp $ + +// Minimal set of symbol interpretations to provide +// reasonable default behavior (Num lock, shift and +// caps lock and mode switch) and set up the +// automatic updating of common keyboard LEDs. + +default xkb_compatibility "basic" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= LockMods(modifiers=Shift); + }; + +// interpret Any+Lock { +// action= LockMods(modifiers=Lock); +// }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=2,clearLocks); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + whichModState= Locked; + modifiers= Lock; + }; + indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff --git a/compat/xfree86 b/compat/xfree86 new file mode 100644 index 0000000..2da65fd --- /dev/null +++ b/compat/xfree86 @@ -0,0 +1,57 @@ +// $XFree86$ +// XFree86 special keysyms + +default partial xkb_compatibility "basic" { + + interpret.repeat= True; + + interpret XF86_Switch_VT_1 { + action = SwitchScreen(Screen=1, !SameServer); + }; + interpret XF86_Switch_VT_2 { + action = SwitchScreen(Screen=2, !SameServer); + }; + interpret XF86_Switch_VT_3 { + action = SwitchScreen(Screen=3, !SameServer); + }; + interpret XF86_Switch_VT_4 { + action = SwitchScreen(Screen=4, !SameServer); + }; + interpret XF86_Switch_VT_5 { + action = SwitchScreen(Screen=5, !SameServer); + }; + interpret XF86_Switch_VT_6 { + action = SwitchScreen(Screen=6, !SameServer); + }; + interpret XF86_Switch_VT_7 { + action = SwitchScreen(Screen=7, !SameServer); + }; + interpret XF86_Switch_VT_8 { + action = SwitchScreen(Screen=8, !SameServer); + }; + interpret XF86_Switch_VT_9 { + action = SwitchScreen(Screen=9, !SameServer); + }; + interpret XF86_Switch_VT_10 { + action = SwitchScreen(Screen=10, !SameServer); + }; + interpret XF86_Switch_VT_11 { + action = SwitchScreen(Screen=11, !SameServer); + }; + interpret XF86_Switch_VT_12 { + action = SwitchScreen(Screen=12, !SameServer); + }; + + interpret XF86_Ungrab { + action = Private(type=0x86, data="Ungrab"); + }; + interpret XF86_ClearGrab { + action = Private(type=0x86, data="ClsGrb"); + }; + interpret XF86_Next_VMode { + action = Private(type=0x86, data="+VMode"); + }; + interpret XF86_Prev_VMode { + action = Private(type=0x86, data="-VMode"); + }; +}; diff --git a/compat/xtest b/compat/xtest new file mode 100644 index 0000000..a35ced9 --- /dev/null +++ b/compat/xtest @@ -0,0 +1,58 @@ +// $Xorg: xtest,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "xtest" { + + // Minimal set of symbol interpretations to provide + // reasonable behavior for testing. The X Test + // Suite assumes that it can set any modifier by + // simulating a KeyPress and clear it by simulating + // a KeyRelease. Because of the way that XKB + // implements locking/latching modifiers, this + // approach fails in some cases (typically the + // lock or num lock modifiers). These symbol + // interpretations make all modifier keys just + // set the corresponding modifier so that xtest + // will see the behavior it expects. + + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= False; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= SetMods(modifiers=Shift); + }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= SetMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=2); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + modifiers= Lock; + }; + indicator "Num Lock" { + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff --git a/configure.in b/configure.in index 78c2df9..c0ec15b 100644 --- a/configure.in +++ b/configure.in @@ -1,9 +1,9 @@ -AC_INIT(xfree86.xml.in) +AC_INIT(rules/base.xml.in) -PACKAGE=xfree86_xkb_xml +PACKAGE=xkbdesc GETTEXT_PACKAGE=$PACKAGE MAJOR_VERSION=0 -MINOR_VERSION=5 +MINOR_VERSION=1 VERSION=$MAJOR_VERSION.$MINOR_VERSION AC_SUBST(MAJOR_VERSION) @@ -32,6 +32,31 @@ AC_SUBST(xkb_base) AC_OUTPUT([ intl/Makefile po/Makefile.in m4/Makefile Makefile -xfree86_xkb_xml.spec +compat/Makefile +geometry/Makefile +geometry/digital.vndr/Makefile +geometry/ibm.vndr/Makefile +geometry/sgi.vndr/Makefile +keycodes/Makefile +keycodes/digital.vndr/Makefile +keycodes/sgi.vndr/Makefile +keymap/Makefile +keymap/digital.vndr/Makefile +keymap/sgi.vndr/Makefile +keymap/sun.vndr/Makefile +semantics/Makefile +rules/Makefile +symbols/Makefile +symbols/digital.vndr/Makefile +symbols/fujitsu.vndr/Makefile +symbols/hp.vndr/Makefile +symbols/macintosh.vndr/Makefile +symbols/nec.vndr/Makefile +symbols/sgi.vndr/Makefile +symbols/sony.vndr/Makefile +symbols/sun.vndr/Makefile +symbols/xfree68.vndr/Makefile +types/Makefile +xkbdesc.spec ]) diff --git a/geometry/.cvsignore b/geometry/.cvsignore new file mode 100644 index 0000000..282522d --- /dev/null +++ b/geometry/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/Makefile.am b/geometry/Makefile.am new file mode 100644 index 0000000..684553a --- /dev/null +++ b/geometry/Makefile.am @@ -0,0 +1,15 @@ +SUBDIRS = digital.vndr ibm.vndr sgi.vndr + +geom_DATA = \ +amiga ataritt chicony \ +dell everex fujitsu \ +hp keytronic kinesis \ +macintosh microsoft nec \ +northgate pc sony \ +sun winbook README + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry + + diff --git a/geometry/README b/geometry/README new file mode 100644 index 0000000..245270d --- /dev/null +++ b/geometry/README @@ -0,0 +1,10 @@ +The geometry component of a keyboard mapping specifies primarily the geometry of +the keyboard. It contains the geometry symbolic name and the keyboard geometry +description. The geometry component might also contain aliases for some keys or +symbolic names for some indicators and might affect the set of indicators that +are physically present. Key aliases defined in the geometry component of a +keyboard mapping override those defined in the keycodes component. + + + +/* $XFree86$ */ diff --git a/geometry/amiga b/geometry/amiga new file mode 100644 index 0000000..357c4c0 --- /dev/null +++ b/geometry/amiga @@ -0,0 +1,270 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/geometry/amiga,v 3.2 1997/10/26 13:25:34 dawes Exp $ + +default xkb_geometry "usa1" { + + description= "Amiga (usa1)"; + width= 490; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "TLDE" { { [ 28,18] }, { [2,1], [ 21,17] } }; + shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "RTRN" { + approx = { [ 16, 0], [42,37] }, + { [16, 0], [42, 0], [42,37], + [ 0,37], [ 0,19], [16,19] }, + { [18, 1], [40, 1], [40,36], + [ 2,36], [ 2,20], [18,20] } }; + shape "LFSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 22; + row.left= 1; + key.shape= "FCTS"; + key.gap= 1; + section "Function" { + top= 28; + row { + top= 1; + keys { { <ESC>, shape="NORM" }, + { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 9 }, <FK07>, <FK08>, <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 56; + row { + top= 1; + keys { { <TLDE>, shape="TLDE" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <BKSL>, { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", -15 } + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <LALT>, 10 }, <LAMI>, + { <SPCE>, "SPCE" }, + <RAMI>, <RALT> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 56; + left= 326; + row { + top= 1; + key.shape = "DELE"; + keys { <DELE>, <HELP> }; + }; + row { + top= 39; + left = 20; + keys { <UP> }; + }; + row { + top= 58; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 56; + left= 392; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; + +xkb_geometry "de" { + + description= "Amiga (de)"; + width= 490; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "TLDE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "RTRN" { + { [ 0, 0], [28,0], [28,37], [5,37], [5,18], [ 0,18] }, + { [ 2, 1], [26,1], [26,36], [7,36], [7,17], [ 2,17] } }; + shape "LFSH" { { [ 32,18] }, { [2,1], [ 29,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 22; + row.left= 1; + key.shape= "FCTS"; + key.gap= 1; + section "Function" { + top= 28; + row { + top= 1; + keys { { <ESC>, shape="NORM" }, + { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 9 }, <FK07>, <FK08>, <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 56; + row { + top= 1; + keys { { <TLDE>, shape="TLDE" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <BKSL>, { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <LALT>, 14 }, <LAMI>, + { <SPCE>, "SPCE" }, + <RAMI>, <RALT> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 56; + left= 326; + row { + top= 1; + key.shape = "DELE"; + keys { <DELE>, <HELP> }; + }; + row { + top= 39; + left = 20; + keys { <UP> }; + }; + row { + top= 58; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 56; + left= 392; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; diff --git a/geometry/ataritt b/geometry/ataritt new file mode 100644 index 0000000..e53cd94 --- /dev/null +++ b/geometry/ataritt @@ -0,0 +1,257 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/geometry/ataritt,v 3.2 1997/10/26 13:25:34 dawes Exp $ + +default xkb_geometry "us" { + + description= "Atari TT (us)"; + width= 480; + height= 173; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTRN" { approx = { [0,19], [32,37] }, + { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] }, + { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } }; + shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "FCTS" { { [ 28,10] }, { [2,1], [ 26,9] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 21; + row.left= 1; + key.shape = "NORM"; + key.gap= 1; + section "Function" { + top= 36; + key.shape= "FCTS"; + row { + top= 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 63; + row { + top= 1; + keys { <ESC>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <TLDE>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", -13 }, <DELE> + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <BKSL>, 34 } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <ALT>, 24 }, + { <SPCE>, "SPCE" }, + <CAPS> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 63; + left= 319; + row { + top= 1; + key.shape = "BKSP"; + keys { <HELP>, <UNDO> }; + }; + row { + top= 20; + keys { <INS>, <UP>, <HOME> }; + }; + row { + top= 39; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 63; + left= 381; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; + +xkb_geometry "de" { + + description= "Atari TT (de)"; + width= 480; + height= 173; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { approx = { [0,19], [32,37] }, + { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] }, + { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } }; + shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "FCTS" { { [ 28,11] }, { [2,1], [ 26,10] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 21; + row.left= 1; + key.shape = "NORM"; + key.gap= 1; + section "Function" { + top= 36; + key.shape= "FCTS"; + row { + top= 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 63; + row { + top= 1; + keys { <ESC>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <TLDE>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", -13 }, <DELE> + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <BKSL>, 34 } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, + <AB05>, <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <ALT>, 24 }, { <SPCE>, "SPCE" }, <CAPS> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 63; + left= 319; + row { + top= 1; + key.shape = "BKSP"; + keys { <HELP>, <UNDO> }; + }; + row { + top= 20; + keys { <INS>, <UP>, <HOME> }; + }; + row { + top= 39; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 63; + left= 381; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; diff --git a/geometry/chicony b/geometry/chicony new file mode 100644 index 0000000..9bdd15b --- /dev/null +++ b/geometry/chicony @@ -0,0 +1,190 @@ +// -*- indent-tabs-mode: nil -*- +// $XFree86: xc/programs/xkbcomp/geometry/chicony,v 1.1 2003/05/29 12:41:57 pascal Exp $ + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> +// Geometry specification for Chicony KB-9820 keyboard. + +// 86 keys +default xkb_geometry "us" { + description = "Chicony KB-9820 infra-red keyboard"; + width = 350; + height = 180; + //baseColor = "grey60"; + labelColor = "white"; + + shape "EDGE" { cornerRadius = 25, + { [0, 8], [142.5, 0], [202.5, 0], [347, 8], + [347, 60], [327, 100], [322, 160], + [202.5, 165], [142.5, 165], + [25, 160], [20, 100], [0, 60] } }; + shape "KEYS" { cornerRadius = 2, { [271, 109] } }; + shape "MOUS" { cornerRadius = 12, { [24, 24] } }; + shape "MOUS2" { cornerRadius = 9, { [18, 18] } }; + shape "BTNS" { cornerRadius = 5, { [10, 10] } }; + + solid "Edges" { + top = 0; + left = 0; + shape = "EDGE"; + color = "grey60"; + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 38; + top = 22; + color = "black"; + }; + + solid "Mouse" { + shape = "MOUS"; + left = 315; + top = 30; + color = "grey30"; + }; + + outline "Mouse2" { + shape = "MOUS2"; + left = 318; + top = 33; + color = "black"; + }; + + solid "Button1" { + shape = "BTNS"; + left = 10; + top = 32; + color = "grey30"; + }; + + solid "Button2" { + shape = "BTNS"; + left = 20; + top = 42; + color = "grey30"; + }; + + outline "Buttons" { + shape = "MOUS"; + left = 8; + top = 30; + color = "black"; + }; + + shape.cornerRadius = 1; + shape "ESC" { { [17, 12] }, { [1.5, 0], [15.5, 10] } }; + shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } }; + shape "THIN" { { [14, 18] }, { [2, 0], [12, 15] } }; + shape "NARR" { { [16, 18] }, { [2, 0], [14, 15] } }; + shape "NORM" { { [17, 18] }, { [2, 0], [15, 15] } }; + shape "WIDER" { { [18, 18] }, { [2, 0], [16, 15] } }; + shape "CAPS" { { [22, 18] }, { [2, 0], [20, 15] } }; + shape "RTSH" { { [23, 18] }, { [2, 0], [21, 15] } }; + shape "WIDEST" { { [30, 18] }, { [2, 0], [28, 15] } }; + shape "SPCE" { { [68, 18] }, { [2, 0], [66, 15] } }; + + section "Function" { + key.shape = "SMALL"; + key.gap = 0.79; + key.color = "grey60"; + left = 38; + top = 22; + row { + top = 1; + keys { { <ESC>, shape="ESC", 1 }, + { <FK01>, 1.5 }, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <NMLK>, <PRSC>, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Control" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey60"; + left = 38; + top = 111; + row { + top = 1; + keys { <EASY>, <LCTL>, <LWIN>, <LALT>, + { <SPCE>, shape="SPCE" }, + <RALT>, + { <RWIN>, shape="THIN" }, + { <MENU>, shape="THIN" }, + { <INS>, shape="THIN" }, + { <DELE>, shape="THIN" } }; + }; + }; // End of "Control" section + + section "Editing" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey60"; + left = 291; + top = 34; + row.vertical = True; + row { + top = 1; + keys { <HOME>, <PGUP>, <PGDN>, <END> }; + }; + }; // End of "Editing" section + + section "Navigation" { + key.gap = 1; + key.shape = "NARR"; + key.color = "grey60"; + left = 257; + top = 92; + row { + left = 16; + top = 1; + keys { <UP> }; + }; + row { + top = 20; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + section "Alpha" { + key.gap = 1; + key.shape = "NORM"; + key.color = "grey60"; + left = 38; + top = 35; + row { + top = 1; + keys { { <TLDE>, shape="NARR" }, + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, shape="WIDER" } + }; + }; + row { + top = 20; + keys { <TAB>, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, <AD13> + }; + }; + row { + top = 39; + keys { { <CAPS>, shape="CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, shape="WIDEST" } + }; + }; + row { + top = 58; + keys { { <LFSH>, shape="WIDEST" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, shape="RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/dell b/geometry/dell new file mode 100644 index 0000000..935bcca --- /dev/null +++ b/geometry/dell @@ -0,0 +1,185 @@ +// $Xorg: dell,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86$ +// +default xkb_geometry "dell101" { + + description= "Dell 101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 21 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 21 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry diff --git a/geometry/digital.vndr/.cvsignore b/geometry/digital.vndr/.cvsignore new file mode 100644 index 0000000..282522d --- /dev/null +++ b/geometry/digital.vndr/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/digital.vndr/Makefile.am b/geometry/digital.vndr/Makefile.am new file mode 100644 index 0000000..3e918b9 --- /dev/null +++ b/geometry/digital.vndr/Makefile.am @@ -0,0 +1,6 @@ +geom_DATA = \ +lk pc unix + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry/digital.vndr diff --git a/geometry/digital.vndr/lk b/geometry/digital.vndr/lk new file mode 100644 index 0000000..1ccd331 --- /dev/null +++ b/geometry/digital.vndr/lk @@ -0,0 +1,730 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: lk,v +// Revision 1.2 1996/06/18 09:12:47 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/18 21:15:16 William_Walker +// Upgrade XKB to Protocol Rev. 0.64 +// [1995/08/18 20:41:46 William_Walker] +// +// Revision 1.1.2.5 1995/08/11 19:35:47 William_Walker +// Sync up with Erik's pool. +// [1995/08/11 18:35:58 William_Walker] +// +// Revision 1.1.2.4 1995/06/27 12:17:28 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:23:07 William_Walker] +// +// Revision 1.1.2.3 1995/06/09 20:54:36 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:40:38 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:16 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:43 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16:00 +// +xkb_geometry "lk201" { + width = 530; + height = 170; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [171,19] },{ [3,2], [168,16]} }; + shape "LEDS" { [ 30,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 27; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 19 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 19 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 98 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 350; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left = 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 426; + row { top = 1; + keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 26; + keys { { <LCMP>, "LONG" }, + { <SPCE>, "SPCE" } + }; + }; + }; + + section.left = 341; + section.top = 3; + + section "Indicators" { + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 10; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 9; }; + indicator "Caps Lock" { left = 27; }; + indicator "Compose" { left = 45; }; + indicator "Wait" { left = 63; }; + text.top = 4; + text.color = "black"; + text "HoldScreenLabel" {left = 5; text="Hold\n"; }; + text "CapsLockLabel" {left = 23; text="Lock\n"; }; + text "ComposeLabel" {left = 37; text="Compose\n"; }; + text "WaitLabel" {left = 60; text="Wait\n"; }; + }; +}; + +xkb_geometry "lk401" { + + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 36,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 15 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 75 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left= 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> }; + }; + row { + top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { <LCMP>, "MED" }, + { <LALT>, "MED" }, + { <SPCE>, "SPCE" }, + { <RALT>, "MED" }, + { <RCMP>, "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.shape = "LED"; + indicator.top = 1; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + }; + section "IndicatorLabels" { + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk450" { + + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 36,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 15 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 75 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left= 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> }; + }; + row { + top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { <LCMP>, "MED" }, + { <LALT>, "MED" }, + { <SPCE>, "SPCE" }, + { <RALT>, "MED" }, + { <RCMP>, "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.shape = "LED"; + indicator.top = 1; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + }; + section "IndicatorLabels" { + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk401bj" +{ + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 30,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 15 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 75 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left = 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { <PF1>, <PF2>, <PF3>, <PF4> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { <LCMP>, "MED" }, + { <LALT>, "MED" }, + { <SPCE>, "SPCE" }, + { <RALT>, "MED" }, + { <RCMP>, "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 1; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 19; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk401jj" { + + width = 460; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[28,23] }, + { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] }, + { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "LONG1" { { [32,19] }, { [3,2], [29,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "MED1" { { [23,19] }, { [3,2], [20,16] } }; + shape "CTRL" { { [43,19] }, { [3,2], [38,16] } }; + shape "SPCE" { { [55,19] },{ [3,2], [53,16]} }; + shape "LEDS" { [ 56,15] }; + shape "LED" { [ 5, 2] }; + + section.left = 5; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 7; top = 10; text="digital\n"; }; + + section "Function" { top = 40; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 18 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 18 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 73 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 40; left = 313; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 31; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 51; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 71; left= 20; + keys { <UP> }; + }; + row { top = 91; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 70; left = 377; + row { top = 1; + keys { <PF1>, <PF2>, <PF3>, <PF4> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 70; + row { top = 1; left = 7; + keys { { <AE00>, "MED1" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AB00>, { <BKSP>, "MED1" } + }; + }; + row { top = 21; left = 7; + keys { { <TAB>, "LONG1" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 41; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { <CAPS>, { <LFSH>, "LONG1" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "MED" } + }; + }; + row { top = 81; left = 7; + keys { { <LCMP>, "LONG" }, + { <LALT>, "LONG" }, + { <MUHE>, "LONG" }, + { <SPCE>, "SPCE" }, + { <KANJ>, "LONG" }, + { <HIRA>, "LONG" }, + <RALT>, <RCMP> + }; + }; + }; + + section.left = 315; + section.top = 20; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 11; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 6; }; + indicator "Caps Lock" { left = 26; }; + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + diff --git a/geometry/digital.vndr/pc b/geometry/digital.vndr/pc new file mode 100644 index 0000000..1529ed2 --- /dev/null +++ b/geometry/digital.vndr/pc @@ -0,0 +1,350 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: pc,v +// Revision 1.2 1996/06/18 09:12:50 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/18 21:15:18 William_Walker +// Upgrade XKB to Protocol Rev. 0.64 +// [1995/08/18 20:41:49 William_Walker] +// +// Revision 1.1.2.4 1995/08/11 19:35:48 William_Walker +// Sync up with Erik's pool. +// [1995/08/11 18:36:03 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:29 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:23:10 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:19 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:51 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc,v Revision: 1.2 (DEC) Date: 1996/02/02 14:40:25 +// +partial xkb_geometry "common" { + width = 480; + height = 200; + + shape.cornerRadius = 1; + shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } }; + shape "KP0" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "KPAD" { primary = { [18,39] }, { [3,2], [15,36] } }; + shape "LEDS" { [78,22] }; + shape "LED" { [5,2] }; + + text.color = "black"; + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Function" { top = 40; + row { top = 1; + keys { <ESC>, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 10 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 10 }, <FK10>, <FK11>, <FK12> + }; + }; + }; + + section "Editing" { top = 40; left = 308; + row { top = 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { top = 41; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { top = 61; + keys { <DELE>, <END>, <PGDN> }; + }; + row { top = 101; left = 20; + keys { <UP> }; + }; + row { top = 121; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 80; left = 374; + row { top = 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD" } }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD" } }; + }; + row { top = 81; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; +}; + +partial xkb_geometry "leds_on_keys" { + section.top = 40; + section.left = 17; + section "LedPanel" { + indicator.onColor = "#00ff00"; + indicator.offColor = "#001000"; + indicator.shape = "LED"; + indicator "Scroll Lock" { left = 317; top = 5; }; + indicator "Num Lock" { left = 364; top = 45; }; + indicator "Caps Lock" { left = 10; top = 85; }; + }; + + section.left = 375; + section.top = 40; + section "LogoPanel" { + solid "logo_panel" { top = 0; left = 0; + shape = "LEDS"; + color = "grey"; + }; + text "Logo" {left = 28; top = 10; text="digital\n"; }; + }; +}; + +partial xkb_geometry "leds_alone" { + section.left = 375; + section.top = 40; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + shape = "LEDS"; + color = "grey"; + }; + indicator.top = 16; + indicator.onColor = "#00ff00"; + indicator.offColor = "#001000"; + indicator.shape = "LED"; + indicator "Num Lock" { left = 3; }; + indicator "Caps Lock" { left = 26; }; + indicator "Scroll Lock" { left = 50; }; + text "Logo" {left = 2; top = 3; text="digital\n"; }; + }; + section "IndicatorLabels" { + text.top = 11; + text "NumLockLabel" {left = 10; text="Num\nLock"; }; + text "CapsLockLabel" {left = 33; text="Caps\nLock"; }; + text "ScrollLockLabel" {left = 58; text="Scroll\nLock"; }; + }; +}; + +xkb_geometry "pc101" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + + }; + row { top = 41; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 61; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>, + <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { <LCTL>, + { <LALT>, 20 }, + { <SPCE>, "SPCE" }, + <RALT>, + { <RCTL>, 21 } + }; + }; + }; +}; + +xkb_geometry "pc102" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { + approx = { [0,0],[28,19] }, + { [0,0], [27,0], [27,39], [5,39], [5,19], [0,19] }, + { [3,2], [24,2], [24,36], [8,36], [8,16], [3,16] } + }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [22,19] }, { [3,2], [19,16] } }; + shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <AC12> + }; + }; + row { top = 61; + keys { { <LFSH>, "LFSH" }, + <BKSL>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { <LCTL>, + { <LALT>, 20 }, + { <SPCE>, "SPCE" }, + <RALT>, + { <RCTL>, 21 } + }; + }; + }; +}; + +xkb_geometry "pcxaj" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { primary = { [22,19] }, { [3,2], [19,16] } }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "RTSH" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [114,19]}, { [3,2], [111,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { top = 41; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <AC12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 61; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>, + <AB07>, <AB08>, <AB09>, <AB10>, <AB11>, + { <RTSH>, "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { <LCTL>, <LALT>, + { <MUHE>, "NORM" }, + { <SPCE>, "SPCE" }, + { <KANJ>, "NORM" }, + { <HIRA>, "NORM" }, + <RALT>, <RCTL> + }; + }; + }; +}; diff --git a/geometry/digital.vndr/unix b/geometry/digital.vndr/unix new file mode 100644 index 0000000..2ca477e --- /dev/null +++ b/geometry/digital.vndr/unix @@ -0,0 +1,230 @@ +// $Xorg: unix,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: unix,v +// Revision 1.2 1996/06/18 09:12:53 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.2.3 1995/06/27 12:17:30 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:23:12 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:23 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:56 William_Walker] +// +// EndLog +// +// @(#)RCSfile: unix,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16: +// +xkb_geometry "unix" { + + width = 340; + height = 160; + shape.cornerRadius = 1; + + shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } }; + shape "AE00" { primary = { [28,19] }, { [3,2], [25,16] } }; + shape "BKSP" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "TABK" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "CTRL" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "RTRN" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "SHFT" { primary = { [56,19] }, { [3,2], [53,16] } }; + shape "MODK" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text.color = "black"; + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 30; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 20 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <LEFT>, 20 }, <DOWN>, <UP>, <RGHT> + }; + }; + }; + + section "Alpha" { top = 50; + row { top = 1; + keys { { <AE00>, "AE00" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + <BKSL>, <AB00> + }; + + }; + row { top = 41; left = -4; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 61; left = -4; + keys { { <LFSH>, "SHFT" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>, + <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "SHFT" } + }; + }; + solid "ExtendKey" { top = 81; left= 1; + shape= "NORM"; + color= "grey20"; + }; + text.top = 89; + text.color = "black"; + text "ExtendLabel" {left = 6; text="Ext\nend"; }; + row { top = 81; left = 19; + key.shape = "MODK"; + keys { { <LCMP>, "NORM" }, <LALT>, + { <SPCE>, "SPCE" }, + <RALT>, <RCMP> + }; + }; + }; +}; + +xkb_geometry "lk421jj" { + + width = 315; + height = 170; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[28,23] }, + { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] }, + { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "LONG1" { { [32,19] }, { [3,2], [29,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [23,19] }, { [3,2], [20,16] } }; + shape "CTRL" { { [43,19] }, { [3,2], [38,16] } }; + shape "SPCE" { { [55,19] },{ [3,2], [53,16]} }; + shape "LEDS" { [ 56,15] }; + shape "LED" { [ 5, 2] }; + + section.left = 5; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 7; top = 10; text="digital\n"; }; + + section "Function" { top = 45; + row { top = 1; left = 7; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 18 }, <FK07>, <FK08>, <FK09>, <FK10> + }; + }; + }; + + section "Editing" { top = 45; left= 230; + row { top = 1; + keys { <LEFT>, <DOWN>, <UP>, <RGHT> }; + }; + }; + + section "Alpha" { top = 65; + row { top = 1; left = 7; + keys { { <AE00>, "MED" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AB00>, { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 7; + keys { { <TAB>, "LONG1" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 41; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { <CAPS>, { <LFSH>, "LONG1" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "LONG1" } + }; + }; + row { top = 81; left = 7; + keys { <AA00>, <LCMP>, + { <LALT>, "LONG" }, + { <MUHE>, "LONG" }, + { <SPCE>, "SPCE" }, + { <KANJ>, "LONG" }, + { <HIRA>, "LONG" }, + <RALT>, <RCMP> + }; + }; + }; + + section.left = 233; + section.top = 20; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 11; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 6; }; + indicator "Caps Lock" { left = 26; }; + text.top = 3; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + + diff --git a/geometry/everex b/geometry/everex new file mode 100644 index 0000000..5be3266 --- /dev/null +++ b/geometry/everex @@ -0,0 +1,174 @@ +// $Xorg: everex,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "STEPnote" { + + description= "Everex STEPnote"; + width= 281; + height= 150; + + shape.cornerRadius= 1; + + shape "NORM" { + { [17,17] }, + { [ 2, 1], [ 15, 15 ] } + }; + shape "NARR" { + { [ 15, 17 ] }, + { [ 2, 1 ], [ 13, 15 ] } + }; + shape "FKEY" { + { [ 15.1, 15.5 ] }, + { [ 1, 1 ], [ 14.1, 14.5 ] } + }; + shape "ESC" { + { [ 16.4, 15.5 ] }, + { [ 1, 1 ], [ 14.1, 14.5 ] } + }; + shape "WIDE" { // backspace, tab and Fn + { [ 25, 17 ] }, + { [ 2, 1 ], [ 23, 15 ] } + }; + shape "RTRN" { + { [ 27.5, 17 ] }, + { [ 2, 1 ], [ 25.5, 15 ] } + }; + shape "CAPS" { + { [ 30, 17 ] }, + { [ 2, 1 ], [ 28, 15 ] } + }; + shape "LFSH" { + { [ 38.5, 17 ] }, + { [ 2, 1 ], [ 36.5, 15 ] } + }; + shape "RTSH" { + { [ 21, 17 ] }, + { [ 2, 1 ], [ 19, 15 ] } + }; + shape "SPCE" { + { [ 88.8, 17 ] }, + { [ 2, 1 ], [ 86.8, 15 ] } + }; + shape "WELL" { + { [ 269, 105 ] } + }; + shape "LED" { + cornerRadius= 1.5, + { [ 3, 10 ] } + }; + + section.left= 6; + row.left= 1; + key.shape= "NORM"; + key.gap= 0.5; + + key.color= "grey20"; + labelColor= "white"; + baseColor= "grey20"; + + indicator.top= 20; + indicator.shape= "LED"; + indicator.onColor= "green"; + indicator.offColor= "green30"; + + indicator "Power" { left= 40; }; + indicator "Battery" { left=101; }; + indicator "Suspend" { left=112; }; + indicator "HardDrive" { left=123; }; + indicator "Floppy" { left=134; }; + indicator "KeyPad" { left=145; }; + indicator "Num Lock" { left=156; }; + indicator "Caps Lock" { left=167; }; + indicator "Scroll Lock" { left=178; }; + + solid "KeyWell" { + top= 35; + left= 6; + shape= "WELL"; + color= "grey10"; + }; + section "Whole" { + top= 35; + row { + top= 0.5; + key.color= "grey30"; + key.shape= "FKEY"; + keys { + { <ESC>, "ESC" }, + <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, <FK06>, + <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12>, + <NMLK>, <PRSC>, <SCLK>, <PAUS> + }; + }; + row { + top= 16.5; + keys { + { <TLDE>, "NARR" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, shape="WIDE", color="grey30" }, + { <HOME>, shape="NARR", color="grey30" } + }; + }; + row { + top= 34; + keys { + { <TAB>, shape="WIDE", color="grey30" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "NARR" }, + { <PGUP>, shape="NARR", color="grey30" } + }; + }; + row { + top= 51.5; + keys { + { <CAPS>, shape="CAPS", color="grey30" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, shape="RTRN", color="grey30" }, + { <PGDN>, shape="NARR", color="grey30" } + }; + }; + row { + top= 69; + keys { + { <LFSH>, shape="LFSH", color="grey30" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, shape="RTSH", color="grey30" }, + { <UP>, shape="NARR", color="grey30" }, + { <END>, shape="NARR", color="grey30" } + }; + }; + row { + top= 86.5; + key.color= "grey30"; + keys { + { <FUNC>, "WIDE" }, + <LCTL>, <LALT>, + { <SPCE>, shape="SPCE", 18, color="grey20" }, + <RALT>, <INS>, <DELE>, + { <LEFT>, "NARR" }, { <DOWN>, "NARR" }, + { <RGHT>, "NARR" } + }; + }; + solid "FakeKey" { + top= 86.5; + left= 62.1; + shape= "NORM"; + color= "grey20"; + }; + overlay "KPAD" { + <AE07>=<KP7>, <AE08>=<KP8>, <AE09>=<KP9>, <AE10>=<KPMU>, + <AD07>=<KP4>, <AD08>=<KP5>, <AD09>=<KP6>, <AD10>=<KPSU>, + <AC07>=<KP1>, <AC08>=<KP2>, <AC09>=<KP3>, <AC10>=<KPAD>, + <AB07>=<KP0>, <AB09>=<KPDL>, <AB10>=<KPSL> + }; + }; // End of "Whole" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/fujitsu b/geometry/fujitsu new file mode 100644 index 0000000..02fe0bc --- /dev/null +++ b/geometry/fujitsu @@ -0,0 +1,315 @@ +// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_geometry "138" { + + // This is an approximate layout for a (US/ASCII) Fujitsu keyboard. + + description= "Fujitsu English keyboard"; + + width= 480; + height= 215; + + shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "SPCE" { { [151,18] }, { [2,1], [149,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 15; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 28; + row { + top= 1; + keys { + <BREA>, { <PRSC>, 6 }, + { <FK13>, 30 }, <FK14>, <FK15>, <FK16>, + { <FK17>, 6 }, <FK18>, <FK19>, <FK20>, + { <FK21>, 6 }, <FK22>, <FK23>, <FK24>, + { <FK29>, 68 }, <FK30>, <FK31>, <FK32> + }; + }; + row { + top= 20; + keys { + <KNJI>, { <PAUS>, 6 }, + { <FK01>, 30 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 6 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 6 }, <FK10>, <FK11>, <FK12>, + { <UNK0>, 6 }, <UNK1>, <UNK2>, + { <FK25>, 6 }, <FK26>, <FK27>, <FK28> + }; + }; + row { + top= 39; + left= 316; + keys { + <PGUP>, <HOME>, <PGDN> + }; + }; + row { + top= 54; + keys { + <UNDO>, { <ESC>, 6 }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, <TLDE>, <BKSP>, + { <KPMU>, 68 }, <KPDV>, <KPAD>, <KPSU> + + }; + }; + row { + top= 58; + left= 316; + keys { + <UNK3>, <DEL>, <INS> + }; + }; + row { + top= 73; + keys { <COPY>, + { <TAB>, 6, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" }, + { <KP7>, 68 }, <KP8>, <KP9>, <KPEQ> + }; + }; + row { + top= 92; + keys { <PAST>, + { <LCTL>, 6, "LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL>, + { <UP>, 49 }, + { <KP4>, 25 }, <KP5>, <KP6>, <KPDC> + }; + }; + row { + top= 102; + left= 316; + keys { <LEFT>, { <RGHT>, 19 } + }; + }; + row { + top= 111; + keys { <CUT>, + { <LFSH>, 6 , "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH" }, + { <DOWN>, 25 }, + { <KP1>, 25 }, <KP2>, <KP3>, { <KPEN>, "KPEN" } + }; + }; + row { + top= 130; + keys { <HELP>, { <CAPS>, 6 }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <RALT>, <COMP>, <LNFD>, + { <KP0>, 68, "KP0" }, <KP00> + }; + }; + row { + top= 149; + left= 316; + keys { + { <EXEC>, "EXEC" } + }; + }; + }; // End of "Alpha" section +}; + +xkb_geometry "140" { + + // This is an approximate layout for a Fujitsu Japanese keyboard. + + description= "Fujitsu Japanese keyboard"; + + width= 480; + height= 215; + + shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "HNKN" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 15; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 28; + row { + top= 1; + keys { + <BREA>, { <PRSC>, 6 }, + { <FK13>, 30 }, <FK14>, <FK15>, <FK16>, + { <FK17>, 6 }, <FK18>, <FK19>, <FK20>, + { <FK21>, 6 }, <FK22>, <FK23>, <FK24>, + { <FK29>, 68 }, <FK30>, <FK31>, <FK32> + }; + }; + row { + top= 20; + keys { + <KNJI>, { <PAUS>, 6 }, + { <FK01>, 30 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 6 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 6 }, <FK10>, <FK11>, <FK12>, + { <UNK0>, 6 }, <UNK1>, <UNK2>, + { <FK25>, 6 }, <FK26>, <FK27>, <FK28> + }; + }; + row { + top= 39; + left= 316; + keys { + <PGUP>, <HOME>, <PGDN> + }; + }; + row { + top= 54; + keys { + <UNDO>, { <ESC>, 6 }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, <BKSL>, <BKSP>, + { <KPMU>, 68 }, <KPDV>, <KPAD>, <KPSU> + + }; + }; + row { + top= 58; + left= 316; + keys { + <UNK3>, <DEL>, <INS> + }; + }; + row { + top= 73; + keys { <COPY>, + { <TAB>, 6, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" }, + { <KP7>, 68 }, <KP8>, <KP9>, <KPEQ> + }; + }; + row { + top= 92; + keys { <PAST>, + { <LCTL>, 6, "LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <TLDE>, + { <UP>, 49 }, + { <KP4>, 25 }, <KP5>, <KP6>, <KPDC> + }; + }; + row { + top= 102; + left= 316; + keys { <LEFT>, { <RGHT>, 19 } + }; + }; + row { + top= 111; + keys { <CUT>, + { <LFSH>, 6 , "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH" }, + { <DOWN>, 25 }, + { <KP1>, 25 }, <KP2>, <KP3>, { <KPEN>, "KPEN" } + }; + }; + row { + top= 130; + keys { <HELP>, { <CAPS>, 6 }, + <LALT>, <LMTA>, <UNK4>, + { <SPCE>, "SPCE" }, + <UNK5>, <RMTA>, <COMP>, <LNFD>, <UNK6>, + { <KP0>, 68, "KP0" }, <KP00> + }; + }; + row { + top= 149; + left= 134; + keys { + { <UNK7>, "HNKN" }, { <UNK8>, "HNKN" }, + { <EXEC>, 132, "EXEC" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/hp b/geometry/hp new file mode 100644 index 0000000..c93cb0c --- /dev/null +++ b/geometry/hp @@ -0,0 +1,456 @@ +// $Xorg: hp,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/hp,v 1.8 2003/08/09 14:30:46 pascal Exp $ + +default xkb_geometry "pc101" { + + description= "HP PC101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [132,18] }, { [2,1], [130,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry + +xkb_geometry "hil" { + + description= "HP hil"; + width= 455; + height= 170; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "TABK" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "BKSL" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "RTRN" { { [ 38,18] }, { [2,1], [ 36,17] } }; + shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [151,18] }, { [2,1], [150,17] } }; + shape "KP0" { { [ 38,18] }, { [2,1], [ 36,17] } }; + shape "KPTB" { { [ 18,38] }, { [2,1], [ 16,37] } }; + shape "TLDE" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "FKT1" { { [ 17,14] }, { [2,1], [ 15,13] } }; + shape "FKT2" { { [ 23,14] }, { [2,1], [ 21,13] } }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 14; + row { + top= 1; + keys { { <BRK>, "FKT1" }, { <STOP>, "FKT1" } , + { <FK01>, "FKT2", 10 }, { <FK02>, "FKT2" }, + { <FK03>, "FKT2" }, { <FK04>, "FKT2" }, + { <MENU>, "FKT1" }, { <SYST>, "FKT1" }, + { <FK05>, "FKT2" }, { <FK06>, "FKT2" }, + { <FK07>, "FKT2" }, { <FK08>, "FKT2" }, + { <CLRL>, "FKT1", 10 }, { <CLR>, "FKT1" }, + { <FK09>, "FKT1", 19 }, { <FK10>, "FKT1" }, + { <FK11>, "FKT1" }, { <FK12>, "FKT1" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 52; + row { + top= 1; + keys { { <TLDE>, "TLDE" }, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" }, <INSL>, <DELL> + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" }, + <INSC>, <DELC> + }; + }; + row { + top= 39; + keys { <CAPS>, <LCTL>, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN" }, + <HOME>, <PGUP> + }; + }; + row { + top= 58; + keys { <ESC>, { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" }, <SELE>, + <UP>, <PGDN> + }; + }; + row { + top= 77; + keys { <PRSC>, { <LALT>, 30 }, + { <SPCE>, "SPCE" }, + <RALT>, { <LEFT>, 30 }, <DOWN>, <RGHT> + }; + }; + }; // End of "Alpha" section + + section "Keypad" { + top= 52; + left= 360; + row { + top= 1; + keys { <KPMU>, <KPDV>, <KPAD>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPEN> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPSP> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPTB>, "KPTB" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry + + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> +// Geometry specification for HP Omnibook keyboards. +// Compatible Models: 6100, 6000. + +xkb_geometry "omnibook" { + width = 282; + height = 128; + baseColor = "grey80"; + labelColor = "white"; + + shape "FN0" { cornerRadius = 1, { [15.5, 12] }, { [1, 0], [14.5, 11] } }; + shape "NORM" { cornerRadius = 1, { [18, 16] }, { [2, 0], [16, 14] } }; + shape "BKSP" { cornerRadius = 1, { [31, 16] }, { [2, 0], [29, 14] } }; + shape "TABK" { cornerRadius = 1, { [27, 16] }, { [2, 0], [25, 14] } }; + shape "CAPS" { cornerRadius = 1, { [32, 16] }, { [2, 0], [30, 14] } }; + shape "RTSH" { cornerRadius = 1, { [45, 16] }, { [2, 0], [43, 14] } }; + shape "MODK" { cornerRadius = 1, { [28, 16] }, { [2, 0], [26, 14] } }; + shape "SPCE" { cornerRadius = 1, { [90, 16] }, { [2, 0], [88, 14] } }; + shape "ARRS" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 11] } }; + + shape "LED" { cornerRadius = 1, { [2, 4] } }; + + shape "KEYS" { cornerRadius = 1, + { [0, 13], + [197, 13], [197, 0], + [280, 0], [280, 125], + [224, 125], [224, 112], + [0, 112] } + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 1; + top = 1; + color = "black"; + }; + + shape "NULL1" { cornerRadius = 1, { [54, 16] } }; + + solid "NullPanel1" { + shape = "NULL1"; + left = 226; + top = 96; + color = "grey80"; + }; + + shape "NULL2" { cornerRadius = 1, { [19, 14] } }; + + solid "NullPanel2" { + shape = "NULL2"; + left = 243; + top = 97; + color = "black"; + }; + + indicator.onColor = "green"; + indicator.offColor = "grey10"; + indicator.top = 4; + indicator.shape = "LED"; + indicator "Caps Lock" { left = 45; }; + indicator "Num Lock" { left = 60; }; + indicator "Scroll Lock" { left = 75; }; + indicator "HDDActivity" { onColor = "red"; left = 90; }; + + key.color = "grey60"; + + section "Function" { + key.gap = 0.99; + left = 1; + top = 1; + key.shape = "FN0"; + row { + left = 197; + top = 1; + keys { <PRSC>, <PAUS>, <INS>, <HOME>, <PGUP> }; + }; + row { + top = 14; + keys { <ESC>, + <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <SCLK>, <DELE>, <END>, <PGDN> + }; + }; + }; // End of "Function" section + + section "Control" { + left = 1; + top = 34; + key.gap = 1; + row { + top = 62; + key.shape = "NORM"; + keys { <LCTL>, <FN>, <LWIN>, <LALT>, + { <SPCE>, "SPCE" }, <RALT>, <MENU>, <RCTL> + }; + }; + }; // End of "Control" section + + section "Navigation" { + key.shape = "ARRS"; + left = 225; + top = 97; + key.gap = 1.4; + row { + left= 18; + top = 1; + keys { <UP> }; + }; + row { + top = 16; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + shape "STIK" { cornerRadius = 4, { [7, 7] } }; + + solid "STIK" { + priority = 255; + color = "red"; + shape = "STIK"; + top = 73; + left = 126; + }; +}; + +// 86 keys +xkb_geometry "omnibook_intl" { + include "hp(omnibook)" + description = "HP Omnibook 6000/6100, Intl"; + + shape "RTRN" { cornerRadius = 1, + { [22, 0], [22, 33], [5, 33], [5, 16], [0, 16], [0, 0] }, + { [20, 0], [20, 31], [7, 31], [7, 14], [2, 14], [2, 0] } }; + shape "LFSH" { cornerRadius = 1, { [23, 16] }, { [2, 0], [21, 14] } }; + + section "Alpha" { + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + left = 1; + top = 27; + row { + top = 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top = 18; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top = 35; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top = 52; + keys { { <LFSH>, "LFSH" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/ibm.vndr/.cvsignore b/geometry/ibm.vndr/.cvsignore new file mode 100644 index 0000000..282522d --- /dev/null +++ b/geometry/ibm.vndr/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/ibm.vndr/Makefile.am b/geometry/ibm.vndr/Makefile.am new file mode 100644 index 0000000..883420e --- /dev/null +++ b/geometry/ibm.vndr/Makefile.am @@ -0,0 +1,6 @@ +geom_DATA = \ +thinkpad + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry/ibm.vndr diff --git a/geometry/ibm.vndr/thinkpad b/geometry/ibm.vndr/thinkpad new file mode 100644 index 0000000..c9b769c --- /dev/null +++ b/geometry/ibm.vndr/thinkpad @@ -0,0 +1,267 @@ +// -*- indent-tabs-mode: nil -*- +// $XFree86: xc/programs/xkbcomp/geometry/ibm/thinkpad,v 1.3 2003/08/09 14:30:48 pascal Exp $ + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> +// Geometry specification for IBM ThinkPad keyboard. +// Compatible Models: THINKPAD 560Z 2640-90U, THINKPAD 560Z 2640-91U, +// THINKPAD 560Z 2640-B0U, THINKPAD 560Z 2640-B1U, THINKPAD 560Z 2640-RR3, +// THINKPAD 600 2645-31U, THINKPAD 600 2645-35U, THINKPAD 600 2645-41U, +// THINKPAD 600 2645-42U, THINKPAD 600 2645-45U, THINKPAD 600 2645-48U, +// THINKPAD 600 2645-51U, THINKPAD 600 2645-85U, THINKPAD 600 2645-A1U, +// THINKPAD 600 2645-RR1, THINKPAD 600 2645-RR2, THINKPAD 600E 2645-3AU, +// THINKPAD 600E 2645-4AU, THINKPAD 600E 2645-4BU, THINKPAD 600E 2645-55U, +// THINKPAD 600E 2645-5AU, THINKPAD 600E 2645-5BU, THINKPAD 600E 2645-5JU, +// THINKPAD 600E 2645-8AO, THINKPAD 600E 2645-8AU, THINKPAD 600E 2645-8BU, +// THINKPAD 600E 2645-AAU, THINKPAD 600E 2645-RRB, THINKPAD 600E 2645-RRD, +// THINKPAD 600E 2645-RRF, THINKPAD 600E 2645-RRS, THINKPAD A22E 2645-45U + +xkb_geometry "common" { + width = 290; + height = 150; + baseColor = "grey80"; + labelColor = "white"; + + shape "FN0" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 10] } }; + shape "NORM" { cornerRadius = 1, { [18, 18] }, { [2.5, 0], [15.5, 14] } }; + shape "BKSP" { cornerRadius = 1, { [37, 18] }, { [2.5, 0], [34.5, 14] } }; + shape "TABK" { cornerRadius = 1, { [27, 18] }, { [2.5, 0], [24.5, 14] } }; + shape "CAPS" { cornerRadius = 1, { [31, 18] }, { [1, 0], [30, 16] }, + { [1, 0], [26, 16] }, + { [2.5, 0], [24.5, 14] } }; + shape "RTSH" { cornerRadius = 1, { [50, 18] }, { [2.5, 0], [46.5, 14] } }; + shape "MODK" { cornerRadius = 1, { [27.5, 18] }, { [2.5, 0], [25, 14] } }; + shape "SPCE" { cornerRadius = 1, { [100, 18] }, { [2.5, 0], [97.5, 14] } }; + shape "ARRS" { cornerRadius = 1, { [16, 13] }, { [1.5, 0], [14.5, 11] } }; + + shape "LED" { cornerRadius = 2, { [3, 3] } }; + + shape "KEYS" { cornerRadius = 2, + { [0, 0], [19, 0], [19, 13], [172, 13], + [172, 0], [286, 0], [286, 138], [216, 138], + [216, 124], [0, 124] } }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 2; + top = 5; + color = "black"; + }; + + shape "NULL1" { cornerRadius = 1, + { [0, 0], [50, 0], [50, 18], [34, 18], [34, 4], + [16, 4], [16, 18], [0, 18] } }; + + solid "NullPanel1" { + shape = "NULL1"; + left = 237; + top = 110; + color = "grey80"; + }; + + shape "NULL2" { cornerRadius = 1, { [17, 13] } }; + + solid "NullPanel2" { + shape = "NULL2"; + left = 219; + top = 129; + color = "grey80"; + }; + + shape "NULL3" { cornerRadius = 1, + { [0, 26], + [72, 26], [72, 13], [76, 13], [76, 26], + [149, 26], [149, 13], [153, 13], [153, 26], + [226, 26], [226, 0], [230, 0], [230, 26], + [284, 26], [285, 27], + [0, 27] } }; + + solid "NullPanel3" { + shape = "NULL3"; + left = 3; + top = 6; + color = "grey80"; + }; + + indicator.onColor = "green"; + indicator.offColor = "grey10"; + indicator.top = 4; + indicator.shape = "LED"; + indicator "HDDActivity" { onColor = "red"; left = 100; }; + indicator "Num Lock" { left = 108; }; + indicator "Caps Lock" { left = 114; }; + indicator "Scroll Lock" { left = 120; }; + indicator "Power" { left = 128; }; + + key.gap = 1; + key.color = "grey60"; + + section "Function" { + left = 2; + top = 5; + key.shape = "FN0"; + row { + top = 1; + keys { <ESC>, { <PRSC>, 155 }, <SCLK>, <PAUS> }; + }; + row { + top = 14; + keys { <FK01>, <FK02>, <FK03>, <FK04>, + { <FK05>, 6 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 6 }, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Control" { + left= 2; + top = 109; + key.shape = "MODK"; + row { + top = 1; + keys { { <FN>, "NORM" }, <LCTL>, <LALT>, + { <SPCE>, "SPCE" }, <RALT>, <RCTL> + }; + }; + }; // End of "Control" section + + section "Editing" { + top = 5; + left = 233; + key.shape = "FN0"; + row { + top = 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top = 14; + keys { <DELE>, <END>, <PGDN> }; + }; + }; // End of "Editing" section + + section "Navigation" { + top = 114; + left = 236; + key.shape = "ARRS"; + row { + top = 1; + left = 17; + keys { <UP> }; + }; + row { + top = 15; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + shape "STIK" { cornerRadius = 4, { [7, 7] } }; + + solid "STIK" { + priority = 255; + color = "red"; + shape = "STIK"; + top = 85; + left = 126; + }; +}; + +// 85 keys +// US/English (FRU 02K4785). +xkb_geometry "us" { + include "thinkpad(common)" + description = "IBM ThinkPad 560Z/600/600E/A22E, US"; + + shape "RTRN" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } }; + shape "LFSH" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } }; + shape "BKSL" { cornerRadius = 1, { [28, 18] }, { [2.5, 0], [25.5, 14] } }; + + section "Alpha" { + left = 2; + top = 33; + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + row { + top = 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top = 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top = 39; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN" } + }; + }; + row { + top = 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + }; // End of "Alpha" section +}; + +// 86 keys +// Tested on: DE/German, UK/English (FRU 02K4787). +xkb_geometry "intl" { + include "thinkpad(common)" + description = "IBM ThinkPad 560Z/600/600E/A22E, Intl"; + + shape "RTRN" { cornerRadius = 1, { [28, 0], [28, 37], [4, 37], [4, 18], + [0, 18], [0, 0] }, + { [25.5, 0], [25.5, 33], [6.5, 33], + [6.5, 14], [2.5, 14], [2.5, 0] } }; + shape "LFSH" { cornerRadius = 1, { [24, 18] }, { [2.5, 0], [21.5, 14] } }; + + section "Alpha" { + left = 2; + top = 33; + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + row { + top = 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top = 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top = 39; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top = 58; + keys { { <LFSH>, "LFSH" }, <AB00>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/keytronic b/geometry/keytronic new file mode 100644 index 0000000..2e4e37a --- /dev/null +++ b/geometry/keytronic @@ -0,0 +1,255 @@ +// $Xorg: keytronic,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86$ +// +default xkb_geometry "FlexPro" { + + // This is an approximate layout for a Key Tronic FlexPro + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Key Tronic FlexPro keyboard"; + + width= 515; + height= 200; + + shape "EDGE" { cornerRadius= 2, { [ 515, 200 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "TABK" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "BKSL" { { [ 23,18] }, { [2,1], [21,17] } }; + shape "RTRN" { + approx = { [16, 0], [38,37] }, + { [16, 0], [38, 0], [38,37], + [ 0,37], [ 0,19], [16,19] }, + { [18, 1], [36, 1], [36,36], + [ 2,36], [ 2,20], [18,20] } }; + shape "CAPS" { { [36,18] }, { [2,1], [34,17] } }; + shape "SHFT" { { [46,18] }, { [2,1], [44,17] } }; + shape "LCTL" { { [32,18] }, { [2,1], [30,17] } }; + shape "RCTL" { { [38,18] }, { [2,1], [36,17] } }; + shape "LALT" { { [28,18] }, { [2,1], [26,17] } }; + shape "RALT" { { [33,18] }, { [2,1], [31,17] } }; + shape "LSPC" { { [66,22] }, { [0,0], [66,22] } }; + shape "RSPC" { { [76,22] }, { [0,0], [76,22] } }; + shape "KP0" { { [37,18] }, { [2,1], [35,17] } }; + shape "KPEN" { { [18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { cornerRadius= 3, { [80,35] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 9; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Function" { + top= 56; + row { + top = 1; + key.color= "grey20"; + keys { <FK01>, <FK02> }; + }; + row { + top = 20; + key.color= "grey20"; + keys { <FK03>, <FK04> }; + }; + row { + top = 39; + keys { <FK05>, <FK06> }; + }; + row { + top = 58; + key.color= "grey20"; + keys { <FK07>, <FK08> }; + }; + row { + top = 77; + key.color= "grey20"; + keys { <FK09>, <FK10> }; + }; + row { + top = 96; + keys { <FK11>, <FK12> }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 56; + left= 53; + row { + top= 1; + keys { + { <ESC>, color="grey20" }, { <BKSL>, "BKSL", color="grey20" }, + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { + { <TLDE>, color="grey20" }, { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { + { <LCTL>, color="grey20" }, { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, <AC11> + }; + }; + row { + top= 58; + keys { + { <LFSH>, color="grey20" }, + { <LFSH>, "SHFT", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "SHFT", color="grey20" } + }; + }; + row { + top= 77; + key.color= "grey20"; + keys { + <LALT>, + { <LCTL>, shape="LCTL" }, + { <LALT>, shape="LALT" }, + { <SPCE>, shape="LSPC", 4, color="white" }, + { <SPCE>, shape="RSPC",color="white" }, + { <RALT>, shape="RALT", 4 }, + { <RCTL>, shape="RCTL" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 12; + left= 365; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 45; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 64; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 102; + left= 20; + keys { <UP> }; + }; + row { + top= 121; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 3, { [ 76, 20 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 11; + left= 430; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 13; + indicator.shape= "LED"; + indicator "Num Lock" { left= 440; }; + indicator "Caps Lock" { left= 467; }; + indicator "Scroll Lock" { left= 489; }; + text.top= 22; + text.color= "black"; + text "NumLockLabel" { left= 438; text="Num\nLock"; }; + text "CapsLockLabel" { left= 465; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 487; text="Scroll\nLock"; }; + + logo "FlexProLogoImage" { + top= 12; + left= 45; + name= "KeyTronic"; + shape= "LOGO"; + }; + text "KeyTronicLogoText" { + top= 15; + left= 50; + width= 55; + text= "FlexPro"; + font= "times"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 36; + }; + + section "Keypad" { + top= 56; + left= 430; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <LEFT> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPSU>, color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, { <KPAD>, color= "grey20" } }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; diff --git a/geometry/kinesis b/geometry/kinesis new file mode 100644 index 0000000..548d092 --- /dev/null +++ b/geometry/kinesis @@ -0,0 +1,193 @@ +// $Xorg: kinesis,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "model100" { + + // This is an approximate layout for a Kinesis Ergonomic keyboard + // Generated completely by eye. I didn't actually *measure* a real + // keyboard. + + description= "Kinesis Ergonomic Keyboard"; + width= 421; + height= 185; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "WIDE" { { [ 21,18] }, { [2,1], [19,17] } }; + shape "TALL" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "FKEY" { cornerRadius=0, { [ 10,13] } }; + shape "LED" { cornerRadius= 1.5, { [ 3, 3] } }; + shape "LOGO" { { [ 40, 10 ] } }; + shape "EDGE" { cornerRadius=5, { [ 421, 185 ] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section "LeftFunction" { + left= 15; + top= 11; + key.shape= "FKEY"; + key.gap= 3; + row { + left= 1; + top= 1; + keys { + <ESC>, <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08> + }; + }; + }; // End of "LeftFunction" section + + section "RightFunction" { + left= 290; + top= 11; + key.shape= "FKEY"; + key.gap= 3; + row { + left= 1; + top= 0.2; + keys { + <FK09>, <FK10>, <FK11>, <FK12>, <PRSC>, + <SCLK>, <PAUS>, <FK16>, <FK17> + }; + }; + }; // End of "RightFunction" section + + row.vertical= True; + row.top= 1; + key.gap= 0.5; + + logo "KinesisLogoImage" { + top= 25; + left= 240; + name= "Kinesis"; + shape= "LOGO"; + }; + + indicator.shape= "LED"; + indicator.top= 30; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator "Caps Lock" { left= 23; }; + + section "LeftAlpha" { + top= 34; + left= 15; + row { + left= 2; + key.shape= "WIDE"; + keys { <AE12>, <TAB>, <CAPS>, <LFSH> }; + }; + row { + top= 4; + left= 24; + keys { <AE01>, <AD01>, { <AC01>, color="grey20" }, <AB01>, <TLDE> }; + }; + row { + left= 43; + keys { <AE02>, <AD02>, { <AC02>, color="grey20" }, <AB02>, <INS> }; + }; + row { + left= 62; + keys { <AE03>, <AD03>, { <AC03>, color="grey20" }, <AB03>, <LEFT> }; + }; + row { + left= 81; + keys { <AE04>, <AD04>, { <AC04>, color="grey20" }, <AB04>, <RGHT> }; + }; + row { + left= 100; + keys { <AE05>, <AD05>, <AC05>, <AB05> }; + }; + }; // End of "LeftAlpha" section + + indicator "NumLock" { left= 318; }; + indicator "Overlay" { left= 387; }; + section "RightAlpha" { + top= 34; + left= 290; + row { + left= 2; + keys { <AE06>, <AD06>, <AC06>, <AB06> }; + }; + row { + left= 21; + keys { <AE07>, <AD07>, { <AC07>, color="grey20" }, <AB07>, <UP> }; + }; + row { + left= 40; + keys { <AE08>, <AD08>, { <AC08>, color="grey20" }, <AB08>, <DOWN> }; + }; + row { + left= 59; + keys { <AE09>, <AD09>, { <AC09>, color="grey20" }, <AB09>, <AD11> }; + }; + row { + top= 4; + left= 78; + keys { <AE10>, <AD10>, { <AC10>, color="grey20" }, <AB10>, <AD12> }; + }; + row { + left= 97; + key.shape= "WIDE"; + keys { <AE11>, <BKSL>, <AC11>, <RTSH> }; + }; + overlay "KPAD" { + <AE07>=<NMLK>, <AE08>=<KPEQ>, <AE09>=<KPSL>, <AE10>=<KPMU>, + <AD07>=<KP7>, <AD08>=<KP8>, <AD09>=<KP9>, <AD10>=<KPSU>, + <AC07>=<KP4>, <AC08>=<KP5>, <AC09>=<KP6>, <AC10>=<KPAD>, + <AB07>=<KP1>, <AB08>=<KP2>, <AB09>=<KP3>, <AB10>=<KPEN>, + <AE10>=<KPDL>, <AE11>=<KPEN> + }; + }; // End of "RightAlpha" section + + section "LeftEdit" { + top= 109; + left= 123; + angle= 20; + row.top= -18; + row { + top= 1; + left= 1; + keys { { <BKSP>, "TALL" } }; + }; + row { + left= 20; + keys { <LCTL>, { <DELE>, "TALL" } }; + }; + row { + left= 39; + keys { <LALT>, <HOME>, <END> }; + }; + }; // End of "RightEdit" section + + section "RightEdit" { + top= 109; + left= 302; + angle= -20; + row.top= -18; + row { + left= -57; + keys { <RALT>, <PGUP>, <PGDN> }; + }; + row { + left= -38; + keys { <RCTL>, { <RTRN>, "TALL" } }; + }; + row { + top= 1; + left= -19; + keys { { <SPCE>, "TALL" } }; + }; + overlay "KPAD" { + <SPCE>= <KP0> + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/macintosh b/geometry/macintosh new file mode 100644 index 0000000..f97251f --- /dev/null +++ b/geometry/macintosh @@ -0,0 +1,174 @@ +// $XFree86: xc/programs/xkbcomp/geometry/macintosh,v 1.3 2003/08/09 14:30:47 pascal Exp $ +// +// Some modifications (<eqdar@castalie.org>) : +// - Added a <LSGT> key +// - Fixed the shape of the <RTRN> key +// - Moved <BKSL> to the 'AC' row +// - Added a special Macintosh sysctl key +// - Minor changes (Function keys shape, LED position...) + +default xkb_geometry "macintosh" { + + description= "Apple Extended Keyboard II"; + width = 475; + height = 194; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TLDE" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "BKSP" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "TAB" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "RTRN" { + { [0,0],[23,0],[23,37],[4,37],[4,18],[0,18] }, + { [2,1],[21,1],[21,36],[6,36],[6,17],[2,17] } }; + shape "CAPS" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "LCTL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "LALT" { { [ 22,18] }, { [2,1], [ 20,17] } }; + shape "LMTA" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RCTL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RALT" { { [ 22,18] }, { [2,1], [ 20,17] } }; + shape "RMTA" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTSH" { { [ 47,18] }, { [2,1], [ 45,17] } }; + shape "SPCE" { { [123,18] }, { [2,1], [121,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + // Macintosh keyboards have a special sysctl key at the top right + shape "AAPL" { + { [ 0,0], [ 18,0], [ 18,18], [ 0,18] }, + { [ 1,1], [ 17,1], [ 17,17], [ 1,17] }, + { [ 8,5], [ 8,12], [ 2,9] } }; + + shape "LEDS" { cornerRadius = 0, { [ 55,19] } }; + shape "LED" { cornerRadius = 0, { [ 8, 2] } }; + + solid "LedPanel" { + shape= "LEDS"; + top = 48; + left = 378; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top = 50; + indicator.shape= "LED"; + indicator "NumLock" { left = 381; }; + indicator "CapsLock" { left = 398; }; + indicator "ScrollLock" { left = 415; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left = 381; text = "Num\nLock"; }; + text "CapsLockLabel" { left = 398; text = "Caps\nLock"; }; + text "ScrollLockLabel" { left = 415; text = "Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Function" { + top = 48; + row { + top= 1; + keys { <ESC>, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 10 }, <SCLK>, <PAUS>, + // This is the sysctl key on macintosh keyboards + // keycode is 222 with a 4.21 kernel, which is <I5E> + { <I5E>, "AAPL", 67 } + }; + }; + }; // End of "Function" section + + section "Alpha" { + top = 87; + row { + top= 1; + keys { { <TLDE>, "TLDE" }, <AE01>, <AE02>, <AE03>, + <AE04>, <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TAB" }, <AD01>, <AD02>, <AD03>, + <AD04>, <AD05>, <AD06>, <AD07>, <AD08>, <AD09>, + <AD10>, <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS" }, <AC01>, <AC02>, <AC03>, + <AC04>, <AC05>, <AC06>, <AC07>, <AC08>, <AC09>, + <AC10>, <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, <LSGT>, <AB01>, <AB02>, + <AB03>, <AB04>, <AB05>, <AB06>, <AB07>, <AB08>, + <AB09>, <AB10>, { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + keys { { <LCTL>, "LCTL" }, { <LALT>, "LALT" }, + { <LMTA>, "LMTA" }, + { <SPCE>, "SPCE" }, + { <RMTA>, "RMTA" }, + { <RALT>, "RALT" }, { <RCTL>, "RCTL" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top = 87; + left = 314; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + // Begin of "Keypad" section + section "Keypad" { + top = 87; + left = 380; + row { + top= 1; + keys { <NMLK>, <KPEQ>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry diff --git a/geometry/microsoft b/geometry/microsoft new file mode 100644 index 0000000..0894937 --- /dev/null +++ b/geometry/microsoft @@ -0,0 +1,256 @@ +// $Xorg: microsoft,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "natural" { + + // Approximate layout for a Microsoft Natural Keyboard + description= "Microsoft Natural Keyboard"; + width= 550; + height= 190; + + shape.cornerRadius= 1; + shape "LDEF" { { [ 18,18] }, { [2,1], [15,15] } }; + shape "TABK" { { [ 26,18] }, { [2,1], [23,15] } }; + shape "CAPS" { { [ 30,18] }, { [2,1], [23,15] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [38,15] } }; + shape "KEY6" { { [ 22,18] }, { [2,1], [15,15] } }; + shape "KEYT" { { [ 33,18] }, { [2,1], [15,15] } }; + shape "KEYG" { { [ 29,18] }, { [2,1], [15,15] } }; + shape "LCTL" { + approx= { [ 32, 22 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 23 ], [ 0, 22 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 17 ], [ 2, 15 ] } + }; + shape "LWIN" { + approx= { [ 32, 23 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 24 ], [ 0, 23 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 18 ], [ 2, 17 ] } + }; + shape "LALT" { + approx= { [ 32, 24 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 25 ], [ 0, 24 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 20 ], [ 2, 19 ] } + }; + shape "RDEF" { { [ 18,18] }, { [3,1], [15,15] } }; + shape "KEY7" { { [ 28, 18 ] }, { [ 14, 1], [26, 15] } }; + shape "KEYH" { { [ 24, 18 ] }, { [ 10, 1], [22, 15] } }; + shape "KEYN" { { [ 32, 18 ] }, { [ 18, 1], [30, 15] } }; + shape "BKSP" { { [ 41, 18 ] }, { [ 3, 1], [39, 15] } }; + shape "BKSL" { { [ 24, 18 ] }, { [ 3, 1], [22, 15] } }; + shape "RTRN" { { [ 37, 18 ] }, { [ 3, 1], [35, 15] } }; + shape "RTSH" { { [ 43, 18 ] }, { [ 3, 1], [41, 15] } }; + shape "RALT" { + approx= { [ 27, 24 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 24 ], [ 0, 25 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 19 ], [ 3, 20 ] } + }; + shape "RWIN" { + approx= { [ 27, 23 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 23 ], [ 0, 24 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 18 ], [ 3, 19 ] } + }; + shape "MENU" { + approx= { [ 27, 21 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 21 ], [ 0, 23 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 16 ], [ 3, 17 ] } + }; + shape "RCTL" { + approx= { [ 27, 19 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 19 ], [ 0, 21 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 14 ], [ 3, 15 ] } + }; + shape "KPAD" { { [ 18, 37 ] }, { [ 3, 1 ], [ 16, 34 ] } }; + shape "KP0" { { [ 37, 18 ] }, { [ 3, 1 ], [ 35, 15 ] } }; + shape "SPCE" { + { [ 4, 3], [42,10], [44, 0], [88, 0], [90,10], [130, 3], + [134,26], [99,30], [67,33], [33,30], [ 0,26] }, + { [ 6, 4.5], [43,11], [45, 1], [87, 1], [89,11], [128, 4.5], + [131,23], [99,28], [67,32], [33,28], [ 3,23] } + }; + + shape "EDGE" { + cornerRadius= 2, + { [ 25, 0 ], [ 177, 17 ], [ 329, 0 ], [ 542, 0 ], + [ 542, 150 ], [ 354, 150 ], [ 177, 185 ], [ 0, 150 ] } + }; + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + row.left= 1; + key.shape= "LDEF"; + key.gap= 1; + section "LeftFunction" { + top= 10; + left= 40; + angle= 10; + row { + top= 1; + keys { <ESC>, { <FK01>, 12 }, <FK02>, <FK03>, <FK04>, <FK05> }; + }; + }; // End of "LeftFunction" section + + section "LeftAlpha" { + top= 47; + left= 30; + angle= 10; + row { + top= 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, { <AE06>, "KEY6" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, { <AD05>, "KEYT" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, { <AC05>, "KEYG" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05> + }; + }; + row { + top= 77; + keys { { <LCTL>, "LCTL" }, { <LWIN>, "LWIN" }, { <LALT>, "LALT" } }; + }; + }; // End of "LeftAlpha" section + + key.shape= "RDEF"; + section "RightFunction" { + top= 32; + left= 195; + angle= -10; + row { + top= 1; + left= 1; + keys { <FK06>, <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12> }; + }; + }; // End of "RightFunction" section + + section "RightAlpha" { + top= 71; + left= 190; + angle= -10; + row.left= 1; + row { + top= 1; + keys { { <AE07>, "KEY7" }, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <AC06>, "KEYH" }, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { { <AB06>, "KEYN" }, + <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + left= 40; + keys { { <RALT>, "RALT" }, { <RWIN>, "RWIN" }, + { <MENU>, "MENU" }, { <RCTL>, "RCTL" } + }; + }; + }; // End of "RightAlpha" section + + section "SpaceBar" { + top= 139; + left= 111; + key.shape= "SPCE"; + row { keys { <SPCE> }; }; + }; + + section "Editing" { + top= 15; + left= 385; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 109; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LED" { + cornerRadius= 0, + { [ 3, 1 ] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.left= 177; + indicator.shape= "LED"; + indicator "Num Lock" { top= 90; }; + indicator "Caps Lock" { top= 107; }; + indicator "Scroll Lock" { top= 127; }; + + section "Keypad" { + top= 47; + left= 456; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/nec b/geometry/nec new file mode 100644 index 0000000..189d9ca --- /dev/null +++ b/geometry/nec @@ -0,0 +1,159 @@ +// $Xorg: nec,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/nec,v 3.4 2001/01/17 23:45:49 dawes Exp $ + +default xkb_geometry "pc98" { + + description= "Generic PC98"; + width= 405; + height= 172; + + shape.cornerRadius= 1; + shape "NORM" { { [ 17,18] }, { [2,1], [ 15,17] } }; + shape "RTRN" { { [ 20,37] }, { [2,1], [ 18,35] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [115,18] }, { [2,1], [113,17] } }; + shape "FUNC" { { [ 21,18] }, { [2,1], [ 19,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "TABK" { { [ 30,18] }, { [2,1], [ 28,17] } }; + shape "ARRW" { { [ 35,18] }, { [2,1], [ 33,17] } }; + + section.left= 8; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 29; + row { + top= 1; + key.shape="FUNC"; + keys { { <BRK>, "NORM" }, { <PRSC>, "NORM", 5 }, + { <FK01>, 6 }, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 6 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 6 }, <FK12>, <FK13>, <FK14>, <FK15> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 54; + row { + top= 1; + keys { { <ESC>, shape="BKSP"}, + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <BKSL>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", 6 } + }; + }; + row { + top= 39; + keys { <LCTL>, <CAPS>, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, <AB11>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + keys { { <ALGR>, 35 } , <LALT>, { <NFER>, "FUNC" }, + { <SPCE>, "SPCE" }, { <XFER>, "FUNC" } + + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 54; + left= 281; + row { + top= 1; + keys { <INS>, <DELE> }; + }; + row { + top= 20; + keys { <PGDN>, <PGUP> }; + }; + row { + top= 39; + keys { { <UP>, "ARRW" } }; + }; + row { + top= 58; + keys { <LEFT>, <RGHT> }; + }; + row { + top= 77; + keys { { <DOWN>, "ARRW" } }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 54; + left= 320; + row { + top= 1; + keys { <HOME>, <HELP>, <KPSU>, <KPDV> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPMU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, <KPEQ> }; + }; + row { + top= 77; + keys { <KP0>, <KPSP>, <KPDC>, <KPEN> }; + }; + }; // End of "Keypad" section + +}; // End of "pc98" geometry diff --git a/geometry/northgate b/geometry/northgate new file mode 100644 index 0000000..fd376ce --- /dev/null +++ b/geometry/northgate @@ -0,0 +1,172 @@ +// $Xorg: northgate,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "omnikey101" { + + description= "North Gate Omnikey 101"; + width= 470; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [34,18] }, { [2,1], [32,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [15, 0], [40,37] }, + { [15, 0], [40, 0], [40,37], + [ 0,37], [ 0,19], [15,19] }, + { [17, 1], [38, 1], [38,36], + [ 2,36], [ 2,20], [17,20] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "RTSH" { { [ 30,18] }, { [2,1], [28,17] } }; + shape "MODK" { { [ 26,18] }, { [2,1], [24,17] } }; + shape "SPCE" { { [129,18] }, { [2,1], [127,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 32; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 46.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 34; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 32; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 9 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 9 }, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 65; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" }, <BKSL> + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LALT>, + { <LCTL>, 23 }, + { <SPCE>, "SPCE", color="white" }, + <RCTL>, + { <RALT>, 23 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 32; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 65; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry diff --git a/geometry/pc b/geometry/pc new file mode 100644 index 0000000..8a53871 --- /dev/null +++ b/geometry/pc @@ -0,0 +1,1159 @@ +// $Xorg: pc,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/pc,v 3.14 2003/08/09 14:30:47 pascal Exp $ + +default xkb_geometry "pc101" { + + description= "Generic 101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 21 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 21 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry + +xkb_geometry "pc102" { + + description= "Generic 102"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { + { [16,0],[ 43,0],[43,37],[2,37],[2,19],[16,19] }, + { [18,1],[ 41,1],[41,36],[4,36],[4,20],[18,20] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [ 47,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [134,18] }, { [2,1], [132,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, "TABK", color="grey20" }, + { <FK01>, 10 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <BKSL>, + { <BKSP>, color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, -15, "RTRN", color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "pc102" geometry + +xkb_geometry "pc104" { + + description= "Generic 104"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "SMOD"; + key.color= "grey20"; + keys { { <LCTL>, "MODK" }, <LWIN>, <LALT>, + { <SPCE>, "SPCE", color="white" }, + <RALT>, <RWIN>, <MENU>, <RCTL> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "pc104" geometry + +xkb_geometry "pc105" { + + description= "Generic 105"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "SMOD"; + key.color= "grey20"; + keys { { <LCTL>, "MODK" }, <LWIN>, <LALT>, + { <SPCE>, "SPCE", color="white" }, + <RALT>, <RWIN>, <MENU>, <RCTL> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "pc105" geometry + + +// Added for japanese 106 keyboard +// by tsuka@kawalab.dnj.ynu.ac.jp . +xkb_geometry "jp106" { + + description= "Japanese 106"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 379; }; + indicator "Caps Lock" { left= 404; }; + indicator "Scroll Lock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AE13>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 },<NFER>, + { <SPCE>, "SPCE", color="white" }, + <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "jp106" geometry + +// Added for brazilian ABNT2 by Ricardo Y. Igarashi(iga@that.com.br) +xkb_geometry "abnt2" { + + description= "Brazilian ABNT2"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 379; }; + indicator "Caps Lock" { left= 404; }; + indicator "Scroll Lock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, <BKSL>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "abnt2" geometry + + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> + +xkb_geometry "pc86" { + description = "Noname keyboard with 86 keys, DE"; + width = 287; + height = 143; + baseColor = "grey20"; + + shape "EDGE" { cornerRadius = 2, { [287, 143] } }; + shape "LED" { cornerRadius = 2, { [3, 3] } }; + shape "LEDS" { cornerRadius = 0, { [75, 5] } }; + shape "KEYS" { cornerRadius = 0, { [271, 109] } }; + + outline "Edges" { + top = 0; + left = 0; + shape = "EDGE"; + color = "black"; + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 8; + top = 22; + color = "grey70"; + }; + + solid "LedPanel" { + shape = "LEDS"; + left = 212; + top = 10; + color = "black"; + }; + + indicator.onColor = "green"; + indicator.offColor = "green30"; + indicator.top = 11; + indicator.shape = "LED"; + indicator "Num Lock" { left = 212 + 7; }; + indicator "Caps Lock" { left = 212 + 23; }; + indicator "Scroll Lock" { left = 212 + 39; }; + text.fontSize = 6; + text.top = 10; + text.color = "white"; + text "NumLockLabel" { left = 212 + 7 + 5; text = "Num\nLock"; }; + text "CapsLockLabel" { left = 212 + 23 + 5; text = "Caps\nLock"; }; + text "ScrollLockLabel" { left = 212 + 39 + 5; text = "Scroll\nLock"; }; + + shape.cornerRadius = 1; + shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } }; + shape "NARR" { { [13, 18] }, { [1.5, 0], [11.5, 14] } }; + shape "NORM" { { [18, 18] }, { [3, 0], [15, 14] } }; + shape "NORM_1" { { [22, 18] }, { [4, 0], [22, 18] }, + { [7, 0], [19, 14] } }; + shape "WIDER" { { [23, 18] }, { [3, 0], [20, 14] } }; + shape "WIDEST" { { [27, 18] }, { [3, 0], [24, 14] } }; + shape "SPCE" { { [75, 18] }, { [3, 0], [72, 14] } }; + + section "Function" { + key.shape = "SMALL"; + key.gap = 0.99; + key.color = "grey30"; + left = 8; + top = 22; + row { + top = 1; + keys { <ESC>, + <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <NMLK>, <PRSC>, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Control" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey30"; + left = 8; + top = 111; + row { + top = 1; + keys { <LCTL>, <FN>, <LALT>, + { <SPCE>, shape="SPCE", 39 }, <RALT>, + <INS>, <DELE> + }; + }; + }; // End of "Control" section + + section "Editing" { + key.shape = "NARR"; + key.gap = 1; + key.color = "grey30"; + left = 265; + top = 34; + row.vertical = True; + row { + top = 1; + keys { <HOME>, <PGUP>, <PGDN>, <END> }; + }; + }; // End of "Editing" section + + section "Navigation" { + key.gap = 1; + key.shape = "NARR"; + key.color = "grey30"; + left = 236; + top = 92; + row { + left = 14; + top = 1; + keys { <UP> }; + }; + row { + top = 20; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + section "Alpha" { + key.gap = 1; + key.shape = "NORM"; + key.color = "grey10"; + left = 8; + top = 35; + row { + top = 1; + keys { { <AE01>, shape="NORM_1" }, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, shape="WIDER", color="grey30" } + }; + }; + row { + top = 20; + keys { { <TAB>, shape="NARR", color="grey30" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <AD13>, shape="NARR" } + }; + }; + row { + top = 39; + keys { { <CAPS>, color="grey30" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, shape="WIDEST", color="grey30" } + }; + }; + row { + top = 58; + keys { { <LFSH>, shape="WIDEST", color="grey30" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, shape="WIDER", color="grey30" } + }; + }; + row { + left = 57; + top = 77; + keys { <AE00>, <LSGT> }; + }; + }; // End of "Alpha" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; // End of "pc86" geometry diff --git a/geometry/sgi.vndr/.cvsignore b/geometry/sgi.vndr/.cvsignore new file mode 100644 index 0000000..282522d --- /dev/null +++ b/geometry/sgi.vndr/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/sgi.vndr/Makefile.am b/geometry/sgi.vndr/Makefile.am new file mode 100644 index 0000000..c72d1c2 --- /dev/null +++ b/geometry/sgi.vndr/Makefile.am @@ -0,0 +1,6 @@ +geom_DATA = \ +indigo indy O2 + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry/sgi.vndr diff --git a/geometry/sgi.vndr/O2 b/geometry/sgi.vndr/O2 new file mode 100644 index 0000000..52ba1a6 --- /dev/null +++ b/geometry/sgi.vndr/O2 @@ -0,0 +1,618 @@ +// $Xorg: O2,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "101-key keyboard for Silicon Graphics O2"; + + width= 448; + height= 162; + + shape "EDGE" { + cornerRadius= 2, + { [ 15, 0 ], [ 433, 0 ], [ 433, 10 ], [ 448, 10 ], + [ 448, 162 ], [ 0, 162 ], [ 0, 10 ], [ 15, 10 ] } + }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 12,12] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 6; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 19}, <FK02>, <FK03>, <FK04>, + { <FK05>, 11}, <FK06>, <FK07>, <FK08>, + { <FK09>, 11}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 58; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE",color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 25; + left= 299; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 3, 1.5] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 364; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 372; }; + indicator "Caps Lock" { left= 397; }; + indicator "Scro llLock" { left= 422; }; + + text.font= "helvetica"; + text.weight= "bold"; + text.slant= "r"; + text.fontWidth= "normal"; + text.fontSize= 12; + text.top= 39.5; + text.color= "black"; + text "NumLockLabel" { left= 376.5; text="1"; }; + text "CapsLockLabel" { left= 401.5; text="A"; }; + text "ScrollLockLabel" { left= 426.5; text="S"; }; + + logo "SGILogoImage" { + top= 26.5; + left= 396; + name= "SGI"; + shape= "LOGO"; + }; + text.font= "helvetica"; + text.weight= "bold"; + text.slant= "o"; + text.fontWidth= "narrow"; + text.fontSize= 18; + text "SiliconLogoText" { + top= 27; + left= 375; + width= 20; + text= "Silicon"; + }; + text "GraphicsLogoText" { + top= 27; + left= 409; + width= 20; + text= "Graphics"; + }; + + section "Keypad" { + top= 58; + left= 363; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 10}, <FK06>, <FK07>, <FK08>, + { <FK09>, 10}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color= "grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, + { <LALT>, 19 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, + { <RCTL>, 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "jp106" { + description= "Silicon Graphics 106-key Japanese keyboard"; + width= 442; + height= 167; + + shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + logo "SGILogoImage" { + top= 5; + left= 6; + name= "SGI"; + shape= "LOGO"; + }; + + text "SGILogoText" { + top= 9; + left= 25; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 362; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 366; }; + indicator "Caps Lock" { left= 391; }; + indicator "Scroll Lock" { left= 416; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 366; text="Num\nLock"; }; + text "CapsLockLabel" { left= 391; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; }; + + section.left= 5; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AE13>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 },<NFER>, + { <SPCE>, "SPCE", color="white" }, + <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 296; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 361; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "jp106" geometry + diff --git a/geometry/sgi.vndr/indigo b/geometry/sgi.vndr/indigo new file mode 100644 index 0000000..f7b7a68 --- /dev/null +++ b/geometry/sgi.vndr/indigo @@ -0,0 +1,413 @@ +// $Xorg: indigo,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 101-key keyboard"; + + width= 472; + height= 193; + + shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 19}, <FK02>, <FK03>, <FK04>, + { <FK05>, 11}, <FK06>, <FK07>, <FK08>, + { <FK09>, 11}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE",color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 377; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 386; }; + indicator "Caps Lock" { left= 411; }; + indicator "Scroll Lock" { left= 436; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 382.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 407; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 10}, <FK06>, <FK07>, <FK08>, + { <FK09>, 10}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color= "grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, + { <LALT>, 19 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, + { <RCTL>, 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/sgi.vndr/indy b/geometry/sgi.vndr/indy new file mode 100644 index 0000000..fc5d485 --- /dev/null +++ b/geometry/sgi.vndr/indy @@ -0,0 +1,601 @@ +// $Xorg: indy,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 101-key keyboard"; + + width= 472; + height= 193; + + shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 19}, <FK02>, <FK03>, <FK04>, + { <FK05>, 11}, <FK06>, <FK07>, <FK08>, + { <FK09>, 11}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE",color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 377; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 386; }; + indicator "Caps Lock" { left= 411; }; + indicator "Scroll Lock" { left= 436; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 382.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 407; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 10}, <FK06>, <FK07>, <FK08>, + { <FK09>, 10}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color= "grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, + { <LALT>, 19 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, + { <RCTL>, 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "jp106" { + description= "Silicon Graphics 106-key Japanese keyboard"; + width= 442; + height= 167; + + shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + logo "SGILogoImage" { + top= 5; + left= 6; + name= "SGI"; + shape= "LOGO"; + }; + + text "SGILogoText" { + top= 9; + left= 25; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 362; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 366; }; + indicator "Caps Lock" { left= 391; }; + indicator "Scroll Lock" { left= 416; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 366; text="Num\nLock"; }; + text "CapsLockLabel" { left= 391; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; }; + + section.left= 5; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AE13>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 },<NFER>, + { <SPCE>, "SPCE", color="white" }, + <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 296; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 361; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "jp106" geometry diff --git a/geometry/sony b/geometry/sony new file mode 100644 index 0000000..4e69f0e --- /dev/null +++ b/geometry/sony @@ -0,0 +1,180 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_geometry "nwp5461" { + + description= "Sony NEWS NWS-5000 Keyboard"; + width= 425; + height= 190; + + shape.cornerRadius= 1; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [28,18] }, { [2,1], [26,17] } }; + shape "TABK" { { [28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [28,18] }, { [2,1], [26,17] } }; + shape "RTRN" { + approx = { [15, 0], [33,37] }, + { [15, 0], [33, 0], [33,37], + [ 0,37], [ 0,19], [15,19] }, + { [17, 1], [31, 1], [31,36], + [ 2,36], [ 2,20], [17,20] } + }; + shape "SHFT" { { [42,18] }, { [2,1], [40,17] } }; + shape "MODK" { { [33,18] }, { [2,1], [31,17] } }; + shape "SPCE" { { [85,18] }, { [2,1], [83,17] } }; + shape "KPEN" { { [18,38] }, { [2,1], [16,37] } }; + shape "STOP" { { [28,18] }, { [2,1], [26,17] } }; + shape "CUT" { { [55,18] }, { [2,1], [53,17] } }; + shape "EXEC" { { [32,18] }, { [2,1], [30,17] } }; + shape "UNK" { { [18,18] }, { [2,1], [16,17] } }; + shape "CAPS" { { [18,18] }, { [2,1], [16,17] } }; + shape "FKEY" { { [23,18] }, { [2,1], [21,17] } }; + + section.left= 13; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 55; + row { + top= 1; + left= 37; + key.shape="FKEY"; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 5 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 5 }, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 80; + row { + top= 1; + keys { { <ESC>, color="grey20" } , + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, + <AE09>, <AE10>, <AE11>, <AE12>, + <BKSL>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <DELE>, color="grey20" }, + { <RTRN>, "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { { <LCTL>, "MODK", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <TLDE> + }; + }; + row { + top= 58; + keys { { <LFSH>, "SHFT", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, <AB11>, + { <RTSH>, "SHFT", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LALT>, { <CAPS>, "CAPS" }, + { <STOP>, "STOP", color="white" }, + { <SPCE>, "SPCE", color="white" }, + { <CUT>, "CUT", color="white" }, + { <UNK0>, "UNK" }, { <UNK1>, "UNK" }, + { <EXEC>, "EXEC" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 80; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <HELP> }; + }; + row { + top= 20; + keys { <INS> }; + }; + row { + top= 39; + keys { <CLR> }; + }; + row { + top= 58; + keys { <PGUP> }; + }; + row { + top= 77; + keys { <PGDN> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 334; + row { + top= 1; + key.color= "grey20"; + keys { { <KPMU>, 19 }, <KPDV>, <KPAD> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPSU>, color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, { <KPSP>, color="grey20" } }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN", color="grey20" } }; + }; + row { + top= 77; + keys { <KP0>, { <KPDC>, color="grey20" }, <UP> }; + }; + row { + top= 96; + key.color= "grey20"; + keys { <KPTB>, <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry diff --git a/geometry/sun b/geometry/sun new file mode 100644 index 0000000..1b8117a --- /dev/null +++ b/geometry/sun @@ -0,0 +1,1338 @@ +// $Xorg: sun,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/sun,v 1.6 2001/12/14 20:01:58 dawes Exp $ +// +xkb_geometry "type4" { + + // This is an approximate layout for a (US/ASCII) Sun Type4 US + // keyboard. + + description= "Sun Type4 keyboard"; + + width= 452; + height= 185; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "DELE" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <BKSL>, { <DELE>, "DELE" }, + { <PAUS>, 9 }, <PRSC>, <SCLK>, <NMLK> + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <ESC>, 9 }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, + { <BKSP>, "BKSP" }, + { <KPEQ>, 9 }, <KPDV>, <KPMU>, <KPSU> + + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, + { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" }, + { <KP7>, 9 }, <KP8>, <KP9>, { <KPAD>, "KPAD" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, + { <LCTL>, 9, shape="LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <TLDE>, + { <KP4>, 33 }, <KP5>, <KP6> + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, + { <LFSH>, 9 , shape="LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" }, <LNFD>, + { <KP1>, 9} , <KP2>, <KP3>, { <KPEN>, "KPAD" } + }; + }; + row { + top= 96; + keys { { <HELP>, "HELP" }, { <CAPS>, 9 }, + <LALT>, <LMTA>, { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR>, + { <KP0>, 9, shape="KP0" }, <KPDL> + }; + }; + }; // End of "Alpha" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "Scroll Lock" { left= 402; }; + indicator "Num Lock" { left= 421; }; + text.top= 34; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="Compose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; + +default xkb_geometry "type5" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + description= "Sun Type5 keyboard"; + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { <HELP>, "HELP" }, { <ESC>, 9 }, + { <FK01>, 19 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 9 }, <SCLK>, <PAUS>, + { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <TLDE>, 9}, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, { <CAPS>, 9, shape="CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, { <LCTL>, 9, shape="LCTL" }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "type5euro" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + description= "Sun Type5 keyboard"; + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [22,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { <HELP>, "HELP" }, { <ESC>, 9 }, + { <FK01>, 19 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 9 }, <SCLK>, <PAUS>, + { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <TLDE>, 9}, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, { <CAPS>, 9, shape="CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, { <LCTL>, 9, shape="LCTL" }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; + + +xkb_geometry "type5unix" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + description= "Sun Type5 Unix keyboard"; + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { <HELP>, "HELP" }, { <NONE>, 9 }, + { <FK01>, 19 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 9 }, <SCLK>, <PAUS>, + { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <ESC>, 9}, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + <BKSL>, <TLDE> + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, { <LCTL>, 9, shape="LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, { <CAPS>, 9, shape="CAPS" }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "type5_se" { + + // kbd: type = 4, layout = 43 + + description= "Sun Type5 keyboard (Sweden)"; + + width= 510; + height= 170; + + baseColor= "grey"; + labelColor= "black"; + + shape.cornerRadius= 1; + + shape "EDGE" { cornerRadius= 2, { [ 510, 170 ] } }; + shape "LOGO" { cornerRadius= 2, + { [ 0, 8], [ 8, 16], [ 16, 8], [ 8, 0] } + }; + + shape "NORM" { { [ 18, 18] }, { [ 2, 1], [ 16, 17] } }; + shape "BKSP" { { [ 38, 18] }, { [ 2, 1], [ 36, 17] } }; + shape "TABK" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } }; + shape "RTRN" { + { [ 0, 0], [ 29, 0], [ 29, 37], [ 5, 37], [ 5, 18], [ 0, 18] }, + { [ 2, 1], [ 27, 1], [ 27, 36], [ 7, 36], [ 7, 17], [ 2, 17] } + }; + shape "CAPS" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "LFSH" { { [ 24, 18] }, { [ 2, 1], [ 22, 17 ] } }; + shape "RTSH" { { [ 51, 18] }, { [ 2, 1], [ 49, 17 ] } }; + shape "LCTL" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "MODK" { { [ 28, 18] }, { [ 2, 1], [ 26, 17 ] } }; + shape "SPCE" { { [157, 18] }, { [ 2, 1], [155, 17 ] } }; + shape "KP0" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + shape "KPAD" { { [ 18, 37] }, { [ 2, 1], [ 16, 36 ] } }; + shape "HELP" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + + section "Function" { + key.color= "grey10"; + priority= 1; + top= 24; + left= 14; + width= 481; + height= 19; + row { + top= 1; + left= 1; + keys { + { <HELP>, "HELP", 1 }, { <ESC>, "NORM", 9 }, + { <FK01>, "NORM", 19 }, { <FK02>, "NORM", 1 }, + { <FK03>, "NORM", 1 }, { <FK04>, "NORM", 1 }, + { <FK05>, "NORM", 11 }, { <FK06>, "NORM", 1 }, + { <FK07>, "NORM", 1 }, { <FK08>, "NORM", 1 }, + { <FK09>, "NORM", 11 }, { <FK10>, "NORM", 1 }, + { <FK11>, "NORM", 1 }, { <FK12>, "NORM", 1 }, + { <PRSC>, "NORM", 9 }, { <SCLK>, "NORM", 1 }, + { <PAUS>, "NORM", 1 }, { <MUTE>, "NORM", 11 }, + { <VOL->, "NORM", 1 }, { <VOL+>, "NORM", 1 }, + { <POWR>, "NORM", 1, color= "white" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + key.color= "white"; + priority= 2; + top= 61; + left= 14; + width= 333; + height= 95; + row { + top= 1; + left= 1; + keys { + { <STOP>, "NORM", 1, color= "grey10" }, + { <AGAI>, "NORM", 1, color= "grey10" }, + { <TLDE>, "NORM", 9 }, { <AE01>, "NORM", 1 }, + { <AE02>, "NORM", 1 }, { <AE03>, "NORM", 1 }, + { <AE04>, "NORM", 1 }, { <AE05>, "NORM", 1 }, + { <AE06>, "NORM", 1 }, { <AE07>, "NORM", 1 }, + { <AE08>, "NORM", 1 }, { <AE09>, "NORM", 1 }, + { <AE10>, "NORM", 1 }, { <AE11>, "NORM", 1 }, + { <AE12>, "NORM", 1 }, + { <BKSP>, "BKSP", 1, color="grey10" } + }; + }; + row { + top= 20; + left= 1; + keys { + { <PROP>, "NORM", 1, color= "grey10" }, + { <UNDO>, "NORM", 1, color= "grey10" }, + { <TAB>, "TABK", 9, color= "grey10" }, + { <AD01>, "NORM", 1 }, + { <AD02>, "NORM", 1 }, { <AD03>, "NORM", 1 }, + { <AD04>, "NORM", 1 }, { <AD05>, "NORM", 1 }, + { <AD06>, "NORM", 1 }, { <AD07>, "NORM", 1 }, + { <AD08>, "NORM", 1 }, { <AD09>, "NORM", 1 }, + { <AD10>, "NORM", 1 }, { <AD11>, "NORM", 1 }, + { <AD12>, "NORM", 1 }, + { <RTRN>, "RTRN", 1, color= "grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <FRNT>, "NORM", 1, color= "grey10" }, + { <COPY>, "NORM", 1, color= "grey10" }, + { <CAPS>, "CAPS", 9, color= "grey10" }, + { <AC01>, "NORM", 1 }, + { <AC02>, "NORM", 1 }, { <AC03>, "NORM", 1 }, + { <AC04>, "NORM", 1 }, { <AC05>, "NORM", 1 }, + { <AC06>, "NORM", 1 }, { <AC07>, "NORM", 1 }, + { <AC08>, "NORM", 1 }, { <AC09>, "NORM", 1 }, + { <AC10>, "NORM", 1 }, { <AC11>, "NORM", 1 }, + { <AC12>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <OPEN>, "NORM", 1, color= "grey10" }, + { <PAST>, "NORM", 1, color= "grey10" }, + { <LFSH>, "LFSH", 9, color= "grey10" }, + { <AB00>, "NORM", 1 }, { <AB01>, "NORM", 1 }, + { <AB02>, "NORM", 1 }, { <AB03>, "NORM", 1 }, + { <AB04>, "NORM", 1 }, { <AB05>, "NORM", 1 }, + { <AB06>, "NORM", 1 }, { <AB07>, "NORM", 1 }, + { <AB08>, "NORM", 1 }, { <AB09>, "NORM", 1 }, + { <AB10>, "NORM", 1 }, + { <RTSH>, "RTSH", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + key.color= "grey10"; + keys { + { <FIND>, "NORM", 1 }, { <CUT>, "NORM", 1 }, + { <LCTL>, "LCTL", 9 }, { <LALT>, "NORM", 1 }, + { <LMTA>, "NORM", 1 }, + { <SPCE>, "SPCE", 1, color= "white" }, + { <RMTA>, "NORM", 1 }, { <COMP>, "NORM", 1 }, + { <ALGR>, "NORM", 1 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + key.color= "grey10"; + priority= 3; + top= 61; + left= 352; + width= 58; + height= 95; + row { + top= 1; + left= 1; + keys { + { <INS>, "NORM", 1 }, { <HOME>, "NORM", 1 }, + { <PGUP>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <DELE>, "NORM", 1 }, { <END>, "NORM", 1 }, + { <PGDN>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 20; + keys { + { <UP>, "NORM", 1 } + }; + }; + row { + top= 77; + left= 1; + keys { + { <LEFT>, "NORM", 1 }, { <DOWN>, "NORM", 1 }, + { <RGHT>, "NORM", 1 } + }; + }; + }; // End of "Editing" section + + section "Keypad" { + key.color= "white"; + priority= 4; + top= 61; + left= 420; + width= 77; + height= 95; + row { + top= 1; + left= 1; + key.color= "grey10"; + keys { + { <NMLK>, "NORM", 1 }, { <KPDV>, "NORM", 1 }, + { <KPMU>, "NORM", 1 }, { <KPSU>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <KP7>, "NORM", 1 }, { <KP8>, "NORM", 1 }, + { <KP9>, "NORM", 1 }, + { <KPAD>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <KP4>, "NORM", 1 }, { <KP5>, "NORM", 1 }, + { <KP6>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <KP1>, "NORM", 1 }, { <KP2>, "NORM", 1 }, + { <KP3>, "NORM", 1 }, + { <KPEN>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + keys { + { <KP0>, "KP0", 1 }, { <KPDL>, "NORM", 1 } + }; + }; + }; // End of "Keypad" section + + outline "Edges" { + top= 0; + left= 0; + priority= 0; + shape= "EDGE"; + }; + + solid "Logos" { + color= "blue"; + top= 5; + left= 25; + priority= 0; + shape= "LOGO"; + }; + + logo "SUNLogoImage" { + top= 5; + left= 25; + name= "SUN"; + priority= 1; + shape= "LOGO"; + }; + + shape "LED" { cornerRadius= 1, + { [ 0, 1.5], [ 1.5, 3], [ 3, 1.5], [ 1.5, 0] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 75; top= 103; priority= 5; }; + indicator "Compose" { left= 314; top= 142; priority= 5; }; + indicator "Scroll Lock" { left= 378; top= 29; }; + indicator "Num Lock" { left= 426; top= 66; }; +}; + +xkb_geometry "type5c_se" { + + // kbd: type = 4, layout = 43 + + description= "Sun Type5c keyboard (Sweden)"; + + width= 510; + height= 170; + + baseColor= "grey"; + labelColor= "black"; + + shape.cornerRadius= 1; + + shape "EDGE" { cornerRadius= 2, { [ 510, 170 ] } }; + shape "LOGO" { cornerRadius= 2, + { [ 0, 8], [ 8, 16], [ 16, 8], [ 8, 0] } + }; + + shape "NORM" { { [ 18, 18] }, { [ 2, 1], [ 16, 17] } }; + shape "BKSP" { { [ 38, 18] }, { [ 2, 1], [ 36, 17] } }; + shape "TABK" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } }; + shape "META" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } }; + shape "RTRN" { + { [ 0, 0], [ 29, 0], [ 29, 37], [ 5, 37], [ 5, 18], [ 0, 18] }, + { [ 2, 1], [ 27, 1], [ 27, 36], [ 7, 36], [ 7, 17], [ 2, 17] } + }; + shape "CAPS" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "LFSH" { { [ 24, 18] }, { [ 2, 1], [ 22, 17 ] } }; + shape "RTSH" { { [ 51, 18] }, { [ 2, 1], [ 49, 17 ] } }; + shape "LCTL" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "MODK" { { [ 28, 18] }, { [ 2, 1], [ 26, 17 ] } }; + shape "SPCE" { { [139, 18] }, { [ 2, 1], [137, 17 ] } }; + shape "KP0" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + shape "KPAD" { { [ 18, 37] }, { [ 2, 1], [ 16, 36 ] } }; + shape "HELP" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + + section "Function" { + key.color= "grey10"; + priority= 1; + top= 24; + left= 14; + width= 481; + height= 19; + row { + top= 1; + left= 1; + keys { + { <HELP>, "HELP", 1 }, { <ESC>, "NORM", 9 }, + { <FK01>, "NORM", 19 }, { <FK02>, "NORM", 1 }, + { <FK03>, "NORM", 1 }, { <FK04>, "NORM", 1 }, + { <FK05>, "NORM", 11 }, { <FK06>, "NORM", 1 }, + { <FK07>, "NORM", 1 }, { <FK08>, "NORM", 1 }, + { <FK09>, "NORM", 11 }, { <FK10>, "NORM", 1 }, + { <FK11>, "NORM", 1 }, { <FK12>, "NORM", 1 }, + { <PRSC>, "NORM", 9 }, { <SCLK>, "NORM", 1 }, + { <PAUS>, "NORM", 1 }, { <MUTE>, "NORM", 11 }, + { <VOL->, "NORM", 1 }, { <VOL+>, "NORM", 1 }, + { <POWR>, "NORM", 1, color= "white" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + key.color= "white"; + priority= 2; + top= 61; + left= 14; + width= 333; + height= 95; + row { + top= 1; + left= 1; + keys { + { <STOP>, "NORM", 1, color= "grey10" }, + { <AGAI>, "NORM", 1, color= "grey10" }, + { <TLDE>, "NORM", 9 }, { <AE01>, "NORM", 1 }, + { <AE02>, "NORM", 1 }, { <AE03>, "NORM", 1 }, + { <AE04>, "NORM", 1 }, { <AE05>, "NORM", 1 }, + { <AE06>, "NORM", 1 }, { <AE07>, "NORM", 1 }, + { <AE08>, "NORM", 1 }, { <AE09>, "NORM", 1 }, + { <AE10>, "NORM", 1 }, { <AE11>, "NORM", 1 }, + { <AE12>, "NORM", 1 }, + { <BKSP>, "BKSP", 1, color="grey10" } + }; + }; + row { + top= 20; + left= 1; + keys { + { <PROP>, "NORM", 1, color= "grey10" }, + { <UNDO>, "NORM", 1, color= "grey10" }, + { <TAB>, "TABK", 9, color= "grey10" }, + { <AD01>, "NORM", 1 }, + { <AD02>, "NORM", 1 }, { <AD03>, "NORM", 1 }, + { <AD04>, "NORM", 1 }, { <AD05>, "NORM", 1 }, + { <AD06>, "NORM", 1 }, { <AD07>, "NORM", 1 }, + { <AD08>, "NORM", 1 }, { <AD09>, "NORM", 1 }, + { <AD10>, "NORM", 1 }, { <AD11>, "NORM", 1 }, + { <AD12>, "NORM", 1 }, + { <RTRN>, "RTRN", 1, color= "grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <FRNT>, "NORM", 1, color= "grey10" }, + { <COPY>, "NORM", 1, color= "grey10" }, + { <CAPS>, "CAPS", 9, color= "grey10" }, + { <AC01>, "NORM", 1 }, + { <AC02>, "NORM", 1 }, { <AC03>, "NORM", 1 }, + { <AC04>, "NORM", 1 }, { <AC05>, "NORM", 1 }, + { <AC06>, "NORM", 1 }, { <AC07>, "NORM", 1 }, + { <AC08>, "NORM", 1 }, { <AC09>, "NORM", 1 }, + { <AC10>, "NORM", 1 }, { <AC11>, "NORM", 1 }, + { <AC12>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <OPEN>, "NORM", 1, color= "grey10" }, + { <PAST>, "NORM", 1, color= "grey10" }, + { <LFSH>, "LFSH", 9, color= "grey10" }, + { <AB00>, "NORM", 1 }, { <AB01>, "NORM", 1 }, + { <AB02>, "NORM", 1 }, { <AB03>, "NORM", 1 }, + { <AB04>, "NORM", 1 }, { <AB05>, "NORM", 1 }, + { <AB06>, "NORM", 1 }, { <AB07>, "NORM", 1 }, + { <AB08>, "NORM", 1 }, { <AB09>, "NORM", 1 }, + { <AB10>, "NORM", 1 }, + { <RTSH>, "RTSH", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + key.color= "grey10"; + keys { + { <FIND>, "NORM", 1 }, { <CUT>, "NORM", 1 }, + { <LCTL>, "LCTL", 9 }, { <LALT>, "NORM", 1 }, + { <LMTA>, "META", 1 }, + { <SPCE>, "SPCE", 1, color= "white" }, + { <RMTA>, "META", 1 }, { <COMP>, "NORM", 1 }, + { <ALGR>, "NORM", 1 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + key.color= "grey10"; + priority= 3; + top= 61; + left= 352; + width= 58; + height= 95; + row { + top= 1; + left= 1; + keys { + { <INS>, "NORM", 1 }, { <HOME>, "NORM", 1 }, + { <PGUP>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <DELE>, "NORM", 1 }, { <END>, "NORM", 1 }, + { <PGDN>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 20; + keys { + { <UP>, "NORM", 1 } + }; + }; + row { + top= 77; + left= 1; + keys { + { <LEFT>, "NORM", 1 }, { <DOWN>, "NORM", 1 }, + { <RGHT>, "NORM", 1 } + }; + }; + }; // End of "Editing" section + + section "Keypad" { + key.color= "white"; + priority= 4; + top= 61; + left= 420; + width= 77; + height= 95; + row { + top= 1; + left= 1; + key.color= "grey10"; + keys { + { <NMLK>, "NORM", 1 }, { <KPDV>, "NORM", 1 }, + { <KPMU>, "NORM", 1 }, { <KPSU>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <KP7>, "NORM", 1 }, { <KP8>, "NORM", 1 }, + { <KP9>, "NORM", 1 }, + { <KPAD>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <KP4>, "NORM", 1 }, { <KP5>, "NORM", 1 }, + { <KP6>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <KP1>, "NORM", 1 }, { <KP2>, "NORM", 1 }, + { <KP3>, "NORM", 1 }, + { <KPEN>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + keys { + { <KP0>, "KP0", 1 }, { <KPDL>, "NORM", 1 } + }; + }; + }; // End of "Keypad" section + + outline "Edges" { + top= 0; + left= 0; + priority= 0; + shape= "EDGE"; + }; + + solid "Logos" { + color= "blue"; + top= 5; + left= 15; + priority= 0; + shape= "LOGO"; + }; + + logo "SUNLogoImage" { + top= 5; + left= 15; + name= "SUN"; + priority= 1; + shape= "LOGO"; + }; + + text.font= "charter"; + text.weight= "medium"; + text.slant= "i"; + text.fontSize= 40; + text "SunLogoText" { + top= 5; + left= 32; + color= "blue"; + text= "Sun"; + }; + + shape "LED" { cornerRadius= 1, + { [ 0, 1.5], [ 1.5, 3], [ 3, 1.5], [ 1.5, 0] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 75; top= 103; priority= 5; }; + indicator "Compose" { left= 314; top= 142; priority= 5; }; + indicator "Scroll Lock" { left= 378; top= 29; }; + indicator "Num Lock" { left= 426; top= 66; }; +}; + +xkb_geometry "type4_se" { + + // kbd: type = 4, layout = 11 + + description= "Sun Type4 keyboard (Sweden)"; + + + width= 453; + height= 183; + + baseColor= "grey"; + labelColor= "black"; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "DELE" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + key.color= "grey10"; + keys { <STOP>, <AGAI>, { <FK01>, 9 }, + <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + { <AF13>, color= "white"}, + { <AF14>, color= "white"}, + <DELE>, { <PAUS>, 9 }, + <PRSC>, <SCLK>, <NMLK> + }; + }; + row { + top= 20; + key.color= "white"; + keys { + { <PROP>, color= "grey10" }, + { <UNDO>, color= "grey10" }, + { <ESC>, 9, color= "grey10" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey10" }, + { <KPEQ>, 9, color= "grey10" }, + { <KPDV>, color= "grey10" }, + { <KPMU>, color= "grey10" }, + { <KPSU>, color= "grey10" } + }; + }; + row { + top= 39; + key.color= "white"; + keys { + { <FRNT>, color= "grey10" }, + { <COPY>, color= "grey10" }, + { <TAB>, 9, "TABK", color= "grey10" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey10" }, + { <KP7>, 9, color= "grey10" }, + { <KP8>, color= "grey10" }, + { <KP9>, color= "grey10" }, + { <KPAD>, "KPAD", color= "grey10" } + }; + }; + row { + top= 58; + key.color= "white"; + keys { + { <OPEN>, color= "grey10" }, + { <PAST>, color= "grey10" }, + { <CAPS>, 9, "LCTL", color= "grey10" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12>, + { <KP4>, 33, color= "grey10" }, + { <KP5>, color= "grey10" }, + { <KP6>, color= "grey10" } + }; + }; + row { + top= 77; + key.color= "white"; + keys { + { <FIND>, color= "grey10" }, + { <CUT>, color= "grey10" }, + { <LFSH>, 9 , "LFSH", color= "grey10" }, + <AB00>, <AB01>, <AB02>, <AB03>, + <AB04>, <AB05>, <AB06>, <AB07>, + <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey10" }, + { <LNFD>, color= "grey10" }, + { <KP1>, 9, color= "grey10" }, + { <KP2>, color= "grey10" }, + { <KP3>, color= "grey10" }, + { <KPEN>, "KPAD", color= "grey10" } + }; + }; + row { + top= 96; + key.color= "grey10"; + keys { + { <HELP>, "HELP" }, { <LCTL>, 9 }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE", color= "white" }, + <RMTA>, <COMP>, <ALGR>, + { <KP0>, 9, "KP0" }, <KPDL> + }; + }; + }; // End of "Alpha" section + + shape "RIDGE" { cornerRadius= 1, { [ 0, 1], [ 1, 0 ], + [330, 0], [331, 1], + [330, 2], [ 1, 2] } }; + solid "Ridge" { + shape= "RIDGE"; + top= 48; + left= 18; + }; + + shape "LEDS" { cornerRadius= 1, { [ 75 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + outline "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "Scroll Lock" { left= 402; }; + indicator "Num Lock" { left= 421; }; + text.top= 32; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="\nCompose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; diff --git a/geometry/winbook b/geometry/winbook new file mode 100644 index 0000000..e4de478 --- /dev/null +++ b/geometry/winbook @@ -0,0 +1,144 @@ +// $Xorg: winbook,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +default xkb_geometry "XP5" { + + description= "WinBook XP5"; + width= 281; + height= 180; + + shape.cornerRadius= 1; + + shape "NORM" { + { [17,17] }, + { [ 2, 1], [ 15, 15 ] } + }; + shape "FKEY" { + { [ 15, 10 ] }, + { [ 1, 0 ], [ 14, 9.5 ] } + }; + shape "ONE" { + { [ 28, 17 ] }, + { [ 11, 0 ], [ 28, 17 ] }, + { [ 13, 1 ], [ 26, 15 ] } + }; + shape "WIDE" { // backspace, caps lock, ctrl alt ? + { [ 24.5, 17 ] }, + { [ 2, 1 ], [ 22.5, 15 ] } + }; + shape "WIDR" { // backslash, left shift + { [ 35, 17 ] }, + { [ 2, 1 ], [ 33, 15 ] } + }; + shape "RTRN" { + { [ 45, 17 ] }, + { [ 2, 1 ], [ 43, 15 ] } + }; + shape "SPCE" { + { [ 90, 17 ] }, + { [ 2, 1 ], [ 88, 15 ] } + }; + shape "STIK" { + cornerRadius= 4, + { [ 8, 8 ] } + }; + shape "BTN" { + { [ 31, 6 ] } + }; + + section.left= 2; + row.left= 1; + key.shape= "NORM"; + key.gap= 0.5; + + key.color= "grey10"; + labelColor= "white"; + baseColor= "grey20"; + + section "Whole" { + top= 10; + row { + top= 11; + key.shape= "FKEY"; + keys { + <ESC>, + <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, <FK06>, + <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12>, + <PAUS>, <HOME>, <END>, <PGUP> + }; + }; + row { + top= 22; + keys { + { <AEO1>, "ONE" }, + <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, shape="WIDE" }, + <PGDN> + }; + }; + row { + top= 40; + keys { + <TAB>, <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "WIDR" } + }; + }; + row { + top= 58; + keys { { <CAPS>, shape="WIDE" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, shape="RTRN" } + }; + }; + row { + top= 76; + keys { + { <LFSH>, shape="WIDR" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <RTSH>, <UP>, <NMLK> + }; + }; + row { + top= 94; + keys { + { <LCTL>, "WIDE" }, <FUNC>, { <LALT>, "WIDE" }, + <TLDE>, { <SPCE>, shape="SPCE" }, <INS>, <DELE>, + <LEFT>, <DOWN>, <RGHT> + }; + }; + overlay "KPAD" { + <AE07>=<KP7>, <AE08>=<KP8>, <AE09>=<KP9>, <AE10>=<KPMU>, + <AD07>=<KP4>, <AD08>=<KP5>, <AD09>=<KP6>, <AD10>=<KPSU>, + <AC07>=<KP1>, <AC08>=<KP2>, <AC09>=<KP3>, <AC10>=<KPAD>, + <AB07>=<KP0>, <AB09>=<KPDL>, <AB10>=<KPSL> + }; + }; // End of "Whole" section + + solid "STIK" { + color= "red"; + shape= "STIK"; + top= 81; + left= 112; + }; + + solid "BTN1" { + color= "red"; + shape= "BTN"; + top= 137; + left= 93; + }; + + solid "BTN2" { + color= "red"; + shape= "BTN"; + top= 137; + left= 127; + }; + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; diff --git a/keycodes/README b/keycodes/README new file mode 100644 index 0000000..b0ca78a --- /dev/null +++ b/keycodes/README @@ -0,0 +1,10 @@ +The keycodes component of a keyboard mapping specifies the range and +interpretation of the raw keycodes reported by the device. It sets the keycodes +symbolic name, the minimum and maximum legal codes for the keyboard, and the +symbolic name for each key. The keycodes component might also contain aliases +for some keys, symbolic names for some indicators and a description of which +indicators are physically present. + + + +/* $XFree86$ */ diff --git a/keycodes/aliases b/keycodes/aliases new file mode 100644 index 0000000..7cfc25b --- /dev/null +++ b/keycodes/aliases @@ -0,0 +1,101 @@ + +// keycode aliases for phonetic keyboard maps +// +// $XFree86$ + +default +xkb_keycodes "qwerty" { + + alias <LatQ> = <AD01>; + alias <LatW> = <AD02>; + alias <LatE> = <AD03>; + alias <LatR> = <AD04>; + alias <LatT> = <AD05>; + alias <LatY> = <AD06>; + alias <LatU> = <AD07>; + alias <LatI> = <AD08>; + alias <LatO> = <AD09>; + alias <LatP> = <AD10>; + + alias <LatA> = <AC01>; + alias <LatS> = <AC02>; + alias <LatD> = <AC03>; + alias <LatF> = <AC04>; + alias <LatG> = <AC05>; + alias <LatH> = <AC06>; + alias <LatJ> = <AC07>; + alias <LatK> = <AC08>; + alias <LatL> = <AC09>; + + alias <LatZ> = <AB01>; + alias <LatX> = <AB02>; + alias <LatC> = <AB03>; + alias <LatV> = <AB04>; + alias <LatB> = <AB05>; + alias <LatN> = <AB06>; + alias <LatM> = <AB07>; +}; + +xkb_keycodes "azerty" { + + alias <LatA> = <AD01>; + alias <LatZ> = <AD02>; + alias <LatE> = <AD03>; + alias <LatR> = <AD04>; + alias <LatT> = <AD05>; + alias <LatY> = <AD06>; + alias <LatU> = <AD07>; + alias <LatI> = <AD08>; + alias <LatO> = <AD09>; + alias <LatP> = <AD10>; + + alias <LatQ> = <AC01>; + alias <LatS> = <AC02>; + alias <LatD> = <AC03>; + alias <LatF> = <AC04>; + alias <LatG> = <AC05>; + alias <LatH> = <AC06>; + alias <LatJ> = <AC07>; + alias <LatK> = <AC08>; + alias <LatL> = <AC09>; + alias <LatM> = <AC10>; + + alias <LatW> = <AB01>; + alias <LatX> = <AB02>; + alias <LatC> = <AB03>; + alias <LatV> = <AB04>; + alias <LatB> = <AB05>; + alias <LatN> = <AB06>; +}; + +xkb_keycodes "qwertz" { + + alias <LatQ> = <AD01>; + alias <LatW> = <AD02>; + alias <LatE> = <AD03>; + alias <LatR> = <AD04>; + alias <LatT> = <AD05>; + alias <LatZ> = <AD06>; + alias <LatU> = <AD07>; + alias <LatI> = <AD08>; + alias <LatO> = <AD09>; + alias <LatP> = <AD10>; + + alias <LatA> = <AC01>; + alias <LatS> = <AC02>; + alias <LatD> = <AC03>; + alias <LatF> = <AC04>; + alias <LatG> = <AC05>; + alias <LatH> = <AC06>; + alias <LatJ> = <AC07>; + alias <LatK> = <AC08>; + alias <LatL> = <AC09>; + + alias <LatY> = <AB01>; + alias <LatX> = <AB02>; + alias <LatC> = <AB03>; + alias <LatV> = <AB04>; + alias <LatB> = <AB05>; + alias <LatN> = <AB06>; + alias <LatM> = <AB07>; +}; diff --git a/keycodes/amiga b/keycodes/amiga new file mode 100644 index 0000000..7b661a5 --- /dev/null +++ b/keycodes/amiga @@ -0,0 +1,231 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/keycodes/amiga,v 3.2 1997/10/26 13:25:35 dawes Exp $ + +default xkb_keycodes "usa1" { + + minimum= 8; + maximum= 111; + + <ESC> = 77; + <FK01> = 88; + <FK02> = 89; + <FK03> = 90; + <FK04> = 91; + <FK05> = 92; + <FK06> = 93; + <FK07> = 94; + <FK08> = 95; + <FK09> = 96; + <FK10> = 97; + + <TLDE> = 8; + <AE01> = 9; + <AE02> = 10; + <AE03> = 11; + <AE04> = 12; + <AE05> = 13; + <AE06> = 14; + <AE07> = 15; + <AE08> = 16; + <AE09> = 17; + <AE10> = 18; + <AE11> = 19; + <AE12> = 20; + <BKSL> = 21; + <BKSP> = 73; + + <TAB> = 74; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 76; + + <LCTL> = 107; + <CAPS> = 106; + <AC01> = 40; + <AC02> = 41; + <AC03> = 42; + <AC04> = 43; + <AC05> = 44; + <AC06> = 45; + <AC07> = 46; + <AC08> = 47; + <AC09> = 48; + <AC10> = 49; + <AC11> = 50; + + <LFSH> = 104; + <AB01> = 57; + <AB02> = 58; + <AB03> = 59; + <AB04> = 60; + <AB05> = 61; + <AB06> = 62; + <AB07> = 63; + <AB08> = 64; + <AB09> = 65; + <AB10> = 66; + <RTSH> = 105; + + <LALT> = 108; + <LAMI> = 110; + <SPCE> = 72; + <RAMI> = 111; + <RALT> = 109; + + <DELE> = 78; + <HELP> = 103; + <UP> = 84; + <LEFT> = 87; + <DOWN> = 85; + <RGHT> = 86; + + <KPLP> = 98; + <KPRP> = 99; + <KPDV> = 100; + <KPMU> = 101; + + <KP7> = 69; + <KP8> = 70; + <KP9> = 71; + <KPSU> = 82; + + <KP4> = 53; + <KP5> = 54; + <KP6> = 55; + <KPAD> = 102; + + <KP1> = 37; + <KP2> = 38; + <KP3> = 39; + + <KP0> = 23; + <KPDC> = 68; + <KPEN> = 75; +}; + +xkb_keycodes "de" { + + minimum= 8; + maximum= 111; + + <ESC> = 77; + <FK01> = 88; + <FK02> = 89; + <FK03> = 90; + <FK04> = 91; + <FK05> = 92; + <FK06> = 93; + <FK07> = 94; + <FK08> = 95; + <FK09> = 96; + <FK10> = 97; + + <TLDE> = 8; + <AE01> = 9; + <AE02> = 10; + <AE03> = 11; + <AE04> = 12; + <AE05> = 13; + <AE06> = 14; + <AE07> = 15; + <AE08> = 16; + <AE09> = 17; + <AE10> = 18; + <AE11> = 19; + <AE12> = 20; + <BKSL> = 21; + <BKSP> = 73; + + <TAB> = 74; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 76; + + <LCTL> = 107; + <CAPS> = 106; + <AC01> = 40; + <AC02> = 41; + <AC03> = 42; + <AC04> = 43; + <AC05> = 44; + <AC06> = 45; + <AC07> = 46; + <AC08> = 47; + <AC09> = 48; + <AC10> = 49; + <AC11> = 50; + <AC12> = 51; + + <LFSH> = 104; + <LSGT> = 56; + <AB01> = 57; + <AB02> = 58; + <AB03> = 59; + <AB04> = 60; + <AB05> = 61; + <AB06> = 62; + <AB07> = 63; + <AB08> = 64; + <AB09> = 65; + <AB10> = 66; + <RTSH> = 105; + + <LALT> = 108; + <LAMI> = 110; + <SPCE> = 72; + <RAMI> = 111; + <RALT> = 109; + + <DELE> = 78; + <HELP> = 103; + <UP> = 84; + <LEFT> = 87; + <DOWN> = 85; + <RGHT> = 86; + + <KPLP> = 98; + <KPRP> = 99; + <KPDV> = 100; + <KPMU> = 101; + + <KP7> = 69; + <KP8> = 70; + <KP9> = 71; + <KPSU> = 82; + + <KP4> = 53; + <KP5> = 54; + <KP6> = 55; + <KPAD> = 102; + + <KP1> = 37; + <KP2> = 38; + <KP3> = 39; + + <KP0> = 23; + <KPDC> = 68; + <KPEN> = 75; +}; diff --git a/keycodes/ataritt b/keycodes/ataritt new file mode 100644 index 0000000..3cfd503 --- /dev/null +++ b/keycodes/ataritt @@ -0,0 +1,123 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/keycodes/ataritt,v 3.1 1997/10/26 13:25:35 dawes Exp $ + +default xkb_keycodes "us" { + + minimum= 8; + maximum= 134; + + <ESC> = 9; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <TLDE> = 49; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + <DELE> = 91; + + <LCTL> = 37; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + <BKSL> = 51; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + + <ALT> = 64; + <SPCE> = 65; + <CAPS> = 66; + + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + + <HELP> = 106; + <UNDO> = 105; + <INS> = 90; + <HOME> = 79; + <UP> = 80; + <LEFT> = 83; + <DOWN> = 88; + <RGHT> = 85; + + <KPLP> = 107; + <KPRP> = 108; + <KPDV> = 109; + <KPMU> = 110; + + <KP7> = 111; + <KP8> = 112; + <KP9> = 113; + <KPSU> = 82; + + <KP4> = 114; + <KP5> = 115; + <KP6> = 116; + <KPAD> = 86; + + <KP1> = 117; + <KP2> = 118; + <KP3> = 119; + + <KP0> = 120; + <KPDC> = 121; + <KPEN> = 122; +}; + +xkb_keycodes "de" { + include "ataritt(us)" + + <LSGT> = 104; +}; diff --git a/keycodes/digital.vndr/lk b/keycodes/digital.vndr/lk new file mode 100644 index 0000000..2d8c584 --- /dev/null +++ b/keycodes/digital.vndr/lk @@ -0,0 +1,271 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:38 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:13:22 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/07 17:40:34 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:25 William_Walker] +// +// Revision 1.1.2.4 1995/08/05 15:25:55 William_Walker +// Upgrade to XKB protocol 0.62 +// [1995/08/05 14:39:58 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:31 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:24:04 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:28 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:07:29 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk Revision: /main/3 (DEC) Date: 1996/01/24 12:13:31 +// +xkb_keycodes "lk_common" { + // "Function" keys + <FK01> = 86; + <FK02> = 87; + <FK03> = 88; + <FK04> = 89; + <FK05> = 90; + <FK06> = 100; + <FK07> = 101; + <FK08> = 102; + <FK09> = 103; + <FK10> = 104; + <FK11> = 113; + <FK12> = 114; + + <UP> = 170; + <LEFT> = 167; + <DOWN> = 169; + <RGHT> = 168; + + // "Keypad" keys + <KP7> = 157; + <KP8> = 158; + <KP9> = 159; + <KP4> = 153; + <KP5> = 154; + <KP6> = 155; + <KP1> = 150; + <KP2> = 151; + <KP3> = 152; + <KPEN> = 149; + <KP0> = 146; + <KPDL> = 148; + + // "Alphanumeric" keys + <AE00> = 191; + <AE01> = 192; + <AE02> = 197; + <AE03> = 203; + <AE04> = 208; + <AE05> = 214; + <AE06> = 219; + <AE07> = 224; + <AE08> = 229; + <AE09> = 234; + <AE10> = 239; + <AE11> = 249; + <AE12> = 245; + <BKSP> = 188; + + <TAB> = 190; + <AD01> = 193; + <AD02> = 198; + <AD03> = 204; + <AD04> = 209; + <AD05> = 215; + <AD06> = 220; + <AD07> = 225; + <AD08> = 230; + <AD09> = 235; + <AD10> = 240; + <AD11> = 250; + <AD12> = 246; + <RTRN> = 189; + + <LCTL> = 175; + <CAPS> = 176; + <AC01> = 194; + <AC02> = 199; + <AC03> = 205; + <AC04> = 210; + <AC05> = 216; + <AC06> = 221; + <AC07> = 226; + <AC08> = 231; + <AC09> = 236; + <AC10> = 242; + <AC11> = 251; + + <LFSH> = 174; + <AB01> = 195; + <AB02> = 200; + <AB03> = 206; + <AB04> = 211; + <AB05> = 217; + <AB06> = 222; + <AB07> = 227; + <AB08> = 232; + <AB09> = 237; + <AB10> = 243; + <RTSH> = 171; + + <SPCE> = 212; + + <LDM> = 255; // Support R5 Lock Down Modifiers + + alias <TLDE> = <AE00>; +}; + +xkb_keycodes "lkx01" { + include "digital/lk(lk_common)" + <AB00> = 201; + <FK13> = 115; + <FK14> = 116; + <FK17> = 128; + <FK18> = 129; + <FK19> = 130; + <FK20> = 131; + <HELP> = 124; + <DO> = 125; + <FIND> = 138; + <INS> = 139; + <DELE> = 140; + <SELE> = 141; + <PGUP> = 142; + <PGDN> = 143; + <KPF1> = 161; + <KPF2> = 162; + <KPF3> = 163; + <KPF4> = 164; + <KPSU> = 160; + <KPCO> = 156; + <BKSL> = 247; + <LCMP> = 177; +}; + +xkb_keycodes "lk201" { + include "digital/lk(lkx01)" + indicator 4 = "Scroll Lock"; + indicator 3 = "Caps Lock"; + indicator 2 = "Compose"; + indicator 1 = "Wait"; +}; + +xkb_keycodes "lk421" { + include "digital/lk(lkx01)" + <LALT> = 172; + <RALT> = 178; + <RCMP> = 173; +}; + +xkb_keycodes "lk401" { + include "digital/lk(lk421)" + indicator 4 = "Scroll Lock"; + indicator 3 = "Caps Lock"; +}; + +xkb_keycodes "lk44x" { + include "digital/lk(lk_common)" + <ESC> = 85; + <PRSC> = 115; + <SCLK> = 116; + <PAUS> = 124; + <INS> = 138; + <HOME> = 139; + <PGUP> = 140; + <DELE> = 141; + <END> = 142; + <PGDN> = 143; + <NMLK> = 161; + <KPDV> = 162; + <KPMU> = 163; + <KPSU> = 164; + <KPAD> = 156; + <LALT> = 172; + <RALT> = 178; + <RCTL> = 173; +}; + +xkb_keycodes "lk443" { + include "digital/lk(lk44x)" + <BKSL> = 247; + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; + indicator 5 = "Num Lock"; +}; + +xkb_keycodes "lk444" { + include "digital/lk(lk44x)" + <BKSL> = 201; + <AC12> = 247; + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; + indicator 5 = "Num Lock"; +}; + +// LK201-LT = lk201 +// LK421-AJ = lk421 +AB11 +// LK421-JJ = lk421aj+MUHE+KANJ+HIRA +// LK401-AJ = lk401 +// LK401-BJ = lk401 +MUHE+KANJ+HIRA +// LK401-JJ = lk401bj+AB11 +// LK401-LT = lk401 +// LK441-LT = lk443 + +xkb_keycodes "lk421aj" { + include "digital/lk(lk421)" + <AB11> = 252; +}; + +xkb_keycodes "lk421jj" { + include "digital/lk(lk421aj)" + <MUHE> = 94; + <KANJ> = 95; + <HIRA> = 97; +}; + +xkb_keycodes "lk401bj" { + include "digital/lk(lk401)" + <MUHE> = 94; + <KANJ> = 95; + <HIRA> = 97; +}; + +xkb_keycodes "lk401jj" { + include "digital/lk(lk401bj)" + <AB11> = 252; +}; diff --git a/keycodes/digital.vndr/pc b/keycodes/digital.vndr/pc new file mode 100644 index 0000000..b0aebc3 --- /dev/null +++ b/keycodes/digital.vndr/pc @@ -0,0 +1,280 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:38 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:13:25 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.3 1995/10/25 21:00:14 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:21 William_Walker] +// +// Revision 1.1.6.2 1995/08/07 17:40:37 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:28 William_Walker] +// +// Revision 1.1.2.4 1995/08/05 15:25:56 William_Walker +// Upgrade to XKB protocol 0.62 +// [1995/08/05 14:40:02 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:32 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:24:07 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:31 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:07:34 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc Revision: /main/3 (DEC) Date: 1996/01/24 12:13:36 +// +xkb_keycodes "pc_common" { + // "Function" keys + <FK01> = 9; + <FK02> = 15; + <FK03> = 23; + <FK04> = 31; + <FK05> = 39; + <FK06> = 47; + <FK07> = 55; + <FK08> = 63; + <FK09> = 71; + <FK10> = 79; + <FK11> = 86; + <FK12> = 94; + + // "Editing" keys + + <UP> = 99; + <LEFT> = 97; + <DOWN> = 96; + <RGHT> = 106; + + // "Keypad" keys + <KP7> = 108; + <KP8> = 117; + <KP9> = 125; + + <KP4> = 107; + <KP5> = 115; + <KP6> = 116; + + <KP1> = 105; + <KP2> = 114; + <KP3> = 122; + <KPEN> = 121; + + <KP0> = 112; + <KPDL> = 113; + + // "Alphanumeric" keys + <AE01> = 22; + <AE02> = 30; + <AE03> = 38; + <AE04> = 37; + <AE05> = 46; + <AE06> = 54; + <AE07> = 61; + <AE08> = 62; + <AE09> = 70; + <AE10> = 69; + <AE11> = 78; + <AE12> = 85; + <BKSP> = 102; + + <TAB> = 13; + <AD01> = 21; + <AD02> = 29; + <AD03> = 36; + <AD04> = 45; + <AD05> = 44; + <AD06> = 53; + <AD07> = 60; + <AD08> = 67; + <AD09> = 68; + <AD10> = 77; + <AD11> = 84; + <AD12> = 91; + + <CAPS> = 20; + <AC01> = 28; + <AC02> = 27; + <AC03> = 35; + <AC04> = 43; + <AC05> = 52; + <AC06> = 51; + <AC07> = 59; + <AC08> = 66; + <AC09> = 75; + <AC10> = 76; + <AC11> = 82; + <RTRN> = 90; + + <LFSH> = 18; + <AB01> = 26; + <AB02> = 34; + <AB03> = 33; + <AB04> = 42; + <AB05> = 50; + <AB06> = 49; + <AB07> = 58; + <AB08> = 65; + <AB09> = 73; + <AB10> = 74; + <RTSH> = 89; + + <LCTL> = 17; + <LALT> = 25; + <SPCE> = 41; + <RALT> = 57; + + <LDM> = 255; // Support R5 Lock Down Modifiers + +}; + +xkb_keycodes "pc10x" { + include "digital/pc(pc_common)" + <ESC> = 8; + <AE00> = 14; + <PRSC> = 87; + <SCLK> = 95; + <PAUS> = 98; + <INS> = 103; + <HOME> = 110; + <PGUP> = 111; + <DELE> = 100; + <END> = 101; + <PGDN> = 109; + <NMLK> = 118; + <KPDV> = 119; + <KPMU> = 126; + <KPSU> = 132; + <KPAD> = 124; + <RCTL> = 88; + + alias <TLDE> = <AE00>; + + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; +}; + +xkb_keycodes "pc101" { + include "digital/pc(pc10x)" + <BKSL> = 92; + indicator 5 = "Num Lock"; +}; + + +xkb_keycodes "pc102" { + include "digital/pc(pc10x)" + <BKSL> = 19; + <AC12> = 83; + indicator 5 = "Num Lock"; +}; + +xkb_keycodes "pc104" { + include "digital/pc(pc101)" + <LWIN> = 139; + <RWIN> = 140; + <MENU> = 141; +}; + +xkb_keycodes "lk411_common" { + include "digital/pc(pc_common)" + <AE00> = 8; + <AB00> = 14; + <FK13> = 24; + <FK14> = 10; + <FK17> = 16; + <FK18> = 87; + <FK19> = 95; + <FK20> = 98; + <HELP> = 11; + <DO> = 12; + <FIND> = 110; + <INS> = 103; + <DELE> = 100; + <SELE> = 101; + <PGUP> = 111; + <PGDN> = 109; + <KPF1> = 118; + <KPF2> = 119; + <KPF3> = 126; + <KPF4> = 132; + <KPSU> = 19; + <KPCO> = 124; + <LCMP> = 40; + <RCMP> = 88; + + alias <TLDE> = <AE00>; + + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; +}; + +xkb_keycodes "lk411" { + include "digital/pc(lk411_common)" + <BKSL> = 92; +}; + +xkb_keycodes "lk450" { + include "digital/pc(lk411)" + indicator 2 = "Compose"; + indicator 1 = "Wait"; +}; + +// Japanese variants +// +// PCXAJ-AA = pc+BKSL+AC12+AB11+MUHE+KANJ+HIRA+indicator +// LK411-AJ = lk411+MUHE+KANJ+HIRA +// LK411-JJ = lk411+BKSL+AZ01+MUHE+KANJ+HIRA +// LK411-LT = lk411 + +xkb_keycodes "pcxajaa" { + include "digital/pc(pc10x)" + <BKSL> = 93; + <AC12> = 83; + <AB11> = 81; + <MUHE> = 133; + <KANJ> = 134; + <HIRA> = 135; + indicator 5 = "Group 2"; +}; + +xkb_keycodes "lk411jj" { + include "digital/pc(lk411_common)" + <AB11> = 81; + <BKSL> = 83; + <MUHE> = 133; + <KANJ> = 134; + <HIRA> = 135; +}; + + diff --git a/keycodes/fujitsu b/keycodes/fujitsu new file mode 100644 index 0000000..e0e63c6 --- /dev/null +++ b/keycodes/fujitsu @@ -0,0 +1,187 @@ +// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "138" { + + minimum= 8; + maximum= 156; + + <ESC> = 37; + <AE01> = 38; + <AE02> = 39; + <AE03> = 40; + <AE04> = 41; + <AE05> = 42; + <AE06> = 43; + <AE07> = 44; + <AE08> = 45; + <AE09> = 46; + <AE10> = 47; + <AE11> = 48; + <AE12> = 49; + <TLDE> = 50; + <BKSP> = 51; + + <TAB> = 61; + <AD01> = 62; + <AD02> = 63; + <AD03> = 64; + <AD04> = 65; + <AD05> = 66; + <AD06> = 67; + <AD07> = 68; + <AD08> = 69; + <AD09> = 70; + <AD10> = 71; + <AD11> = 72; + <AD12> = 73; + + <LCTL> = 84; + <AC01> = 85; + <AC02> = 86; + <AC03> = 87; + <AC04> = 88; + <AC05> = 89; + <AC06> = 90; + <AC07> = 91; + <AC08> = 92; + <AC09> = 93; + <AC10> = 94; + <AC11> = 95; + <BKSL> = 96; + <RTRN> = 97; + + <LFSH> = 107; + <AB01> = 108; + <AB02> = 109; + <AB03> = 110; + <AB04> = 111; + <AB05> = 112; + <AB06> = 113; + <AB07> = 114; + <AB08> = 115; + <AB09> = 116; + <AB10> = 117; + <AB11> = 52; + <RTSH> = 118; + + <CAPS> = 127; + <LALT> = 27; + <LMTA> = 128; + <UNK4> = 125; + <SPCE> = 129; + <UNK5> = 10; + <RMTA> = 130; + <RALT> = 23; + <COMP> = 75; + <LNFD> = 119; + <UNK6> = 56; + + <FK01> = 13; + <FK02> = 14; + <FK03> = 16; + <FK04> = 18; + <FK05> = 20; + <FK06> = 22; + <FK07> = 24; + <FK08> = 25; + <FK09> = 26; + <FK10> = 15; + <FK11> = 17; + <FK12> = 19; + <FK13> = 137; + <FK14> = 138; + <FK15> = 139; + <FK16> = 140; + <FK17> = 141; + <FK18> = 142; + <FK19> = 143; + <FK20> = 144; + <FK21> = 145; + <FK22> = 146; + <FK23> = 147; + <FK24> = 148; + <FK25> = 153; + <FK26> = 154; + <FK27> = 155; + <FK28> = 156; + <FK29> = 149; + <FK30> = 150; + <FK31> = 151; + <FK32> = 152; + + <UNDO> = 34; + <COPY> = 59; + <PAST> = 81; + <CUT> = 105; + <HELP> = 126; + + <BREA> = 9; + <PRSC> = 30; + <KNJI> = 21; + <PAUS> = 29; + + <UNK0> = 82; + <UNK1> = 83; + <UNK2> = 12; + <PGUP> = 35; + <HOME> = 32; + <PGDN> = 36; + <UNK3> = 28; + <DEL> = 74; + <INS> = 60; + <UP> = 33; + <DOWN> = 103; + <LEFT> = 57; + <RGHT> = 80; + <EXEC> = 11; + + <KPMU> = 55; + <KPDV> = 54; + <KPAD> = 133; + <KPSU> = 79; + + <KP7> = 76; + <KP8> = 77; + <KP9> = 78; + <KPEQ> = 53; + + <KP4> = 99; + <KP5> = 100; + <KP6> = 101; + <KPDC> = 58; + + <KP1> = 120; + <KP2> = 121; + <KP3> = 122; + <KPEN> = 98; + + <KP0> = 102; + <KP00> = 31; + + <UNK7> = 123; + <UNK8> = 124; +}; diff --git a/keycodes/hp b/keycodes/hp new file mode 100644 index 0000000..0c98072 --- /dev/null +++ b/keycodes/hp @@ -0,0 +1,271 @@ +// $Xorg: hp,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "hp-101" { + + <TLDE> = 23; + <AE01> = 31; + <AE02> = 39; + <AE03> = 47; + <AE04> = 46; + <AE05> = 55; + <AE06> = 63; + <AE07> = 70; + <AE08> = 71; + <AE09> = 79; + <AE10> = 78; + <AE11> = 87; + <AE12> = 94; + <BKSP> = 111; + + <TAB> = 22; + <AD01> = 30; + <AD02> = 38; + <AD03> = 45; + <AD04> = 54; + <AD05> = 53; + <AD06> = 62; + <AD07> = 69; + <AD08> = 76; + <AD09> = 77; + <AD10> = 86; + <AD11> = 93; + <AD12> = 100; + <BKSL> = 101; + + <CAPS> = 29; + <AC01> = 37; + <AC02> = 36; + <AC03> = 44; + <AC04> = 52; + <AC05> = 61; + <AC06> = 60; + <AC07> = 68; + <AC08> = 75; + <AC09> = 84; + <AC10> = 85; + <AC11> = 91; + <RTRN> = 99; + + <LFSH> = 27; + <AB01> = 35; + <AB02> = 43; + <AB03> = 42; + <AB04> = 51; + <AB05> = 59; + <AB06> = 58; + <AB07> = 67; + <AB08> = 74; + <AB09> = 82; + <AB10> = 83; + <RTSH> = 98; + + <LCTL> = 26; + <LALT> = 34; + <SPCE> = 50; + <RALT> = 66; + <RCTL> = 97; + + <ESC> = 17; + <FK01> = 16; + <FK02> = 24; + <FK03> = 32; + <FK04> = 40; + <FK05> = 48; + <FK06> = 56; + <FK07> = 64; + <FK08> = 72; + <FK09> = 80; + <FK10> = 88; + <FK11> = 95; + <FK12> = 103; + + <PRSC> = 96; + <SCLK> = 104; + <PAUS> = 107; + + <INS> = 112; + <HOME> = 119; + <PGUP> = 120; + <DELE> = 109; + <END> = 110; + <PGDN> = 118; + + <UP> = 108; + <LEFT> = 106; + <DOWN> = 105; + <RGHT> = 115; + + <NMLK> = 127; + <KPDV> = 128; + <KPMU> = 135; + <KPSU> = 141; + + <KP7> = 117; + <KP8> = 126; + <KP9> = 134; + <KPAD> = 133; + + <KP4> = 116; + <KP5> = 124; + <KP6> = 125; + + <KP1> = 114; + <KP2> = 123; + <KP3> = 131; + <KPEN> = 130; + + <KP0> = 121; + <KPDL> = 122; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; + +xkb_keycodes "hil" { + + <TLDE> = 71; + <AE01> = 70; + <AE02> = 69; + <AE03> = 68; + <AE04> = 67; + <AE05> = 66; + <AE06> = 65; + <AE07> = 64; + <AE08> = 96; + <AE09> = 97; + <AE10> = 98; + <AE11> = 99; + <AE12> = 100; + <BKSP> = 101; + + <TAB> = 63; + <AD01> = 62; + <AD02> = 61; + <AD03> = 60; + <AD04> = 59; + <AD05> = 58; + <AD06> = 57; + <AD07> = 56; + <AD08> = 104; + <AD09> = 105; + <AD10> = 106; + <AD11> = 107; + <AD12> = 108; + <BKSL> = 109; + + <CAPS> = 55; + <AC01> = 53; + <AC02> = 52; + <AC03> = 51; + <AC04> = 50; + <AC05> = 49; + <AC06> = 48; + <AC07> = 112; + <AC08> = 113; + <AC09> = 114; + <AC10> = 115; + <AC11> = 116; + <RTRN> = 117; + + <LFSH> = 13; + <AB01> = 36; + <AB02> = 35; + <AB03> = 34; + <AB04> = 33; + <AB05> = 32; + <AB06> = 128; + <AB07> = 120; + <AB08> = 121; + <AB09> = 122; + <AB10> = 123; + <RTSH> = 12; + + <LCTL> = 14; + <LALT> = 11; + <SPCE> = 129; + <RALT> = 10; + <PRSC> = 87; + + <ESC> = 39; + <BRK> = 15; + <STOP> = 86; + <FK01> = 84; + <FK02> = 83; + <FK03> = 82; + <FK04> = 81; + <MENU> = 80; + <SYST> = 88; + <FK05> = 89; + <FK06> = 90; + <FK07> = 91; + <FK08> = 92; + <FK09> = 45; + <FK10> = 41; + <FK11> = 43; + <FK12> = 47; + <CLRL> = 94; + <CLR> = 95; + + <INSL> = 102; + <DELL> = 103; + <INSC> = 110; + <DELC> = 111; + + <HOME> = 118; + <PGUP> = 119; + <PGDN> = 127; + <SELE> = 125; + + <UP> = 134; + <LEFT> = 132; + <DOWN> = 133; + <RGHT> = 135; + + <KPDV> = 25; + <KPMU> = 29; + <KPAD> = 27; + <KPSU> = 31; + + <KP7> = 21; + <KP8> = 17; + <KP9> = 19; + <KPEN> = 23; + + <KP4> = 16; + <KP5> = 18; + <KP6> = 20; + <KPSP> = 22; + + <KP1> = 24; + <KP2> = 26; + <KP3> = 28; + <KPTB> = 46; + + <KP0> = 30; + <KPDL> = 44; +}; diff --git a/keycodes/ibm b/keycodes/ibm new file mode 100644 index 0000000..303d4b3 --- /dev/null +++ b/keycodes/ibm @@ -0,0 +1,151 @@ +// $Xorg: ibm,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keycodes "rs6k-101" { + + <TLDE> = 9; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 23; + + <TAB> = 24; + <AD01> = 25; + <AD02> = 26; + <AD03> = 27; + <AD04> = 28; + <AD05> = 29; + <AD06> = 30; + <AD07> = 31; + <AD08> = 32; + <AD09> = 33; + <AD10> = 34; + <AD11> = 35; + <AD12> = 36; + <BKSL> = 37; + + <CAPS> = 38; + <AC01> = 39; + <AC02> = 40; + <AC03> = 41; + <AC04> = 42; + <AC05> = 43; + <AC06> = 44; + <AC07> = 45; + <AC08> = 46; + <AC09> = 47; + <AC10> = 48; + <AC11> = 49; + <RTRN> = 51; + + <LFSH> = 52; + <AB01> = 54; + <AB02> = 55; + <AB03> = 56; + <AB04> = 57; + <AB05> = 58; + <AB06> = 59; + <AB07> = 60; + <AB08> = 61; + <AB09> = 62; + <AB10> = 63; + <RTSH> = 65; + + <LCTL> = 66; + <LALT> = 68; + <SPCE> = 69; + <RALT> = 70; + <RCTL> = 72; + + <ESC> = 118; + <FK01> = 120; + <FK02> = 121; + <FK03> = 122; + <FK04> = 123; + <FK05> = 124; + <FK06> = 125; + <FK07> = 126; + <FK08> = 127; + <FK09> = 128; + <FK10> = 129; + <FK11> = 130; + <FK12> = 131; + + <PRSC> = 132; + <SCLK> = 133; + <PAUS> = 134; + + <INS> = 83; + <HOME> = 88; + <PGUP> = 93; + <DELE> = 84; + <END> = 89; + <PGDN> = 94; + + <UP> = 91; + <LEFT> = 87; + <DOWN> = 92; + <RGHT> = 97; + + <NMLK> = 98; + <KPDV> = 103; + <KPMU> = 108; + <KPSU> = 113; + + <KP7> = 99; + <KP8> = 104; + <KP9> = 109; + <KPAD> = 114; + + <KP4> = 100; + <KP5> = 105; + <KP6> = 110; + + <KP1> = 101; + <KP2> = 106; + <KP3> = 111; + <KPEN> = 116; + + <KP0> = 107; + <KPDL> = 112; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; +xkb_keycodes "rs6k-102" { + include "ibm(rs6k-101)" + <LSGT> = 53; +}; diff --git a/keycodes/macintosh b/keycodes/macintosh new file mode 100644 index 0000000..5ed575c --- /dev/null +++ b/keycodes/macintosh @@ -0,0 +1,161 @@ +// $XConsortium: macintosh /main/10 1996/01/24 12:17:35 kaleb $ +// +//Copyright (c) 1996 X Consortium +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and/or sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the X Consortium shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from the X Consortium. +// +// $XFree86: xc/programs/xkbcomp/keycodes/macintosh,v 1.4 2001/10/02 19:57:00 alanh Exp $ +// +default xkb_keycodes "macintosh" { + + minimum= 8; + maximum= 134; + + <ESC> = 61; + <TLDE> = 58; + <AE01> = 26; + <AE02> = 27; + <AE03> = 28; + <AE04> = 29; + <AE05> = 31; + <AE06> = 30; + <AE07> = 34; + <AE08> = 36; + <AE09> = 33; + <AE10> = 37; + <AE11> = 35; + <AE12> = 32; + <BKSP> = 59; + + <TAB> = 56; + <AD01> = 20; + <AD02> = 21; + <AD03> = 22; + <AD04> = 23; + <AD05> = 25; + <AD06> = 24; + <AD07> = 40; + <AD08> = 42; + <AD09> = 39; + <AD10> = 43; + <AD11> = 41; + <AD12> = 38; + <BKSL> = 50; + + <CAPS> = 65; + <AC01> = 8; + <AC02> = 9; + <AC03> = 10; + <AC04> = 11; + <AC05> = 13; + <AC06> = 12; + <AC07> = 46; + <AC08> = 48; + <AC09> = 45; + <AC10> = 49; + <AC11> = 47; + <RTRN> = 44; + + <LSGT> = 18; + <AB01> = 14; + <AB02> = 15; + <AB03> = 16; + <AB04> = 17; + <AB05> = 19; + <AB06> = 53; + <AB07> = 54; + <AB08> = 51; + <AB09> = 55; + <AB10> = 52; + + <SPCE> = 57; + + <LCTL> = 62; // Left Control + <LALT> = 63; // Left Option + <LFSH> = 64; // Left Shift + <RALT> = 66; // Left Command +// <RTSH> = 131; // Right Shift +// <RALT> = 132; // Right Command +// <RCTL> = 133; // Right Control +// <RMTA> = 134; // Right Option + + <FK01> = 130; + <FK02> = 128; + <FK03> = 107; + <FK04> = 126; + <FK05> = 104; + <FK06> = 105; + <FK07> = 106; + <FK08> = 108; + <FK09> = 109; + <FK10> = 117; + <FK11> = 111; + <FK12> = 119; + + <PRSC> = 113; + <SCLK> = 115; + <PAUS> = 121; + + <INS> = 122; + <HOME> = 123; + <PGUP> = 124; + <DELE> = 125; + <END> = 127; + <PGDN> = 129; + + <UP> = 70; + <LEFT> = 67; + <DOWN> = 69; + <RGHT> = 68; + + <NMLK> = 79; + <KPEQ> = 89; + <KPDV> = 83; + <KPMU> = 75; + + <KP7> = 97; + <KP8> = 99; + <KP9> = 100; + <KPSU> = 86; + + <KP4> = 94; + <KP5> = 95; + <KP6> = 96; + <KPAD> = 77; + + <KP1> = 91; + <KP2> = 92; + <KP3> = 93; + <KPEN> = 84; + + <KP0> = 90; + <KPDL> = 73; + + indicator 3 = "Scroll Lock"; + indicator 2 = "Num Lock"; + indicator 1 = "Caps Lock"; + + alias <ALGR> = <RALT>; +}; diff --git a/keycodes/powerpcps2 b/keycodes/powerpcps2 new file mode 100644 index 0000000..a607036 --- /dev/null +++ b/keycodes/powerpcps2 @@ -0,0 +1,134 @@ +// $XConsortium: xfree86 /main/4 1996/08/31 12:16:59 kaleb $ +// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.3.2.1 1999/06/21 09:45:28 hohndel Exp $ +default xkb_keycodes "powerpcps2" { + + minimum= 8; + maximum= 135; + + <TLDE> = 49; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <CAPS> = 66; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + <BKSL> = 51; + <LSGT> = 94; + + <LALT> = 64; + <LCTL> = 37; + <SPCE> = 65; + <RCTL> = 105; + <RALT> = 108; + // Microsoft keyboard extra keys + <LWIN> = 133; + <RWIN> = 134; + <MENU> = 135; + + <ESC> = 9; + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + <FK11> = 95; + <FK12> = 96; + + <PRSC> = 107; + <SCLK> = 78; + <PAUS> = 127; + + <INS> = 118; + <HOME> = 110; + <PGUP> = 112; + <DELE> = 119; + <END> = 115; + <PGDN> = 117; + + <UP> = 111; + <LEFT> = 113; + <DOWN> = 116; + <RGHT> = 114; + + <NMLK> = 77; + <KPDV> = 106; + <KPMU> = 63; + <KPSU> = 82; + + <KP7> = 79; + <KP8> = 80; + <KP9> = 81; + <KPAD> = 86; + + <KP4> = 83; + <KP5> = 84; + <KP6> = 85; + + <KP1> = 87; + <KP2> = 88; + <KP3> = 89; + <KPEN> = 104; + + <KP0> = 90; + <KPDL> = 91; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; + + alias <ALGR> = <RALT>; +}; + diff --git a/keycodes/sgi.vndr/indigo b/keycodes/sgi.vndr/indigo new file mode 100644 index 0000000..df86802 --- /dev/null +++ b/keycodes/sgi.vndr/indigo @@ -0,0 +1,140 @@ +// $Xorg: indigo,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "pc101" { + minimum= 10; + maximum= 118; + + <TLDE> = 62; + <AE01> = 15; + <AE02> = 21; + <AE03> = 22; + <AE04> = 29; + <AE05> = 30; + <AE06> = 37; + <AE07> = 38; + <AE08> = 45; + <AE09> = 46; + <AE10> = 53; + <AE11> = 54; + <AE12> = 61; + <BKSP> = 68; + + <TAB> = 16; + <AD01> = 17; + <AD02> = 23; + <AD03> = 24; + <AD04> = 31; + <AD05> = 32; + <AD06> = 39; + <AD07> = 40; + <AD08> = 47; + <AD09> = 48; + <AD10> = 55; + <AD11> = 56; + <AD12> = 63; + <RTRN> = 58; + + <CAPS> = 11; + <AC01> = 18; + <AC02> = 19; + <AC03> = 25; + <AC04> = 26; + <AC05> = 33; + <AC06> = 34; + <AC07> = 41; + <AC08> = 42; + <AC09> = 49; + <AC10> = 50; + <AC11> = 57; + + <LFSH> = 13; + <AB01> = 27; + <AB02> = 28; + <AB03> = 35; + <AB04> = 36; + <AB05> = 43; + <AB06> = 44; + <AB07> = 51; + <AB08> = 52; + <AB09> = 59; + <AB10> = 60; + <RTSH> = 12; + <BKSL> = 64; + + <LALT> = 91; + <LCTL> = 10; + <SPCE> = 90; + <RCTL> = 93; + <RALT> = 92; + + <ESC> = 14; + <FK01> = 94; + <FK02> = 95; + <FK03> = 96; + <FK04> = 97; + <FK05> = 98; + <FK06> = 99; + <FK07> = 100; + <FK08> = 101; + <FK09> = 102; + <FK10> = 103; + <FK11> = 104; + <FK12> = 105; + + <PRSC> = 106; + <SCLK> = 107; + <PAUS> = 108; + + <INS> = 109; + <HOME> = 110; + <PGUP> = 111; + <DELE> = 69; + <END> = 112; + <PGDN> = 113; + + <UP> = 88; + <LEFT> = 80; + <DOWN> = 81; + <RGHT> = 87; + + <NMLK> = 114; + <KPDV> = 115; + <KPMU> = 116; + <KPSU> = 83; + + <KP7> = 74; + <KP8> = 75; + <KP9> = 82; + <KPAD> = 117; + + <KP4> = 70; + <KP5> = 76; + <KP6> = 77; + + <KP1> = 65; + <KP2> = 71; + <KP3> = 72; + <KPEN> = 89; + + <KP0> = 66; + <KPDL> = 73; + + alias <AE00> = <TLDE>; + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + alias <AA01> = <LALT>; + alias <AA09> = <RALT>; + alias <ALGR> = <RALT>; + alias <AA12> = <RCTL>; + + virtual indicator 1 = "L1"; + virtual indicator 2 = "L2"; + virtual indicator 3 = "L3"; + virtual indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; +}; +xkb_keycodes "pc102" { + include "sgi/indigo(pc101)" + <LSGT> = 118; +}; diff --git a/keycodes/sgi.vndr/indy b/keycodes/sgi.vndr/indy new file mode 100644 index 0000000..f59609d --- /dev/null +++ b/keycodes/sgi.vndr/indy @@ -0,0 +1,203 @@ +// $Xorg: indy,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "universal" { + minimum= 15; + maximum= 149; + include "sgi/indy(pc105)" + alternate <BKSL> = 91; + alternate <BKSL> = 100; + alternate <BKSL> = 101; +}; +xkb_keycodes "pc101" { + minimum= 15; + maximum= 149; + + <TLDE> = 22; + <AE01> = 30; + <AE02> = 38; + <AE03> = 46; + <AE04> = 45; + <AE05> = 54; + <AE06> = 62; + <AE07> = 69; + <AE08> = 70; + <AE09> = 78; + <AE10> = 77; + <AE11> = 86; + <AE12> = 93; + <BKSP> = 110; + + <TAB> = 21; + <AD01> = 29; + <AD02> = 37; + <AD03> = 44; + <AD04> = 53; + <AD05> = 52; + <AD06> = 61; + <AD07> = 68; + <AD08> = 75; + <AD09> = 76; + <AD10> = 85; + <AD11> = 92; + <AD12> = 99; + <RTRN> = 98; + + <CAPS> = 28; + <AC01> = 36; + <AC02> = 35; + <AC03> = 43; + <AC04> = 51; + <AC05> = 60; + <AC06> = 59; + <AC07> = 67; + <AC08> = 74; + <AC09> = 83; + <AC10> = 84; + <AC11> = 90; + + <LFSH> = 26; + <AB01> = 34; + <AB02> = 42; + <AB03> = 41; + <AB04> = 50; + <AB05> = 58; + <AB06> = 57; + <AB07> = 66; + <AB08> = 73; + <AB09> = 81; + <AB10> = 82; + <RTSH> = 97; + <BKSL> = 100; + + <LALT> = 33; + <LCTL> = 25; + <SPCE> = 49; + <RCTL> = 96; + <RALT> = 65; + + <ESC> = 16; + <FK01> = 15; + <FK02> = 23; + <FK03> = 31; + <FK04> = 39; + <FK05> = 47; + <FK06> = 55; + <FK07> = 63; + <FK08> = 71; + <FK09> = 79; + <FK10> = 87; + <FK11> = 94; + <FK12> = 102; + + <PRSC> = 95; + <SCLK> = 103; + <PAUS> = 106; + + <INS> = 111; + <HOME> = 118; + <PGUP> = 119; + <DELE> = 108; + <END> = 109; + <PGDN> = 117; + + <UP> = 107; + <LEFT> = 105; + <DOWN> = 104; + <RGHT> = 114; + + <NMLK> = 126; + <KPDV> = 127; + <KPMU> = 134; + <KPSU> = 140; + + <KP7> = 116; + <KP8> = 125; + <KP9> = 133; + <KPAD> = 132; + + <KP4> = 115; + <KP5> = 123; + <KP6> = 124; + + <KP1> = 113; + <KP2> = 122; + <KP3> = 130; + <KPEN> = 129; + + <KP0> = 120; + <KPDL> = 121; + + alias <AE00> = <TLDE>; + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + alias <AA01> = <LALT>; + alias <AA09> = <RALT>; + alias <ALGR> = <RALT>; + alias <AA12> = <RCTL>; + + virtual indicator 1 = "L1"; + virtual indicator 2 = "L2"; + virtual indicator 3 = "L3"; + virtual indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; + +}; +xkb_keycodes "pc102" { + <BKSL> = 91; + <LSGT> = 27; + augment "sgi/indy(pc101)" + maximum= 149; + minimum= 15; +}; +xkb_keycodes "pc104" { + include "sgi/indy(pc101)" + minimum= 15; + maximum= 149; + + // These key names are here to support so-called "Windows95" + // keyboards like the Microsoft Natural keyboard. + <LWIN> = 147; + <RWIN> = 148; + <MENU> = 149; +}; +xkb_keycodes "pc105" { + <LSGT> = 27; + augment "sgi/indy(pc104)" + minimum= 15; + maximum= 149; +}; +xkb_keycodes "jp106" { + <HZTG> = 22; + <AB11> = 89; + <AC12> = 91; + <NFER> = 141; + <XFER> = 142; + <HKTG> = 143; + alias <TLDE> = <HZTG>; + alias <AE00> = <HZTG>; + alias <AE13> = <BKSL>; + augment "sgi/indy(pc101)" + minimum= 15; + maximum= 149; +}; +// can be combined with any other "indy" keycode +// description to add virtual keys which can be +// used to implement an overlay-based numeric +// keypad. +partial hidden xkb_keycodes "overlayKeypad" { + <KO7> = 17; + <KO8> = 18; + <KO9> = 19; + <KO6> = 146; + <KO5> = 145; + <KO4> = 144; + <KO1> = 136; + <KO2> = 137; + <KO3> = 138; + <KO0> = 135; + <KODL> = 139; +}; +partial hidden xkb_keycodes "shiftLock" { + indicator 5 = "Shift Lock"; +}; diff --git a/keycodes/sgi.vndr/iris b/keycodes/sgi.vndr/iris new file mode 100644 index 0000000..30375e9 --- /dev/null +++ b/keycodes/sgi.vndr/iris @@ -0,0 +1,11 @@ +// $Xorg: iris,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "iris" { + include "sgi/indigo(pc101)" + indicator 1 = "L1"; + indicator 2 = "L2"; + indicator 3 = "L3"; + indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; +}; diff --git a/keycodes/sony b/keycodes/sony new file mode 100644 index 0000000..0e720b4 --- /dev/null +++ b/keycodes/sony @@ -0,0 +1,142 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keycodes "nwp5461" { + + <ESC> = 18; + <AE01> = 19; + <AE02> = 20; + <AE03> = 21; + <AE04> = 22; + <AE05> = 23; + <AE06> = 24; + <AE07> = 25; + <AE08> = 26; + <AE09> = 27; + <AE10> = 28; + <AE11> = 29; + <AE12> = 30; + <BKSL> = 31; + <BKSP> = 32; + + <TAB> = 33; + <AD01> = 34; + <AD02> = 35; + <AD03> = 36; + <AD04> = 37; + <AD05> = 38; + <AD06> = 39; + <AD07> = 40; + <AD08> = 41; + <AD09> = 42; + <AD10> = 43; + <AD11> = 44; + <AD12> = 45; + <DELE> = 46; + + <LCTL> = 47; + <AC01> = 48; + <AC02> = 49; + <AC03> = 50; + <AC04> = 51; + <AC05> = 52; + <AC06> = 53; + <AC07> = 54; + <AC08> = 55; + <AC09> = 56; + <AC10> = 57; + <AC11> = 58; + <TLDE> = 59; + <RTRN> = 60; + + <LFSH> = 61; + <AB01> = 62; + <AB02> = 63; + <AB03> = 64; + <AB04> = 65; + <AB05> = 66; + <AB06> = 67; + <AB07> = 68; + <AB08> = 69; + <AB09> = 70; + <AB10> = 71; + <AB11> = 72; + <RTSH> = 73; + + <LALT> = 74; + <CAPS> = 75; + <STOP> = 76; + <SPCE> = 77; + <CUT> = 78; + <EXEC> = 81; + + <FK01> = 8; + <FK02> = 9; + <FK03> = 10; + <FK04> = 11; + <FK05> = 12; + <FK06> = 13; + <FK07> = 14; + <FK08> = 15; + <FK09> = 16; + <FK10> = 17; + <FK11> = 111; + <FK12> = 112; + + <HELP> = 113; + <INS> = 114; + <CLR> = 115; + <PGUP> = 116; + <PGDN> = 117; + + <KPTB> = 109; + <UP> = 95; + <LEFT> = 98; + <DOWN> = 99; + <RGHT> = 100; + + <KPMU> = 107; + <KPDV> = 108; + <KPAD> = 89; + + <KP7> = 82; + <KP8> = 83; + <KP9> = 84; + <KPSU> = 85; + + <KP4> = 86; + <KP5> = 87; + <KP6> = 88; + <KPSP> = 93; + + <KP1> = 90; + <KP2> = 91; + <KP3> = 92; + <KPEN> = 97; + + <KP0> = 94; + <KPDC> = 96; +}; diff --git a/keycodes/sun b/keycodes/sun new file mode 100644 index 0000000..a74411a --- /dev/null +++ b/keycodes/sun @@ -0,0 +1,819 @@ +// $Xorg: sun,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keycodes/sun,v 3.5 2001/12/14 20:02:00 dawes Exp $ +// +default xkb_keycodes "type4" { + + minimum= 8; + maximum= 132; + + <ESC> = 36; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <TLDE> = 49; + <BKSP> = 50; + + <TAB> = 60; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + <DELE> = 73; + + <LCTL> = 83; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <BKSL> = 95; + <RTRN> = 96; + + <LFSH> = 106; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + <LNFD> = 118; + + <HELP> = 125; + <CAPS> = 126; + <LALT> = 26; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + + <STOP> = 8; + <AGAI> = 10; + <PROP> = 32; + <UNDO> = 33; + <FRNT> = 56; + <COPY> = 58; + <OPEN> = 79; + <PAST> = 80; + <FIND> = 102; + <CUT> = 104; + + <PRSC> = 29; + <SCLK> = 30; + <PAUS> = 28; + + <NMLK> = 105; + <KPEQ> = 52; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + + <KP0> = 101; + <KPDL> = 57; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type5" { + + minimum= 8; + maximum= 132; + + <ESC> = 36; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <TLDE> = 49; + <BKSP> = 50; + + <TAB> = 60; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + <DELE> = 73; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + + <LCTL> = 83; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <BKSL> = 95; + <RTRN> = 96; + + <LFSH> = 106; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + + <LALT> = 26; + <CAPS> = 126; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + <STOP> = 8; + <AGAI> = 10; + <PROP> = 32; + <UNDO> = 33; + <FRNT> = 56; + <COPY> = 58; + <OPEN> = 79; + <PAST> = 80; + <FIND> = 102; + <CUT> = 104; + + <PRSC> = 29; + <SCLK> = 30; + <PAUS> = 28; + + <NMLK> = 105; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + + <KP0> = 101; + <KPDL> = 57; + + <UP> = 27; + <LEFT> = 31; + <DOWN> = 34; + <RGHT> = 35; + + <INS> = 51; + <HOME> = 59; + <END> = 81; + <PGUP> = 103; + <PGDN> = 130; + <HELP> = 125; + + <MUTE> = 52; + <VOL-> = 9; + <VOL+> = 11; + <POWR> = 55; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type6" { + minimum= 8; + maximum= 255; + + <TLDE> = 49; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <CAPS> = 66; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + <BKSL> = 51; + + <LALT> = 64; + <LCTL> = 37; + <SPCE> = 65; + <ALGR> = 113; + alias <RALT> = <ALGR>; + + <LMTA> = 115; + <RMTA> = 116; + <COMP> = 117; + + <ESC> = 9; + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + <FK11> = 95; + <FK12> = 96; + + <PRSC> = 111; + <SCLK> = 78; + <PAUS> = 110; + + <INS> = 106; + <HOME> = 97; + <PGUP> = 99; + <DELE> = 107; + <END> = 103; + <PGDN> = 105; + + <UP> = 98; + <LEFT> = 100; + <DOWN> = 104; + <RGHT> = 102; + + <NMLK> = 77; + <KPDV> = 112; + <KPMU> = 63; + <KPSU> = 82; + + <KP7> = 79; + <KP8> = 80; + <KP9> = 81; + <KPAD> = 86; + + <KP4> = 83; + <KP5> = 84; + <KP6> = 85; + + <KP1> = 87; + <KP2> = 88; + <KP3> = 89; + <KPEN> = 108; + + <KP0> = 90; + <KPDL> = 91; + + <STOP> = 222; + <AGAI> = 223; + <PROP> = 224; + <UNDO> = 225; + <FRNT> = 226; + <COPY> = 227; + <OPEN> = 228; + <PAST> = 229; + <FIND> = 230; + <CUT> = 231; + + <HELP> = 232; + + <MUTE> = 165; + <VOL-> = 159; + <VOL+> = 158; + <POWR> = 160; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; + +xkb_keycodes "type4_euro" { + include "sun(type4)" + <LSGT> = 131; +}; + +xkb_keycodes "type5_euro" { + include "sun(type5)" + <LSGT> = 131; +}; + +xkb_keycodes "type6_euro" { + include "sun(type6)" + <LSGT> = 94; +}; + +xkb_keycodes "type5_se" { + + minimum= 8; + maximum= 132; + + // Row G + <HELP> = 125; + // + <ESC> = 36; + // + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + // + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + // + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + // + <PRSC> = 29; + <SCLK> = 30; + <PAUS> = 28; + // + <MUTE> = 52; + <VOL-> = 9; + <VOL+> = 11; + <POWR> = 55; + // End Row G + + // Row F + // + // End Row F + + // Row E + <STOP> = 8; + <AGAI> = 10; + // + <AE00> = 49; + alias <TLDE> = <AE00>; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <BKSP> = 50; + // + <INS> = 51; + <HOME> = 59; + <PGUP> = 103; + // + <NMLK> = 105; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + //End Row E + + // Row D + <PROP> = 32; + <UNDO> = 33; + // + <AD00> = 60; + alias <TAB> = <AD00>; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + // + <DELE> = 73; + <END> = 81; + <PGDN> = 130; + // + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + // End Row D + + // Row C + <FRNT> = 56; + <COPY> = 58; + // + <AC00> = 126; + alias <CAPS> = <AC00>; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <AC12> = 95; + alias <BKSL> = <AC12>; + <RTRN> = 96; + // + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + // End Row C + + // Row B + <OPEN> = 79; + <PAST> = 80; + // + <LFSH> = 106; + <AB00> = 131; + alias <LSGT> = <AB00>; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + // + <UP> = 27; + // + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + // End Row B + + // Row A + <FIND> = 102; + <CUT> = 104; + // + <LCTL> = 83; + <LALT> = 26; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + // + <LEFT> = 31; + <DOWN> = 34; + <RGHT> = 35; + // + <KP0> = 101; + <KPDL> = 57; + // End Row A + + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type5c_se" { + include "sun(type5_se)" +}; + +xkb_keycodes "type4__se" { + + minimum= 8; + maximum= 132; + + // Row F + <STOP> = 8; + <AGAI> = 10; + // + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + <AF13> = 95; + alias <TLDE> = <AF13>; + <AF14> = 22; + <DELE> = 73; + // + <PAUS> = 28; + <PRSC> = 29; + <SCLK> = 30; + <NMLK> = 105; + // End Row F + + // Row E + <PROP> = 32; + <UNDO> = 33; + // + <AE00> = 36; + alias <ESC> = <AE00>; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <BKSP> = 50; + // + <KPEQ> = 52; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + // End Row E + + // Row D + <FRNT> = 56; + <COPY> = 58; + // + <AD00> = 60; + alias <TAB> = <AD00>; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + // + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + // End Row D + + // Row C + <OPEN> = 79; + <PAST> = 80; + // + <AC00> = 83; + // alias <CAPS> = <AC00>; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <AC12> = 49; + alias <BKSL> = <AC12>; + <RTRN> = 96; + // + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + // End Row C + + // Row B + <FIND> = 102; + <CUT> = 104; + // + <LFSH> = 106; + <AB00> = 131; + alias <LSGT> = <AB00>; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + <LNFD> = 118; + // + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + // End Row B + + // Row A + <HELP> = 125; + // + <AA00> = 126; + // alias <LCTL> = <AA00>; + <LALT> = 26; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + // + <KP0> = 101; + <KPDL> = 57; + // End Row A + + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type4_se" { + + include "sun(type4__se)" + + alias <LCTL> = <AA00>; + alias <CAPS> = <AC00>; +}; + +xkb_keycodes "type4_se_swapctl" { + + include "sun(type4__se)" + + alias <LCTL> = <AC00>; + alias <CAPS> = <AA00>; +}; diff --git a/keycodes/xfree86 b/keycodes/xfree86 new file mode 100644 index 0000000..6b1387a --- /dev/null +++ b/keycodes/xfree86 @@ -0,0 +1,415 @@ +// $XdotOrg: xc/programs/xkbcomp/keycodes/xfree86,v 1.1.4.4 2004/03/05 13:41:30 eich Exp $ +// $Xorg: xfree86,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.28 2003/11/21 04:46:42 dawes Exp $ + +// "standard" XFree86 codes +// It seems that the "default" must be the first entry in the file. + +default xkb_keycodes "xfree86" { + include "xfree86(basic)" + <BKSL> = 51; + <LSGT> = 94; +}; + +xkb_keycodes "basic" { + + minimum= 8; + maximum= 255; + + <TLDE> = 49; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <CAPS> = 66; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + + <LALT> = 64; + <LCTL> = 37; + <SPCE> = 65; + <RCTL> = 109; + <RALT> = 113; + // Microsoft keyboard extra keys + <LWIN> = 115; + <RWIN> = 116; + <MENU> = 117; + + <ESC> = 9; + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + <FK11> = 95; + <FK12> = 96; + + <PRSC> = 111; + <SYRQ> = 92; + <SCLK> = 78; + <PAUS> = 110; + <BRK> = 114; + + <INS> = 106; + <HOME> = 97; + <PGUP> = 99; + <DELE> = 107; + <END> = 103; + <PGDN> = 105; + + <UP> = 98; + <LEFT> = 100; + <DOWN> = 104; + <RGHT> = 102; + + <NMLK> = 77; + <KPDV> = 112; + <KPMU> = 63; + <KPSU> = 82; + + <KP7> = 79; + <KP8> = 80; + <KP9> = 81; + <KPAD> = 86; + + <KP4> = 83; + <KP5> = 84; + <KP6> = 85; + + <KP1> = 87; + <KP2> = 88; + <KP3> = 89; + <KPEN> = 108; + + <KP0> = 90; + <KPDL> = 91; + <KPEQ> = 126; + + <FK13> = 118; + <FK14> = 119; + <FK15> = 120; + <FK16> = 121; + <FK17> = 122; + <KPDC> = 123; + + // Keys that are generated on Japanese keyboards + + alias <HZTG> = <TLDE>; // Hankaku_Zenkaku toggle + <HKTG> = 208; // Hiragana_Katakana toggle + <AB11> = 211; // backslash/underscore + <XFER> = 129; // Henkan + <NFER> = 131; // Muhenkan + <AE13> = 133; // Yen + + // Keys that are generated on Korean keyboards + + alias <HNGL> = <FK16>; // Hangul Latin toggle + alias <HJCV> = <FK17>; // Hangul to Hanja conversion + + // Extended keys that may be generated on "Internet" keyboards. + // These are not standardised, hence the meaningless names. + // The entries commented out are never generated because the raw codes + // in those positions are already used for well-defined keys. + + alias <I01> = <XFER>; + <I02> = 130; + alias <I03> = <NFER>; + <I04> = 132; + alias <I05> = <AE13>; + <I06> = 134; + <I07> = 135; + <I08> = 136; + <I09> = 137; + <I0A> = 138; + <I0B> = 139; + <I0C> = 140; + <I0D> = 141; + <I0E> = 142; + <I0F> = 143; + <I10> = 144; + <I11> = 145; + <I12> = 146; + <I13> = 147; + <I14> = 148; + <I15> = 149; + <I16> = 150; + <I17> = 151; + <I18> = 152; + <I19> = 153; + <I1A> = 154; + <I1B> = 155; + // <I1C> = 156; <META> + // <I1D> = 157; <K59> + <I1E> = 158; + <I1F> = 159; + <I20> = 160; + <I21> = 161; + <I22> = 162; + <I23> = 163; + <I24> = 164; + <I25> = 165; + <I26> = 166; + <I27> = 167; + <I28> = 168; + <I29> = 169; + // <I2A> = 170; <K5A> + <I2B> = 171; + <I2C> = 172; + <I2D> = 173; + <I2E> = 174; + <I2F> = 175; + <I30> = 176; + <I31> = 177; + <I32> = 178; + <I33> = 179; + <I34> = 180; + // <I35> = 181; <K5B> + // <I36> = 182; <K5D> + // <I37> = 183; <K5E> + // <I38> = 184; <K5F> + <I39> = 185; + <I3A> = 186; + <I3B> = 187; + <I3C> = 188; + // <I3D> = 189; <K62> + // <I3E> = 190; <K63> + // <I3F> = 191; <K64> + // <I40> = 192; <K65> + // <I41> = 193; <K66> + <I42> = 194; + <I43> = 195; + <I44> = 196; + <I45> = 197; + // <I46> = 198; <K67> + // <I47> = 199; <K68> + // <I48> = 200; <K69> + // <I49> = 201; <K6A> + <I4A> = 202; + // <I4B> = 203; <K6B> + // <I4C> = 204; <K6C> + // <I4D> = 205; <K6D> + // <I4E> = 206; <K6E> + // <I4F> = 207; <K6F> + // <I50> = 208; <K70> + // <I51> = 209; <K71> + // <I52> = 210; <K72> + // <I53> = 211; <K73> + <I54> = 212; + <I55> = 213; + <I56> = 214; + <I57> = 215; + <I58> = 216; + <I59> = 217; + <I5A> = 218; + // <I5B> = 219; <K74> + // <I5C> = 220; <K75> + // <I5D> = 221; <K76> + <I5E> = 222; + <I5F> = 223; + <I60> = 224; + <I61> = 225; + <I62> = 226; + <I63> = 227; + <I64> = 228; + <I65> = 229; + <I66> = 230; + <I67> = 231; + <I68> = 232; + <I69> = 233; + <I6A> = 234; + <I6B> = 235; + <I6C> = 236; + <I6D> = 237; + <I6E> = 238; + <I6F> = 239; + <I70> = 240; + <I71> = 241; + <I72> = 242; + <I73> = 243; + <I74> = 244; + <I75> = 245; + <I76> = 246; + <I77> = 247; + <I78> = 248; + <I79> = 249; + <I7A> = 250; + <I7B> = 251; + <I7C> = 252; + <I7D> = 253; + <I7E> = 254; + <I7F> = 255; + + // Codes generated for scancodes 0x59-0x5f, 0x62-0x76 + <K59> = 157; // <I1D> + <K5A> = 170; // <I2A> + <K5B> = 181; // <I35> + alias <K5C> = <KPEQ>; + <K5D> = 182; // <I36> + <K5E> = 183; // <I37> + <K5F> = 184; // <I38> + <K62> = 189; // <I3D> + <K63> = 190; // <I3E> + <K64> = 191; // <I3F> + <K65> = 192; // <I40> + <K66> = 193; // <I41> + <K67> = 198; // <I46> + <K68> = 199; // <I47> + <K69> = 200; // <I48> + <K6A> = 201; // <I49> + <K6B> = 203; // <I4B> + <K6C> = 204; // <I4C> + <K6D> = 205; // <I4D> + <K6E> = 206; // <I4E> + <K6F> = 207; // <I4F> + alias <K70> = <HKTG>; // <I50> + <K71> = 209; // <I51> + <K72> = 210; // <I52> + alias <K73> = <AB11>; // <I53> + <K74> = 219; // <I5B> + <K75> = 220; // <I5C> + <K76> = 221; // <I5D> + + // Solaris compatibility + + alias <LMTA> = <LWIN>; + alias <RMTA> = <RWIN>; + alias <COMP> = <MENU>; + alias <POWR> = <I0C>; + alias <MUTE> = <I0D>; + alias <VOL-> = <I0E>; + alias <VOL+> = <I0F>; + alias <HELP> = <I10>; + alias <STOP> = <I11>; + alias <AGAI> = <I12>; + alias <PROP> = <I13>; + alias <UNDO> = <I14>; + alias <FRNT> = <I15>; + alias <COPY> = <I16>; + alias <OPEN> = <I17>; + alias <PAST> = <I18>; + alias <FIND> = <I19>; + alias <CUT> = <I1A>; + + // Other codes never generated. The XFree86 ddx never generates + // these codes. + // Thus we can use them as fake keys + <MDSW> = 93; // <U5D> + <LVL3> = 124; // <U7C> + <ALT> = 125; // <U7D> + <META> = 156; // <I1C> + <SUPR> = 127; // <U7F> + <HYPR> = 128; // <U80> + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; + + alias <ALGR> = <RALT>; +}; + +// What keyboard is this? + +xkb_keycodes "102" { + include "xfree86(xfree86)" + + // There will be warnings from xkbcomp because of multiple definitions. + + <RALT> = 122; + <RCTL> = 123; + + <PRSC> = 121; + <PAUS> = 118; + + <INS> = 131; + <HOME> = 135; + <PGUP> = 119; + <DELE> = 129; + <END> = 130; + <PGDN> = 134; + + <UP> = 128; + <LEFT> = 132; + <DOWN> = 120; + <RGHT> = 133; + + <KPDV> = 125; + + <KPEN> = 124; +}; + + +// For japanese 106 keyboard. by tsuka(tsuka@kawalab.dnj.ynu.ac.jp) +// +// All of the keycodes here are now in the basic "xfree86" set. +// +xkb_keycodes "jp106" { + include "xfree86(basic)" + <AC12> = 51; +}; + + +// For brazilian ABNT2 keyboard. by Ricardo Y. Igarashi(iga@that.com.br) +xkb_keycodes "abnt2" { + include "xfree86(basic)" + <BKSL> = 94; + <AC12> = 51; + <KPPT> = 134; +}; + + diff --git a/keycodes/xfree98 b/keycodes/xfree98 new file mode 100644 index 0000000..6d34772 --- /dev/null +++ b/keycodes/xfree98 @@ -0,0 +1,155 @@ +// $Xorg: xfree98,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keycodes/xfree98,v 3.6 2001/01/17 23:45:51 dawes Exp $ +// +default xkb_keycodes "pc98" { + + minimum= 8; + maximum= 134; + + <ESC> = 8; + <AE01> = 9; + <AE02> = 10; + <AE03> = 11; + <AE04> = 12; + <AE05> = 13; + <AE06> = 14; + <AE07> = 15; + <AE08> = 16; + <AE09> = 17; + <AE10> = 18; + <AE11> = 19; + <AE12> = 20; + <BKSL> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <LCTL> = 124; + <CAPS> = 121; + <AC01> = 37; + <AC02> = 38; + <AC03> = 39; + <AC04> = 40; + <AC05> = 41; + <AC06> = 42; + <AC07> = 43; + <AC08> = 44; + <AC09> = 45; + <AC10> = 46; + <AC11> = 47; + <AC12> = 48; + + <LFSH> = 120; + <AB01> = 49; + <AB02> = 50; + <AB03> = 51; + <AB04> = 52; + <AB05> = 53; + <AB06> = 54; + <AB07> = 55; + <AB08> = 56; + <AB09> = 57; + <AB10> = 58; + <AB11> = 59; + + <ALGR> = 122; + <LALT> = 123; + <NFER> = 89; + <SPCE> = 60; + <XFER> = 61; + + <BRK> = 104; + <PRSC> = 105; + <FK01> = 106; + <FK02> = 107; + <FK03> = 108; + <FK04> = 109; + <FK05> = 110; + <FK06> = 111; + <FK07> = 112; + <FK08> = 113; + <FK09> = 114; + <FK10> = 115; + <FK11> = 90; + <FK12> = 91; + <FK13> = 92; + <FK14> = 93; + <FK15> = 94; + + + <INS> = 64; + <DELE> = 65; + <PGUP> = 63; + <PGDN> = 62; + <UP> = 66; + <LEFT> = 67; + <RGHT> = 68; + <DOWN> = 69; + + <HOME> = 70; + <HELP> = 71; + + <KPSU> = 72; + <KPDV> = 73; + + <KP7> = 74; + <KP8> = 75; + <KP9> = 76; + <KPMU> = 77; + + <KP4> = 78; + <KP5> = 79; + <KP6> = 80; + <KPAD> = 81; + + <KP1> = 82; + <KP2> = 83; + <KP3> = 84; + <KPEQ> = 85; + + <KP0> = 86; + <KPSP> = 87; + <KPDC> = 88; + + indicator 1 = "Caps Lock"; + indicator 2 = "Kana"; +}; + diff --git a/keymap/README b/keymap/README new file mode 100644 index 0000000..adef966 --- /dev/null +++ b/keymap/README @@ -0,0 +1,8 @@ +The keymap component provides a way how to set up one pre-defined keyboard +mapping from a given set. It has been obsoleted by 'rules' component which +is simplier and more flexible. The directory is preserved for compatibility +reasons. Avoid using it if it is possible. + + + +/* $XFree86$ */ diff --git a/keymap/amiga b/keymap/amiga new file mode 100644 index 0000000..d697a98 --- /dev/null +++ b/keymap/amiga @@ -0,0 +1,22 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keymap/amiga,v 3.2 1997/10/26 13:25:36 dawes Exp $ + +default xkb_keymap "usa1" { + xkb_keycodes { include "amiga(usa1)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "amiga(usa1)" }; + xkb_geometry { include "amiga(usa1)" }; +}; + +xkb_keymap "de" { + xkb_keycodes { include "amiga(de)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "amiga(de)" }; + xkb_geometry { include "amiga(de)" }; +}; diff --git a/keymap/ataritt b/keymap/ataritt new file mode 100644 index 0000000..b801ac2 --- /dev/null +++ b/keymap/ataritt @@ -0,0 +1,21 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keymap/ataritt,v 3.1 1997/10/26 13:25:37 dawes Exp $ + +default xkb_keymap "us" { + xkb_keycodes { include "ataritt(us)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "ataritt(us)" }; + xkb_geometry { include "ataritt(us)" }; +}; +xkb_keymap "de" { + xkb_keycodes { include "ataritt(de)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "ataritt(de)" }; + xkb_geometry { include "ataritt(de)" }; +}; diff --git a/keymap/digital.vndr/us b/keymap/digital.vndr/us new file mode 100644 index 0000000..00058cd --- /dev/null +++ b/keymap/digital.vndr/us @@ -0,0 +1,188 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: us,v +// Revision 1.3 1996/06/18 09:14:51 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/10/25 21:00:53 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:24 William_Walker] +// +// Revision 1.1.2.6 1995/06/27 12:18:05 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:26:19 William_Walker] +// +// Revision 1.1.2.5 1995/06/05 19:23:12 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:14:04 William_Walker] +// +// EndLog +// +// @(#)RCSfile: us,v Revision: 1.3 (DEC) Date: 1996/02/02 14:21:15 +// + +// ************************************************************** +// * * +// * Keymaps for en_US.ISO8859-1 - English for U.S. * +// * * +// ************************************************************** + +xkb_keymap "lk201" { + xkb_keycodes { include "digital/lk(lk201)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt105)" }; + xkb_geometry { description = "Digital US LK201"; + include "digital/lk(lk201)" }; +}; + +xkb_keymap "lk401" { + xkb_keycodes { include "digital/lk(lk401)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK401"; + include "digital/lk(lk401)" }; +}; + +xkb_keymap "lk411" { + xkb_keycodes { include "digital/pc(lk411)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK411"; + include "digital/lk(lk401)" }; +}; + +xkb_keymap "lk421" { + xkb_keycodes { include "digital/lk(lk421)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(unix)" }; + xkb_geometry { description = "Digital US LK421"; + include "digital/unix(unix)" }; +}; + +xkb_keymap "lk441" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK441"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk443" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK443"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk44x" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK443"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk450" { + xkb_keycodes { include "digital/pc(lk450)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK450"; + include "digital/lk(lk450)" }; +}; + +xkb_keymap "pcxalaa" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalaa)" }; + xkb_geometry { description = "Digital US PCXAL-AA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxalfa" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalfa)" }; + xkb_geometry { description = "Digital US PCXAL-FA"; + include "digital/pc(pc101)" + include "digital/pc(leds_on_keys)" }; +}; + +xkb_keymap "pcxalga" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalga)" }; + xkb_geometry { description = "Digital US PCXAL-GA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxalka" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalka)" }; + xkb_geometry { description = "Digital US PCXAL-KA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxal" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxal)" }; + xkb_geometry { description = "Digital US PCXAL"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "mnk" { + xkb_keycodes { include "digital/pc(pc104)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pc104)" }; + xkb_geometry { include "microsoft" }; +}; diff --git a/keymap/macintosh b/keymap/macintosh new file mode 100644 index 0000000..d230dca --- /dev/null +++ b/keymap/macintosh @@ -0,0 +1,17 @@ +// $XConsortium: macintosh /main/11 1996/03/07 13:42:13 kaleb $ +// $XFree86: xc/programs/xkbcomp/keymap/macintosh,v 1.1 1999/05/23 05:27:51 dawes Exp $ +default xkb_keymap "macintosh" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "macintosh/us(extended)" }; + xkb_geometry { include "macintosh" }; +}; + +xkb_keymap "macintosh_old" { + xkb_keycodes { include "macintosh" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "macintosh/us(extended)" }; + xkb_geometry { include "macintosh" }; +}; diff --git a/keymap/sgi.vndr/be b/keymap/sgi.vndr/be new file mode 100644 index 0000000..ef8c3dc --- /dev/null +++ b/keymap/sgi.vndr/be @@ -0,0 +1,34 @@ +// $Xorg: be,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+be" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+be(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+be" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+be(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/bg b/keymap/sgi.vndr/bg new file mode 100644 index 0000000..46cd545 --- /dev/null +++ b/keymap/sgi.vndr/bg @@ -0,0 +1,19 @@ +// $Xorg: bg,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "us(pc_universal)+bg+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "us(pc102)+bg+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/ca b/keymap/sgi.vndr/ca new file mode 100644 index 0000000..9030e15 --- /dev/null +++ b/keymap/sgi.vndr/ca @@ -0,0 +1,33 @@ +// $Xorg: ca,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+ca" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+ca(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+ca" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+ca(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/cz b/keymap/sgi.vndr/cz new file mode 100644 index 0000000..b1c8598 --- /dev/null +++ b/keymap/sgi.vndr/cz @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+cz" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+cz" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/cz_qwerty b/keymap/sgi.vndr/cz_qwerty new file mode 100644 index 0000000..a87e7d5 --- /dev/null +++ b/keymap/sgi.vndr/cz_qwerty @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+cz_qwerty" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+cz_qwerty" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/de b/keymap/sgi.vndr/de new file mode 100644 index 0000000..1e4cfe7 --- /dev/null +++ b/keymap/sgi.vndr/de @@ -0,0 +1,34 @@ +// $Xorg: de,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+de" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+de" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/de_CH b/keymap/sgi.vndr/de_CH new file mode 100644 index 0000000..093a5b1 --- /dev/null +++ b/keymap/sgi.vndr/de_CH @@ -0,0 +1,34 @@ +// $Xorg: de_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+de_CH" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+de_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+de_CH" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+de_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/dk b/keymap/sgi.vndr/dk new file mode 100644 index 0000000..9eceffd --- /dev/null +++ b/keymap/sgi.vndr/dk @@ -0,0 +1,34 @@ +// $Xorg: dk,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+dk" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+dk(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+dk" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+dk(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/dvorak b/keymap/sgi.vndr/dvorak new file mode 100644 index 0000000..a282cd1 --- /dev/null +++ b/keymap/sgi.vndr/dvorak @@ -0,0 +1,15 @@ +// $Xorg: dvorak,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+dvorak" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+dvorak" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; diff --git a/keymap/sgi.vndr/en_US b/keymap/sgi.vndr/en_US new file mode 100644 index 0000000..446f563 --- /dev/null +++ b/keymap/sgi.vndr/en_US @@ -0,0 +1,58 @@ +// $Xorg: en_US,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy101" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy101_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy104" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "microsoft(natural)" }; +}; +xkb_keymap "indy104_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "microsoft(natural)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102_nodeadkeys)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/es b/keymap/sgi.vndr/es new file mode 100644 index 0000000..a57750c --- /dev/null +++ b/keymap/sgi.vndr/es @@ -0,0 +1,34 @@ +// $Xorg: es,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+es" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+es(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+es" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+es(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/fi b/keymap/sgi.vndr/fi new file mode 100644 index 0000000..bb0fd20 --- /dev/null +++ b/keymap/sgi.vndr/fi @@ -0,0 +1,34 @@ +// $Xorg: fi,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fi" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fi(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fi" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fi(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/fr b/keymap/sgi.vndr/fr new file mode 100644 index 0000000..ecf615f --- /dev/null +++ b/keymap/sgi.vndr/fr @@ -0,0 +1,34 @@ +// $Xorg: fr,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fr" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fr(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fr" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fr(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/fr_CH b/keymap/sgi.vndr/fr_CH new file mode 100644 index 0000000..3f825e0 --- /dev/null +++ b/keymap/sgi.vndr/fr_CH @@ -0,0 +1,34 @@ +// $Xorg: fr_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fr_CH" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fr_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fr_CH" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fr_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/gb b/keymap/sgi.vndr/gb new file mode 100644 index 0000000..5c7566c --- /dev/null +++ b/keymap/sgi.vndr/gb @@ -0,0 +1,34 @@ +// $Xorg: gb,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+gb" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+gb(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+gb" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+gb(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/hu b/keymap/sgi.vndr/hu new file mode 100644 index 0000000..92d31a8 --- /dev/null +++ b/keymap/sgi.vndr/hu @@ -0,0 +1,105 @@ +// $Xorg: hu,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+hu(basic)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_caps_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+hu(basic)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_caps_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/it b/keymap/sgi.vndr/it new file mode 100644 index 0000000..17d6a10 --- /dev/null +++ b/keymap/sgi.vndr/it @@ -0,0 +1,34 @@ +// $Xorg: it,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+it" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+it(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+it" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+it(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/jp b/keymap/sgi.vndr/jp new file mode 100644 index 0000000..c83900a --- /dev/null +++ b/keymap/sgi.vndr/jp @@ -0,0 +1,8 @@ +// $Xorg: jp,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(jp106)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+sgi/jp" }; + xkb_geometry { include "sgi/indy(jp106)" }; +}; diff --git a/keymap/sgi.vndr/no b/keymap/sgi.vndr/no new file mode 100644 index 0000000..ed293d2 --- /dev/null +++ b/keymap/sgi.vndr/no @@ -0,0 +1,34 @@ +// $Xorg: no,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+no" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+no(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+no" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+no(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/pl b/keymap/sgi.vndr/pl new file mode 100644 index 0000000..b75f1f3 --- /dev/null +++ b/keymap/sgi.vndr/pl @@ -0,0 +1,29 @@ +// $Xorg: pl,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+pl" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+pl(nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+pl" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+pl(nodeadkeys)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/pt b/keymap/sgi.vndr/pt new file mode 100644 index 0000000..eda0035 --- /dev/null +++ b/keymap/sgi.vndr/pt @@ -0,0 +1,34 @@ +// $Xorg: pt,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+pt" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+pt(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+pt" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+pt(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/ru b/keymap/sgi.vndr/ru new file mode 100644 index 0000000..6a2a189 --- /dev/null +++ b/keymap/sgi.vndr/ru @@ -0,0 +1,105 @@ +// $Xorg: ru,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+ru(basic)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_caps_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+ru(basic)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_caps_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/se b/keymap/sgi.vndr/se new file mode 100644 index 0000000..3fe54e2 --- /dev/null +++ b/keymap/sgi.vndr/se @@ -0,0 +1,34 @@ +// $Xorg: se,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+se" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+se(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+se" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+se(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/sk b/keymap/sgi.vndr/sk new file mode 100644 index 0000000..89bd9b5 --- /dev/null +++ b/keymap/sgi.vndr/sk @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+sk" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+sk" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/sk_qwerty b/keymap/sgi.vndr/sk_qwerty new file mode 100644 index 0000000..9094cbc --- /dev/null +++ b/keymap/sgi.vndr/sk_qwerty @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+sk_qwerty" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+sk_qwerty" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/th b/keymap/sgi.vndr/th new file mode 100644 index 0000000..b614913 --- /dev/null +++ b/keymap/sgi.vndr/th @@ -0,0 +1,17 @@ +// $Xorg: th,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+th+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+th+group(shift_toggle)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/us b/keymap/sgi.vndr/us new file mode 100644 index 0000000..2d704ca --- /dev/null +++ b/keymap/sgi.vndr/us @@ -0,0 +1,43 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy101_euro" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy_compose" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; +xkb_keymap "indigo_compose" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101compose)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; +xkb_keymap "indigo101_compose" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101euro)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; diff --git a/keymap/sony b/keymap/sony new file mode 100644 index 0000000..5380c4e --- /dev/null +++ b/keymap/sony @@ -0,0 +1,33 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "news5000-nwp5461" { + xkb_keycodes { include "sony(nwp5461)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sony/us(nwp5461)" }; + xkb_geometry { include "sony(nwp5461)" }; +}; diff --git a/keymap/sun.vndr/de b/keymap/sun.vndr/de new file mode 100644 index 0000000..0b4bd53 --- /dev/null +++ b/keymap/sun.vndr/de @@ -0,0 +1,78 @@ +// $Xorg: de,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "type4_de" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+de" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_de_nodeadkeys" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_de_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+de" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_de" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+de" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_de_nodeadkeys" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_de_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+de" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/es b/keymap/sun.vndr/es new file mode 100644 index 0000000..ab29c43 --- /dev/null +++ b/keymap/sun.vndr/es @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/es,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_es" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+es" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_es_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+es" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_es" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+es" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_es_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+es" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/fi b/keymap/sun.vndr/fi new file mode 100644 index 0000000..3ca6003 --- /dev/null +++ b/keymap/sun.vndr/fi @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/fi,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_fi" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+fi" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_fi_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+fi" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_fi" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+fi" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_fi_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+fi" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/fr b/keymap/sun.vndr/fr new file mode 100644 index 0000000..60be0d1 --- /dev/null +++ b/keymap/sun.vndr/fr @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/fr,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_fr" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+fr" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_fr_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+fr" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_fr" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+fr" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_fr_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+fr" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/no b/keymap/sun.vndr/no new file mode 100644 index 0000000..d57fc49 --- /dev/null +++ b/keymap/sun.vndr/no @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/no,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_no" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+no" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_no_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+no" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_no" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+no" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_no_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+no" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/pl b/keymap/sun.vndr/pl new file mode 100644 index 0000000..d672db7 --- /dev/null +++ b/keymap/sun.vndr/pl @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/pl,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_pl" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+pl" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_pl_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+pl" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_pl" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+pl" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_pl_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+pl" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/ru b/keymap/sun.vndr/ru new file mode 100644 index 0000000..9dead90 --- /dev/null +++ b/keymap/sun.vndr/ru @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/ru,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_ru" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+ru" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_ru_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+ru" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_ru" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+ru" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_ru_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+ru" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/se b/keymap/sun.vndr/se new file mode 100644 index 0000000..dd0a167 --- /dev/null +++ b/keymap/sun.vndr/se @@ -0,0 +1,56 @@ +// $XFree86: xc/programs/xkbcomp/keymap/sun/se,v 1.2 1998/12/20 09:34:42 dawes Exp $ + +default xkb_keymap "type5c_se_fixdollar" { + xkb_keycodes { include "sun(type5_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun5)+se(fixdollar)" + }; + xkb_geometry { include "sun(type5c_se)" }; +}; +xkb_keymap "type5c_se" { + xkb_keycodes { include "sun(type5_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun5)" + }; + xkb_geometry { include "sun(type5c_se)" }; +}; +xkb_keymap "type5_se" { + xkb_keycodes { include "sun(type5_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun5)" + }; + xkb_geometry { include "sun(type5_se)" }; +}; +xkb_keymap "type4_se_fixdollar_swapctl" { + xkb_keycodes { include "sun(type4_se_swapctl)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun4)+se(fixdollar)" + }; + xkb_geometry { include "sun(type4_se)" }; +}; +xkb_keymap "type4_se_fixdollar" { + xkb_keycodes { include "sun(type4_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun4)+se(fixdollar)" + }; + xkb_geometry { include "sun(type4_se)" }; +}; +xkb_keymap "type4_se" { + xkb_keycodes { include "sun(type4_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun4)" + }; + xkb_geometry { include "sun(type4_se)" }; +}; diff --git a/keymap/sun.vndr/uk b/keymap/sun.vndr/uk new file mode 100644 index 0000000..d99e2ff --- /dev/null +++ b/keymap/sun.vndr/uk @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/uk,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_uk" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+uk" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_uk_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+uk" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_uk" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+uk" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_uk_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+uk" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/us b/keymap/sun.vndr/us new file mode 100644 index 0000000..2133c21 --- /dev/null +++ b/keymap/sun.vndr/us @@ -0,0 +1,68 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "type4_us" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun4)" }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_us_openlook" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun4ol)" }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_us" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5)" }; + xkb_geometry { include "sun(type5)" }; +}; +xkb_keymap "type5_us_openlook" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)" }; + xkb_geometry { include "sun(type5)" }; +}; +xkb_keymap "type5_unix" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5)" }; + xkb_geometry { include "sun(type5unix)" }; +}; +xkb_keymap "type5_unix_openlook" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)" }; + xkb_geometry { include "sun(type5unix)" }; +}; diff --git a/keymap/xfree86 b/keymap/xfree86 new file mode 100644 index 0000000..e1967a1 --- /dev/null +++ b/keymap/xfree86 @@ -0,0 +1,362 @@ +// $XFree86: xc/programs/xkbcomp/keymap/xfree86,v 3.30 2003/04/03 16:34:49 dawes Exp $ + + +default xkb_keymap "us" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "pc" }; +}; + +// "ar" addition by Arabeyes Team, <support@arabeyes.org> +xkb_keymap "ar" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ar" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "be" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+be" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "bg" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+bg" }; + xkb_geometry { include "pc(pc102)" }; +}; +// us_intl and br by Ricardo Y. Igarashi (iga@that.com.br) +xkb_keymap "br" { + xkb_keycodes { include "xfree86(abnt2)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+br" }; + xkb_geometry { include "pc(abnt2)" }; +}; +// cz and sk keymaps by Kamil Toman (ktoman@email.cz) +// are designed to replace old czechoslovakian and czsk keyboards +// and their prog variants. Those are now obsolete and should not be used anymore. +xkb_keymap "cz" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+cz" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "cz_qwerty" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+cz_qwerty" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "de" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+de" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "de_CH" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+de_CH" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "dk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+dk" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "dvorak" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+dvorak" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "en_US" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "es" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+es" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr-latin9" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr-latin9" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "fr_CA" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ca" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr_CH" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr_CH" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "gb" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+gb" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "hr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+hr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "it" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+it" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "jp106" { + xkb_keycodes { include "xfree86(jp106)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "jp(jp106)" }; + xkb_geometry { include "pc(jp106)" }; +}; +xkb_keymap "lt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lt" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "lt_std" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lt_std" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "lv" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lv" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mk" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mt" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mt_us" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mt_us" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "no" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+no" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "pl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+pl" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "pt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+pt" }; + xkb_geometry { include "pc(pc102)" }; +}; +// ro: additions by Cristian Gafton, <gafton@redhat.com> +xkb_keymap "ro" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc101)+ro(pc101)" }; + xkb_geometry { include "pc(pc101)" }; +}; +xkb_keymap "ro_microsoft" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ro(pc105)" }; + xkb_geometry { include "pc(pc105)" }; +}; +xkb_keymap "ru" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ru" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "se_FI" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fi" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "se_SE" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+se" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "sl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+si" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "sl_SI" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+si" }; + xkb_geometry { include "pc(pc102)" }; +}; +// cz and sk keymaps by Kamil Toman (ktoman@email.cz) +// are designed to replace old czechoslovakian and czsk keyboards +// and their prog variants. Those are now obsolete and should not be used anymore. +xkb_keymap "sk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+sk" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "sk_qwerty" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+sk_qwerty" }; + xkb_geometry { include "pc" }; +}; +// Additions by Emil Soleyman-Zomalan, <emil@nishra.com> +xkb_keymap "syr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+syr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th_tis" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th_tis" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th_pat" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th_pat" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "tr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+tr" }; + xkb_geometry { include "pc(pc102)" }; +}; +x |