summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorsvu <svu>2004-04-10 02:08:51 +0000
committersvu <svu>2004-04-10 02:08:51 +0000
commit9bbda6bfbcc29a575ea3b5cb7bd2553767e80d53 (patch)
tree8bc7094a3bc1cd14e8c652d0f4669f3371f80407
parentcfecfecb04a7c73bdd79e659b1d4f1192593ce8c (diff)
first feed-in of the layouts. The revolution is coming
-rw-r--r--Makefile.am11
-rw-r--r--README27
-rw-r--r--README.config198
-rw-r--r--README.enhancing511
-rw-r--r--compat/.cvsignore2
-rw-r--r--compat/Makefile.am13
-rw-r--r--compat/README37
-rw-r--r--compat/accessx54
-rw-r--r--compat/basic59
-rw-r--r--compat/complete10
-rw-r--r--compat/default11
-rw-r--r--compat/group_led22
-rw-r--r--compat/iso999584
-rw-r--r--compat/japan29
-rw-r--r--compat/keypad60
-rw-r--r--compat/leds24
-rw-r--r--compat/misc121
-rw-r--r--compat/mousekeys182
-rw-r--r--compat/norepeat11
-rw-r--r--compat/pc18
-rw-r--r--compat/pc9862
-rw-r--r--compat/xfree8657
-rw-r--r--compat/xtest58
-rw-r--r--configure.in33
-rw-r--r--geometry/.cvsignore2
-rw-r--r--geometry/Makefile.am15
-rw-r--r--geometry/README10
-rw-r--r--geometry/amiga270
-rw-r--r--geometry/ataritt257
-rw-r--r--geometry/chicony190
-rw-r--r--geometry/dell185
-rw-r--r--geometry/digital.vndr/.cvsignore2
-rw-r--r--geometry/digital.vndr/Makefile.am6
-rw-r--r--geometry/digital.vndr/lk730
-rw-r--r--geometry/digital.vndr/pc350
-rw-r--r--geometry/digital.vndr/unix230
-rw-r--r--geometry/everex174
-rw-r--r--geometry/fujitsu315
-rw-r--r--geometry/hp456
-rw-r--r--geometry/ibm.vndr/.cvsignore2
-rw-r--r--geometry/ibm.vndr/Makefile.am6
-rw-r--r--geometry/ibm.vndr/thinkpad267
-rw-r--r--geometry/keytronic255
-rw-r--r--geometry/kinesis193
-rw-r--r--geometry/macintosh174
-rw-r--r--geometry/microsoft256
-rw-r--r--geometry/nec159
-rw-r--r--geometry/northgate172
-rw-r--r--geometry/pc1159
-rw-r--r--geometry/sgi.vndr/.cvsignore2
-rw-r--r--geometry/sgi.vndr/Makefile.am6
-rw-r--r--geometry/sgi.vndr/O2618
-rw-r--r--geometry/sgi.vndr/indigo413
-rw-r--r--geometry/sgi.vndr/indy601
-rw-r--r--geometry/sony180
-rw-r--r--geometry/sun1338
-rw-r--r--geometry/winbook144
-rw-r--r--keycodes/README10
-rw-r--r--keycodes/aliases101
-rw-r--r--keycodes/amiga231
-rw-r--r--keycodes/ataritt123
-rw-r--r--keycodes/digital.vndr/lk271
-rw-r--r--keycodes/digital.vndr/pc280
-rw-r--r--keycodes/fujitsu187
-rw-r--r--keycodes/hp271
-rw-r--r--keycodes/ibm151
-rw-r--r--keycodes/macintosh161
-rw-r--r--keycodes/powerpcps2134
-rw-r--r--keycodes/sgi.vndr/indigo140
-rw-r--r--keycodes/sgi.vndr/indy203
-rw-r--r--keycodes/sgi.vndr/iris11
-rw-r--r--keycodes/sony142
-rw-r--r--keycodes/sun819
-rw-r--r--keycodes/xfree86415
-rw-r--r--keycodes/xfree98155
-rw-r--r--keymap/README8
-rw-r--r--keymap/amiga22
-rw-r--r--keymap/ataritt21
-rw-r--r--keymap/digital.vndr/us188
-rw-r--r--keymap/macintosh17
-rw-r--r--keymap/sgi.vndr/be34
-rw-r--r--keymap/sgi.vndr/bg19
-rw-r--r--keymap/sgi.vndr/ca33
-rw-r--r--keymap/sgi.vndr/cz21
-rw-r--r--keymap/sgi.vndr/cz_qwerty21
-rw-r--r--keymap/sgi.vndr/de34
-rw-r--r--keymap/sgi.vndr/de_CH34
-rw-r--r--keymap/sgi.vndr/dk34
-rw-r--r--keymap/sgi.vndr/dvorak15
-rw-r--r--keymap/sgi.vndr/en_US58
-rw-r--r--keymap/sgi.vndr/es34
-rw-r--r--keymap/sgi.vndr/fi34
-rw-r--r--keymap/sgi.vndr/fr34
-rw-r--r--keymap/sgi.vndr/fr_CH34
-rw-r--r--keymap/sgi.vndr/gb34
-rw-r--r--keymap/sgi.vndr/hu105
-rw-r--r--keymap/sgi.vndr/it34
-rw-r--r--keymap/sgi.vndr/jp8
-rw-r--r--keymap/sgi.vndr/no34
-rw-r--r--keymap/sgi.vndr/pl29
-rw-r--r--keymap/sgi.vndr/pt34
-rw-r--r--keymap/sgi.vndr/ru105
-rw-r--r--keymap/sgi.vndr/se34
-rw-r--r--keymap/sgi.vndr/sk21
-rw-r--r--keymap/sgi.vndr/sk_qwerty21
-rw-r--r--keymap/sgi.vndr/th17
-rw-r--r--keymap/sgi.vndr/us43
-rw-r--r--keymap/sony33
-rw-r--r--keymap/sun.vndr/de78
-rw-r--r--keymap/sun.vndr/es62
-rw-r--r--keymap/sun.vndr/fi62
-rw-r--r--keymap/sun.vndr/fr62
-rw-r--r--keymap/sun.vndr/no62
-rw-r--r--keymap/sun.vndr/pl62
-rw-r--r--keymap/sun.vndr/ru62
-rw-r--r--keymap/sun.vndr/se56
-rw-r--r--keymap/sun.vndr/uk62
-rw-r--r--keymap/sun.vndr/us68
-rw-r--r--keymap/xfree86362
-rw-r--r--keymap/xfree9835
-rw-r--r--po/POTFILES.in2
-rw-r--r--po/af.po792
-rwxr-xr-xpo/az.po792
-rw-r--r--po/bg.po461
-rw-r--r--po/cs.po458
-rw-r--r--po/da.po458
-rw-r--r--po/fr.po458
-rw-r--r--po/hu.po458
-rw-r--r--po/nl.po458
-rw-r--r--po/ru.po2
-rw-r--r--po/sk.po458
-rw-r--r--po/sq.po788
-rw-r--r--po/sr.po458
-rw-r--r--po/sv.po822
-rw-r--r--po/tr.po458
-rw-r--r--po/uk.po461
-rw-r--r--po/zh_CN.po458
-rw-r--r--rules/README6
-rw-r--r--rules/base196
-rw-r--r--rules/base-it.lst51
-rw-r--r--rules/base.lst269
-rw-r--r--rules/base.xml.in (renamed from xfree86.xml.in)0
-rw-r--r--rules/sgi73
-rw-r--r--rules/sgi.lst82
-rw-r--r--rules/sun43
-rw-r--r--rules/sun.lst62
-rw-r--r--rules/xfree9829
-rw-r--r--rules/xfree98.lst30
-rw-r--r--rules/xkb.dtd (renamed from xkb.dtd)0
-rw-r--r--rules/xml2lst.pl288
-rw-r--r--semantics/basic7
-rw-r--r--semantics/complete7
-rw-r--r--semantics/default7
-rw-r--r--semantics/xtest7
-rw-r--r--symbols/al43
-rw-r--r--symbols/am174
-rw-r--r--symbols/ar142
-rw-r--r--symbols/be98
-rw-r--r--symbols/ben143
-rw-r--r--symbols/bg141
-rw-r--r--symbols/br60
-rw-r--r--symbols/by75
-rw-r--r--symbols/cz83
-rw-r--r--symbols/cz_qwerty21
-rw-r--r--symbols/de108
-rw-r--r--symbols/dev71
-rw-r--r--symbols/digital.vndr/lk131
-rw-r--r--symbols/digital.vndr/pc176
-rw-r--r--symbols/digital.vndr/us212
-rw-r--r--symbols/digital.vndr/vt159
-rw-r--r--symbols/dk44
-rw-r--r--symbols/dvorak278
-rw-r--r--symbols/dz87
-rw-r--r--symbols/ee55
-rw-r--r--symbols/el122
-rw-r--r--symbols/en_US22
-rw-r--r--symbols/es59
-rw-r--r--symbols/fi73
-rw-r--r--symbols/fo48
-rw-r--r--symbols/fr78
-rw-r--r--symbols/fr-latin9167
-rw-r--r--symbols/fujitsu.vndr/jp88
-rw-r--r--symbols/fujitsu.vndr/us145
-rw-r--r--symbols/gb61
-rw-r--r--symbols/ge_la52
-rw-r--r--symbols/ge_ru65
-rw-r--r--symbols/guj69
-rw-r--r--symbols/gur69
-rw-r--r--symbols/hp.vndr/us106
-rw-r--r--symbols/hr50
-rw-r--r--symbols/ie253
-rw-r--r--symbols/il154
-rw-r--r--symbols/il_phonetic46
-rw-r--r--symbols/ir69
-rw-r--r--symbols/is64
-rw-r--r--symbols/it63
-rw-r--r--symbols/iu67
-rw-r--r--symbols/kan69
-rw-r--r--symbols/la60
-rw-r--r--symbols/latin179
-rw-r--r--symbols/lo80
-rw-r--r--symbols/lt111
-rw-r--r--symbols/lv34
-rw-r--r--symbols/macintosh.vndr/de144
-rw-r--r--symbols/macintosh.vndr/de_CH150
-rw-r--r--symbols/macintosh.vndr/dk92
-rw-r--r--symbols/macintosh.vndr/es50
-rw-r--r--symbols/macintosh.vndr/fi19
-rw-r--r--symbols/macintosh.vndr/fr101
-rw-r--r--symbols/macintosh.vndr/fr_CH28
-rw-r--r--symbols/macintosh.vndr/gb19
-rw-r--r--symbols/macintosh.vndr/it93
-rw-r--r--symbols/macintosh.vndr/nl15
-rw-r--r--symbols/macintosh.vndr/no58
-rw-r--r--symbols/macintosh.vndr/pt66
-rw-r--r--symbols/macintosh.vndr/se56
-rw-r--r--symbols/macintosh.vndr/us204
-rw-r--r--symbols/mk67
-rw-r--r--symbols/ml91
-rw-r--r--symbols/mm66
-rw-r--r--symbols/mt34
-rw-r--r--symbols/mt_us22
-rw-r--r--symbols/nec.vndr/jp167
-rw-r--r--symbols/nl54
-rw-r--r--symbols/no46
-rw-r--r--symbols/ogham206
-rw-r--r--symbols/ori66
-rw-r--r--symbols/pc262
-rw-r--r--symbols/pl25
-rw-r--r--symbols/pl246
-rw-r--r--symbols/pt58
-rw-r--r--symbols/ro99
-rw-r--r--symbols/ru165
-rw-r--r--symbols/sapmi94
-rw-r--r--symbols/se46
-rw-r--r--symbols/se_FI10
-rw-r--r--symbols/se_NO10
-rw-r--r--symbols/se_SE10
-rw-r--r--symbols/sgi.vndr/jp46
-rw-r--r--symbols/si46
-rw-r--r--symbols/sk83
-rw-r--r--symbols/sk_qwerty21
-rw-r--r--symbols/sony.vndr/us93
-rw-r--r--symbols/sr211
-rw-r--r--symbols/sun.vndr/se193
-rw-r--r--symbols/sun.vndr/us338
-rw-r--r--symbols/sun.vndr/usb28
-rw-r--r--symbols/syr72
-rw-r--r--symbols/syr_phonetic72
-rw-r--r--symbols/tel69
-rw-r--r--symbols/th63
-rw-r--r--symbols/th_pat64
-rw-r--r--symbols/th_tis63
-rw-r--r--symbols/tj82
-rw-r--r--symbols/tml234
-rw-r--r--symbols/tr153
-rw-r--r--symbols/ua149
-rw-r--r--symbols/us122
-rw-r--r--symbols/us_intl54
-rw-r--r--symbols/uz81
-rw-r--r--symbols/xfree68.vndr/amiga132
-rw-r--r--symbols/xfree68.vndr/ataritt161
-rw-r--r--symbols/yu58
-rw-r--r--types/README8
-rw-r--r--types/basic40
-rw-r--r--types/cancel12
-rw-r--r--types/caps170
-rw-r--r--types/complete14
-rw-r--r--types/default14
-rw-r--r--types/extra96
-rw-r--r--types/iso999520
-rw-r--r--types/mousekeys13
-rw-r--r--types/numpad13
-rw-r--r--types/pc33
-rw-r--r--xkbdesc.spec.in (renamed from xfree86_xkb_xml.spec.in)0
275 files changed, 33133 insertions, 3866 deletions
diff --git a/Makefile.am b/Makefile.am
index 62169d2..9c27eda 100644
--- a/Makefile.am
+++ b/Makefile.am
@@ -1,16 +1,9 @@
-SUBDIRS = intl m4 po
+SUBDIRS = compat geometry intl keycodes keymap m4 po rules semantics symbols types
-xml_in_files = xfree86.xml.in
-xml_DATA = $(xml_in_files:.xml.in=.xml) xkb.dtd
-
-@INTLTOOL_XML_RULE@
-
-EXTRA_DIST= config.rpath mkinstalldirs config.rpath $(xml_in_files) $(xml_DATA) \
+EXTRA_DIST= config.rpath mkinstalldirs config.rpath \
autogen.sh \
xfree86_xkb_xml.spec \
xfree86_xkb_xml.spec.in \
intltool-extract.in intltool-merge.in intltool-update.in
-xmldir = $(xkb_base)/rules
-
ACLOCAL_AMFLAGS = -I m4
diff --git a/README b/README
index ff8a005..8dd7a58 100644
--- a/README
+++ b/README
@@ -1,2 +1,25 @@
-This is just a module containing xmlized directory of the
-XKB configuration repository. At the moment, only xfree86. is maintainer here.
+X Keyboard Extension
+--------------------
+
+The X Keyboard Extension essentially replaces the core protocol definition of
+keyboard. The extension makes possible to clearly and explicitly specify most
+aspects of keyboard behaviour on per-key basis and to more closely track the
+logical and physical state of the keyboard. It also includes a number of
+keyboard controls designed to make keyboards more accessible to people with
+physical impairments.
+
+There are five types of components in the server database corresponing to five
+xkb symbolic names: symbols, geometry, keycodes, compat and types which
+determine the keyboard behaviour. These five components can combined together
+into a resulting keyboard mapping using the 'rules' component.
+
+The complete specification can be found on
+http://www.x-docs.org/XKB/XKBproto.pdf
+
+For XKB configuration information see 'README.config' file.
+
+For information how to further enhance XKB configuration see 'README.enhancing'
+file.
+
+
+$XFree86$
diff --git a/README.config b/README.config
new file mode 100644
index 0000000..229049d
--- /dev/null
+++ b/README.config
@@ -0,0 +1,198 @@
+ The XKB Configuration Guide
+
+ Kamil Toman, Ivan U. Pascal
+
+ 25 November 2002
+
+ Abstract
+
+ This document describes how to configure XFree86 XKB from a user's
+ point a few. It converts basic configuration syntax and gives also
+ a few examples.
+
+1. Overview
+
+The XKB configuration is decomposed into a number of components. Selecting
+proper parts and combining them back you can achieve most of configurations
+you might need. Unless you have a completely atypical keyboard you really
+don't need to touch any of xkb configuration files.
+
+2. Selecting XKB Configuration
+
+The easiest and the most natural way how to specify a keyboard mapping is to
+use rules component. As its name suggests it describes a number of general
+rules how to combine all bits and pieces into a valid and useful keyboard
+mapping. All you need to do is to select a suitable rules file and then to
+feed it with a few parameters that will adjust the keyboard behaviour to ful-
+fill your needs.
+
+The parameters are:
+
+ o XkbRules - files of rules to be used for keyboard mapping composition
+
+ o XkbModel - name of model of your keyboard type
+
+ o XkbLayout - layout(s) you intend to use
+
+ o XkbVariant - variant(s) of layout you intend to use
+
+ o XkbOptions - extra xkb configuration options
+
+The proper rules file depends on your vendor. In reality, the commonest file
+of rules is xfree86. For each rules file there is a description file named
+<vendor-rules>.lst, for instance xfree86.lst which is located in xkb configu-
+ration subdirectory rules (for example /etc/X11/xkb/rules).
+
+2.1 Basic Configuration
+
+Let's say you want to configure a PC style America keyboard with 104 keys as
+described in xfree86.lst. It can be done by simply writing several lines from
+below to you XFree86 configuration file (often found as /etc/X11/XF86Config-4
+or /etc/X11/XF86Config):
+
+ Section "InputDevice"
+ Identifier "Keyboard1"
+ Driver "Keyboard"
+
+ Option "XkbModel" "pc104"
+ Option "XkbLayout" "us"
+ Option "XKbOptions" ""
+ EndSection
+
+The values of parameters XkbModel and XkbLayout are really not surprising.
+The parameters XkbOptions has been explicitly set to empty set of parameters.
+The parameter XkbVariant has been left out. That means the default variant
+named basic is loaded.
+
+Of course, this can be also done at runtime using utility setxkbmap. Shell
+command loading the same keyboard mapping would look like:
+
+ setxkbmap -rules xfree86 -model pc104 -layout us -option ""
+
+The configuration and the shell command would be very analogical for most
+other layouts (internationalized mappings).
+
+2.2 Advanced Configuration
+
+Since XFree86 4.3.x you can use multi-layouts xkb configuration. What does
+it mean? Basically it allows to load up to four different keyboard layouts at
+a time. Each such layout would reside in its own group. The groups (unlike
+complete keyboard remapping) can be switched very fast from one to another by
+a combination of keys.
+
+Let's say you want to configure your new Logitech cordless desktop keyboard,
+you intend to use three different layouts at the same time - us, czech and
+german (in this order), and that you are used to Alt-Shift combination for
+switching among them.
+
+Then the configuration snippet could look like this:
+
+ Section "InputDevice"
+ Identifier "Keyboard1"
+ Driver "Keyboard"
+
+ Option "XkbModel" "logicordless"
+ Option "XkbLayout" "us,cz,de"
+ Option "XKbOptions" "grp:alt_shift_toggle"
+ EndSection
+
+Of course, this can be also done at runtime using utility setxkbmap. Shell
+command loading the same keyboard mapping would look like:
+
+ setxkbmap -rules xfree86 -model logicordless -layout "us,cz,de" \
+ -option "grp:alt_shift_toggle"
+
+2.3 Even More Advanced Configuration
+
+Okay, let's say you are more demanding. You do like the example above but you
+want it to change a bit. Let's imagine you want the czech keyboard mapping to
+use another variant but basic. The configuration snippet then changes into:
+
+ Section "InputDevice"
+ Identifier "Keyboard1"
+ Driver "Keyboard"
+
+ Option "XkbModel" "logicordless"
+ Option "XkbLayout" "us,cz,de"
+ Option "XkbVariant" ",bksl,"
+ Option "XKbOptions" "grp:alt_shift_toggle"
+ EndSection
+
+That's seems tricky but it is not. The logic for settings of variants is the
+same as for layouts, that means the first and the third variant settings are
+left out (set to basic), the second is set to bksl (a special variant with an
+enhanced definition of the backslash key).
+
+Analogically, the loading runtime will change to:
+
+ setxkmap -rules xfree86 -model logicordless -layout "us,cz,de" \
+ -variant ",bksl," -option "grp:alt_shift_toggle"
+
+2.4 Basic Global Options
+
+See rules/*.lst files.
+
+3. Direct XKB Configuration
+
+Generally, you can directly prescribe what configuration of each of basic xkb
+components should be used to form the resulting keyboard mapping. This
+method is rather "brute force". You precisely need to know the structure and
+the meaning of all of used configuration components.
+
+This method also exposes all xkb configuration details directly into XFree86
+configuration file which is a not very fortunate fact. In rare occasions it
+may be needed, though. So how does it work?
+
+3.1 Basic Components
+
+There are five basic components used to form a keyboard mapping:
+
+ o key codes - a translation of the scan codes produced by the keyboard
+ into a suitable symbolic form
+
+ o types - a specification of what various combinations of modifiers pro-
+ duce
+
+ o key symbols - a translation of symbolic key codes into actual symbols
+
+ o geometry - a description of physical keyboard geometry
+
+ o compatibility maps - a specification of what action should each key pro-
+ duce in order to preserve compatibility with XKB-unware clients
+
+3.2 Example Configuration
+
+Look at the following example:
+
+ Section "InputDevice"
+ Identifier "Keyboard0"
+ Driver "Keyboard"
+
+ Option "XkbKeycodes" "xfree86"
+ Option "XkbTypes" "default"
+ Option "XkbSymbols" "en_US(pc104)+de+swapcaps"
+ Option "XkbGeometry" "pc(pc104)"
+ Option "XkbCompat" "basic+pc+iso9995"
+ EndSection
+
+This configuration sets the standard XFree86 default interpretation of key-
+board keycodes, sets the default modificator types. The symbol table is com-
+posed of extended US keyboard layout in its variant for pc keyboards with 104
+keys plus all keys for german layout are redefined respectively. Also the
+logical meaning of Caps-lock and Control keys is swapped. The standard key-
+board geometry (physical look) is set to pc style keyboard with 104 keys. The
+compatibility map is set to allow basic shifting, to allow Alt keys to be
+interpreted and also to allow iso9995 group shifting.
+
+4. Keymap XKB Configuration
+
+It is the formerly used way to configure xkb. The user included a special
+keymap file which specified the direct xkb configuration. This method has
+been obsoleted by previously described rules files which are far more flexi-
+ble and allow simpler and more intuitive syntax. It is preserved merely for
+compatibility reasons. Avoid using it if it is possible.
+
+ Generated from XFree86: xc/programs/Xserver/hw/xfree86/doc/sgml/XKB-Config.sgml,v 1.4 dawes Exp $
+
+
+$XFree86: $
diff --git a/README.enhancing b/README.enhancing
new file mode 100644
index 0000000..db78026
--- /dev/null
+++ b/README.enhancing
@@ -0,0 +1,511 @@
+ How to further enhance XKB configuration
+
+ Kamil Toman, Ivan U. Pascal
+
+ 25 November 2002
+
+ Abstract
+
+ This guide is aimed to relieve one's labour to create a new (inter-
+ nationalized) keyboard layout. Unlike other documents this guide
+ accents the keymap developer's point of view.
+
+1. Overview
+
+The developer of a new layout should read the xkb protocol specification (The
+X Keyboard Extension: Protocol Specification <URL:http://www.x-
+docs.org/XKB/XKBproto.pdf>) at least to clarify for himself some xkb-specific
+terms used in this document and elsewhere in xkb configuration. Also it shows
+wise to understand how the X server and a client digest their keyboard inputs
+(with and without xkb).
+
+A useful source is also Ivan Pascal's text about xkb configuration
+<URL:http://www.tsu.ru/~pascal/en/xkb> often referenced throughout this docu-
+ment.
+
+Note that this document covers only enhancements which are to be made to
+XFree86 version 4.3.x and above.
+
+2. The Basics
+
+At the startup (or at later at user's command) X server starts its xkb key-
+board module extension and reads data from a compiled configuration file.
+
+This compiled configuration file is prepared by the program xkbcomp which
+behaves altogether as an ordinary compiler (see man xkbcomp). Its input are
+human readable xkb configuration files which are verified and then composed
+into a useful xkb configuration. Users don't need to mess with xkbcomp them-
+selves, for them it is invisible. Usually, it is started upon X server
+startup.
+
+As you probably already know, the xkb configuration consists of five main
+modules:
+
+ Keycodes
+ Tables that defines translation from keyboard scan codes into
+ reasonable symbolic names, maximum, minimum legal keycodes, sym-
+ bolic aliases and description of physically present LED-indica-
+ tors. The primary sence of this component is to allow definitions
+ of maps of symbols (see below) to be independent of physical key-
+ board scancodes. There are two main naming conventions for sym-
+ bolic names (always four bytes long):
+
+ o names which express some traditional meaning like <SPCE>
+ (stands for space bar) or
+
+ o names which express some relative positioning on a key-
+ board, for example <AE01> (an exclamation mark on US key-
+ boards), on the right there are keys <AE02>, <AE03> etc.
+
+ Types
+ Types describe how the produced key is changed by active modi-
+ fiers (like Shift, Control, Alt, ...). There are several prede-
+ fined types which cover most of used combinations.
+
+ Compat
+ Compatibility component defines internal behaviour of modifiers.
+ Using compat component you can assign various actions (elabo-
+ rately described in xkb specification) to key events. This is
+ also the place where LED-indicators behaviour is defined.
+
+ Symbols
+ For i18n purposes, this is the most important table. It defines
+ what values (=symbols) are assigned to what keycodes (represented
+ by their symbolic name, see above). There may be defined more
+ than one value for each key and then it depends on a key type and
+ on modifiers state (respective compat component) which value will
+ be the resulting one.
+
+ Geometry
+ Geometry files aren't used by xkb itself but they may be used by
+ some external programs to depict a keyboard image.
+
+All these components have the files located in xkb configuration tree in sub-
+directories with the same names (usually in /usr/lib/X11/xkb).
+
+3. Enhancing XKB Configuration
+
+Most of xkb enhancements concerns a need to define new output symbols for the
+some input key events. In other words, a need to define a new symbol map (for
+a new language, standard or just to feel more comfortable when typing text).
+
+What do you need to do? Generally, you have to define following things:
+
+ o the map of symbols itself
+
+ o the rules to allow users to select the new mapping
+
+ o the description of the new layout
+
+First of all, it is good to go through existing layouts and to examine them
+if there is something you could easily adjust to fit your needs. Even if
+there is nothing similar you may get some ideas about basic concepts and used
+tricks.
+
+3.1 Levels And Groups
+
+Since XFree86 4.3.0 you can use multi-layout concept of xkb configuration.
+Though it is still in boundaries of xkb protocol and general ideas, the
+keymap designer must obey new rules when creating new maps. In exchange we
+get a more powerful and cleaner configuration system.
+
+Remember that it is the application which must decide which symbol matches
+which keycode according to effective modifier state. The X server itself
+sends only an input event message to. Of course, usually the general inter-
+pretation is processed by Xlib, Xaw, Motif, Qt, Gtk and similar libraries.
+The X server only supplies its mapping table (usually upon an application
+startup).
+
+You can think of the X server's symbol table as of a irregular table where
+each keycode has its row and where each combination of modifiers determines
+exactly one column. The resulting cell then gives the proper symbolic value.
+Not all keycodes need to bind different values for different combination of
+modifiers. <ENTER> key, for instance, usually doesn't depend on any modi-
+fiers so it its row has only one column defined.
+
+Note that in XKB there is no prior assumption that certain modifiers are
+bound to certain columns. By editing proper files (see keytypes (section 4.2,
+page 1)) this mapping can be changed as well.
+
+Unlike the original X protocol the XKB approach is far more flexible. It is
+comfortable to add one additional XKB term - group. You can think of a group
+as of a vector of columns per each keycode (naturally the dimension of this
+vector may differ for different keycodes). What is it good for? The group is
+not very useful unless you intend to use more than one logically different
+set of symbols (like more than one alphabet) defined in a single mapping ta-
+ble. But then, the group has a natural meaning - each symbol set has its own
+group and changing it means selecting a different one. XKB approach allows
+up to four different groups. The columns inside each group are called (shift)
+levels. The X server knows the current group and reports it together with
+modifier set and with a keycode in key events.
+
+To sum it up:
+
+ o for each keycode XKB keyboard map contains up to four one-dimensional
+ tables - groups (logically different symbol sets)
+
+ o for each group of a keycode XKB keyboard map contains some columns -
+ shift levels (values reached by combinations of Shift, Ctrl, Alt, ...
+ modifiers)
+
+ o different keycodes can have different number of groups
+
+ o different groups of one keycode can have different number of shift lev-
+ els
+
+ o the current group number is tracked by X server
+
+It is clear that if you sanely define levels, groups and sanely bind modi-
+fiers and associated actions you can have simultaneously loaded up to four
+different symbol sets where each of them would reside in its own group.
+
+The multi-layout concept provides a facility to manipulate xkb groups and
+symbol definitions in a way that allows almost arbitrary composition of pre-
+defined symbol tables. To keep it fully functional you have to:
+
+ o define all symbols only in the first group
+
+ o (re)define any modifiers with extra care to avoid strange (anisometric)
+ behaviour
+
+4. Defining New Layouts
+
+See Some Words About XKB internals <URL:http://www.tsu.ru/~pas-
+cal/en/xkb/internals.html> for explanation of used xkb terms and problems
+addressed by XKB extension.
+
+See Common notes about XKB configuration files language
+<URL:http://www.tsu.ru/~pascal/en/xkb/gram-common.html> for more precise
+explanation of syntax of xkb configuration files.
+
+4.1 Predefined XKB Symbol Sets
+
+If you are about to define some European symbol map extension, you might want
+to use on of four predefined latin alphabet layouts.
+
+Okay, let's assume you want extend an existing keymap and you want to over-
+ride a few keys. Let's take a simple U.K. keyboard as an example (defined in
+pc/gb):
+
+ partial default alphanumeric_keys
+ xkb_symbols "basic" {
+ include "pc/latin"
+
+ name[Group1]="Great Britain";
+
+ key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] };
+ key <AE03> { [ 3, sterling, threesuperior, sterling ] };
+ key <AC11> { [apostrophe, at, dead_circumflex, dead_caron] };
+ key <TLDE> { [ grave, notsign, bar, bar ] };
+ key <BKSL> { [numbersign, asciitilde, dead_grave, dead_breve ] };
+ key <RALT> { type[Group1]="TWO_LEVEL",
+ [ ISO_Level3_Shift, Multi_key ] };
+
+ modifier_map Mod5 { <RALT> };
+ };
+
+It defines a new layout in basic variant as an extension of common latin
+alphabet layout. The layout (symbol set) name is set to "Great Britain".
+Then there are redefinitions of a few keycodes and a modifiers binding. As
+you can see the number of shift levels is the same for <AE02>, <AE03>,
+<AC11>, <TLDE> and <BKSL> keys but it differs from number of shift levels of
+<RALT>.
+
+Note that the <RALT> key itself is a binding key for Mod5 and that it serves
+like a shift modifier for LevelThree, together with Shift as a multi-key. It
+is a good habit to respect this rule in a new similar layout.
+
+Okay, you could now define more variants of your new layout besides basic
+simply by including (augmenting/overriding/...) the basic definition and
+altering what may be needed.
+
+4.2 Key Types
+
+The differences in the number of columns (shift levels) are caused by a dif-
+ferent types of keys (see the types definition in section basics). Most key-
+codes have implicitly set the keytype in the included "pc/latin" file to
+"FOUR_LEVEL_ALPHABETIC". The only exception is <RALT> keycode which is
+explicitly set "TWO_LEVEL" keytype.
+
+All those names refer to pre-defined shift level schemes. Usually you can
+choose a suitable shift level scheme from default types scheme list in proper
+xkb component's subdirectory.
+
+The most used schemes are:
+
+ ONE_LEVEL
+ The key does not depend on any modifiers. The symbol from first
+ level is always chosen.
+
+ TWO_LEVEL
+ The key uses a modifier Shift and may have two possible values.
+ The second level may be chosen by Shift modifier. If Lock modi-
+ fier (usually Caps-lock) applies the symbol is further processed
+ using system-specific capitalization rules. If both Shift+Lock
+ modifier apply the symbol from the second level is taken and cap-
+ italization rules are applied (and usually have no effect).
+
+ ALPHABETIC
+ The key uses modifiers Shift and Lock. It may have two possible
+ values. The second level may be chosen by Shift modifier. When
+ Lock modifier applies, the symbol from the first level is taken
+ and further processed using system-specific capitalization rules.
+ If both Shift+Lock modifier apply the symbol from the first level
+ is taken and no capitalization rules applied. This is often
+ called shift-cancels-caps behaviour.
+
+ THREE_LEVEL
+ Is the same as TWO_LEVEL but it considers an extra modifier -
+ LevelThree which can be used to gain the symbol value from the
+ third level. If both Shift+LevelThree modifiers apply the value
+ from the third level is also taken. As in TWO_LEVEL, the Lock
+ modifier doesn't influence the resulting level. Only Shift and
+ LevelThree are taken into that consideration. If the Lock modi-
+ fier is active capitalization rules are applied on the resulting
+ symbol.
+
+ FOUR_LEVEL
+ Is the same as THREE_LEVEL but unlike LEVEL_THREE if both
+ Shift+LevelThree modifiers apply the symbol is taken from the
+ fourth level.
+
+ FOUR_LEVEL_ALPHABETIC
+ Is similar to FOUR_LEVEL but also defines shift-cancels-caps
+ behaviour as in ALPHABETIC. If Lock+LevelThree apply the symbol
+ from the third level is taken and the capitalization rules are
+ applied. If Lock+Shift+LevelThree apply the symbol from the
+ third level is taken and no capitalization rules are applied.
+
+ KEYPAD
+ As the name suggest this scheme is primarily used for numeric
+ keypads. The scheme considers two modifiers - Shift and NumLock.
+ If none of modifiers applies the symbol from the first level is
+ taken. If either Shift or NumLock modifiers apply the symbol from
+ the second level is taken. If both Shift+NumLock modifiers apply
+ the symbol from the first level is taken. Again, shift-cancels-
+ caps variant.
+
+ FOUR_LEVEL_KEYPAD
+ Is similar to KEYPAD scheme but considers also LevelThree modi-
+ fier. If LevelThree modifier applies the symbol from the third
+ level is taken. If Shift+LevelThree or NumLock+LevelThree apply
+ the symbol from the fourth level is taken. If all Shift+Num-
+ Lock+LevelThree modifiers apply the symbol from the third level
+ is taken. This also, shift-cancels-caps variant.
+
+Besides that, there are several schemes for special purposes:
+
+ PC_BREAK
+ It is similar to TWO_LEVEL scheme but it considers the Control
+ modifier rather than Shift. That means, the symbol from the sec-
+ ond level is chosen by Control rather than by Shift.
+
+ PC_SYSRQ
+ It is similar to TWO_LEVEL scheme but it considers the Alt modi-
+ fier rather than Shift. That means, the symbol from the second
+ level is chosen by Alt rather than by Shift.
+
+ CTRL+ALT
+ The key uses modifiers Alt and Control. It may have two possible
+ values. If only one modifier (Alt or Control) applies the symbol
+ from the first level is chosen. Only if both Alt+Control modi-
+ fiers apply the symbol from the second level is chosen.
+
+ SHIFT+ALT
+ The key uses modifiers Shift and Alt. It may have two possible
+ values. If only one modifier (Alt or Shift) applies the symbol
+ from the first level is chosen. Only if both Alt+Shift modifiers
+ apply the symbol from the second level is chosen.
+
+If needed, special caps schemes may be used. They redefine the standard
+behaviour of all *ALPHABETIC types. The layouts (maps of symbols) with keys
+defined in respective types then automatically change their behaviour accord-
+ingly. Possible redefinitions are:
+
+ o internal
+
+ o internal_nocancel
+
+ o shift
+
+ o shift_nocancel
+
+None of these schemes should be used directly. They are defined merely for
+'caps:' xkb options (used to globally change the layouts behaviour).
+
+Don't alter any of existing key types. If you need a different behaviour cre-
+ate a new one.
+
+4.2.1 More On Definitions Of Types
+
+When the XKB software deals with a separate type description it gets a com-
+plete list of modifiers that should be taken into account from the 'modi-
+fiers=<list of modifiers>' list and expects that a set of 'map[<combination
+of modifiers>]=<list of modifiers>' instructions that contain the mapping for
+each combination of modifiers mentioned in that list. Modifiers that are not
+explicitly listed are NOT taken into account when the resulting shift level
+is computed. If some combination is omitted the program (subroutine) should
+choose the first level for this combination (a quite reasonable behavior).
+
+Lets consider an example with two modifiers ModOne and ModTwo:
+
+ type "..." {
+ modifiers = ModOne+ModTwo;
+ map[None] = Level1;
+ map[ModOne] = Level2;
+ };
+
+In this case the map statements for ModTwo only and ModOne+ModTwo are omit-
+ted. It means that if the ModTwo is active the subroutine can't found
+explicit mapping for such combination an will use the default level i.e.
+Level1.
+
+But in the case the type described as:
+
+ type "..." {
+ modifiers = ModOne;
+ map[None] = Level1;
+ map[ModOne] = Level2;
+ };
+
+the ModTwo will not be taken into account and the resulting level depends on
+the ModOne state only. That means, ModTwo alone produces the Level1 but the
+combination ModOne+ModTwo produces the Level2 as well as ModOne alone.
+
+What does it mean if the second modifier is the Lock? It means that in the
+first case (the Lock itself is included in the list of modifiers but combina-
+tions with this modifier aren't mentioned in the map statements) the internal
+capitalization rules will be applied to the symbol from the first level. But
+in the second case the capitalization will be applied to the symbol chosen
+accordingly to he first modifier - and this can be the symbol from the first
+as well as from the second level.
+
+Usually, all modifiers introduced in 'modifiers=<list of modifiers>' list are
+used for shift level calculation and then discarded. Sometimes this is not
+desirable. If you want to use a modifier for shift level calculation but you
+don't want to discard it, you may list in 'preserve[<combination of modi-
+fiers>]=<list of modifiers>'. That means, for a given combination all listed
+modifiers will be preserved. If the Lock modifier is preserved then the
+resulting symbol is passed to internal capitalization routine regardless
+whether it has been used for a shift level calculation or not.
+
+Any key type description can use both real and virtual modifiers. Since real
+modifiers always have standard names it is not necessary to explicitly
+declare them. Virtual modifiers can have arbitrary names and can be declared
+(prior using them) directly in key type definition:
+
+ virtual_modifiers <comma-separated list of modifiers> ;
+
+as seen in for example basic, pc or mousekeys key type definitions.
+
+4.3 Rules
+
+Once you are finished with your symbol map you need to add it to rules file.
+The rules file describes how all the five basic keycodes, types, compat, sym-
+bols and geometry components should be composed to give a sensible resulting
+xkb configuration.
+
+The main advantage of rules over formerly used keymaps is a possibility to
+simply parameterize (once) fixed patterns of configurations and thus to ele-
+gantly allow substitutions of various local configurations into predefined
+templates.
+
+A pattern in a rules file (often located in /usr/lib/X11/xkb/rules) can be
+parameterized with four other arguments: Model, Layout, Variant and Options.
+For most cases parameters model and layout should be sufficient for choosing
+a functional keyboard mapping.
+
+The rules file itself is composed of pattern lines and lines with rules. The
+pattern line starts with an exclamation mark ('!') and describes how will the
+xkb interpret the following lines (rules). A sample rules file looks like
+this:
+
+ ! model = keycodes
+ macintosh_old = macintosh
+ ...
+ * = xfree86
+
+ ! model = symbols
+ hp = +inet(%m)
+ microsoftpro = +inet(%m)
+ geniuscomfy = +inet(%m)
+
+ ! model layout[1] = symbols
+ macintosh us = macintosh/us%(v[1])
+ * * = pc/pc(%m)+pc/%l[1]%(v[1])
+
+ ! model layout[2] = symbols
+ macintosh us = +macintosh/us[2]%(v[2]):2
+ * * = +pc/%l[2]%(v[2]):2
+
+ ! option = types
+ caps:internal = +caps(internal)
+ caps:internal_nocancel = +caps(internal_nocancel)
+
+Each rule defines what certain combination of values on the left side of
+equal sign ('=') results in. For example a (keyboard) model macintosh_old
+instructs xkb to take definitions of keycodes from file keycodes/macintosh
+while the rest of models (represented by a wild card '*') instructs it to
+take them from file keycodes/xfree86. The wild card represents all possible
+values on the left side which were not found in any of the previous rules.
+The more specialized (more complete) rules have higher precedence than gen-
+eral ones, i.e. the more general rules supply reasonable default values.
+
+As you can see some lines contain substitution parameters - the parameters
+preceded by the percent sign ('%'). The first alphabetical character after
+the percent sign expands to the value which has been found on the left side.
+For example +%l%(v) expands into +cz(bksl) if the respective values on the
+left side were cz layout in its bksl variant. More, if the layout resp. vari-
+ant parameter is followed by a pair of brackets ('[', ']') it means that xkb
+should place the layout resp. variant into specified xkb group. If the brack-
+ets are omitted the first group is the default value.
+
+So the second block of rules enhances symbol definitions for some particular
+keyboard models with extra keys (for internet, multimedia, ...) . Other mod-
+els are left intact. Similarly, the last block overrides some key type defi-
+nitions, so the common global behaviour ''shift cancels caps'' or ''shift
+doesn't cancel caps'' can be selected. The rest of rules produces special
+symbols for each variant us layout of macintosh keyboard and standard pc sym-
+bols in appropriate variants as a default.
+
+4.4 Descriptive Files of Rules
+
+Now you just need to add a detailed description to <rules>.xml description
+file so the other users (and external programs which often parse this file)
+know what is your work about.
+
+4.4.1 Old Descriptive Files
+
+The formerly used descriptive files were named <rules>.lst Its structure is
+very simple and quite self descriptive but such simplicity had also some cav-
+ities, for example there was no way how to describe local variants of layouts
+and there were problems with the localization of descriptions. To preserve
+compatibility with some older programs, new XML descriptive files can be con-
+verted to old format '.lst'.
+
+For each parameter of rules file should be described its meaning. For the
+rules file described above the .lst file could look like:
+
+ ! model
+ pc104 Generic 104-key PC
+ microsoft Microsoft Natural
+ pc98 PC-98xx Series
+ macintosh Original Macintosh
+ ...
+
+ ! layout
+ us U.S. English
+ cz Czech
+ de German
+ ...
+
+ ! option
+ caps:internal uses internal capitalization. Shift cancels Caps
+ caps:internal_nocancel uses internal capitalization. Shift doesn't cancel Caps
+
+And that should be it. Enjoy creating your own xkb mapping.
+
+ Generated from XFree86: xc/programs/Xserver/hw/xfree86/doc/sgml/XKB-Enhancing.sgml,v 1.2 dawes Exp $
+
+
+$XFree86: $
diff --git a/compat/.cvsignore b/compat/.cvsignore
new file mode 100644
index 0000000..282522d
--- /dev/null
+++ b/compat/.cvsignore
@@ -0,0 +1,2 @@
+Makefile
+Makefile.in
diff --git a/compat/Makefile.am b/compat/Makefile.am
new file mode 100644
index 0000000..b667bd1
--- /dev/null
+++ b/compat/Makefile.am
@@ -0,0 +1,13 @@
+compat_DATA = \
+accessx basic complete \
+default group_led iso9995 \
+japan keypad leds \
+misc mousekeys norepeat \
+pc pc98 xfree86 \
+xtest README
+
+EXTRA_DIST= $(compat_DATA)
+
+compatdir = $(xkb_base)/compat
+
+
diff --git a/compat/README b/compat/README
new file mode 100644
index 0000000..fb84d71
--- /dev/null
+++ b/compat/README
@@ -0,0 +1,37 @@
+The core protocol interpretation of keyboard modifiers does not include direct
+support for multiple keyboard groups, so XKB reports the effective keyboard
+group to XKB-aware clients using some of reserved bits in the state field of
+some core protocol events. This modified state field would not be interpreted
+correctly by XKB-unaware clients, so XKB provides a group compatibility mapping
+which remaps the keyboard group into a core modifier mask that has similar
+effects, when possible.
+
+XKB maintains three compatibility state components that are used to make
+XKB-unaware clients(*) work as well as possible:
+- The compatibility state which corresponds to the effective modifier and
+ effective group state.
+- The compatibility lookup state which is the core-protocol equivalent of the
+ lookup state.
+- The compatibility grab state which is the nearest core-protocol equivalent
+ of the grab state.
+
+Compatibility state are essentially the corresponding XKB states, but with
+keyboard group possibly encoded as one or more modifiers.
+
+Modifiers that correspond to each keyboard group are described in this
+group compatibility map.
+
+
+----
+(*) The implementation of XKB invisibly extends the X library to use the
+keyboard extension if it is present. That means, clients that use library or
+toolkit routines to interpret keyboard events automatically use all of XKB
+features; clients that directly interpret the state field of core protocol
+events or the keymap direcly may be affected by some of the XKB differences.
+Thus most clients can take all advantages without modification but it also
+means that XKB state can be reported to clients that have not explicitly
+requested the keyboard extension.
+
+
+
+/* $XFree86$ */
diff --git a/compat/accessx b/compat/accessx
new file mode 100644
index 0000000..3e4b461
--- /dev/null
+++ b/compat/accessx
@@ -0,0 +1,54 @@
+// $Xorg: accessx,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+default partial xkb_compatibility "basic" {
+ interpret AccessX_Enable {
+ action= LockControls(controls=AccessXKeys);
+ };
+};
+
+partial xkb_compatibility "full" {
+
+ interpret AccessX_Enable {
+ action= LockControls(controls=AccessXKeys);
+ };
+
+ interpret AccessX_Feedback_Enable {
+ action= LockControls(controls=AccessXFeedback);
+ };
+
+ interpret RepeatKeys_Enable {
+ action= LockControls(controls=RepeatKeys);
+ };
+
+ interpret SlowKeys_Enable {
+ action= LockControls(controls=SlowKeys);
+ };
+
+ interpret BounceKeys_Enable {
+ action= LockControls(controls=BounceKeys);
+ };
+
+ interpret StickyKeys_Enable {
+ action= LockControls(controls=StickyKeys);
+ };
+
+ interpret MouseKeys_Enable {
+ action= LockControls(controls=MouseKeys);
+ };
+
+ interpret MouseKeys_Accel_Enable {
+ action= LockControls(controls=MouseKeysAccel);
+ };
+
+ interpret Overlay1_Enable {
+ action= LockControls(controls=Overlay1);
+ };
+
+ interpret Overlay2_Enable {
+ action= LockControls(controls=Overlay2);
+ };
+
+ interpret AudibleBell_Enable {
+ action= LockControls(controls=AudibleBell);
+ };
+};
diff --git a/compat/basic b/compat/basic
new file mode 100644
index 0000000..f369b0b
--- /dev/null
+++ b/compat/basic
@@ -0,0 +1,59 @@
+// $Xorg: basic,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+// Minimal set of symbol interpretations to provide
+// reasonable default behavior (Num lock, shift and
+// caps lock and mode switch) and set up the
+// automatic updating of common keyboard LEDs.
+
+// $XFree86: xc/programs/xkbcomp/compat/basic,v 1.2 2000/11/06 19:24:10 dawes Exp $
+
+default xkb_compatibility "basic" {
+ virtual_modifiers NumLock,AltGr;
+
+ interpret.repeat= False;
+ setMods.clearLocks= True;
+ latchMods.clearLocks= True;
+ latchMods.latchToLock= True;
+
+ interpret Shift_Lock+AnyOf(Shift+Lock) {
+ action= LockMods(modifiers=Shift);
+ };
+
+ interpret Any+Lock {
+ action= LockMods(modifiers=Lock);
+ };
+
+ interpret Num_Lock+Any {
+ virtualModifier= NumLock;
+ action= LockMods(modifiers=NumLock);
+ };
+
+ interpret Mode_switch {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= SetGroup(group=+1);
+ };
+
+ interpret Any + Any {
+ action= SetMods(modifiers=modMapMods);
+ };
+
+ group 2 = AltGr;
+ group 3 = AltGr;
+ group 4 = AltGr;
+
+ indicator.allowExplicit= False;
+ indicator "Caps Lock" {
+ whichModState= Locked;
+ modifiers= Lock;
+ };
+ indicator "Num Lock" {
+ whichModState= Locked;
+ modifiers= NumLock;
+ };
+ indicator "Shift Lock" {
+ whichModState= Locked;
+ modifiers= Shift;
+ };
+ indicator.allowExplicit= True;
+};
diff --git a/compat/complete b/compat/complete
new file mode 100644
index 0000000..68f89c8
--- /dev/null
+++ b/compat/complete
@@ -0,0 +1,10 @@
+// $Xorg: complete,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+default xkb_compatibility "complete" {
+ include "basic"
+ augment "iso9995"
+ augment "mousekeys"
+ augment "accessx(full)"
+ augment "misc"
+ augment "xfree86"
+};
+
diff --git a/compat/default b/compat/default
new file mode 100644
index 0000000..7cea0f8
--- /dev/null
+++ b/compat/default
@@ -0,0 +1,11 @@
+// $Xorg: default,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+default xkb_compatibility "default" {
+ include "basic"
+ augment "mousekeys"
+ augment "accessx(basic)"
+ augment "misc"
+ augment "iso9995"
+// ??should be changed/renamed/removed
+// augment "xfree86"
+ augment "japan"
+};
diff --git a/compat/group_led b/compat/group_led
new file mode 100644
index 0000000..0805fa6
--- /dev/null
+++ b/compat/group_led
@@ -0,0 +1,22 @@
+// $XFree86: xc/programs/xkbcomp/compat/group_led,v 1.1.2.2 1999/07/22 14:21:30 hohndel Exp $
+// This is a "default" compatibility with a small modification:
+// an "Scroll Lock" LED now shows the active keyboard group
+default xkb_compatibility "group_led" {
+ include "basic"
+ augment "mousekeys"
+ augment "accessx(basic)"
+ augment "misc"
+ augment "iso9995"
+ augment "japan"
+// This is to make Mode_switch working even in group 2
+ virtual_modifiers AltGr;
+ interpret Mode_switch {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= SetGroup(group=+1);
+ };
+ indicator "Scroll Lock" {
+ allowExplicit;
+ groups= All-Group1;
+ };
+};
diff --git a/compat/iso9995 b/compat/iso9995
new file mode 100644
index 0000000..d513c1c
--- /dev/null
+++ b/compat/iso9995
@@ -0,0 +1,84 @@
+// $Xorg: iso9995,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+// Fairly complete set of symbol interpretations
+// to provide reasonable default behavior
+
+// $XFree86: xc/programs/xkbcomp/compat/iso9995,v 1.3 2003/02/21 03:16:34 dawes Exp $
+
+default partial xkb_compatibility "default" {
+ virtual_modifiers LevelThree,AltGr;
+
+ interpret.repeat= False;
+ setMods.clearLocks= True;
+ latchMods.clearLocks= True;
+ latchMods.latchToLock= True;
+
+ interpret ISO_Lock+Any {
+ action= ISOLock(affect= all,modifiers=modMapMods);
+ };
+
+ interpret ISO_Level2_Latch+Shift {
+ useModMapMods= level1;
+ action= LatchMods(modifiers=Shift);
+ };
+
+ interpret ISO_Level3_Shift+Any {
+ useModMapMods= level1;
+ virtualModifier= LevelThree;
+ action= SetMods(modifiers=LevelThree);
+ };
+
+ interpret ISO_Level3_Shift {
+ action= SetMods(modifiers=LevelThree);
+ };
+
+ interpret ISO_Level3_Latch+Any {
+ useModMapMods= level1;
+ virtualModifier= LevelThree;
+ action= LatchMods(modifiers=LevelThree);
+ };
+
+ interpret ISO_Level3_Latch {
+ action= LatchMods(modifiers=LevelThree);
+ };
+
+ interpret ISO_Level3_Lock+Any {
+ useModMapMods= level1;
+ virtualModifier= LevelThree;
+ action= LockMods(modifiers=LevelThree);
+ };
+
+ interpret ISO_Level3_Lock {
+ action= LockMods(modifiers=LevelThree);
+ };
+
+ interpret ISO_Group_Latch {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= LatchGroup(group=2);
+ };
+
+ interpret ISO_Next_Group {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= LockGroup(group=+1);
+ };
+
+ interpret ISO_Prev_Group {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= LockGroup(group=-1);
+ };
+ interpret ISO_First_Group {
+ action= LockGroup(group=1);
+ };
+
+ interpret ISO_Last_Group {
+ action= LockGroup(group=2);
+ };
+
+ indicator "Group 2" {
+ !allowExplicit;
+ groups= All-Group1;
+ };
+};
diff --git a/compat/japan b/compat/japan
new file mode 100644
index 0000000..34bcc09
--- /dev/null
+++ b/compat/japan
@@ -0,0 +1,29 @@
+// $Xorg: japan,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+// Japanese keyboards need Eisu and Kana shift and
+// lock keys, which are typically bound to the
+// second shift level for some other modifier key.
+// These interpretations disable the default
+// interpretation (which would have these keys set
+// the same modifier as the level one symbol).
+
+default partial xkb_compatibility "japan" {
+
+ interpret.repeat= False;
+
+ interpret Eisu_Shift+Lock {
+ action= NoAction();
+ };
+
+ interpret Eisu_toggle+Lock {
+ action= NoAction();
+ };
+
+ interpret Kana_Shift+Lock {
+ action= NoAction();
+ };
+
+ interpret Kana_Lock+Lock {
+ action= NoAction();
+ };
+};
diff --git a/compat/keypad b/compat/keypad
new file mode 100644
index 0000000..469edec
--- /dev/null
+++ b/compat/keypad
@@ -0,0 +1,60 @@
+// $Xorg: keypad,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+// Interpretations needed to implement the numeric keypad
+// as an overlay instead of a modifier.
+
+partial hidden xkb_compatibility "overlay" {
+ include "keypad(overlay1)"
+};
+partial hidden xkb_compatibility "overlay1" {
+ virtual_modifiers NumLock,AltGr;
+
+ interpret.repeat= False;
+ setMods.clearLocks= True;
+ latchMods.clearLocks= True;
+ latchMods.latchToLock= True;
+
+ interpret Num_Lock {
+ virtualModifier= NumLock;
+ action= LockControls(ctrls=overlay1);
+ };
+ interpret Num_Lock+Any {
+ virtualModifier= NumLock;
+ action= LockControls(ctrls=overlay1);
+ };
+
+ indicator.allowExplicit= True;
+ indicator.driveskbd= True;
+ replace indicator "Num Lock" {
+ whichModState= Locked;
+ modifiers= NumLock;
+ controls= Overlay1;
+ };
+ indicator.allowExplicit= True;
+};
+partial hidden xkb_compatibility "overlay2" {
+ virtual_modifiers NumLock,AltGr;
+
+ interpret.repeat= False;
+ setMods.clearLocks= True;
+ latchMods.clearLocks= True;
+ latchMods.latchToLock= True;
+
+ interpret Num_Lock {
+ virtualModifier= NumLock;
+ action= LockControls(ctrls=overlay2);
+ };
+ interpret Num_Lock+Any {
+ virtualModifier= NumLock;
+ action= LockControls(ctrls=overlay1);
+ };
+
+ indicator.allowExplicit= True;
+ indicator.driveskbd= True;
+ replace indicator "Num Lock" {
+ whichModState= Locked;
+ modifiers= NumLock;
+ controls= Overlay2;
+ };
+ indicator.allowExplicit= True;
+};
diff --git a/compat/leds b/compat/leds
new file mode 100644
index 0000000..3d61606
--- /dev/null
+++ b/compat/leds
@@ -0,0 +1,24 @@
+// Use keyboard LEDs to show alternative group
+//
+// $XFree86$
+
+partial xkb_compatibility "scroll" {
+ indicator "Scroll Lock" {
+ modifiers= None;
+ groups=All-group1;
+ };
+};
+
+partial xkb_compatibility "num" {
+ indicator "Num Lock" {
+ modifiers= None;
+ groups=All-group1;
+ };
+};
+
+partial xkb_compatibility "caps" {
+ indicator "Caps Lock" {
+ modifiers= None;
+ groups=All-group1;
+ };
+};
diff --git a/compat/misc b/compat/misc
new file mode 100644
index 0000000..e1dbfd5
--- /dev/null
+++ b/compat/misc
@@ -0,0 +1,121 @@
+// $XdotOrg: xc/programs/xkbcomp/compat/misc,v 1.1.4.4 2004/03/05 13:41:28 eich Exp $
+// $Xorg: misc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+//
+//
+//
+// $XFree86: xc/programs/xkbcomp/compat/misc,v 1.4 2003/05/15 13:31:57 pascal Exp $
+
+default partial xkb_compatibility "misc" {
+
+ virtual_modifiers Alt,Meta,Super,Hyper,ScrollLock;
+
+ // Interpretations for some other useful keys
+
+ interpret Terminate_Server {
+ action = Terminate();
+ };
+
+ setMods.clearLocks= True;
+
+ // Sets the "Alt" virtual modifier
+
+ interpret Alt_L+Any {
+ useModMapMods= level1;
+ virtualModifier= Alt;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Alt_L {
+ action = SetMods(modifiers=Alt);
+ };
+
+ interpret Alt_R+Any {
+ useModMapMods= level1;
+ virtualModifier= Alt;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Alt_R {
+ action = SetMods(modifiers=Alt);
+ };
+
+ // Sets the "Meta" virtual modifier
+
+ interpret Meta_L+Any {
+// useModMapMods= level1;
+ virtualModifier= Meta;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Meta_L {
+ action = SetMods(modifiers=Meta);
+ };
+
+ interpret Meta_R+Any {
+ useModMapMods= level1;
+ virtualModifier= Meta;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Meta_R {
+ action = SetMods(modifiers=Alt);
+ };
+
+ // Sets the "Super" virtual modifier
+
+ interpret Super_L+Any {
+// useModMapMods= level1;
+ virtualModifier= Super;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Super_L {
+ action = SetMods(modifiers=Super);
+ };
+
+ interpret Super_R+Any {
+ useModMapMods= level1;
+ virtualModifier= Super;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Super_R {
+ action = SetMods(modifiers=Super);
+ };
+
+ // Sets the "Hyper" virtual modifier
+
+ interpret Hyper_L+Any {
+// useModMapMods= level1;
+ virtualModifier= Hyper;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Hyper_L {
+ action = SetMods(modifiers=Hyper);
+ };
+
+ interpret Hyper_R+Any {
+ useModMapMods= level1;
+ virtualModifier= Hyper;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Hyper_R {
+ action = SetMods(modifiers=Hyper);
+ };
+
+ // Sets the "ScrollLock" virtual modifier and
+ // makes it actually lock when pressed. Sets
+ // up a map for the scroll lock indicator.
+ interpret Scroll_Lock+Any {
+ virtualModifier= ScrollLock;
+ action = LockMods(modifiers=modMapMods);
+ };
+
+ indicator "Scroll Lock" {
+ allowExplicit;
+ whichModState= Locked;
+ modifiers= ScrollLock;
+ };
+};
diff --git a/compat/mousekeys b/compat/mousekeys
new file mode 100644
index 0000000..6e9a208
--- /dev/null
+++ b/compat/mousekeys
@@ -0,0 +1,182 @@
+
+// $Xorg: mousekeys,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+// Interpretations for arrow keys and a bunch of other
+// common keysyms which make it possible to bind "mouse"
+// keys using xmodmap and activate or deactivate them
+// from the keyboard.
+
+default partial xkb_compatibility "mousekeys" {
+
+ // Keypad actions.
+ //
+ interpret.repeat= True;
+
+ interpret KP_1 {
+ action = MovePtr(x=-1,y= +1);
+ };
+ interpret KP_End {
+ action = MovePtr(x=-1,y= +1);
+ };
+
+ interpret KP_2 {
+ action = MovePtr(x=+0,y= +1);
+ };
+ interpret KP_Down {
+ action = MovePtr(x=+0,y= +1);
+ };
+
+ interpret KP_3 {
+ action = MovePtr(x=+1,y=+1);
+ };
+ interpret KP_Next {
+ action = MovePtr(x=+1,y=+1);
+ };
+
+ interpret KP_4 {
+ action = MovePtr(x=-1,y=+0);
+ };
+ interpret KP_Left {
+ action = MovePtr(x=-1,y=+0);
+ };
+
+ interpret KP_6 {
+ action = MovePtr(x=+1,y=+0);
+ };
+ interpret KP_Right {
+ action = MovePtr(x=+1,y=+0);
+ };
+
+ interpret KP_7 {
+ action = MovePtr(x=-1,y=-1);
+ };
+ interpret KP_Home {
+ action = MovePtr(x=-1,y=-1);
+ };
+
+ interpret KP_8 {
+ action = MovePtr(x=+0,y=-1);
+ };
+ interpret KP_Up {
+ action = MovePtr(x=+0,y=-1);
+ };
+
+ interpret KP_9 {
+ action = MovePtr(x=+1,y=-1);
+ };
+ interpret KP_Prior {
+ action = MovePtr(x=+1,y=-1);
+ };
+
+ interpret KP_5 {
+ action = PointerButton(button=default);
+ };
+ interpret KP_Begin {
+ action = PointerButton(button=default);
+ };
+
+ interpret KP_F2 {
+ action = SetPtrDflt(affect=defaultButton,button=1);
+ };
+ interpret KP_Divide {
+ action = SetPtrDflt(affect=defaultButton,button=1);
+ };
+
+ interpret KP_F3 {
+ action = SetPtrDflt(affect=defaultButton,button=2);
+ };
+ interpret KP_Multiply {
+ action = SetPtrDflt(affect=defaultButton,button=2);
+ };
+
+ interpret KP_F4 {
+ action = SetPtrDflt(affect=defaultButton,button=3);
+ };
+ interpret KP_Subtract {
+ action = SetPtrDflt(affect=defaultButton,button=3);
+ };
+
+ interpret KP_Separator {
+ action = PointerButton(button=default,count=2);
+ };
+ interpret KP_Add {
+ action = PointerButton(button=default,count=2);
+ };
+
+ interpret KP_0 {
+ action = LockPointerButton(button=default,affect=lock);
+ };
+ interpret KP_Insert {
+ action = LockPointerButton(button=default,affect=lock);
+ };
+
+ interpret KP_Decimal {
+ action = LockPointerButton(button=default,affect=unlock);
+ };
+ interpret KP_Delete {
+ action = LockPointerButton(button=default,affect=unlock);
+ };
+
+ interpret.repeat= False;
+
+
+ // New Keysym Actions.
+ //
+ interpret Pointer_Button_Dflt {
+ action= PointerButton(button=default);
+ };
+ interpret Pointer_Button1 {
+ action= PointerButton(button=1);
+ };
+ interpret Pointer_Button2 {
+ action= PointerButton(button=2);
+ };
+ interpret Pointer_Button3 {
+ action= PointerButton(button=3);
+ };
+ interpret Pointer_DblClick_Dflt {
+ action= PointerButton(button=default,count=2);
+ };
+ interpret Pointer_DblClick1 {
+ action= PointerButton(button=1,count=2);
+ };
+ interpret Pointer_DblClick2 {
+ action= PointerButton(button=2,count=2);
+ };
+ interpret Pointer_DblClick3 {
+ action= PointerButton(button=3,count=2);
+ };
+ interpret Pointer_Drag_Dflt {
+ action= LockPointerButton(button=default);
+ };
+ interpret Pointer_Drag1 {
+ action= LockPointerButton(button=1);
+ };
+ interpret Pointer_Drag2 {
+ action= LockPointerButton(button=2);
+ };
+ interpret Pointer_Drag3 {
+ action= LockPointerButton(button=3);
+ };
+
+ interpret Pointer_EnableKeys {
+ action= LockControls(controls=MouseKeys);
+ };
+ interpret Pointer_Accelerate {
+ action= LockControls(controls=MouseKeysAccel);
+ };
+ interpret Pointer_DfltBtnNext {
+ action= SetPtrDflt(affect=defaultButton,button= +1);
+ };
+ interpret Pointer_DfltBtnPrev {
+ action= SetPtrDflt(affect=defaultButton,button= -1);
+ };
+
+
+ // Allow an indicator for MouseKeys.
+ indicator "Mouse Keys" {
+// !allowExplicit;
+ indicatorDrivesKeyboard;
+ controls= MouseKeys;
+ };
+};
diff --git a/compat/norepeat b/compat/norepeat
new file mode 100644
index 0000000..07b0b7a
--- /dev/null
+++ b/compat/norepeat
@@ -0,0 +1,11 @@
+// $Xorg: norepeat,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+// Put any otherwise normal keys that you don't want to repeat in
+// this file
+
+default partial xkb_compatibility "norepeat" {
+ interpret Return {
+ action= NoAction();
+ repeat= False;
+ };
+};
diff --git a/compat/pc b/compat/pc
new file mode 100644
index 0000000..5ce7d76
--- /dev/null
+++ b/compat/pc
@@ -0,0 +1,18 @@
+// $Xorg: pc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+default partial xkb_compatibility "pc" {
+
+ // Sets the "Alt" virtual modifier
+
+ virtual_modifiers Alt;
+
+ setMods.clearLocks= True;
+ interpret Alt_L+Any {
+ virtualModifier= Alt;
+ action = SetMods(modifiers=modMapMods);
+ };
+
+ interpret Alt_R+Any {
+ virtualModifier= Alt;
+ action = SetMods(modifiers=modMapMods);
+ };
+};
diff --git a/compat/pc98 b/compat/pc98
new file mode 100644
index 0000000..23f3f79
--- /dev/null
+++ b/compat/pc98
@@ -0,0 +1,62 @@
+// $Xorg: pc98,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+
+
+
+
+// $XFree86: xc/programs/xkbcomp/compat/pc98,v 3.1 1997/10/26 13:25:33 dawes Exp $
+
+// Minimal set of symbol interpretations to provide
+// reasonable default behavior (Num lock, shift and
+// caps lock and mode switch) and set up the
+// automatic updating of common keyboard LEDs.
+
+default xkb_compatibility "basic" {
+ virtual_modifiers NumLock,AltGr;
+
+ interpret.repeat= False;
+ setMods.clearLocks= True;
+ latchMods.clearLocks= True;
+ latchMods.latchToLock= True;
+
+ interpret Shift_Lock+AnyOf(Shift+Lock) {
+ action= LockMods(modifiers=Shift);
+ };
+
+// interpret Any+Lock {
+// action= LockMods(modifiers=Lock);
+// };
+
+ interpret Num_Lock+Any {
+ virtualModifier= NumLock;
+ action= LockMods(modifiers=NumLock);
+ };
+
+ interpret Mode_switch {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= SetGroup(group=2,clearLocks);
+ };
+
+ interpret Any + Any {
+ action= SetMods(modifiers=modMapMods);
+ };
+
+ group 2 = AltGr;
+ group 3 = AltGr;
+ group 4 = AltGr;
+
+ indicator.allowExplicit= False;
+ indicator "Caps Lock" {
+ whichModState= Locked;
+ modifiers= Lock;
+ };
+ indicator "Num Lock" {
+ whichModState= Locked;
+ modifiers= NumLock;
+ };
+ indicator "Shift Lock" {
+ whichModState= Locked;
+ modifiers= Shift;
+ };
+ indicator.allowExplicit= True;
+};
diff --git a/compat/xfree86 b/compat/xfree86
new file mode 100644
index 0000000..2da65fd
--- /dev/null
+++ b/compat/xfree86
@@ -0,0 +1,57 @@
+// $XFree86$
+// XFree86 special keysyms
+
+default partial xkb_compatibility "basic" {
+
+ interpret.repeat= True;
+
+ interpret XF86_Switch_VT_1 {
+ action = SwitchScreen(Screen=1, !SameServer);
+ };
+ interpret XF86_Switch_VT_2 {
+ action = SwitchScreen(Screen=2, !SameServer);
+ };
+ interpret XF86_Switch_VT_3 {
+ action = SwitchScreen(Screen=3, !SameServer);
+ };
+ interpret XF86_Switch_VT_4 {
+ action = SwitchScreen(Screen=4, !SameServer);
+ };
+ interpret XF86_Switch_VT_5 {
+ action = SwitchScreen(Screen=5, !SameServer);
+ };
+ interpret XF86_Switch_VT_6 {
+ action = SwitchScreen(Screen=6, !SameServer);
+ };
+ interpret XF86_Switch_VT_7 {
+ action = SwitchScreen(Screen=7, !SameServer);
+ };
+ interpret XF86_Switch_VT_8 {
+ action = SwitchScreen(Screen=8, !SameServer);
+ };
+ interpret XF86_Switch_VT_9 {
+ action = SwitchScreen(Screen=9, !SameServer);
+ };
+ interpret XF86_Switch_VT_10 {
+ action = SwitchScreen(Screen=10, !SameServer);
+ };
+ interpret XF86_Switch_VT_11 {
+ action = SwitchScreen(Screen=11, !SameServer);
+ };
+ interpret XF86_Switch_VT_12 {
+ action = SwitchScreen(Screen=12, !SameServer);
+ };
+
+ interpret XF86_Ungrab {
+ action = Private(type=0x86, data="Ungrab");
+ };
+ interpret XF86_ClearGrab {
+ action = Private(type=0x86, data="ClsGrb");
+ };
+ interpret XF86_Next_VMode {
+ action = Private(type=0x86, data="+VMode");
+ };
+ interpret XF86_Prev_VMode {
+ action = Private(type=0x86, data="-VMode");
+ };
+};
diff --git a/compat/xtest b/compat/xtest
new file mode 100644
index 0000000..a35ced9
--- /dev/null
+++ b/compat/xtest
@@ -0,0 +1,58 @@
+// $Xorg: xtest,v 1.3 2000/08/17 19:54:34 cpqbld Exp $
+default xkb_compatibility "xtest" {
+
+ // Minimal set of symbol interpretations to provide
+ // reasonable behavior for testing. The X Test
+ // Suite assumes that it can set any modifier by
+ // simulating a KeyPress and clear it by simulating
+ // a KeyRelease. Because of the way that XKB
+ // implements locking/latching modifiers, this
+ // approach fails in some cases (typically the
+ // lock or num lock modifiers). These symbol
+ // interpretations make all modifier keys just
+ // set the corresponding modifier so that xtest
+ // will see the behavior it expects.
+
+ virtual_modifiers NumLock,AltGr;
+
+ interpret.repeat= False;
+ setMods.clearLocks= True;
+ latchMods.clearLocks= True;
+ latchMods.latchToLock= False;
+
+ interpret Shift_Lock+AnyOf(Shift+Lock) {
+ action= SetMods(modifiers=Shift);
+ };
+
+ interpret Num_Lock+Any {
+ virtualModifier= NumLock;
+ action= SetMods(modifiers=NumLock);
+ };
+
+ interpret Mode_switch {
+ useModMapMods= level1;
+ virtualModifier= AltGr;
+ action= SetGroup(group=2);
+ };
+
+ interpret Any + Any {
+ action= SetMods(modifiers=modMapMods);
+ };
+
+ group 2 = AltGr;
+ group 3 = AltGr;
+ group 4 = AltGr;
+
+ indicator.allowExplicit= False;
+ indicator "Caps Lock" {
+ modifiers= Lock;
+ };
+ indicator "Num Lock" {
+ modifiers= NumLock;
+ };
+ indicator "Shift Lock" {
+ whichModState= Locked;
+ modifiers= Shift;
+ };
+ indicator.allowExplicit= True;
+};
diff --git a/configure.in b/configure.in
index 78c2df9..c0ec15b 100644
--- a/configure.in
+++ b/configure.in
@@ -1,9 +1,9 @@
-AC_INIT(xfree86.xml.in)
+AC_INIT(rules/base.xml.in)
-PACKAGE=xfree86_xkb_xml
+PACKAGE=xkbdesc
GETTEXT_PACKAGE=$PACKAGE
MAJOR_VERSION=0
-MINOR_VERSION=5
+MINOR_VERSION=1
VERSION=$MAJOR_VERSION.$MINOR_VERSION
AC_SUBST(MAJOR_VERSION)
@@ -32,6 +32,31 @@ AC_SUBST(xkb_base)
AC_OUTPUT([ intl/Makefile po/Makefile.in m4/Makefile
Makefile
-xfree86_xkb_xml.spec
+compat/Makefile
+geometry/Makefile
+geometry/digital.vndr/Makefile
+geometry/ibm.vndr/Makefile
+geometry/sgi.vndr/Makefile
+keycodes/Makefile
+keycodes/digital.vndr/Makefile
+keycodes/sgi.vndr/Makefile
+keymap/Makefile
+keymap/digital.vndr/Makefile
+keymap/sgi.vndr/Makefile
+keymap/sun.vndr/Makefile
+semantics/Makefile
+rules/Makefile
+symbols/Makefile
+symbols/digital.vndr/Makefile
+symbols/fujitsu.vndr/Makefile
+symbols/hp.vndr/Makefile
+symbols/macintosh.vndr/Makefile
+symbols/nec.vndr/Makefile
+symbols/sgi.vndr/Makefile
+symbols/sony.vndr/Makefile
+symbols/sun.vndr/Makefile
+symbols/xfree68.vndr/Makefile
+types/Makefile
+xkbdesc.spec
])
diff --git a/geometry/.cvsignore b/geometry/.cvsignore
new file mode 100644
index 0000000..282522d
--- /dev/null
+++ b/geometry/.cvsignore
@@ -0,0 +1,2 @@
+Makefile
+Makefile.in
diff --git a/geometry/Makefile.am b/geometry/Makefile.am
new file mode 100644
index 0000000..684553a
--- /dev/null
+++ b/geometry/Makefile.am
@@ -0,0 +1,15 @@
+SUBDIRS = digital.vndr ibm.vndr sgi.vndr
+
+geom_DATA = \
+amiga ataritt chicony \
+dell everex fujitsu \
+hp keytronic kinesis \
+macintosh microsoft nec \
+northgate pc sony \
+sun winbook README
+
+EXTRA_DIST= $(geom_DATA)
+
+geomdir = $(xkb_base)/geometry
+
+
diff --git a/geometry/README b/geometry/README
new file mode 100644
index 0000000..245270d
--- /dev/null
+++ b/geometry/README
@@ -0,0 +1,10 @@
+The geometry component of a keyboard mapping specifies primarily the geometry of
+the keyboard. It contains the geometry symbolic name and the keyboard geometry
+description. The geometry component might also contain aliases for some keys or
+symbolic names for some indicators and might affect the set of indicators that
+are physically present. Key aliases defined in the geometry component of a
+keyboard mapping override those defined in the keycodes component.
+
+
+
+/* $XFree86$ */
diff --git a/geometry/amiga b/geometry/amiga
new file mode 100644
index 0000000..357c4c0
--- /dev/null
+++ b/geometry/amiga
@@ -0,0 +1,270 @@
+// $Xorg: amiga,v 1.3 2000/08/17 19:54:35 cpqbld Exp $
+
+
+
+// $XFree86: xc/programs/xkbcomp/geometry/amiga,v 3.2 1997/10/26 13:25:34 dawes Exp $
+
+default xkb_geometry "usa1" {
+
+ description= "Amiga (usa1)";
+ width= 490;
+ height= 175;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "TLDE" { { [ 28,18] }, { [2,1], [ 21,17] } };
+ shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "RTRN" {
+ approx = { [ 16, 0], [42,37] },
+ { [16, 0], [42, 0], [42,37],
+ [ 0,37], [ 0,19], [16,19] },
+ { [18, 1], [40, 1], [40,36],
+ [ 2,36], [ 2,20], [18,20] } };
+ shape "LFSH" { { [ 52,18] }, { [2,1], [ 50,17] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } };
+ shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "SPCE" { { [172,18] }, { [2,1], [170,17] } };
+ shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ section.left= 22;
+ row.left= 1;
+ key.shape= "FCTS";
+ key.gap= 1;
+ section "Function" {
+ top= 28;
+ row {
+ top= 1;
+ keys { { <ESC>, shape="NORM" },
+ { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 9 }, <FK07>, <FK08>, <FK09>, <FK10>
+ };
+ };
+ }; // End of "Function" section
+
+ key.shape= "NORM";
+ section "Alpha" {
+ top= 56;
+ row {
+ top= 1;
+ keys { { <TLDE>, shape="TLDE" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <BKSL>, { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN", -15 }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <LCTL>, "CTRL" }, { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ keys { { <LALT>, 10 }, <LAMI>,
+ { <SPCE>, "SPCE" },
+ <RAMI>, <RALT>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 56;
+ left= 326;
+ row {
+ top= 1;
+ key.shape = "DELE";
+ keys { <DELE>, <HELP> };
+ };
+ row {
+ top= 39;
+ left = 20;
+ keys { <UP> };
+ };
+ row {
+ top= 58;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 56;
+ left= 392;
+ row {
+ top= 1;
+ keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPAD> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDC> };
+ };
+ }; // End of "Keypad" section
+
+};
+
+xkb_geometry "de" {
+
+ description= "Amiga (de)";
+ width= 490;
+ height= 175;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "TLDE" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "RTRN" {
+ { [ 0, 0], [28,0], [28,37], [5,37], [5,18], [ 0,18] },
+ { [ 2, 1], [26,1], [26,36], [7,36], [7,17], [ 2,17] } };
+ shape "LFSH" { { [ 32,18] }, { [2,1], [ 29,17] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } };
+ shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "SPCE" { { [172,18] }, { [2,1], [170,17] } };
+ shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ section.left= 22;
+ row.left= 1;
+ key.shape= "FCTS";
+ key.gap= 1;
+ section "Function" {
+ top= 28;
+ row {
+ top= 1;
+ keys { { <ESC>, shape="NORM" },
+ { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 9 }, <FK07>, <FK08>, <FK09>, <FK10>
+ };
+ };
+ }; // End of "Function" section
+
+ key.shape= "NORM";
+ section "Alpha" {
+ top= 56;
+ row {
+ top= 1;
+ keys { { <TLDE>, shape="TLDE" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <BKSL>, { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <LCTL>, "CTRL" }, { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" },
+ <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ keys { { <LALT>, 14 }, <LAMI>,
+ { <SPCE>, "SPCE" },
+ <RAMI>, <RALT>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 56;
+ left= 326;
+ row {
+ top= 1;
+ key.shape = "DELE";
+ keys { <DELE>, <HELP> };
+ };
+ row {
+ top= 39;
+ left = 20;
+ keys { <UP> };
+ };
+ row {
+ top= 58;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 56;
+ left= 392;
+ row {
+ top= 1;
+ keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPAD> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDC> };
+ };
+ }; // End of "Keypad" section
+
+};
diff --git a/geometry/ataritt b/geometry/ataritt
new file mode 100644
index 0000000..e53cd94
--- /dev/null
+++ b/geometry/ataritt
@@ -0,0 +1,257 @@
+// $Xorg: ataritt,v 1.3 2000/08/17 19:54:35 cpqbld Exp $
+
+
+
+// $XFree86: xc/programs/xkbcomp/geometry/ataritt,v 3.2 1997/10/26 13:25:34 dawes Exp $
+
+default xkb_geometry "us" {
+
+ description= "Atari TT (us)";
+ width= 480;
+ height= 173;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "RTRN" { approx = { [0,19], [32,37] },
+ { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] },
+ { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } };
+ shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [172,18] }, { [2,1], [170,17] } };
+ shape "FCTS" { { [ 28,10] }, { [2,1], [ 26,9] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ section.left= 21;
+ row.left= 1;
+ key.shape = "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 36;
+ key.shape= "FCTS";
+ row {
+ top= 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 63;
+ row {
+ top= 1;
+ keys { <ESC>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, <TLDE>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN", -13 }, <DELE>
+ };
+ };
+ row {
+ top= 39;
+ keys { { <LCTL>, "CTRL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <BKSL>, 34 }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ keys { { <ALT>, 24 },
+ { <SPCE>, "SPCE" },
+ <CAPS>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 63;
+ left= 319;
+ row {
+ top= 1;
+ key.shape = "BKSP";
+ keys { <HELP>, <UNDO> };
+ };
+ row {
+ top= 20;
+ keys { <INS>, <UP>, <HOME> };
+ };
+ row {
+ top= 39;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 63;
+ left= 381;
+ row {
+ top= 1;
+ keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPAD> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDC> };
+ };
+ }; // End of "Keypad" section
+
+};
+
+xkb_geometry "de" {
+
+ description= "Atari TT (de)";
+ width= 480;
+ height= 173;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" { approx = { [0,19], [32,37] },
+ { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] },
+ { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } };
+ shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [170,18] }, { [2,1], [168,17] } };
+ shape "FCTS" { { [ 28,11] }, { [2,1], [ 26,10] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ section.left= 21;
+ row.left= 1;
+ key.shape = "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 36;
+ key.shape= "FCTS";
+ row {
+ top= 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 63;
+ row {
+ top= 1;
+ keys { <ESC>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, <TLDE>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN", -13 }, <DELE>
+ };
+ };
+ row {
+ top= 39;
+ keys { { <LCTL>, "CTRL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <BKSL>, 34 }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" }, <LSGT>,
+ <AB01>, <AB02>, <AB03>, <AB04>,
+ <AB05>, <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ keys { { <ALT>, 24 }, { <SPCE>, "SPCE" }, <CAPS>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 63;
+ left= 319;
+ row {
+ top= 1;
+ key.shape = "BKSP";
+ keys { <HELP>, <UNDO> };
+ };
+ row {
+ top= 20;
+ keys { <INS>, <UP>, <HOME> };
+ };
+ row {
+ top= 39;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 63;
+ left= 381;
+ row {
+ top= 1;
+ keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPAD> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDC> };
+ };
+ }; // End of "Keypad" section
+
+};
diff --git a/geometry/chicony b/geometry/chicony
new file mode 100644
index 0000000..9bdd15b
--- /dev/null
+++ b/geometry/chicony
@@ -0,0 +1,190 @@
+// -*- indent-tabs-mode: nil -*-
+// $XFree86: xc/programs/xkbcomp/geometry/chicony,v 1.1 2003/05/29 12:41:57 pascal Exp $
+
+// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net>
+// Geometry specification for Chicony KB-9820 keyboard.
+
+// 86 keys
+default xkb_geometry "us" {
+ description = "Chicony KB-9820 infra-red keyboard";
+ width = 350;
+ height = 180;
+ //baseColor = "grey60";
+ labelColor = "white";
+
+ shape "EDGE" { cornerRadius = 25,
+ { [0, 8], [142.5, 0], [202.5, 0], [347, 8],
+ [347, 60], [327, 100], [322, 160],
+ [202.5, 165], [142.5, 165],
+ [25, 160], [20, 100], [0, 60] } };
+ shape "KEYS" { cornerRadius = 2, { [271, 109] } };
+ shape "MOUS" { cornerRadius = 12, { [24, 24] } };
+ shape "MOUS2" { cornerRadius = 9, { [18, 18] } };
+ shape "BTNS" { cornerRadius = 5, { [10, 10] } };
+
+ solid "Edges" {
+ top = 0;
+ left = 0;
+ shape = "EDGE";
+ color = "grey60";
+ };
+
+ solid "KeyPanel" {
+ shape = "KEYS";
+ left = 38;
+ top = 22;
+ color = "black";
+ };
+
+ solid "Mouse" {
+ shape = "MOUS";
+ left = 315;
+ top = 30;
+ color = "grey30";
+ };
+
+ outline "Mouse2" {
+ shape = "MOUS2";
+ left = 318;
+ top = 33;
+ color = "black";
+ };
+
+ solid "Button1" {
+ shape = "BTNS";
+ left = 10;
+ top = 32;
+ color = "grey30";
+ };
+
+ solid "Button2" {
+ shape = "BTNS";
+ left = 20;
+ top = 42;
+ color = "grey30";
+ };
+
+ outline "Buttons" {
+ shape = "MOUS";
+ left = 8;
+ top = 30;
+ color = "black";
+ };
+
+ shape.cornerRadius = 1;
+ shape "ESC" { { [17, 12] }, { [1.5, 0], [15.5, 10] } };
+ shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } };
+ shape "THIN" { { [14, 18] }, { [2, 0], [12, 15] } };
+ shape "NARR" { { [16, 18] }, { [2, 0], [14, 15] } };
+ shape "NORM" { { [17, 18] }, { [2, 0], [15, 15] } };
+ shape "WIDER" { { [18, 18] }, { [2, 0], [16, 15] } };
+ shape "CAPS" { { [22, 18] }, { [2, 0], [20, 15] } };
+ shape "RTSH" { { [23, 18] }, { [2, 0], [21, 15] } };
+ shape "WIDEST" { { [30, 18] }, { [2, 0], [28, 15] } };
+ shape "SPCE" { { [68, 18] }, { [2, 0], [66, 15] } };
+
+ section "Function" {
+ key.shape = "SMALL";
+ key.gap = 0.79;
+ key.color = "grey60";
+ left = 38;
+ top = 22;
+ row {
+ top = 1;
+ keys { { <ESC>, shape="ESC", 1 },
+ { <FK01>, 1.5 }, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>, <FK11>, <FK12>,
+ <NMLK>, <PRSC>, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Control" {
+ key.shape = "NORM";
+ key.gap = 1;
+ key.color = "grey60";
+ left = 38;
+ top = 111;
+ row {
+ top = 1;
+ keys { <EASY>, <LCTL>, <LWIN>, <LALT>,
+ { <SPCE>, shape="SPCE" },
+ <RALT>,
+ { <RWIN>, shape="THIN" },
+ { <MENU>, shape="THIN" },
+ { <INS>, shape="THIN" },
+ { <DELE>, shape="THIN" } };
+ };
+ }; // End of "Control" section
+
+ section "Editing" {
+ key.shape = "NORM";
+ key.gap = 1;
+ key.color = "grey60";
+ left = 291;
+ top = 34;
+ row.vertical = True;
+ row {
+ top = 1;
+ keys { <HOME>, <PGUP>, <PGDN>, <END> };
+ };
+ }; // End of "Editing" section
+
+ section "Navigation" {
+ key.gap = 1;
+ key.shape = "NARR";
+ key.color = "grey60";
+ left = 257;
+ top = 92;
+ row {
+ left = 16;
+ top = 1;
+ keys { <UP> };
+ };
+ row {
+ top = 20;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Navigation" section
+
+ section "Alpha" {
+ key.gap = 1;
+ key.shape = "NORM";
+ key.color = "grey60";
+ left = 38;
+ top = 35;
+ row {
+ top = 1;
+ keys { { <TLDE>, shape="NARR" },
+ <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, { <BKSP>, shape="WIDER" }
+ };
+ };
+ row {
+ top = 20;
+ keys { <TAB>,
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, <AD13>
+ };
+ };
+ row {
+ top = 39;
+ keys { { <CAPS>, shape="CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, shape="WIDEST" }
+ };
+ };
+ row {
+ top = 58;
+ keys { { <LFSH>, shape="WIDEST" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, shape="RTSH" }
+ };
+ };
+ }; // End of "Alpha" section
+};
diff --git a/geometry/dell b/geometry/dell
new file mode 100644
index 0000000..935bcca
--- /dev/null
+++ b/geometry/dell
@@ -0,0 +1,185 @@
+// $Xorg: dell,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86$
+//
+default xkb_geometry "dell101" {
+
+ description= "Dell 101";
+ width= 470;
+ height= 210;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } };
+ shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "CAPS" { { [ 33,18] }, { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } };
+ shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } };
+ shape "SPCE" { { [133,18] }, { [2,1], [131,16] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 52;
+ left= 377;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 67;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 382; };
+ indicator "Caps Lock" { left= 407; };
+ indicator "Scroll Lock" { left= 433; };
+ text.top= 55;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 20 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 91;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 21 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, { <RCTL>, 21 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 91;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 91;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "default" geometry
diff --git a/geometry/digital.vndr/.cvsignore b/geometry/digital.vndr/.cvsignore
new file mode 100644
index 0000000..282522d
--- /dev/null
+++ b/geometry/digital.vndr/.cvsignore
@@ -0,0 +1,2 @@
+Makefile
+Makefile.in
diff --git a/geometry/digital.vndr/Makefile.am b/geometry/digital.vndr/Makefile.am
new file mode 100644
index 0000000..3e918b9
--- /dev/null
+++ b/geometry/digital.vndr/Makefile.am
@@ -0,0 +1,6 @@
+geom_DATA = \
+lk pc unix
+
+EXTRA_DIST= $(geom_DATA)
+
+geomdir = $(xkb_base)/geometry/digital.vndr
diff --git a/geometry/digital.vndr/lk b/geometry/digital.vndr/lk
new file mode 100644
index 0000000..1ccd331
--- /dev/null
+++ b/geometry/digital.vndr/lk
@@ -0,0 +1,730 @@
+// $Xorg: lk,v 1.3 2000/08/17 19:54:36 cpqbld Exp $
+//
+//Copyright (c) 1996 Digital Equipment Corporation
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be included
+//in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM,
+//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+//THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the Digital Equipment
+//Corporation shall not be used in advertising or otherwise to promote
+//the sale, use or other dealings in this Software without prior written
+//authorization from Digital Equipment Corporation.
+//
+// HISTORY
+// Log: lk,v
+// Revision 1.2 1996/06/18 09:12:47 erik
+// use flags correctly, assorted cleanups and consortium fixes
+//
+// Revision 1.1.6.2 1995/08/18 21:15:16 William_Walker
+// Upgrade XKB to Protocol Rev. 0.64
+// [1995/08/18 20:41:46 William_Walker]
+//
+// Revision 1.1.2.5 1995/08/11 19:35:47 William_Walker
+// Sync up with Erik's pool.
+// [1995/08/11 18:35:58 William_Walker]
+//
+// Revision 1.1.2.4 1995/06/27 12:17:28 William_Walker
+// Rename <TLDE> to ISO9995 compliant <AE00>.
+// [1995/06/26 20:23:07 William_Walker]
+//
+// Revision 1.1.2.3 1995/06/09 20:54:36 William_Walker
+// Add VT105 layout support and ISO group support
+// [1995/06/09 20:40:38 William_Walker]
+//
+// Revision 1.1.2.2 1995/06/05 19:21:16 William_Walker
+// New file. I love keymaps.
+// [1995/06/05 18:05:43 William_Walker]
+//
+// EndLog
+//
+// @(#)RCSfile: lk,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16:00
+//
+xkb_geometry "lk201" {
+ width = 530;
+ height = 170;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { { [18,19] }, { [3,2], [15,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[23,19] },
+ { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] },
+ { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] }
+ };
+ shape "LONG" { { [37,19] }, { [3,2], [34,16] } };
+ shape "TALL" { { [18,39] }, { [3,2], [15,36] } };
+ shape "MED" { { [28,19] }, { [3,2], [25,16] } };
+ shape "CAPS" { { [28,19] }, { [3,2], [18,16] } };
+ shape "SPCE" { { [171,19] },{ [3,2], [168,16]} };
+ shape "LEDS" { [ 30,15] };
+ shape "LED" { [ 5, 2] };
+
+ section.left= 27;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ section "Function" { top = 20;
+ row { top = 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 19 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 19 }, <FK12>, <FK13>, <FK14>,
+ { <FK17>, 98 }, <FK18>, <FK19>, <FK20>
+ };
+ };
+ };
+
+ section "Editing" { top = 20; left = 350;
+ row { top = 1;
+ keys { <HELP>, { <DO>, "LONG" } };
+ };
+ row { top = 41;
+ keys { <FIND>, <INS>, <DELE> };
+ };
+ row { top = 61;
+ keys { <SELE>, <PGUP>, <PGDN> };
+ };
+ row { top = 81; left = 20;
+ keys { <UP> };
+ };
+ row { top = 101;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ };
+
+ section "Keypad" { top = 60; left = 426;
+ row { top = 1;
+ keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> };
+ };
+ row { top = 21;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row { top = 41;
+ keys { <KP4>, <KP5>, <KP6>, <KPCO> };
+ };
+ row { top = 61;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } };
+ };
+ row { top = 81;
+ keys { { <KP0>, "LONG" }, <KPDL> };
+ };
+ };
+
+ section "Alpha" { top = 60;
+ row { top = 1; left = 15;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "MED" }
+ };
+ };
+ row { top = 21; left = 15;
+ keys { { <TAB>, "MED" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+
+ };
+ row { top = 41;
+ keys { <LCTL>,
+ { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LONG" },
+ <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "LONG" }
+ };
+ };
+ row { top = 81; left = 26;
+ keys { { <LCMP>, "LONG" },
+ { <SPCE>, "SPCE" }
+ };
+ };
+ };
+
+ section.left = 341;
+ section.top = 3;
+
+ section "Indicators" {
+ indicator.onColor = "#00ff00";
+ indicator.offColor= "#001000";
+ indicator.top = 10;
+ indicator.shape= "LED";
+ indicator "Scroll Lock" { left = 9; };
+ indicator "Caps Lock" { left = 27; };
+ indicator "Compose" { left = 45; };
+ indicator "Wait" { left = 63; };
+ text.top = 4;
+ text.color = "black";
+ text "HoldScreenLabel" {left = 5; text="Hold\n"; };
+ text "CapsLockLabel" {left = 23; text="Lock\n"; };
+ text "ComposeLabel" {left = 37; text="Compose\n"; };
+ text "WaitLabel" {left = 60; text="Wait\n"; };
+ };
+};
+
+xkb_geometry "lk401" {
+
+ width = 480;
+ height = 180;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { { [18,19] }, { [3,2], [15,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[23,19] },
+ { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] },
+ { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] }
+ };
+ shape "LONG" { { [37,19] }, { [3,2], [34,16] } };
+ shape "TALL" { { [18,39] }, { [3,2], [15,36] } };
+ shape "MED" { { [28,19] }, { [3,2], [25,16] } };
+ shape "CAPS" { { [28,19] }, { [3,2], [18,16] } };
+ shape "SPCE" { { [131,19] },{ [3,2], [128,16]} };
+ shape "LEDS" { [ 36,15] };
+ shape "LED" { [ 5, 2] };
+
+ section.left= 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ text "Logo" {left = 20; top = 10; text="digital\n"; };
+
+ section "Function" { top = 20;
+ row { top = 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 15 }, <FK12>, <FK13>, <FK14>,
+ { <FK17>, 75 }, <FK18>, <FK19>, <FK20>
+ };
+ };
+ };
+
+ section "Editing" { top = 20; left = 320;
+ row { top = 1;
+ keys { <HELP>, { <DO>, "LONG" } };
+ };
+ row { top = 41;
+ keys { <FIND>, <INS>, <DELE> };
+ };
+ row { top = 61;
+ keys { <SELE>, <PGUP>, <PGDN> };
+ };
+ row { top = 81; left= 20;
+ keys { <UP> };
+ };
+ row { top = 101;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ };
+
+ section "Keypad" { top = 60; left = 385;
+ row { top = 1;
+ keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> };
+ };
+ row {
+ top = 21;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row { top = 41;
+ keys { <KP4>, <KP5>, <KP6>, <KPCO> };
+ };
+ row { top = 61;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } };
+ };
+ row { top = 81;
+ keys { { <KP0>, "LONG" }, <KPDL> };
+ };
+ };
+
+ section "Alpha" { top = 60;
+ row { top = 1; left = 15;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "MED" }
+ };
+ };
+ row { top = 21; left = 15;
+ keys { { <TAB>, "MED" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+
+ };
+ row { top = 41;
+ keys { <LCTL>,
+ { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LONG" },
+ <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "LONG" }
+ };
+ };
+ row { top = 81; left = 29;
+ keys { { <LCMP>, "MED" },
+ { <LALT>, "MED" },
+ { <SPCE>, "SPCE" },
+ { <RALT>, "MED" },
+ { <RCMP>, "MED" }
+ };
+ };
+ };
+
+ section.left = 69;
+ section.top = 3;
+ section "Indicators" {
+ solid "led_panel" { top = 0; left = 0;
+ cornerRadius = 1;
+ shape = "LEDS";
+ color = "grey";
+ };
+ indicator.onColor = "#00ff00";
+ indicator.offColor= "#001000";
+ indicator.shape = "LED";
+ indicator.top = 1;
+ indicator "Scroll Lock" { left = 3; };
+ indicator "Caps Lock" { left = 22; };
+ };
+ section "IndicatorLabels" {
+ text.top = 4;
+ text.color = "black";
+ text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; };
+ text "CapsLockLabel" {left = 22; text="Caps\nLock"; };
+ };
+};
+
+xkb_geometry "lk450" {
+
+ width = 480;
+ height = 180;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { { [18,19] }, { [3,2], [15,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[23,19] },
+ { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] },
+ { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] }
+ };
+ shape "LONG" { { [37,19] }, { [3,2], [34,16] } };
+ shape "TALL" { { [18,39] }, { [3,2], [15,36] } };
+ shape "MED" { { [28,19] }, { [3,2], [25,16] } };
+ shape "CAPS" { { [28,19] }, { [3,2], [18,16] } };
+ shape "SPCE" { { [131,19] },{ [3,2], [128,16]} };
+ shape "LEDS" { [ 36,15] };
+ shape "LED" { [ 5, 2] };
+
+ section.left= 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ text "Logo" {left = 20; top = 10; text="digital\n"; };
+
+ section "Function" { top = 20;
+ row { top = 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 15 }, <FK12>, <FK13>, <FK14>,
+ { <FK17>, 75 }, <FK18>, <FK19>, <FK20>
+ };
+ };
+ };
+
+ section "Editing" { top = 20; left = 320;
+ row { top = 1;
+ keys { <HELP>, { <DO>, "LONG" } };
+ };
+ row { top = 41;
+ keys { <FIND>, <INS>, <DELE> };
+ };
+ row { top = 61;
+ keys { <SELE>, <PGUP>, <PGDN> };
+ };
+ row { top = 81; left= 20;
+ keys { <UP> };
+ };
+ row { top = 101;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ };
+
+ section "Keypad" { top = 60; left = 385;
+ row { top = 1;
+ keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> };
+ };
+ row {
+ top = 21;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row { top = 41;
+ keys { <KP4>, <KP5>, <KP6>, <KPCO> };
+ };
+ row { top = 61;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } };
+ };
+ row { top = 81;
+ keys { { <KP0>, "LONG" }, <KPDL> };
+ };
+ };
+
+ section "Alpha" { top = 60;
+ row { top = 1; left = 15;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "MED" }
+ };
+ };
+ row { top = 21; left = 15;
+ keys { { <TAB>, "MED" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+
+ };
+ row { top = 41;
+ keys { <LCTL>,
+ { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LONG" },
+ <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "LONG" }
+ };
+ };
+ row { top = 81; left = 29;
+ keys { { <LCMP>, "MED" },
+ { <LALT>, "MED" },
+ { <SPCE>, "SPCE" },
+ { <RALT>, "MED" },
+ { <RCMP>, "MED" }
+ };
+ };
+ };
+
+ section.left = 69;
+ section.top = 3;
+ section "Indicators" {
+ solid "led_panel" { top = 0; left = 0;
+ cornerRadius = 1;
+ shape = "LEDS";
+ color = "grey";
+ };
+ indicator.onColor = "#00ff00";
+ indicator.offColor= "#001000";
+ indicator.shape = "LED";
+ indicator.top = 1;
+ indicator "Scroll Lock" { left = 3; };
+ indicator "Caps Lock" { left = 22; };
+ };
+ section "IndicatorLabels" {
+ text.top = 4;
+ text.color = "black";
+ text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; };
+ text "CapsLockLabel" {left = 22; text="Caps\nLock"; };
+ };
+};
+
+xkb_geometry "lk401bj"
+{
+ width = 480;
+ height = 180;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { { [18,19] }, { [3,2], [15,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[23,19] },
+ { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] },
+ { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] }
+ };
+ shape "LONG" { { [37,19] }, { [3,2], [34,16] } };
+ shape "TALL" { { [18,39] }, { [3,2], [15,36] } };
+ shape "MED" { { [28,19] }, { [3,2], [25,16] } };
+ shape "CAPS" { { [28,19] }, { [3,2], [18,16] } };
+ shape "SPCE" { { [131,19] },{ [3,2], [128,16]} };
+ shape "LEDS" { [ 30,15] };
+ shape "LED" { [ 5, 2] };
+
+ section.left= 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ text "Logo" {left = 20; top = 10; text="digital\n"; };
+
+ section "Function" { top = 20;
+ row { top = 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 15 }, <FK12>, <FK13>, <FK14>,
+ { <FK17>, 75 }, <FK18>, <FK19>, <FK20>
+ };
+ };
+ };
+
+ section "Editing" { top = 20; left = 320;
+ row { top = 1;
+ keys { <HELP>, { <DO>, "LONG" } };
+ };
+ row { top = 41;
+ keys { <FIND>, <INS>, <DELE> };
+ };
+ row { top = 61;
+ keys { <SELE>, <PGUP>, <PGDN> };
+ };
+ row { top = 81; left = 20;
+ keys { <UP> };
+ };
+ row { top = 101;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ };
+
+ section "Keypad" { top = 60; left = 385;
+ row { top = 1;
+ keys { <PF1>, <PF2>, <PF3>, <PF4> };
+ };
+ row { top = 21;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row { top = 41;
+ keys { <KP4>, <KP5>, <KP6>, <KPCO> };
+ };
+ row { top = 61;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } };
+ };
+ row { top = 81;
+ keys { { <KP0>, "LONG" }, <KPDL> };
+ };
+ };
+
+ section "Alpha" { top = 60;
+ row { top = 1; left = 15;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "MED" }
+ };
+ };
+ row { top = 21; left = 15;
+ keys { { <TAB>, "MED" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row { top = 41;
+ keys { <LCTL>,
+ { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LONG" },
+ <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "LONG" }
+ };
+ };
+ row { top = 81; left = 29;
+ keys { { <LCMP>, "MED" },
+ { <LALT>, "MED" },
+ { <SPCE>, "SPCE" },
+ { <RALT>, "MED" },
+ { <RCMP>, "MED" }
+ };
+ };
+ };
+
+ section.left = 69;
+ section.top = 3;
+
+ section "Indicators" {
+ solid "led_panel" { top = 0; left = 0;
+ cornerRadius = 1;
+ shape = "LEDS";
+ color = "grey";
+ };
+ indicator.onColor = "#00ff00";
+ indicator.offColor= "#001000";
+ indicator.top = 1;
+ indicator.shape= "LED";
+ indicator "Scroll Lock" { left = 3; };
+ indicator "Caps Lock" { left = 22; };
+ text.top = 4;
+ text.color = "black";
+ text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; };
+ text "CapsLockLabel" {left = 19; text="Caps\nLock"; };
+ };
+};
+
+xkb_geometry "lk401jj" {
+
+ width = 460;
+ height = 180;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { { [18,19] }, { [3,2], [15,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[28,23] },
+ { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] },
+ { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] }
+ };
+ shape "LONG" { { [37,19] }, { [3,2], [34,16] } };
+ shape "LONG1" { { [32,19] }, { [3,2], [29,16] } };
+ shape "TALL" { { [18,39] }, { [3,2], [15,36] } };
+ shape "MED" { { [28,19] }, { [3,2], [25,16] } };
+ shape "MED1" { { [23,19] }, { [3,2], [20,16] } };
+ shape "CTRL" { { [43,19] }, { [3,2], [38,16] } };
+ shape "SPCE" { { [55,19] },{ [3,2], [53,16]} };
+ shape "LEDS" { [ 56,15] };
+ shape "LED" { [ 5, 2] };
+
+ section.left = 5;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ text "Logo" {left = 7; top = 10; text="digital\n"; };
+
+ section "Function" { top = 40;
+ row { top = 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 18 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 18 }, <FK12>, <FK13>, <FK14>,
+ { <FK17>, 73 }, <FK18>, <FK19>, <FK20>
+ };
+ };
+ };
+
+ section "Editing" { top = 40; left = 313;
+ row { top = 1;
+ keys { <HELP>, { <DO>, "LONG" } };
+ };
+ row { top = 31;
+ keys { <FIND>, <INS>, <DELE> };
+ };
+ row { top = 51;
+ keys { <SELE>, <PGUP>, <PGDN> };
+ };
+ row { top = 71; left= 20;
+ keys { <UP> };
+ };
+ row { top = 91;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ };
+
+ section "Keypad" { top = 70; left = 377;
+ row { top = 1;
+ keys { <PF1>, <PF2>, <PF3>, <PF4> };
+ };
+ row { top = 21;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row { top = 41;
+ keys { <KP4>, <KP5>, <KP6>, <KPCO> };
+ };
+ row { top = 61;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } };
+ };
+ row { top = 81;
+ keys { { <KP0>, "LONG" }, <KPDL> };
+ };
+ };
+
+ section "Alpha" { top = 70;
+ row { top = 1; left = 7;
+ keys { { <AE00>, "MED1" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <AB00>, { <BKSP>, "MED1" }
+ };
+ };
+ row { top = 21; left = 7;
+ keys { { <TAB>, "LONG1" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row { top = 41;
+ keys { { <LCTL>, "CTRL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row { top = 61;
+ keys { <CAPS>, { <LFSH>, "LONG1" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "MED" }
+ };
+ };
+ row { top = 81; left = 7;
+ keys { { <LCMP>, "LONG" },
+ { <LALT>, "LONG" },
+ { <MUHE>, "LONG" },
+ { <SPCE>, "SPCE" },
+ { <KANJ>, "LONG" },
+ { <HIRA>, "LONG" },
+ <RALT>, <RCMP>
+ };
+ };
+ };
+
+ section.left = 315;
+ section.top = 20;
+
+ section "Indicators" {
+ solid "led_panel" { top = 0; left = 0;
+ cornerRadius = 1;
+ shape = "LEDS";
+ color = "grey";
+ };
+ indicator.onColor = "#00ff00";
+ indicator.offColor= "#001000";
+ indicator.top = 11;
+ indicator.shape= "LED";
+ indicator "Scroll Lock" { left = 6; };
+ indicator "Caps Lock" { left = 26; };
+ text.top = 4;
+ text.color = "black";
+ text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; };
+ text "CapsLockLabel" {left = 22; text="Caps\nLock"; };
+ };
+};
+
diff --git a/geometry/digital.vndr/pc b/geometry/digital.vndr/pc
new file mode 100644
index 0000000..1529ed2
--- /dev/null
+++ b/geometry/digital.vndr/pc
@@ -0,0 +1,350 @@
+// $Xorg: pc,v 1.3 2000/08/17 19:54:36 cpqbld Exp $
+//
+//Copyright (c) 1996 Digital Equipment Corporation
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be included
+//in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM,
+//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+//THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the Digital Equipment
+//Corporation shall not be used in advertising or otherwise to promote
+//the sale, use or other dealings in this Software without prior written
+//authorization from Digital Equipment Corporation.
+//
+// HISTORY
+// Log: pc,v
+// Revision 1.2 1996/06/18 09:12:50 erik
+// use flags correctly, assorted cleanups and consortium fixes
+//
+// Revision 1.1.6.2 1995/08/18 21:15:18 William_Walker
+// Upgrade XKB to Protocol Rev. 0.64
+// [1995/08/18 20:41:49 William_Walker]
+//
+// Revision 1.1.2.4 1995/08/11 19:35:48 William_Walker
+// Sync up with Erik's pool.
+// [1995/08/11 18:36:03 William_Walker]
+//
+// Revision 1.1.2.3 1995/06/27 12:17:29 William_Walker
+// Rename <TLDE> to ISO9995 compliant <AE00>.
+// [1995/06/26 20:23:10 William_Walker]
+//
+// Revision 1.1.2.2 1995/06/05 19:21:19 William_Walker
+// New file. I love keymaps.
+// [1995/06/05 18:05:51 William_Walker]
+//
+// EndLog
+//
+// @(#)RCSfile: pc,v Revision: 1.2 (DEC) Date: 1996/02/02 14:40:25
+//
+partial xkb_geometry "common" {
+ width = 480;
+ height = 200;
+
+ shape.cornerRadius = 1;
+ shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } };
+ shape "KP0" { primary = { [37,19] }, { [3,2], [34,16] } };
+ shape "KPAD" { primary = { [18,39] }, { [3,2], [15,36] } };
+ shape "LEDS" { [78,22] };
+ shape "LED" { [5,2] };
+
+ text.color = "black";
+ section.left = 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ section "Function" { top = 40;
+ row { top = 1;
+ keys { <ESC>,
+ { <FK01>, 20 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 10 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 10 }, <FK10>, <FK11>, <FK12>
+ };
+ };
+ };
+
+ section "Editing" { top = 40; left = 308;
+ row { top = 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row { top = 41;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row { top = 61;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row { top = 101; left = 20;
+ keys { <UP> };
+ };
+ row { top = 121;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ };
+
+ section "Keypad" { top = 80; left = 374;
+ row { top = 1;
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row { top = 21;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD" } };
+ };
+ row { top = 41;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row { top = 61;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD" } };
+ };
+ row { top = 81;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ };
+};
+
+partial xkb_geometry "leds_on_keys" {
+ section.top = 40;
+ section.left = 17;
+ section "LedPanel" {
+ indicator.onColor = "#00ff00";
+ indicator.offColor = "#001000";
+ indicator.shape = "LED";
+ indicator "Scroll Lock" { left = 317; top = 5; };
+ indicator "Num Lock" { left = 364; top = 45; };
+ indicator "Caps Lock" { left = 10; top = 85; };
+ };
+
+ section.left = 375;
+ section.top = 40;
+ section "LogoPanel" {
+ solid "logo_panel" { top = 0; left = 0;
+ shape = "LEDS";
+ color = "grey";
+ };
+ text "Logo" {left = 28; top = 10; text="digital\n"; };
+ };
+};
+
+partial xkb_geometry "leds_alone" {
+ section.left = 375;
+ section.top = 40;
+ section "Indicators" {
+ solid "led_panel" { top = 0; left = 0;
+ shape = "LEDS";
+ color = "grey";
+ };
+ indicator.top = 16;
+ indicator.onColor = "#00ff00";
+ indicator.offColor = "#001000";
+ indicator.shape = "LED";
+ indicator "Num Lock" { left = 3; };
+ indicator "Caps Lock" { left = 26; };
+ indicator "Scroll Lock" { left = 50; };
+ text "Logo" {left = 2; top = 3; text="digital\n"; };
+ };
+ section "IndicatorLabels" {
+ text.top = 11;
+ text "NumLockLabel" {left = 10; text="Num\nLock"; };
+ text "CapsLockLabel" {left = 33; text="Caps\nLock"; };
+ text "ScrollLockLabel" {left = 58; text="Scroll\nLock"; };
+ };
+};
+
+xkb_geometry "pc101" {
+ include "digital/pc(common)"
+
+ shape.cornerRadius = 1;
+ shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } };
+ shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "RTRN" { primary = { [41,19] }, { [3,2], [38,16] } };
+ shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } };
+ shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } };
+ shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } };
+ shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} };
+
+ section.left = 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ section "Alpha" { top = 80;
+ row { top = 1;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row { top = 21;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+
+ };
+ row { top = 41;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>,
+ <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row { top = 81;
+ key.shape = "MODK";
+ keys { <LCTL>,
+ { <LALT>, 20 },
+ { <SPCE>, "SPCE" },
+ <RALT>,
+ { <RCTL>, 21 }
+ };
+ };
+ };
+};
+
+xkb_geometry "pc102" {
+ include "digital/pc(common)"
+
+ shape.cornerRadius = 1;
+ shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } };
+ shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[28,19] },
+ { [0,0], [27,0], [27,39], [5,39], [5,19], [0,19] },
+ { [3,2], [24,2], [24,36], [8,36], [8,16], [3,16] }
+ };
+ shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } };
+ shape "LFSH" { primary = { [22,19] }, { [3,2], [19,16] } };
+ shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } };
+ shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} };
+
+ section.left = 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ section "Alpha" { top = 80;
+ row { top = 1;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row { top = 21;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+
+ };
+ row { top = 41;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <AC12>
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LFSH" },
+ <BKSL>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row { top = 81;
+ key.shape = "MODK";
+ keys { <LCTL>,
+ { <LALT>, 20 },
+ { <SPCE>, "SPCE" },
+ <RALT>,
+ { <RCTL>, 21 }
+ };
+ };
+ };
+};
+
+xkb_geometry "pcxaj" {
+ include "digital/pc(common)"
+
+ shape.cornerRadius = 1;
+ shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } };
+ shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "RTRN" { primary = { [22,19] }, { [3,2], [19,16] } };
+ shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } };
+ shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } };
+ shape "RTSH" { primary = { [32,19] }, { [3,2], [29,16] } };
+ shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } };
+ shape "SPCE" { primary = { [114,19]}, { [3,2], [111,16]} };
+
+ section.left = 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ section "Alpha" { top = 80;
+ row { top = 1;
+ keys { <AE00>,
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row { top = 21;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row { top = 41;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <AC12>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row { top = 61;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>,
+ <AB07>, <AB08>, <AB09>, <AB10>, <AB11>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row { top = 81;
+ key.shape = "MODK";
+ keys { <LCTL>, <LALT>,
+ { <MUHE>, "NORM" },
+ { <SPCE>, "SPCE" },
+ { <KANJ>, "NORM" },
+ { <HIRA>, "NORM" },
+ <RALT>, <RCTL>
+ };
+ };
+ };
+};
diff --git a/geometry/digital.vndr/unix b/geometry/digital.vndr/unix
new file mode 100644
index 0000000..2ca477e
--- /dev/null
+++ b/geometry/digital.vndr/unix
@@ -0,0 +1,230 @@
+// $Xorg: unix,v 1.3 2000/08/17 19:54:36 cpqbld Exp $
+//
+//Copyright (c) 1996 Digital Equipment Corporation
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be included
+//in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM,
+//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+//THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the Digital Equipment
+//Corporation shall not be used in advertising or otherwise to promote
+//the sale, use or other dealings in this Software without prior written
+//authorization from Digital Equipment Corporation.
+//
+// HISTORY
+// Log: unix,v
+// Revision 1.2 1996/06/18 09:12:53 erik
+// use flags correctly, assorted cleanups and consortium fixes
+//
+// Revision 1.1.2.3 1995/06/27 12:17:30 William_Walker
+// Rename <TLDE> to ISO9995 compliant <AE00>.
+// [1995/06/26 20:23:12 William_Walker]
+//
+// Revision 1.1.2.2 1995/06/05 19:21:23 William_Walker
+// New file. I love keymaps.
+// [1995/06/05 18:05:56 William_Walker]
+//
+// EndLog
+//
+// @(#)RCSfile: unix,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16:
+//
+xkb_geometry "unix" {
+
+ width = 340;
+ height = 160;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } };
+ shape "AE00" { primary = { [28,19] }, { [3,2], [25,16] } };
+ shape "BKSP" { primary = { [46,19] }, { [3,2], [43,16] } };
+ shape "TABK" { primary = { [37,19] }, { [3,2], [34,16] } };
+ shape "CTRL" { primary = { [46,19] }, { [3,2], [43,16] } };
+ shape "RTRN" { primary = { [46,19] }, { [3,2], [43,16] } };
+ shape "SHFT" { primary = { [56,19] }, { [3,2], [53,16] } };
+ shape "MODK" { primary = { [37,19] }, { [3,2], [34,16] } };
+ shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} };
+
+ section.left= 17;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ text.color = "black";
+ text "Logo" {left = 20; top = 10; text="digital\n"; };
+
+ section "Function" { top = 30;
+ row { top = 1;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 20 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <LEFT>, 20 }, <DOWN>, <UP>, <RGHT>
+ };
+ };
+ };
+
+ section "Alpha" { top = 50;
+ row { top = 1;
+ keys { { <AE00>, "AE00" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row { top = 21;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ <BKSL>, <AB00>
+ };
+
+ };
+ row { top = 41; left = -4;
+ keys { { <LCTL>, "CTRL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row { top = 61; left = -4;
+ keys { { <LFSH>, "SHFT" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>,
+ <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "SHFT" }
+ };
+ };
+ solid "ExtendKey" { top = 81; left= 1;
+ shape= "NORM";
+ color= "grey20";
+ };
+ text.top = 89;
+ text.color = "black";
+ text "ExtendLabel" {left = 6; text="Ext\nend"; };
+ row { top = 81; left = 19;
+ key.shape = "MODK";
+ keys { { <LCMP>, "NORM" }, <LALT>,
+ { <SPCE>, "SPCE" },
+ <RALT>, <RCMP>
+ };
+ };
+ };
+};
+
+xkb_geometry "lk421jj" {
+
+ width = 315;
+ height = 170;
+ shape.cornerRadius = 1;
+
+ shape "NORM" { { [18,19] }, { [3,2], [15,16] } };
+ shape "RTRN" {
+ approx = { [0,0],[28,23] },
+ { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] },
+ { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] }
+ };
+ shape "LONG" { { [37,19] }, { [3,2], [34,16] } };
+ shape "LONG1" { { [32,19] }, { [3,2], [29,16] } };
+ shape "TALL" { { [18,39] }, { [3,2], [15,36] } };
+ shape "MED" { { [23,19] }, { [3,2], [20,16] } };
+ shape "CTRL" { { [43,19] }, { [3,2], [38,16] } };
+ shape "SPCE" { { [55,19] },{ [3,2], [53,16]} };
+ shape "LEDS" { [ 56,15] };
+ shape "LED" { [ 5, 2] };
+
+ section.left = 5;
+ row.left = 1;
+ key.shape = "NORM";
+ key.gap = 1;
+
+ text "Logo" {left = 7; top = 10; text="digital\n"; };
+
+ section "Function" { top = 45;
+ row { top = 1; left = 7;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 18 }, <FK07>, <FK08>, <FK09>, <FK10>
+ };
+ };
+ };
+
+ section "Editing" { top = 45; left= 230;
+ row { top = 1;
+ keys { <LEFT>, <DOWN>, <UP>, <RGHT> };
+ };
+ };
+
+ section "Alpha" { top = 65;
+ row { top = 1; left = 7;
+ keys { { <AE00>, "MED" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <AB00>, { <BKSP>, "MED" }
+ };
+ };
+ row { top = 21; left = 7;
+ keys { { <TAB>, "LONG1" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row { top = 41;
+ keys { { <LCTL>, "CTRL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>,
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row { top = 61;
+ keys { <CAPS>, { <LFSH>, "LONG1" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "LONG1" }
+ };
+ };
+ row { top = 81; left = 7;
+ keys { <AA00>, <LCMP>,
+ { <LALT>, "LONG" },
+ { <MUHE>, "LONG" },
+ { <SPCE>, "SPCE" },
+ { <KANJ>, "LONG" },
+ { <HIRA>, "LONG" },
+ <RALT>, <RCMP>
+ };
+ };
+ };
+
+ section.left = 233;
+ section.top = 20;
+
+ section "Indicators" {
+ solid "led_panel" { top = 0; left = 0;
+ cornerRadius = 1;
+ shape = "LEDS";
+ color = "grey";
+ };
+ indicator.onColor = "#00ff00";
+ indicator.offColor= "#001000";
+ indicator.top = 11;
+ indicator.shape= "LED";
+ indicator "Scroll Lock" { left = 6; };
+ indicator "Caps Lock" { left = 26; };
+ text.top = 3;
+ text.color = "black";
+ text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; };
+ text "CapsLockLabel" {left = 22; text="Caps\nLock"; };
+ };
+};
+
+
diff --git a/geometry/everex b/geometry/everex
new file mode 100644
index 0000000..5be3266
--- /dev/null
+++ b/geometry/everex
@@ -0,0 +1,174 @@
+// $Xorg: everex,v 1.3 2000/08/17 19:54:35 cpqbld Exp $
+//
+// $XFree86$
+//
+default xkb_geometry "STEPnote" {
+
+ description= "Everex STEPnote";
+ width= 281;
+ height= 150;
+
+ shape.cornerRadius= 1;
+
+ shape "NORM" {
+ { [17,17] },
+ { [ 2, 1], [ 15, 15 ] }
+ };
+ shape "NARR" {
+ { [ 15, 17 ] },
+ { [ 2, 1 ], [ 13, 15 ] }
+ };
+ shape "FKEY" {
+ { [ 15.1, 15.5 ] },
+ { [ 1, 1 ], [ 14.1, 14.5 ] }
+ };
+ shape "ESC" {
+ { [ 16.4, 15.5 ] },
+ { [ 1, 1 ], [ 14.1, 14.5 ] }
+ };
+ shape "WIDE" { // backspace, tab and Fn
+ { [ 25, 17 ] },
+ { [ 2, 1 ], [ 23, 15 ] }
+ };
+ shape "RTRN" {
+ { [ 27.5, 17 ] },
+ { [ 2, 1 ], [ 25.5, 15 ] }
+ };
+ shape "CAPS" {
+ { [ 30, 17 ] },
+ { [ 2, 1 ], [ 28, 15 ] }
+ };
+ shape "LFSH" {
+ { [ 38.5, 17 ] },
+ { [ 2, 1 ], [ 36.5, 15 ] }
+ };
+ shape "RTSH" {
+ { [ 21, 17 ] },
+ { [ 2, 1 ], [ 19, 15 ] }
+ };
+ shape "SPCE" {
+ { [ 88.8, 17 ] },
+ { [ 2, 1 ], [ 86.8, 15 ] }
+ };
+ shape "WELL" {
+ { [ 269, 105 ] }
+ };
+ shape "LED" {
+ cornerRadius= 1.5,
+ { [ 3, 10 ] }
+ };
+
+ section.left= 6;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 0.5;
+
+ key.color= "grey20";
+ labelColor= "white";
+ baseColor= "grey20";
+
+ indicator.top= 20;
+ indicator.shape= "LED";
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+
+ indicator "Power" { left= 40; };
+ indicator "Battery" { left=101; };
+ indicator "Suspend" { left=112; };
+ indicator "HardDrive" { left=123; };
+ indicator "Floppy" { left=134; };
+ indicator "KeyPad" { left=145; };
+ indicator "Num Lock" { left=156; };
+ indicator "Caps Lock" { left=167; };
+ indicator "Scroll Lock" { left=178; };
+
+ solid "KeyWell" {
+ top= 35;
+ left= 6;
+ shape= "WELL";
+ color= "grey10";
+ };
+ section "Whole" {
+ top= 35;
+ row {
+ top= 0.5;
+ key.color= "grey30";
+ key.shape= "FKEY";
+ keys {
+ { <ESC>, "ESC" },
+ <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, <FK06>,
+ <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12>,
+ <NMLK>, <PRSC>, <SCLK>, <PAUS>
+ };
+ };
+ row {
+ top= 16.5;
+ keys {
+ { <TLDE>, "NARR" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, shape="WIDE", color="grey30" },
+ { <HOME>, shape="NARR", color="grey30" }
+ };
+ };
+ row {
+ top= 34;
+ keys {
+ { <TAB>, shape="WIDE", color="grey30" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <BKSL>, "NARR" },
+ { <PGUP>, shape="NARR", color="grey30" }
+ };
+ };
+ row {
+ top= 51.5;
+ keys {
+ { <CAPS>, shape="CAPS", color="grey30" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>,
+ { <RTRN>, shape="RTRN", color="grey30" },
+ { <PGDN>, shape="NARR", color="grey30" }
+ };
+ };
+ row {
+ top= 69;
+ keys {
+ { <LFSH>, shape="LFSH", color="grey30" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, shape="RTSH", color="grey30" },
+ { <UP>, shape="NARR", color="grey30" },
+ { <END>, shape="NARR", color="grey30" }
+ };
+ };
+ row {
+ top= 86.5;
+ key.color= "grey30";
+ keys {
+ { <FUNC>, "WIDE" },
+ <LCTL>, <LALT>,
+ { <SPCE>, shape="SPCE", 18, color="grey20" },
+ <RALT>, <INS>, <DELE>,
+ { <LEFT>, "NARR" }, { <DOWN>, "NARR" },
+ { <RGHT>, "NARR" }
+ };
+ };
+ solid "FakeKey" {
+ top= 86.5;
+ left= 62.1;
+ shape= "NORM";
+ color= "grey20";
+ };
+ overlay "KPAD" {
+ <AE07>=<KP7>, <AE08>=<KP8>, <AE09>=<KP9>, <AE10>=<KPMU>,
+ <AD07>=<KP4>, <AD08>=<KP5>, <AD09>=<KP6>, <AD10>=<KPSU>,
+ <AC07>=<KP1>, <AC08>=<KP2>, <AC09>=<KP3>, <AC10>=<KPAD>,
+ <AB07>=<KP0>, <AB09>=<KPDL>, <AB10>=<KPSL>
+ };
+ }; // End of "Whole" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
diff --git a/geometry/fujitsu b/geometry/fujitsu
new file mode 100644
index 0000000..02fe0bc
--- /dev/null
+++ b/geometry/fujitsu
@@ -0,0 +1,315 @@
+// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+default xkb_geometry "138" {
+
+ // This is an approximate layout for a (US/ASCII) Fujitsu keyboard.
+
+ description= "Fujitsu English keyboard";
+
+ width= 480;
+ height= 215;
+
+ shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [28,37] },
+ { [ 0, 0], [28, 0], [28,37],
+ [ 5,37], [ 5,19], [ 0,19] },
+ { [ 1, 1], [26, 1], [26,36],
+ [ 7,36], [ 7,18], [ 1,18] }
+ };
+ shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } };
+ shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "SPCE" { { [151,18] }, { [2,1], [149,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+ shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 15;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+
+ section "Alpha" {
+ top= 28;
+ row {
+ top= 1;
+ keys {
+ <BREA>, { <PRSC>, 6 },
+ { <FK13>, 30 }, <FK14>, <FK15>, <FK16>,
+ { <FK17>, 6 }, <FK18>, <FK19>, <FK20>,
+ { <FK21>, 6 }, <FK22>, <FK23>, <FK24>,
+ { <FK29>, 68 }, <FK30>, <FK31>, <FK32>
+ };
+ };
+ row {
+ top= 20;
+ keys {
+ <KNJI>, { <PAUS>, 6 },
+ { <FK01>, 30 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 6 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 6 }, <FK10>, <FK11>, <FK12>,
+ { <UNK0>, 6 }, <UNK1>, <UNK2>,
+ { <FK25>, 6 }, <FK26>, <FK27>, <FK28>
+ };
+ };
+ row {
+ top= 39;
+ left= 316;
+ keys {
+ <PGUP>, <HOME>, <PGDN>
+ };
+ };
+ row {
+ top= 54;
+ keys {
+ <UNDO>, { <ESC>, 6 },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>,
+ <AE06>, <AE07>, <AE08>, <AE09>, <AE10>,
+ <AE11>, <AE12>, <TLDE>, <BKSP>,
+ { <KPMU>, 68 }, <KPDV>, <KPAD>, <KPSU>
+
+ };
+ };
+ row {
+ top= 58;
+ left= 316;
+ keys {
+ <UNK3>, <DEL>, <INS>
+ };
+ };
+ row {
+ top= 73;
+ keys { <COPY>,
+ { <TAB>, 6, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN" },
+ { <KP7>, 68 }, <KP8>, <KP9>, <KPEQ>
+ };
+ };
+ row {
+ top= 92;
+ keys { <PAST>,
+ { <LCTL>, 6, "LCTL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <BKSL>,
+ { <UP>, 49 },
+ { <KP4>, 25 }, <KP5>, <KP6>, <KPDC>
+ };
+ };
+ row {
+ top= 102;
+ left= 316;
+ keys { <LEFT>, { <RGHT>, 19 }
+ };
+ };
+ row {
+ top= 111;
+ keys { <CUT>,
+ { <LFSH>, 6 , "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "RTSH" },
+ { <DOWN>, 25 },
+ { <KP1>, 25 }, <KP2>, <KP3>, { <KPEN>, "KPEN" }
+ };
+ };
+ row {
+ top= 130;
+ keys { <HELP>, { <CAPS>, 6 },
+ <LALT>, <LMTA>,
+ { <SPCE>, "SPCE" },
+ <RMTA>, <RALT>, <COMP>, <LNFD>,
+ { <KP0>, 68, "KP0" }, <KP00>
+ };
+ };
+ row {
+ top= 149;
+ left= 316;
+ keys {
+ { <EXEC>, "EXEC" }
+ };
+ };
+ }; // End of "Alpha" section
+};
+
+xkb_geometry "140" {
+
+ // This is an approximate layout for a Fujitsu Japanese keyboard.
+
+ description= "Fujitsu Japanese keyboard";
+
+ width= 480;
+ height= 215;
+
+ shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [28,37] },
+ { [ 0, 0], [28, 0], [28,37],
+ [ 5,37], [ 5,19], [ 0,19] },
+ { [ 1, 1], [26, 1], [26,36],
+ [ 7,36], [ 7,18], [ 1,18] }
+ };
+ shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } };
+ shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "SPCE" { { [113,18] }, { [2,1], [111,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+ shape "HNKN" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 15;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+
+ section "Alpha" {
+ top= 28;
+ row {
+ top= 1;
+ keys {
+ <BREA>, { <PRSC>, 6 },
+ { <FK13>, 30 }, <FK14>, <FK15>, <FK16>,
+ { <FK17>, 6 }, <FK18>, <FK19>, <FK20>,
+ { <FK21>, 6 }, <FK22>, <FK23>, <FK24>,
+ { <FK29>, 68 }, <FK30>, <FK31>, <FK32>
+ };
+ };
+ row {
+ top= 20;
+ keys {
+ <KNJI>, { <PAUS>, 6 },
+ { <FK01>, 30 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 6 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 6 }, <FK10>, <FK11>, <FK12>,
+ { <UNK0>, 6 }, <UNK1>, <UNK2>,
+ { <FK25>, 6 }, <FK26>, <FK27>, <FK28>
+ };
+ };
+ row {
+ top= 39;
+ left= 316;
+ keys {
+ <PGUP>, <HOME>, <PGDN>
+ };
+ };
+ row {
+ top= 54;
+ keys {
+ <UNDO>, { <ESC>, 6 },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>,
+ <AE06>, <AE07>, <AE08>, <AE09>, <AE10>,
+ <AE11>, <AE12>, <BKSL>, <BKSP>,
+ { <KPMU>, 68 }, <KPDV>, <KPAD>, <KPSU>
+
+ };
+ };
+ row {
+ top= 58;
+ left= 316;
+ keys {
+ <UNK3>, <DEL>, <INS>
+ };
+ };
+ row {
+ top= 73;
+ keys { <COPY>,
+ { <TAB>, 6, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN" },
+ { <KP7>, 68 }, <KP8>, <KP9>, <KPEQ>
+ };
+ };
+ row {
+ top= 92;
+ keys { <PAST>,
+ { <LCTL>, 6, "LCTL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <TLDE>,
+ { <UP>, 49 },
+ { <KP4>, 25 }, <KP5>, <KP6>, <KPDC>
+ };
+ };
+ row {
+ top= 102;
+ left= 316;
+ keys { <LEFT>, { <RGHT>, 19 }
+ };
+ };
+ row {
+ top= 111;
+ keys { <CUT>,
+ { <LFSH>, 6 , "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "RTSH" },
+ { <DOWN>, 25 },
+ { <KP1>, 25 }, <KP2>, <KP3>, { <KPEN>, "KPEN" }
+ };
+ };
+ row {
+ top= 130;
+ keys { <HELP>, { <CAPS>, 6 },
+ <LALT>, <LMTA>, <UNK4>,
+ { <SPCE>, "SPCE" },
+ <UNK5>, <RMTA>, <COMP>, <LNFD>, <UNK6>,
+ { <KP0>, 68, "KP0" }, <KP00>
+ };
+ };
+ row {
+ top= 149;
+ left= 134;
+ keys {
+ { <UNK7>, "HNKN" }, { <UNK8>, "HNKN" },
+ { <EXEC>, 132, "EXEC" }
+ };
+ };
+ }; // End of "Alpha" section
+};
diff --git a/geometry/hp b/geometry/hp
new file mode 100644
index 0000000..c93cb0c
--- /dev/null
+++ b/geometry/hp
@@ -0,0 +1,456 @@
+// $Xorg: hp,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/geometry/hp,v 1.8 2003/08/09 14:30:46 pascal Exp $
+
+default xkb_geometry "pc101" {
+
+ description= "HP PC101";
+ width= 470;
+ height= 210;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [132,18] }, { [2,1], [130,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 91;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, { <RCTL>, 20 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 91;
+ left= 310;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 91;
+ left= 375;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "default" geometry
+
+xkb_geometry "hil" {
+
+ description= "HP hil";
+ width= 455;
+ height= 170;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "TABK" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "BKSL" { { [ 24,18] }, { [2,1], [ 22,17] } };
+ shape "RTRN" { { [ 38,18] }, { [2,1], [ 36,17] } };
+ shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [151,18] }, { [2,1], [150,17] } };
+ shape "KP0" { { [ 38,18] }, { [2,1], [ 36,17] } };
+ shape "KPTB" { { [ 18,38] }, { [2,1], [ 16,37] } };
+ shape "TLDE" { { [ 24,18] }, { [2,1], [ 22,17] } };
+ shape "FKT1" { { [ 17,14] }, { [2,1], [ 15,13] } };
+ shape "FKT2" { { [ 23,14] }, { [2,1], [ 21,13] } };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 14;
+ row {
+ top= 1;
+ keys { { <BRK>, "FKT1" }, { <STOP>, "FKT1" } ,
+ { <FK01>, "FKT2", 10 }, { <FK02>, "FKT2" },
+ { <FK03>, "FKT2" }, { <FK04>, "FKT2" },
+ { <MENU>, "FKT1" }, { <SYST>, "FKT1" },
+ { <FK05>, "FKT2" }, { <FK06>, "FKT2" },
+ { <FK07>, "FKT2" }, { <FK08>, "FKT2" },
+ { <CLRL>, "FKT1", 10 }, { <CLR>, "FKT1" },
+ { <FK09>, "FKT1", 19 }, { <FK10>, "FKT1" },
+ { <FK11>, "FKT1" }, { <FK12>, "FKT1" }
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <TLDE>, "TLDE" }, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP" }, <INSL>, <DELL>
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" },
+ <INSC>, <DELC>
+ };
+ };
+ row {
+ top= 39;
+ keys { <CAPS>, <LCTL>,
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN" },
+ <HOME>, <PGUP>
+ };
+ };
+ row {
+ top= 58;
+ keys { <ESC>, { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }, <SELE>,
+ <UP>, <PGDN>
+ };
+ };
+ row {
+ top= 77;
+ keys { <PRSC>, { <LALT>, 30 },
+ { <SPCE>, "SPCE" },
+ <RALT>, { <LEFT>, 30 }, <DOWN>, <RGHT>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Keypad" {
+ top= 52;
+ left= 360;
+ row {
+ top= 1;
+ keys { <KPMU>, <KPDV>, <KPAD>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPEN> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPSP> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPTB>, "KPTB" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+}; // End of "default" geometry
+
+
+// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net>
+// Geometry specification for HP Omnibook keyboards.
+// Compatible Models: 6100, 6000.
+
+xkb_geometry "omnibook" {
+ width = 282;
+ height = 128;
+ baseColor = "grey80";
+ labelColor = "white";
+
+ shape "FN0" { cornerRadius = 1, { [15.5, 12] }, { [1, 0], [14.5, 11] } };
+ shape "NORM" { cornerRadius = 1, { [18, 16] }, { [2, 0], [16, 14] } };
+ shape "BKSP" { cornerRadius = 1, { [31, 16] }, { [2, 0], [29, 14] } };
+ shape "TABK" { cornerRadius = 1, { [27, 16] }, { [2, 0], [25, 14] } };
+ shape "CAPS" { cornerRadius = 1, { [32, 16] }, { [2, 0], [30, 14] } };
+ shape "RTSH" { cornerRadius = 1, { [45, 16] }, { [2, 0], [43, 14] } };
+ shape "MODK" { cornerRadius = 1, { [28, 16] }, { [2, 0], [26, 14] } };
+ shape "SPCE" { cornerRadius = 1, { [90, 16] }, { [2, 0], [88, 14] } };
+ shape "ARRS" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 11] } };
+
+ shape "LED" { cornerRadius = 1, { [2, 4] } };
+
+ shape "KEYS" { cornerRadius = 1,
+ { [0, 13],
+ [197, 13], [197, 0],
+ [280, 0], [280, 125],
+ [224, 125], [224, 112],
+ [0, 112] }
+ };
+
+ solid "KeyPanel" {
+ shape = "KEYS";
+ left = 1;
+ top = 1;
+ color = "black";
+ };
+
+ shape "NULL1" { cornerRadius = 1, { [54, 16] } };
+
+ solid "NullPanel1" {
+ shape = "NULL1";
+ left = 226;
+ top = 96;
+ color = "grey80";
+ };
+
+ shape "NULL2" { cornerRadius = 1, { [19, 14] } };
+
+ solid "NullPanel2" {
+ shape = "NULL2";
+ left = 243;
+ top = 97;
+ color = "black";
+ };
+
+ indicator.onColor = "green";
+ indicator.offColor = "grey10";
+ indicator.top = 4;
+ indicator.shape = "LED";
+ indicator "Caps Lock" { left = 45; };
+ indicator "Num Lock" { left = 60; };
+ indicator "Scroll Lock" { left = 75; };
+ indicator "HDDActivity" { onColor = "red"; left = 90; };
+
+ key.color = "grey60";
+
+ section "Function" {
+ key.gap = 0.99;
+ left = 1;
+ top = 1;
+ key.shape = "FN0";
+ row {
+ left = 197;
+ top = 1;
+ keys { <PRSC>, <PAUS>, <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top = 14;
+ keys { <ESC>,
+ <FK01>, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>, <FK11>, <FK12>,
+ <SCLK>, <DELE>, <END>, <PGDN>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Control" {
+ left = 1;
+ top = 34;
+ key.gap = 1;
+ row {
+ top = 62;
+ key.shape = "NORM";
+ keys { <LCTL>, <FN>, <LWIN>, <LALT>,
+ { <SPCE>, "SPCE" }, <RALT>, <MENU>, <RCTL>
+ };
+ };
+ }; // End of "Control" section
+
+ section "Navigation" {
+ key.shape = "ARRS";
+ left = 225;
+ top = 97;
+ key.gap = 1.4;
+ row {
+ left= 18;
+ top = 1;
+ keys { <UP> };
+ };
+ row {
+ top = 16;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Navigation" section
+
+ shape "STIK" { cornerRadius = 4, { [7, 7] } };
+
+ solid "STIK" {
+ priority = 255;
+ color = "red";
+ shape = "STIK";
+ top = 73;
+ left = 126;
+ };
+};
+
+// 86 keys
+xkb_geometry "omnibook_intl" {
+ include "hp(omnibook)"
+ description = "HP Omnibook 6000/6100, Intl";
+
+ shape "RTRN" { cornerRadius = 1,
+ { [22, 0], [22, 33], [5, 33], [5, 16], [0, 16], [0, 0] },
+ { [20, 0], [20, 31], [7, 31], [7, 14], [2, 14], [2, 0] } };
+ shape "LFSH" { cornerRadius = 1, { [23, 16] }, { [2, 0], [21, 14] } };
+
+ section "Alpha" {
+ key.gap = 1;
+ key.color = "grey60";
+ key.shape = "NORM";
+ left = 1;
+ top = 27;
+ row {
+ top = 1;
+ keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top = 18;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top = 35;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top = 52;
+ keys { { <LFSH>, "LFSH" }, <LSGT>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ }; // End of "Alpha" section
+};
diff --git a/geometry/ibm.vndr/.cvsignore b/geometry/ibm.vndr/.cvsignore
new file mode 100644
index 0000000..282522d
--- /dev/null
+++ b/geometry/ibm.vndr/.cvsignore
@@ -0,0 +1,2 @@
+Makefile
+Makefile.in
diff --git a/geometry/ibm.vndr/Makefile.am b/geometry/ibm.vndr/Makefile.am
new file mode 100644
index 0000000..883420e
--- /dev/null
+++ b/geometry/ibm.vndr/Makefile.am
@@ -0,0 +1,6 @@
+geom_DATA = \
+thinkpad
+
+EXTRA_DIST= $(geom_DATA)
+
+geomdir = $(xkb_base)/geometry/ibm.vndr
diff --git a/geometry/ibm.vndr/thinkpad b/geometry/ibm.vndr/thinkpad
new file mode 100644
index 0000000..c9b769c
--- /dev/null
+++ b/geometry/ibm.vndr/thinkpad
@@ -0,0 +1,267 @@
+// -*- indent-tabs-mode: nil -*-
+// $XFree86: xc/programs/xkbcomp/geometry/ibm/thinkpad,v 1.3 2003/08/09 14:30:48 pascal Exp $
+
+// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net>
+// Geometry specification for IBM ThinkPad keyboard.
+// Compatible Models: THINKPAD 560Z 2640-90U, THINKPAD 560Z 2640-91U,
+// THINKPAD 560Z 2640-B0U, THINKPAD 560Z 2640-B1U, THINKPAD 560Z 2640-RR3,
+// THINKPAD 600 2645-31U, THINKPAD 600 2645-35U, THINKPAD 600 2645-41U,
+// THINKPAD 600 2645-42U, THINKPAD 600 2645-45U, THINKPAD 600 2645-48U,
+// THINKPAD 600 2645-51U, THINKPAD 600 2645-85U, THINKPAD 600 2645-A1U,
+// THINKPAD 600 2645-RR1, THINKPAD 600 2645-RR2, THINKPAD 600E 2645-3AU,
+// THINKPAD 600E 2645-4AU, THINKPAD 600E 2645-4BU, THINKPAD 600E 2645-55U,
+// THINKPAD 600E 2645-5AU, THINKPAD 600E 2645-5BU, THINKPAD 600E 2645-5JU,
+// THINKPAD 600E 2645-8AO, THINKPAD 600E 2645-8AU, THINKPAD 600E 2645-8BU,
+// THINKPAD 600E 2645-AAU, THINKPAD 600E 2645-RRB, THINKPAD 600E 2645-RRD,
+// THINKPAD 600E 2645-RRF, THINKPAD 600E 2645-RRS, THINKPAD A22E 2645-45U
+
+xkb_geometry "common" {
+ width = 290;
+ height = 150;
+ baseColor = "grey80";
+ labelColor = "white";
+
+ shape "FN0" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 10] } };
+ shape "NORM" { cornerRadius = 1, { [18, 18] }, { [2.5, 0], [15.5, 14] } };
+ shape "BKSP" { cornerRadius = 1, { [37, 18] }, { [2.5, 0], [34.5, 14] } };
+ shape "TABK" { cornerRadius = 1, { [27, 18] }, { [2.5, 0], [24.5, 14] } };
+ shape "CAPS" { cornerRadius = 1, { [31, 18] }, { [1, 0], [30, 16] },
+ { [1, 0], [26, 16] },
+ { [2.5, 0], [24.5, 14] } };
+ shape "RTSH" { cornerRadius = 1, { [50, 18] }, { [2.5, 0], [46.5, 14] } };
+ shape "MODK" { cornerRadius = 1, { [27.5, 18] }, { [2.5, 0], [25, 14] } };
+ shape "SPCE" { cornerRadius = 1, { [100, 18] }, { [2.5, 0], [97.5, 14] } };
+ shape "ARRS" { cornerRadius = 1, { [16, 13] }, { [1.5, 0], [14.5, 11] } };
+
+ shape "LED" { cornerRadius = 2, { [3, 3] } };
+
+ shape "KEYS" { cornerRadius = 2,
+ { [0, 0], [19, 0], [19, 13], [172, 13],
+ [172, 0], [286, 0], [286, 138], [216, 138],
+ [216, 124], [0, 124] } };
+
+ solid "KeyPanel" {
+ shape = "KEYS";
+ left = 2;
+ top = 5;
+ color = "black";
+ };
+
+ shape "NULL1" { cornerRadius = 1,
+ { [0, 0], [50, 0], [50, 18], [34, 18], [34, 4],
+ [16, 4], [16, 18], [0, 18] } };
+
+ solid "NullPanel1" {
+ shape = "NULL1";
+ left = 237;
+ top = 110;
+ color = "grey80";
+ };
+
+ shape "NULL2" { cornerRadius = 1, { [17, 13] } };
+
+ solid "NullPanel2" {
+ shape = "NULL2";
+ left = 219;
+ top = 129;
+ color = "grey80";
+ };
+
+ shape "NULL3" { cornerRadius = 1,
+ { [0, 26],
+ [72, 26], [72, 13], [76, 13], [76, 26],
+ [149, 26], [149, 13], [153, 13], [153, 26],
+ [226, 26], [226, 0], [230, 0], [230, 26],
+ [284, 26], [285, 27],
+ [0, 27] } };
+
+ solid "NullPanel3" {
+ shape = "NULL3";
+ left = 3;
+ top = 6;
+ color = "grey80";
+ };
+
+ indicator.onColor = "green";
+ indicator.offColor = "grey10";
+ indicator.top = 4;
+ indicator.shape = "LED";
+ indicator "HDDActivity" { onColor = "red"; left = 100; };
+ indicator "Num Lock" { left = 108; };
+ indicator "Caps Lock" { left = 114; };
+ indicator "Scroll Lock" { left = 120; };
+ indicator "Power" { left = 128; };
+
+ key.gap = 1;
+ key.color = "grey60";
+
+ section "Function" {
+ left = 2;
+ top = 5;
+ key.shape = "FN0";
+ row {
+ top = 1;
+ keys { <ESC>, { <PRSC>, 155 }, <SCLK>, <PAUS> };
+ };
+ row {
+ top = 14;
+ keys { <FK01>, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 6 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 6 }, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Control" {
+ left= 2;
+ top = 109;
+ key.shape = "MODK";
+ row {
+ top = 1;
+ keys { { <FN>, "NORM" }, <LCTL>, <LALT>,
+ { <SPCE>, "SPCE" }, <RALT>, <RCTL>
+ };
+ };
+ }; // End of "Control" section
+
+ section "Editing" {
+ top = 5;
+ left = 233;
+ key.shape = "FN0";
+ row {
+ top = 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top = 14;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ }; // End of "Editing" section
+
+ section "Navigation" {
+ top = 114;
+ left = 236;
+ key.shape = "ARRS";
+ row {
+ top = 1;
+ left = 17;
+ keys { <UP> };
+ };
+ row {
+ top = 15;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Navigation" section
+
+ shape "STIK" { cornerRadius = 4, { [7, 7] } };
+
+ solid "STIK" {
+ priority = 255;
+ color = "red";
+ shape = "STIK";
+ top = 85;
+ left = 126;
+ };
+};
+
+// 85 keys
+// US/English (FRU 02K4785).
+xkb_geometry "us" {
+ include "thinkpad(common)"
+ description = "IBM ThinkPad 560Z/600/600E/A22E, US";
+
+ shape "RTRN" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } };
+ shape "LFSH" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } };
+ shape "BKSL" { cornerRadius = 1, { [28, 18] }, { [2.5, 0], [25.5, 14] } };
+
+ section "Alpha" {
+ left = 2;
+ top = 33;
+ key.gap = 1;
+ key.color = "grey60";
+ key.shape = "NORM";
+ row {
+ top = 1;
+ keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top = 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top = 39;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top = 58;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ }; // End of "Alpha" section
+};
+
+// 86 keys
+// Tested on: DE/German, UK/English (FRU 02K4787).
+xkb_geometry "intl" {
+ include "thinkpad(common)"
+ description = "IBM ThinkPad 560Z/600/600E/A22E, Intl";
+
+ shape "RTRN" { cornerRadius = 1, { [28, 0], [28, 37], [4, 37], [4, 18],
+ [0, 18], [0, 0] },
+ { [25.5, 0], [25.5, 33], [6.5, 33],
+ [6.5, 14], [2.5, 14], [2.5, 0] } };
+ shape "LFSH" { cornerRadius = 1, { [24, 18] }, { [2.5, 0], [21.5, 14] } };
+
+ section "Alpha" {
+ left = 2;
+ top = 33;
+ key.gap = 1;
+ key.color = "grey60";
+ key.shape = "NORM";
+ row {
+ top = 1;
+ keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top = 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top = 39;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top = 58;
+ keys { { <LFSH>, "LFSH" }, <AB00>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ }; // End of "Alpha" section
+};
diff --git a/geometry/keytronic b/geometry/keytronic
new file mode 100644
index 0000000..2e4e37a
--- /dev/null
+++ b/geometry/keytronic
@@ -0,0 +1,255 @@
+// $Xorg: keytronic,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86$
+//
+default xkb_geometry "FlexPro" {
+
+ // This is an approximate layout for a Key Tronic FlexPro
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "Key Tronic FlexPro keyboard";
+
+ width= 515;
+ height= 200;
+
+ shape "EDGE" { cornerRadius= 2, { [ 515, 200 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "TABK" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "BKSL" { { [ 23,18] }, { [2,1], [21,17] } };
+ shape "RTRN" {
+ approx = { [16, 0], [38,37] },
+ { [16, 0], [38, 0], [38,37],
+ [ 0,37], [ 0,19], [16,19] },
+ { [18, 1], [36, 1], [36,36],
+ [ 2,36], [ 2,20], [18,20] } };
+ shape "CAPS" { { [36,18] }, { [2,1], [34,17] } };
+ shape "SHFT" { { [46,18] }, { [2,1], [44,17] } };
+ shape "LCTL" { { [32,18] }, { [2,1], [30,17] } };
+ shape "RCTL" { { [38,18] }, { [2,1], [36,17] } };
+ shape "LALT" { { [28,18] }, { [2,1], [26,17] } };
+ shape "RALT" { { [33,18] }, { [2,1], [31,17] } };
+ shape "LSPC" { { [66,22] }, { [0,0], [66,22] } };
+ shape "RSPC" { { [76,22] }, { [0,0], [76,22] } };
+ shape "KP0" { { [37,18] }, { [2,1], [35,17] } };
+ shape "KPEN" { { [18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { cornerRadius= 3, { [80,35] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 9;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+
+ section "Function" {
+ top= 56;
+ row {
+ top = 1;
+ key.color= "grey20";
+ keys { <FK01>, <FK02> };
+ };
+ row {
+ top = 20;
+ key.color= "grey20";
+ keys { <FK03>, <FK04> };
+ };
+ row {
+ top = 39;
+ keys { <FK05>, <FK06> };
+ };
+ row {
+ top = 58;
+ key.color= "grey20";
+ keys { <FK07>, <FK08> };
+ };
+ row {
+ top = 77;
+ key.color= "grey20";
+ keys { <FK09>, <FK10> };
+ };
+ row {
+ top = 96;
+ keys { <FK11>, <FK12> };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 56;
+ left= 53;
+ row {
+ top= 1;
+ keys {
+ { <ESC>, color="grey20" }, { <BKSL>, "BKSL", color="grey20" },
+ <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys {
+ { <TLDE>, color="grey20" }, { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <RTRN>, "RTRN", -14, color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys {
+ { <LCTL>, color="grey20" }, { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, <AC11>
+ };
+ };
+ row {
+ top= 58;
+ keys {
+ { <LFSH>, color="grey20" },
+ { <LFSH>, "SHFT", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "SHFT", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.color= "grey20";
+ keys {
+ <LALT>,
+ { <LCTL>, shape="LCTL" },
+ { <LALT>, shape="LALT" },
+ { <SPCE>, shape="LSPC", 4, color="white" },
+ { <SPCE>, shape="RSPC",color="white" },
+ { <RALT>, shape="RALT", 4 },
+ { <RCTL>, shape="RCTL" }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 12;
+ left= 365;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 45;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 64;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 102;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 121;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 3, { [ 76, 20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 7, 4 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 11;
+ left= 430;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 13;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 440; };
+ indicator "Caps Lock" { left= 467; };
+ indicator "Scroll Lock" { left= 489; };
+ text.top= 22;
+ text.color= "black";
+ text "NumLockLabel" { left= 438; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 465; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 487; text="Scroll\nLock"; };
+
+ logo "FlexProLogoImage" {
+ top= 12;
+ left= 45;
+ name= "KeyTronic";
+ shape= "LOGO";
+ };
+ text "KeyTronicLogoText" {
+ top= 15;
+ left= 50;
+ width= 55;
+ text= "FlexPro";
+ font= "times";
+ slant= "o";
+ weight= "bold";
+ fontWidth= "narrow";
+ fontSize= 36;
+ };
+
+ section "Keypad" {
+ top= 56;
+ left= 430;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <LEFT> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPSU>, color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, { <KPAD>, color= "grey20" } };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+};
diff --git a/geometry/kinesis b/geometry/kinesis
new file mode 100644
index 0000000..548d092
--- /dev/null
+++ b/geometry/kinesis
@@ -0,0 +1,193 @@
+// $Xorg: kinesis,v 1.3 2000/08/17 19:54:35 cpqbld Exp $
+//
+// $XFree86$
+//
+default xkb_geometry "model100" {
+
+ // This is an approximate layout for a Kinesis Ergonomic keyboard
+ // Generated completely by eye. I didn't actually *measure* a real
+ // keyboard.
+
+ description= "Kinesis Ergonomic Keyboard";
+ width= 421;
+ height= 185;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "WIDE" { { [ 21,18] }, { [2,1], [19,17] } };
+ shape "TALL" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "FKEY" { cornerRadius=0, { [ 10,13] } };
+ shape "LED" { cornerRadius= 1.5, { [ 3, 3] } };
+ shape "LOGO" { { [ 40, 10 ] } };
+ shape "EDGE" { cornerRadius=5, { [ 421, 185 ] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section "LeftFunction" {
+ left= 15;
+ top= 11;
+ key.shape= "FKEY";
+ key.gap= 3;
+ row {
+ left= 1;
+ top= 1;
+ keys {
+ <ESC>, <FK01>, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>
+ };
+ };
+ }; // End of "LeftFunction" section
+
+ section "RightFunction" {
+ left= 290;
+ top= 11;
+ key.shape= "FKEY";
+ key.gap= 3;
+ row {
+ left= 1;
+ top= 0.2;
+ keys {
+ <FK09>, <FK10>, <FK11>, <FK12>, <PRSC>,
+ <SCLK>, <PAUS>, <FK16>, <FK17>
+ };
+ };
+ }; // End of "RightFunction" section
+
+ row.vertical= True;
+ row.top= 1;
+ key.gap= 0.5;
+
+ logo "KinesisLogoImage" {
+ top= 25;
+ left= 240;
+ name= "Kinesis";
+ shape= "LOGO";
+ };
+
+ indicator.shape= "LED";
+ indicator.top= 30;
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator "Caps Lock" { left= 23; };
+
+ section "LeftAlpha" {
+ top= 34;
+ left= 15;
+ row {
+ left= 2;
+ key.shape= "WIDE";
+ keys { <AE12>, <TAB>, <CAPS>, <LFSH> };
+ };
+ row {
+ top= 4;
+ left= 24;
+ keys { <AE01>, <AD01>, { <AC01>, color="grey20" }, <AB01>, <TLDE> };
+ };
+ row {
+ left= 43;
+ keys { <AE02>, <AD02>, { <AC02>, color="grey20" }, <AB02>, <INS> };
+ };
+ row {
+ left= 62;
+ keys { <AE03>, <AD03>, { <AC03>, color="grey20" }, <AB03>, <LEFT> };
+ };
+ row {
+ left= 81;
+ keys { <AE04>, <AD04>, { <AC04>, color="grey20" }, <AB04>, <RGHT> };
+ };
+ row {
+ left= 100;
+ keys { <AE05>, <AD05>, <AC05>, <AB05> };
+ };
+ }; // End of "LeftAlpha" section
+
+ indicator "NumLock" { left= 318; };
+ indicator "Overlay" { left= 387; };
+ section "RightAlpha" {
+ top= 34;
+ left= 290;
+ row {
+ left= 2;
+ keys { <AE06>, <AD06>, <AC06>, <AB06> };
+ };
+ row {
+ left= 21;
+ keys { <AE07>, <AD07>, { <AC07>, color="grey20" }, <AB07>, <UP> };
+ };
+ row {
+ left= 40;
+ keys { <AE08>, <AD08>, { <AC08>, color="grey20" }, <AB08>, <DOWN> };
+ };
+ row {
+ left= 59;
+ keys { <AE09>, <AD09>, { <AC09>, color="grey20" }, <AB09>, <AD11> };
+ };
+ row {
+ top= 4;
+ left= 78;
+ keys { <AE10>, <AD10>, { <AC10>, color="grey20" }, <AB10>, <AD12> };
+ };
+ row {
+ left= 97;
+ key.shape= "WIDE";
+ keys { <AE11>, <BKSL>, <AC11>, <RTSH> };
+ };
+ overlay "KPAD" {
+ <AE07>=<NMLK>, <AE08>=<KPEQ>, <AE09>=<KPSL>, <AE10>=<KPMU>,
+ <AD07>=<KP7>, <AD08>=<KP8>, <AD09>=<KP9>, <AD10>=<KPSU>,
+ <AC07>=<KP4>, <AC08>=<KP5>, <AC09>=<KP6>, <AC10>=<KPAD>,
+ <AB07>=<KP1>, <AB08>=<KP2>, <AB09>=<KP3>, <AB10>=<KPEN>,
+ <AE10>=<KPDL>, <AE11>=<KPEN>
+ };
+ }; // End of "RightAlpha" section
+
+ section "LeftEdit" {
+ top= 109;
+ left= 123;
+ angle= 20;
+ row.top= -18;
+ row {
+ top= 1;
+ left= 1;
+ keys { { <BKSP>, "TALL" } };
+ };
+ row {
+ left= 20;
+ keys { <LCTL>, { <DELE>, "TALL" } };
+ };
+ row {
+ left= 39;
+ keys { <LALT>, <HOME>, <END> };
+ };
+ }; // End of "RightEdit" section
+
+ section "RightEdit" {
+ top= 109;
+ left= 302;
+ angle= -20;
+ row.top= -18;
+ row {
+ left= -57;
+ keys { <RALT>, <PGUP>, <PGDN> };
+ };
+ row {
+ left= -38;
+ keys { <RCTL>, { <RTRN>, "TALL" } };
+ };
+ row {
+ top= 1;
+ left= -19;
+ keys { { <SPCE>, "TALL" } };
+ };
+ overlay "KPAD" {
+ <SPCE>= <KP0>
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
diff --git a/geometry/macintosh b/geometry/macintosh
new file mode 100644
index 0000000..f97251f
--- /dev/null
+++ b/geometry/macintosh
@@ -0,0 +1,174 @@
+// $XFree86: xc/programs/xkbcomp/geometry/macintosh,v 1.3 2003/08/09 14:30:47 pascal Exp $
+//
+// Some modifications (<eqdar@castalie.org>) :
+// - Added a <LSGT> key
+// - Fixed the shape of the <RTRN> key
+// - Moved <BKSL> to the 'AC' row
+// - Added a special Macintosh sysctl key
+// - Minor changes (Function keys shape, LED position...)
+
+default xkb_geometry "macintosh" {
+
+ description= "Apple Extended Keyboard II";
+ width = 475;
+ height = 194;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "TLDE" { { [ 23,18] }, { [2,1], [ 21,17] } };
+ shape "BKSP" { { [ 33,18] }, { [2,1], [ 31,17] } };
+ shape "TAB" { { [ 33,18] }, { [2,1], [ 31,17] } };
+ shape "RTRN" {
+ { [0,0],[23,0],[23,37],[4,37],[4,18],[0,18] },
+ { [2,1],[21,1],[21,36],[6,36],[6,17],[2,17] } };
+ shape "CAPS" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "LCTL" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "LALT" { { [ 22,18] }, { [2,1], [ 20,17] } };
+ shape "LMTA" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "RCTL" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "RALT" { { [ 22,18] }, { [2,1], [ 20,17] } };
+ shape "RMTA" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "RTSH" { { [ 47,18] }, { [2,1], [ 45,17] } };
+ shape "SPCE" { { [123,18] }, { [2,1], [121,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } };
+ // Macintosh keyboards have a special sysctl key at the top right
+ shape "AAPL" {
+ { [ 0,0], [ 18,0], [ 18,18], [ 0,18] },
+ { [ 1,1], [ 17,1], [ 17,17], [ 1,17] },
+ { [ 8,5], [ 8,12], [ 2,9] } };
+
+ shape "LEDS" { cornerRadius = 0, { [ 55,19] } };
+ shape "LED" { cornerRadius = 0, { [ 8, 2] } };
+
+ solid "LedPanel" {
+ shape= "LEDS";
+ top = 48;
+ left = 378;
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top = 50;
+ indicator.shape= "LED";
+ indicator "NumLock" { left = 381; };
+ indicator "CapsLock" { left = 398; };
+ indicator "ScrollLock" { left = 415; };
+ text.top= 55;
+ text.color= "black";
+ text "NumLockLabel" { left = 381; text = "Num\nLock"; };
+ text "CapsLockLabel" { left = 398; text = "Caps\nLock"; };
+ text "ScrollLockLabel" { left = 415; text = "Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+
+ section "Function" {
+ top = 48;
+ row {
+ top= 1;
+ keys { <ESC>,
+ { <FK01>, 20 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 10 }, <SCLK>, <PAUS>,
+ // This is the sysctl key on macintosh keyboards
+ // keycode is 222 with a 4.21 kernel, which is <I5E>
+ { <I5E>, "AAPL", 67 }
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top = 87;
+ row {
+ top= 1;
+ keys { { <TLDE>, "TLDE" }, <AE01>, <AE02>, <AE03>,
+ <AE04>, <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TAB" }, <AD01>, <AD02>, <AD03>,
+ <AD04>, <AD05>, <AD06>, <AD07>, <AD08>, <AD09>,
+ <AD10>, <AD11>, <AD12>, { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS" }, <AC01>, <AC02>, <AC03>,
+ <AC04>, <AC05>, <AC06>, <AC07>, <AC08>, <AC09>,
+ <AC10>, <AC11>, <BKSL>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" }, <LSGT>, <AB01>, <AB02>,
+ <AB03>, <AB04>, <AB05>, <AB06>, <AB07>, <AB08>,
+ <AB09>, <AB10>, { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ keys { { <LCTL>, "LCTL" }, { <LALT>, "LALT" },
+ { <LMTA>, "LMTA" },
+ { <SPCE>, "SPCE" },
+ { <RMTA>, "RMTA" },
+ { <RALT>, "RALT" }, { <RCTL>, "RCTL" }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top = 87;
+ left = 314;
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ // Begin of "Keypad" section
+ section "Keypad" {
+ top = 87;
+ left = 380;
+ row {
+ top= 1;
+ keys { <NMLK>, <KPEQ>, <KPDV>, <KPMU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPSU> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPAD> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+}; // End of "default" geometry
diff --git a/geometry/microsoft b/geometry/microsoft
new file mode 100644
index 0000000..0894937
--- /dev/null
+++ b/geometry/microsoft
@@ -0,0 +1,256 @@
+// $Xorg: microsoft,v 1.3 2000/08/17 19:54:35 cpqbld Exp $
+//
+// $XFree86$
+//
+default xkb_geometry "natural" {
+
+ // Approximate layout for a Microsoft Natural Keyboard
+ description= "Microsoft Natural Keyboard";
+ width= 550;
+ height= 190;
+
+ shape.cornerRadius= 1;
+ shape "LDEF" { { [ 18,18] }, { [2,1], [15,15] } };
+ shape "TABK" { { [ 26,18] }, { [2,1], [23,15] } };
+ shape "CAPS" { { [ 30,18] }, { [2,1], [23,15] } };
+ shape "LFSH" { { [ 41,18] }, { [2,1], [38,15] } };
+ shape "KEY6" { { [ 22,18] }, { [2,1], [15,15] } };
+ shape "KEYT" { { [ 33,18] }, { [2,1], [15,15] } };
+ shape "KEYG" { { [ 29,18] }, { [2,1], [15,15] } };
+ shape "LCTL" {
+ approx= { [ 32, 22 ] },
+ { [ 0, 0], [ 32, 0 ], [ 32, 23 ], [ 0, 22 ] },
+ { [ 2, 1], [ 29, 1 ], [ 29, 17 ], [ 2, 15 ] }
+ };
+ shape "LWIN" {
+ approx= { [ 32, 23 ] },
+ { [ 0, 0], [ 32, 0 ], [ 32, 24 ], [ 0, 23 ] },
+ { [ 2, 1], [ 29, 1 ], [ 29, 18 ], [ 2, 17 ] }
+ };
+ shape "LALT" {
+ approx= { [ 32, 24 ] },
+ { [ 0, 0], [ 32, 0 ], [ 32, 25 ], [ 0, 24 ] },
+ { [ 2, 1], [ 29, 1 ], [ 29, 20 ], [ 2, 19 ] }
+ };
+ shape "RDEF" { { [ 18,18] }, { [3,1], [15,15] } };
+ shape "KEY7" { { [ 28, 18 ] }, { [ 14, 1], [26, 15] } };
+ shape "KEYH" { { [ 24, 18 ] }, { [ 10, 1], [22, 15] } };
+ shape "KEYN" { { [ 32, 18 ] }, { [ 18, 1], [30, 15] } };
+ shape "BKSP" { { [ 41, 18 ] }, { [ 3, 1], [39, 15] } };
+ shape "BKSL" { { [ 24, 18 ] }, { [ 3, 1], [22, 15] } };
+ shape "RTRN" { { [ 37, 18 ] }, { [ 3, 1], [35, 15] } };
+ shape "RTSH" { { [ 43, 18 ] }, { [ 3, 1], [41, 15] } };
+ shape "RALT" {
+ approx= { [ 27, 24 ] },
+ { [ 0, 0], [ 27, 0 ], [ 27, 24 ], [ 0, 25 ] },
+ { [ 3, 1], [ 25, 1 ], [ 25, 19 ], [ 3, 20 ] }
+ };
+ shape "RWIN" {
+ approx= { [ 27, 23 ] },
+ { [ 0, 0], [ 27, 0 ], [ 27, 23 ], [ 0, 24 ] },
+ { [ 3, 1], [ 25, 1 ], [ 25, 18 ], [ 3, 19 ] }
+ };
+ shape "MENU" {
+ approx= { [ 27, 21 ] },
+ { [ 0, 0], [ 27, 0 ], [ 27, 21 ], [ 0, 23 ] },
+ { [ 3, 1], [ 25, 1 ], [ 25, 16 ], [ 3, 17 ] }
+ };
+ shape "RCTL" {
+ approx= { [ 27, 19 ] },
+ { [ 0, 0], [ 27, 0 ], [ 27, 19 ], [ 0, 21 ] },
+ { [ 3, 1], [ 25, 1 ], [ 25, 14 ], [ 3, 15 ] }
+ };
+ shape "KPAD" { { [ 18, 37 ] }, { [ 3, 1 ], [ 16, 34 ] } };
+ shape "KP0" { { [ 37, 18 ] }, { [ 3, 1 ], [ 35, 15 ] } };
+ shape "SPCE" {
+ { [ 4, 3], [42,10], [44, 0], [88, 0], [90,10], [130, 3],
+ [134,26], [99,30], [67,33], [33,30], [ 0,26] },
+ { [ 6, 4.5], [43,11], [45, 1], [87, 1], [89,11], [128, 4.5],
+ [131,23], [99,28], [67,32], [33,28], [ 3,23] }
+ };
+
+ shape "EDGE" {
+ cornerRadius= 2,
+ { [ 25, 0 ], [ 177, 17 ], [ 329, 0 ], [ 542, 0 ],
+ [ 542, 150 ], [ 354, 150 ], [ 177, 185 ], [ 0, 150 ] }
+ };
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ row.left= 1;
+ key.shape= "LDEF";
+ key.gap= 1;
+ section "LeftFunction" {
+ top= 10;
+ left= 40;
+ angle= 10;
+ row {
+ top= 1;
+ keys { <ESC>, { <FK01>, 12 }, <FK02>, <FK03>, <FK04>, <FK05> };
+ };
+ }; // End of "LeftFunction" section
+
+ section "LeftAlpha" {
+ top= 47;
+ left= 30;
+ angle= 10;
+ row {
+ top= 1;
+ keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, { <AE06>, "KEY6" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, { <AD05>, "KEYT" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, { <AC05>, "KEYG" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>
+ };
+ };
+ row {
+ top= 77;
+ keys { { <LCTL>, "LCTL" }, { <LWIN>, "LWIN" }, { <LALT>, "LALT" } };
+ };
+ }; // End of "LeftAlpha" section
+
+ key.shape= "RDEF";
+ section "RightFunction" {
+ top= 32;
+ left= 195;
+ angle= -10;
+ row {
+ top= 1;
+ left= 1;
+ keys { <FK06>, <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12> };
+ };
+ }; // End of "RightFunction" section
+
+ section "RightAlpha" {
+ top= 71;
+ left= 190;
+ angle= -10;
+ row.left= 1;
+ row {
+ top= 1;
+ keys { { <AE07>, "KEY7" },
+ <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys {
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <AC06>, "KEYH" },
+ <AC07>, <AC08>, <AC09>, <AC10>, <AC11>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <AB06>, "KEYN" },
+ <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ left= 40;
+ keys { { <RALT>, "RALT" }, { <RWIN>, "RWIN" },
+ { <MENU>, "MENU" }, { <RCTL>, "RCTL" }
+ };
+ };
+ }; // End of "RightAlpha" section
+
+ section "SpaceBar" {
+ top= 139;
+ left= 111;
+ key.shape= "SPCE";
+ row { keys { <SPCE> }; };
+ };
+
+ section "Editing" {
+ top= 15;
+ left= 385;
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 109;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LED" {
+ cornerRadius= 0,
+ { [ 3, 1 ] }
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.left= 177;
+ indicator.shape= "LED";
+ indicator "Num Lock" { top= 90; };
+ indicator "Caps Lock" { top= 107; };
+ indicator "Scroll Lock" { top= 127; };
+
+ section "Keypad" {
+ top= 47;
+ left= 456;
+ row {
+ top= 1;
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
diff --git a/geometry/nec b/geometry/nec
new file mode 100644
index 0000000..189d9ca
--- /dev/null
+++ b/geometry/nec
@@ -0,0 +1,159 @@
+// $Xorg: nec,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/geometry/nec,v 3.4 2001/01/17 23:45:49 dawes Exp $
+
+default xkb_geometry "pc98" {
+
+ description= "Generic PC98";
+ width= 405;
+ height= 172;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 17,18] }, { [2,1], [ 15,17] } };
+ shape "RTRN" { { [ 20,37] }, { [2,1], [ 18,35] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [115,18] }, { [2,1], [113,17] } };
+ shape "FUNC" { { [ 21,18] }, { [2,1], [ 19,17] } };
+ shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } };
+ shape "TABK" { { [ 30,18] }, { [2,1], [ 28,17] } };
+ shape "ARRW" { { [ 35,18] }, { [2,1], [ 33,17] } };
+
+ section.left= 8;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 29;
+ row {
+ top= 1;
+ key.shape="FUNC";
+ keys { { <BRK>, "NORM" }, { <PRSC>, "NORM", 5 },
+ { <FK01>, 6 }, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 6 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 6 }, <FK12>, <FK13>, <FK14>, <FK15>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 54;
+ row {
+ top= 1;
+ keys { { <ESC>, shape="BKSP"},
+ <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, <BKSL>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN", 6 }
+ };
+ };
+ row {
+ top= 39;
+ keys { <LCTL>, <CAPS>,
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, <AB11>,
+ { <RTSH>, "RTSH" }
+ };
+ };
+ row {
+ top= 77;
+ keys { { <ALGR>, 35 } , <LALT>, { <NFER>, "FUNC" },
+ { <SPCE>, "SPCE" }, { <XFER>, "FUNC" }
+
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 54;
+ left= 281;
+ row {
+ top= 1;
+ keys { <INS>, <DELE> };
+ };
+ row {
+ top= 20;
+ keys { <PGDN>, <PGUP> };
+ };
+ row {
+ top= 39;
+ keys { { <UP>, "ARRW" } };
+ };
+ row {
+ top= 58;
+ keys { <LEFT>, <RGHT> };
+ };
+ row {
+ top= 77;
+ keys { { <DOWN>, "ARRW" } };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 54;
+ left= 320;
+ row {
+ top= 1;
+ keys { <HOME>, <HELP>, <KPSU>, <KPDV> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, <KPMU> };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, <KPAD> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, <KPEQ> };
+ };
+ row {
+ top= 77;
+ keys { <KP0>, <KPSP>, <KPDC>, <KPEN> };
+ };
+ }; // End of "Keypad" section
+
+}; // End of "pc98" geometry
diff --git a/geometry/northgate b/geometry/northgate
new file mode 100644
index 0000000..fd376ce
--- /dev/null
+++ b/geometry/northgate
@@ -0,0 +1,172 @@
+// $Xorg: northgate,v 1.3 2000/08/17 19:54:36 cpqbld Exp $
+//
+// $XFree86$
+//
+default xkb_geometry "omnikey101" {
+
+ description= "North Gate Omnikey 101";
+ width= 470;
+ height= 175;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [34,18] }, { [2,1], [32,17] } };
+ shape "TABK" { { [27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" {
+ approx = { [15, 0], [40,37] },
+ { [15, 0], [40, 0], [40,37],
+ [ 0,37], [ 0,19], [15,19] },
+ { [17, 1], [38, 1], [38,36],
+ [ 2,36], [ 2,20], [17,20] }
+ };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } };
+ shape "RTSH" { { [ 30,18] }, { [2,1], [28,17] } };
+ shape "MODK" { { [ 26,18] }, { [2,1], [24,17] } };
+ shape "SPCE" { { [129,18] }, { [2,1], [127,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 1, 3 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 32;
+ left= 375;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 46.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 384; };
+ indicator "Caps Lock" { left= 409; };
+ indicator "Scroll Lock" { left= 434; };
+ text.top= 34;
+ text.color= "black";
+ text "NumLockLabel" { left= 380.5; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 405; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 32;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 9 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 9 }, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 65;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <RTRN>, "RTRN", -14, color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }, <BKSL>
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LALT>,
+ { <LCTL>, 23 },
+ { <SPCE>, "SPCE", color="white" },
+ <RCTL>,
+ { <RALT>, 23 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 32;
+ left= 308;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 65;
+ left= 374;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "default" geometry
diff --git a/geometry/pc b/geometry/pc
new file mode 100644
index 0000000..8a53871
--- /dev/null
+++ b/geometry/pc
@@ -0,0 +1,1159 @@
+// $Xorg: pc,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/geometry/pc,v 3.14 2003/08/09 14:30:47 pascal Exp $
+
+default xkb_geometry "pc101" {
+
+ description= "Generic 101";
+ width= 470;
+ height= 210;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } };
+ shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } };
+ shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } };
+ shape "SPCE" { { [133,18] }, { [2,1], [131,16] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 52;
+ left= 377;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 67;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 382; };
+ indicator "Caps Lock" { left= 407; };
+ indicator "Scroll Lock" { left= 433; };
+ text.top= 55;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 20 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 91;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 21 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, { <RCTL>, 21 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 91;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 91;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "default" geometry
+
+xkb_geometry "pc102" {
+
+ description= "Generic 102";
+ width= 470;
+ height= 210;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } };
+ shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "RTRN" {
+ { [16,0],[ 43,0],[43,37],[2,37],[2,19],[16,19] },
+ { [18,1],[ 41,1],[41,36],[4,36],[4,20],[18,20] } };
+ shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } };
+ shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } };
+ shape "RTSH" { { [ 49,18] }, { [2,1], [ 47,16] } };
+ shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } };
+ shape "SPCE" { { [134,18] }, { [2,1], [132,16] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 52;
+ left= 377;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 67;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 382; };
+ indicator "Caps Lock" { left= 407; };
+ indicator "Scroll Lock" { left= 433; };
+ text.top= 55;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <ESC>, "TABK", color="grey20" },
+ { <FK01>, 10 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 91;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>, <BKSL>,
+ { <BKSP>, color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, -15, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, { <RCTL>, 20 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 91;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 91;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "pc102" geometry
+
+xkb_geometry "pc104" {
+
+ description= "Generic 104";
+ width= 470;
+ height= 210;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } };
+ shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } };
+ shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } };
+ shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } };
+ shape "SPCE" { { [113,18] }, { [2,1], [111,16] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 52;
+ left= 377;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 67;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 382; };
+ indicator "Caps Lock" { left= 407; };
+ indicator "Scroll Lock" { left= 433; };
+ text.top= 55;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 20 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 91;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "SMOD";
+ key.color= "grey20";
+ keys { { <LCTL>, "MODK" }, <LWIN>, <LALT>,
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, <RWIN>, <MENU>, <RCTL>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 91;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 91;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "pc104" geometry
+
+xkb_geometry "pc105" {
+
+ description= "Generic 105";
+ width= 470;
+ height= 210;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } };
+ shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } };
+ shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } };
+ shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } };
+ shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } };
+ shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } };
+ shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } };
+ shape "SPCE" { { [113,18] }, { [2,1], [111,16] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 52;
+ left= 377;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 67;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 382; };
+ indicator "Caps Lock" { left= 407; };
+ indicator "Scroll Lock" { left= 433; };
+ text.top= 55;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 52;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 20 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 91;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "SMOD";
+ key.color= "grey20";
+ keys { { <LCTL>, "MODK" }, <LWIN>, <LALT>,
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, <RWIN>, <MENU>, <RCTL>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 91;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 91;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "pc105" geometry
+
+
+// Added for japanese 106 keyboard
+// by tsuka@kawalab.dnj.ynu.ac.jp .
+xkb_geometry "jp106" {
+
+ description= "Japanese 106";
+ width= 470;
+ height= 180;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" {
+ { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } ,
+ { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 25;
+ left= 375;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 40;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 379; };
+ indicator "Caps Lock" { left= 404; };
+ indicator "Scroll Lock" { left= 429; };
+ text.top= 28;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 25;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"},
+ { <FK07>, color="grey20"}, {<FK08>,color="grey20"},
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>,
+ <AE03>, <AE04>, <AE05>, <AE06>, <AE07>,
+ <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <AE13>, { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },<NFER>,
+ { <SPCE>, "SPCE", color="white" },
+ <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 310;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 375;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "jp106" geometry
+
+// Added for brazilian ABNT2 by Ricardo Y. Igarashi(iga@that.com.br)
+xkb_geometry "abnt2" {
+
+ description= "Brazilian ABNT2";
+ width= 470;
+ height= 180;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" {
+ { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } ,
+ { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 24,18] }, { [2,1], [ 22,17] } };
+ shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [133,18] }, { [2,1], [131,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } };
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 25;
+ left= 375;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 40;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 379; };
+ indicator "Caps Lock" { left= 404; };
+ indicator "Scroll Lock" { left= 429; };
+ text.top= 28;
+ text.color= "black";
+ text "NumLockLabel" { left= 378; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 403; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 25;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"},
+ { <FK07>, color="grey20"}, {<FK08>,color="grey20"},
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>,
+ <AE03>, <AE04>, <AE05>, <AE06>, <AE07>,
+ <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" }, <BKSL>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>, { <RCTL>, 17 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 310;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 375;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "abnt2" geometry
+
+
+// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net>
+
+xkb_geometry "pc86" {
+ description = "Noname keyboard with 86 keys, DE";
+ width = 287;
+ height = 143;
+ baseColor = "grey20";
+
+ shape "EDGE" { cornerRadius = 2, { [287, 143] } };
+ shape "LED" { cornerRadius = 2, { [3, 3] } };
+ shape "LEDS" { cornerRadius = 0, { [75, 5] } };
+ shape "KEYS" { cornerRadius = 0, { [271, 109] } };
+
+ outline "Edges" {
+ top = 0;
+ left = 0;
+ shape = "EDGE";
+ color = "black";
+ };
+
+ solid "KeyPanel" {
+ shape = "KEYS";
+ left = 8;
+ top = 22;
+ color = "grey70";
+ };
+
+ solid "LedPanel" {
+ shape = "LEDS";
+ left = 212;
+ top = 10;
+ color = "black";
+ };
+
+ indicator.onColor = "green";
+ indicator.offColor = "green30";
+ indicator.top = 11;
+ indicator.shape = "LED";
+ indicator "Num Lock" { left = 212 + 7; };
+ indicator "Caps Lock" { left = 212 + 23; };
+ indicator "Scroll Lock" { left = 212 + 39; };
+ text.fontSize = 6;
+ text.top = 10;
+ text.color = "white";
+ text "NumLockLabel" { left = 212 + 7 + 5; text = "Num\nLock"; };
+ text "CapsLockLabel" { left = 212 + 23 + 5; text = "Caps\nLock"; };
+ text "ScrollLockLabel" { left = 212 + 39 + 5; text = "Scroll\nLock"; };
+
+ shape.cornerRadius = 1;
+ shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } };
+ shape "NARR" { { [13, 18] }, { [1.5, 0], [11.5, 14] } };
+ shape "NORM" { { [18, 18] }, { [3, 0], [15, 14] } };
+ shape "NORM_1" { { [22, 18] }, { [4, 0], [22, 18] },
+ { [7, 0], [19, 14] } };
+ shape "WIDER" { { [23, 18] }, { [3, 0], [20, 14] } };
+ shape "WIDEST" { { [27, 18] }, { [3, 0], [24, 14] } };
+ shape "SPCE" { { [75, 18] }, { [3, 0], [72, 14] } };
+
+ section "Function" {
+ key.shape = "SMALL";
+ key.gap = 0.99;
+ key.color = "grey30";
+ left = 8;
+ top = 22;
+ row {
+ top = 1;
+ keys { <ESC>,
+ <FK01>, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>, <FK11>, <FK12>,
+ <NMLK>, <PRSC>, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Control" {
+ key.shape = "NORM";
+ key.gap = 1;
+ key.color = "grey30";
+ left = 8;
+ top = 111;
+ row {
+ top = 1;
+ keys { <LCTL>, <FN>, <LALT>,
+ { <SPCE>, shape="SPCE", 39 }, <RALT>,
+ <INS>, <DELE>
+ };
+ };
+ }; // End of "Control" section
+
+ section "Editing" {
+ key.shape = "NARR";
+ key.gap = 1;
+ key.color = "grey30";
+ left = 265;
+ top = 34;
+ row.vertical = True;
+ row {
+ top = 1;
+ keys { <HOME>, <PGUP>, <PGDN>, <END> };
+ };
+ }; // End of "Editing" section
+
+ section "Navigation" {
+ key.gap = 1;
+ key.shape = "NARR";
+ key.color = "grey30";
+ left = 236;
+ top = 92;
+ row {
+ left = 14;
+ top = 1;
+ keys { <UP> };
+ };
+ row {
+ top = 20;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Navigation" section
+
+ section "Alpha" {
+ key.gap = 1;
+ key.shape = "NORM";
+ key.color = "grey10";
+ left = 8;
+ top = 35;
+ row {
+ top = 1;
+ keys { { <AE01>, shape="NORM_1" }, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, shape="WIDER", color="grey30" }
+ };
+ };
+ row {
+ top = 20;
+ keys { { <TAB>, shape="NARR", color="grey30" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <AD13>, shape="NARR" }
+ };
+ };
+ row {
+ top = 39;
+ keys { { <CAPS>, color="grey30" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, shape="WIDEST", color="grey30" }
+ };
+ };
+ row {
+ top = 58;
+ keys { { <LFSH>, shape="WIDEST", color="grey30" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, shape="WIDER", color="grey30" }
+ };
+ };
+ row {
+ left = 57;
+ top = 77;
+ keys { <AE00>, <LSGT> };
+ };
+ }; // End of "Alpha" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+}; // End of "pc86" geometry
diff --git a/geometry/sgi.vndr/.cvsignore b/geometry/sgi.vndr/.cvsignore
new file mode 100644
index 0000000..282522d
--- /dev/null
+++ b/geometry/sgi.vndr/.cvsignore
@@ -0,0 +1,2 @@
+Makefile
+Makefile.in
diff --git a/geometry/sgi.vndr/Makefile.am b/geometry/sgi.vndr/Makefile.am
new file mode 100644
index 0000000..c72d1c2
--- /dev/null
+++ b/geometry/sgi.vndr/Makefile.am
@@ -0,0 +1,6 @@
+geom_DATA = \
+indigo indy O2
+
+EXTRA_DIST= $(geom_DATA)
+
+geomdir = $(xkb_base)/geometry/sgi.vndr
diff --git a/geometry/sgi.vndr/O2 b/geometry/sgi.vndr/O2
new file mode 100644
index 0000000..52ba1a6
--- /dev/null
+++ b/geometry/sgi.vndr/O2
@@ -0,0 +1,618 @@
+// $Xorg: O2,v 1.3 2000/08/17 19:54:36 cpqbld Exp $
+//
+// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc.
+//
+// Permission to use, copy, modify, and distribute this
+// software and its documentation for any purpose and without
+// fee is hereby granted, provided that the above copyright
+// notice appear in all copies and that both that copyright
+// notice and this permission notice appear in supporting
+// documentation, and that the name of Silicon Graphics not be
+// used in advertising or publicity pertaining to distribution
+// of the software without specific prior written permission.
+// Silicon Graphics makes no representation about the suitability
+// of this software for any purpose. It is provided "as is"
+// without any express or implied warranty.
+//
+// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS
+// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON
+// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL
+// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE,
+// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE
+// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH
+// THE USE OR PERFORMANCE OF THIS SOFTWARE.
+//
+// $XFree86$
+//
+default xkb_geometry "pc101" {
+
+ // This is an approximate layout for a 101-key (US/ASCII) SGI
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "101-key keyboard for Silicon Graphics O2";
+
+ width= 448;
+ height= 162;
+
+ shape "EDGE" {
+ cornerRadius= 2,
+ { [ 15, 0 ], [ 433, 0 ], [ 433, 10 ], [ 448, 10 ],
+ [ 448, 162 ], [ 0, 162 ], [ 0, 10 ], [ 15, 10 ] }
+ };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } };
+ shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } };
+ shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } };
+ shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [130,18] }, { [2,1], [128,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { { [ 12,12] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 6;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 25;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 19}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11}, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11}, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 58;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color= "grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },
+ { <SPCE>, "SPCE",color="white" },
+ <RALT>, { <RCTL>, 20 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 25;
+ left= 299;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 3, 1.5] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 25;
+ left= 364;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 40.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 372; };
+ indicator "Caps Lock" { left= 397; };
+ indicator "Scro llLock" { left= 422; };
+
+ text.font= "helvetica";
+ text.weight= "bold";
+ text.slant= "r";
+ text.fontWidth= "normal";
+ text.fontSize= 12;
+ text.top= 39.5;
+ text.color= "black";
+ text "NumLockLabel" { left= 376.5; text="1"; };
+ text "CapsLockLabel" { left= 401.5; text="A"; };
+ text "ScrollLockLabel" { left= 426.5; text="S"; };
+
+ logo "SGILogoImage" {
+ top= 26.5;
+ left= 396;
+ name= "SGI";
+ shape= "LOGO";
+ };
+ text.font= "helvetica";
+ text.weight= "bold";
+ text.slant= "o";
+ text.fontWidth= "narrow";
+ text.fontSize= 18;
+ text "SiliconLogoText" {
+ top= 27;
+ left= 375;
+ width= 20;
+ text= "Silicon";
+ };
+ text "GraphicsLogoText" {
+ top= 27;
+ left= 409;
+ width= 20;
+ text= "Graphics";
+ };
+
+ section "Keypad" {
+ top= 58;
+ left= 363;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
+
+xkb_geometry "pc102" {
+
+ // This is an approximate layout for 102-key SGI international
+ // keyboards. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "Silicon Graphics 102-key Keyboard";
+ width= 470;
+ height= 193;
+
+ shape.cornerRadius= 1;
+ shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } };
+ shape "NORM" { { [18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [35,18] }, { [2,1], [33,17] } };
+ shape "TABK" { { [27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [26,37] },
+ { [ 0, 0], [26, 0], [26,37],
+ [ 5,37], [ 5,18], [ 0,18] },
+ { [ 1, 1], [24, 1], [24,36],
+ [ 7,36], [ 7,17], [ 1,17] }
+ };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } };
+ shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } };
+ shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [130,18] }, { [2,1], [128,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 50;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 10}, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 10}, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 83;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color= "grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color= "grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <RTRN>, "RTRN", color= "grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color= "grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <BKSL>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color= "grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>,
+ { <LALT>, 19 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>,
+ { <RCTL>, 19 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 50;
+ left= 308;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 1, 3 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 50;
+ left= 375;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 64.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 384; };
+ indicator "Caps Lock" { left= 409; };
+ indicator "Scroll Lock" { left= 434; };
+ text.top= 52;
+ text.color= "black";
+ text "NumLockLabel" { left= 380.5; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 405; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; };
+
+ logo "SGILogoImage" {
+ top= 17;
+ left= 22;
+ name= "SGI";
+ shape= "LOGO";
+ };
+ text "SGILogoText" {
+ top= 21;
+ left= 40;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ setWidth= "narrow";
+ fontSize= 24;
+ };
+
+ section "Keypad" {
+ top= 83;
+ left= 374;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
+
+xkb_geometry "jp106" {
+ description= "Silicon Graphics 106-key Japanese keyboard";
+ width= 442;
+ height= 167;
+
+ shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" {
+ { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } ,
+ { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ logo "SGILogoImage" {
+ top= 5;
+ left= 6;
+ name= "SGI";
+ shape= "LOGO";
+ };
+
+ text "SGILogoText" {
+ top= 9;
+ left= 25;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ fontWidth= "narrow";
+ fontSize= 24;
+ };
+
+ shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 25;
+ left= 362;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 40;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 366; };
+ indicator "Caps Lock" { left= 391; };
+ indicator "Scroll Lock" { left= 416; };
+ text.top= 28;
+ text.color= "black";
+ text "NumLockLabel" { left= 366; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 391; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; };
+
+ section.left= 5;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 25;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"},
+ { <FK07>, color="grey20"}, {<FK08>,color="grey20"},
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>,
+ <AE03>, <AE04>, <AE05>, <AE06>, <AE07>,
+ <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <AE13>, { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },<NFER>,
+ { <SPCE>, "SPCE", color="white" },
+ <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 296;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 361;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "jp106" geometry
+
diff --git a/geometry/sgi.vndr/indigo b/geometry/sgi.vndr/indigo
new file mode 100644
index 0000000..f7b7a68
--- /dev/null
+++ b/geometry/sgi.vndr/indigo
@@ -0,0 +1,413 @@
+// $Xorg: indigo,v 1.3 2000/08/17 19:54:37 cpqbld Exp $
+//
+// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc.
+//
+// Permission to use, copy, modify, and distribute this
+// software and its documentation for any purpose and without
+// fee is hereby granted, provided that the above copyright
+// notice appear in all copies and that both that copyright
+// notice and this permission notice appear in supporting
+// documentation, and that the name of Silicon Graphics not be
+// used in advertising or publicity pertaining to distribution
+// of the software without specific prior written permission.
+// Silicon Graphics makes no representation about the suitability
+// of this software for any purpose. It is provided "as is"
+// without any express or implied warranty.
+//
+// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS
+// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON
+// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL
+// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE,
+// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE
+// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH
+// THE USE OR PERFORMANCE OF THIS SOFTWARE.
+//
+// $XFree86$
+//
+default xkb_geometry "pc101" {
+
+ // This is an approximate layout for a 101-key (US/ASCII) SGI
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "Silicon Graphics 101-key keyboard";
+
+ width= 472;
+ height= 193;
+
+ shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } };
+ shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } };
+ shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } };
+ shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [130,18] }, { [2,1], [128,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 50;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 19}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11}, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11}, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 83;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color= "grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },
+ { <SPCE>, "SPCE",color="white" },
+ <RALT>, { <RCTL>, 20 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 50;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 1, 3 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 50;
+ left= 377;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 64.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 386; };
+ indicator "Caps Lock" { left= 411; };
+ indicator "Scroll Lock" { left= 436; };
+ text.top= 52;
+ text.color= "black";
+ text "NumLockLabel" { left= 382.5; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 407; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; };
+
+ logo "SGILogoImage" {
+ top= 17;
+ left= 22;
+ name= "SGI";
+ shape= "LOGO";
+ };
+ text "SGILogoText" {
+ top= 21;
+ left= 40;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ fontWidth= "narrow";
+ fontSize= 24;
+ };
+
+ section "Keypad" {
+ top= 83;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
+xkb_geometry "pc102" {
+
+ // This is an approximate layout for 102-key SGI international
+ // keyboards. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "Silicon Graphics 102-key Keyboard";
+ width= 470;
+ height= 193;
+
+ shape.cornerRadius= 1;
+ shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } };
+ shape "NORM" { { [18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [35,18] }, { [2,1], [33,17] } };
+ shape "TABK" { { [27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [26,37] },
+ { [ 0, 0], [26, 0], [26,37],
+ [ 5,37], [ 5,18], [ 0,18] },
+ { [ 1, 1], [24, 1], [24,36],
+ [ 7,36], [ 7,17], [ 1,17] }
+ };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } };
+ shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } };
+ shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [130,18] }, { [2,1], [128,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 50;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 10}, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 10}, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 83;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color= "grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color= "grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <RTRN>, "RTRN", color= "grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color= "grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <BKSL>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color= "grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>,
+ { <LALT>, 19 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>,
+ { <RCTL>, 19 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 50;
+ left= 308;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 1, 3 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 50;
+ left= 375;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 64.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 384; };
+ indicator "Caps Lock" { left= 409; };
+ indicator "Scroll Lock" { left= 434; };
+ text.top= 52;
+ text.color= "black";
+ text "NumLockLabel" { left= 380.5; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 405; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; };
+
+ logo "SGILogoImage" {
+ top= 17;
+ left= 22;
+ name= "SGI";
+ shape= "LOGO";
+ };
+ text "SGILogoText" {
+ top= 21;
+ left= 40;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ setWidth= "narrow";
+ fontSize= 24;
+ };
+
+ section "Keypad" {
+ top= 83;
+ left= 374;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
diff --git a/geometry/sgi.vndr/indy b/geometry/sgi.vndr/indy
new file mode 100644
index 0000000..fc5d485
--- /dev/null
+++ b/geometry/sgi.vndr/indy
@@ -0,0 +1,601 @@
+// $Xorg: indy,v 1.3 2000/08/17 19:54:37 cpqbld Exp $
+//
+// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc.
+//
+// Permission to use, copy, modify, and distribute this
+// software and its documentation for any purpose and without
+// fee is hereby granted, provided that the above copyright
+// notice appear in all copies and that both that copyright
+// notice and this permission notice appear in supporting
+// documentation, and that the name of Silicon Graphics not be
+// used in advertising or publicity pertaining to distribution
+// of the software without specific prior written permission.
+// Silicon Graphics makes no representation about the suitability
+// of this software for any purpose. It is provided "as is"
+// without any express or implied warranty.
+//
+// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS
+// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON
+// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL
+// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE,
+// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE
+// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH
+// THE USE OR PERFORMANCE OF THIS SOFTWARE.
+//
+// $XFree86$
+//
+default xkb_geometry "pc101" {
+
+ // This is an approximate layout for a 101-key (US/ASCII) SGI
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "Silicon Graphics 101-key keyboard";
+
+ width= 472;
+ height= 193;
+
+ shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } };
+ shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } };
+ shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } };
+ shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [130,18] }, { [2,1], [128,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 50;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 19}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11}, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11}, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 83;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color= "grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, { <RTRN>, "RTRN", color="grey20" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },
+ { <SPCE>, "SPCE",color="white" },
+ <RALT>, { <RCTL>, 20 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 50;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 1, 3 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 50;
+ left= 377;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 64.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 386; };
+ indicator "Caps Lock" { left= 411; };
+ indicator "Scroll Lock" { left= 436; };
+ text.top= 52;
+ text.color= "black";
+ text "NumLockLabel" { left= 382.5; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 407; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; };
+
+ logo "SGILogoImage" {
+ top= 17;
+ left= 22;
+ name= "SGI";
+ shape= "LOGO";
+ };
+ text "SGILogoText" {
+ top= 21;
+ left= 40;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ fontWidth= "narrow";
+ fontSize= 24;
+ };
+
+ section "Keypad" {
+ top= 83;
+ left= 376;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
+
+xkb_geometry "pc102" {
+
+ // This is an approximate layout for 102-key SGI international
+ // keyboards. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes of a few keys by eye. I didn't actually
+ // *measure* a real keyboard.
+
+ description= "Silicon Graphics 102-key Keyboard";
+ width= 470;
+ height= 193;
+
+ shape.cornerRadius= 1;
+ shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } };
+ shape "NORM" { { [18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [35,18] }, { [2,1], [33,17] } };
+ shape "TABK" { { [27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [26,37] },
+ { [ 0, 0], [26, 0], [26,37],
+ [ 5,37], [ 5,18], [ 0,18] },
+ { [ 1, 1], [24, 1], [24,36],
+ [ 7,36], [ 7,17], [ 1,17] }
+ };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } };
+ shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } };
+ shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [130,18] }, { [2,1], [128,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 19;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 50;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18}, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 10}, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 10}, <FK10>, <FK11>, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 83;
+ row {
+ top= 1;
+ keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color= "grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color= "grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <RTRN>, "RTRN", color= "grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color= "grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <BKSL>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color= "grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>,
+ { <LALT>, 19 },
+ { <SPCE>, "SPCE", color="white" },
+ <RALT>,
+ { <RCTL>, 19 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 50;
+ left= 308;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <PRSC>, <SCLK>, <PAUS> };
+ };
+ row {
+ top= 33;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 53;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 91;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 110;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 1, 3 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 50;
+ left= 375;
+ color= "grey10";
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 64.5;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 384; };
+ indicator "Caps Lock" { left= 409; };
+ indicator "Scroll Lock" { left= 434; };
+ text.top= 52;
+ text.color= "black";
+ text "NumLockLabel" { left= 380.5; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 405; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; };
+
+ logo "SGILogoImage" {
+ top= 17;
+ left= 22;
+ name= "SGI";
+ shape= "LOGO";
+ };
+ text "SGILogoText" {
+ top= 21;
+ left= 40;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ setWidth= "narrow";
+ fontSize= 24;
+ };
+
+ section "Keypad" {
+ top= 83;
+ left= 374;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+};
+
+xkb_geometry "jp106" {
+ description= "Silicon Graphics 106-key Japanese keyboard";
+ width= 442;
+ height= 167;
+
+ shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } };
+ shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } };
+ shape "RTRN" {
+ { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } ,
+ { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } };
+ shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } };
+ shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ logo "SGILogoImage" {
+ top= 5;
+ left= 6;
+ name= "SGI";
+ shape= "LOGO";
+ };
+
+ text "SGILogoText" {
+ top= 9;
+ left= 25;
+ width= 50;
+ text= "SiliconGraphics";
+ font= "helvetica";
+ slant= "o";
+ weight= "bold";
+ fontWidth= "narrow";
+ fontSize= 24;
+ };
+
+ shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } };
+ shape "LED" { cornerRadius= 0, { [ 5, 1 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 25;
+ left= 362;
+ color= "grey10";
+ };
+
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 40;
+ indicator.shape= "LED";
+ indicator "Num Lock" { left= 366; };
+ indicator "Caps Lock" { left= 391; };
+ indicator "Scroll Lock" { left= 416; };
+ text.top= 28;
+ text.color= "black";
+ text "NumLockLabel" { left= 366; text="Num\nLock"; };
+ text "CapsLockLabel" { left= 391; text="Caps\nLock"; };
+ text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; };
+
+ section.left= 5;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 25;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" },
+ { <FK01>, 18 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"},
+ { <FK07>, color="grey20"}, {<FK08>,color="grey20"},
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 8 }, <SCLK>, <PAUS>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>,
+ <AE03>, <AE04>, <AE05>, <AE06>, <AE07>,
+ <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ <AE13>, { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <CAPS>, "CAPS", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "LFSH", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <AB11>, { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LCTL>, { <LALT>, 20 },<NFER>,
+ { <SPCE>, "SPCE", color="white" },
+ <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 296;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 361;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+}; // End of "jp106" geometry
diff --git a/geometry/sony b/geometry/sony
new file mode 100644
index 0000000..4e69f0e
--- /dev/null
+++ b/geometry/sony
@@ -0,0 +1,180 @@
+// $Xorg: sony,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+default xkb_geometry "nwp5461" {
+
+ description= "Sony NEWS NWS-5000 Keyboard";
+ width= 425;
+ height= 190;
+
+ shape.cornerRadius= 1;
+ shape "NORM" { { [18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [28,18] }, { [2,1], [26,17] } };
+ shape "TABK" { { [28,18] }, { [2,1], [26,17] } };
+ shape "BKSL" { { [28,18] }, { [2,1], [26,17] } };
+ shape "RTRN" {
+ approx = { [15, 0], [33,37] },
+ { [15, 0], [33, 0], [33,37],
+ [ 0,37], [ 0,19], [15,19] },
+ { [17, 1], [31, 1], [31,36],
+ [ 2,36], [ 2,20], [17,20] }
+ };
+ shape "SHFT" { { [42,18] }, { [2,1], [40,17] } };
+ shape "MODK" { { [33,18] }, { [2,1], [31,17] } };
+ shape "SPCE" { { [85,18] }, { [2,1], [83,17] } };
+ shape "KPEN" { { [18,38] }, { [2,1], [16,37] } };
+ shape "STOP" { { [28,18] }, { [2,1], [26,17] } };
+ shape "CUT" { { [55,18] }, { [2,1], [53,17] } };
+ shape "EXEC" { { [32,18] }, { [2,1], [30,17] } };
+ shape "UNK" { { [18,18] }, { [2,1], [16,17] } };
+ shape "CAPS" { { [18,18] }, { [2,1], [16,17] } };
+ shape "FKEY" { { [23,18] }, { [2,1], [21,17] } };
+
+ section.left= 13;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 55;
+ row {
+ top= 1;
+ left= 37;
+ key.shape="FKEY";
+ keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>,
+ { <FK06>, 5 }, <FK07>, <FK08>, <FK09>, <FK10>,
+ { <FK11>, 5 }, <FK12>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 80;
+ row {
+ top= 1;
+ keys { { <ESC>, color="grey20" } ,
+ <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>,
+ <AE09>, <AE10>, <AE11>, <AE12>,
+ <BKSL>, { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { { <TAB>, "TABK", color="grey20" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <DELE>, color="grey20" },
+ { <RTRN>, "RTRN", -14, color="grey20" }
+ };
+ };
+ row {
+ top= 39;
+ keys { { <LCTL>, "MODK", color="grey20" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <TLDE>
+ };
+ };
+ row {
+ top= 58;
+ keys { { <LFSH>, "SHFT", color="grey20" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, <AB11>,
+ { <RTSH>, "SHFT", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ key.shape= "MODK";
+ key.color= "grey20";
+ keys { <LALT>, { <CAPS>, "CAPS" },
+ { <STOP>, "STOP", color="white" },
+ { <SPCE>, "SPCE", color="white" },
+ { <CUT>, "CUT", color="white" },
+ { <UNK0>, "UNK" }, { <UNK1>, "UNK" },
+ { <EXEC>, "EXEC" }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 80;
+ left= 312;
+ key.color= "grey20";
+ row {
+ top= 1;
+ keys { <HELP> };
+ };
+ row {
+ top= 20;
+ keys { <INS> };
+ };
+ row {
+ top= 39;
+ keys { <CLR> };
+ };
+ row {
+ top= 58;
+ keys { <PGUP> };
+ };
+ row {
+ top= 77;
+ keys { <PGDN> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 334;
+ row {
+ top= 1;
+ key.color= "grey20";
+ keys { { <KPMU>, 19 }, <KPDV>, <KPAD> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPSU>, color="grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6>, { <KPSP>, color="grey20" } };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN", color="grey20" } };
+ };
+ row {
+ top= 77;
+ keys { <KP0>, { <KPDC>, color="grey20" }, <UP> };
+ };
+ row {
+ top= 96;
+ key.color= "grey20";
+ keys { <KPTB>, <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Keypad" section
+
+}; // End of "default" geometry
diff --git a/geometry/sun b/geometry/sun
new file mode 100644
index 0000000..1b8117a
--- /dev/null
+++ b/geometry/sun
@@ -0,0 +1,1338 @@
+// $Xorg: sun,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/geometry/sun,v 1.6 2001/12/14 20:01:58 dawes Exp $
+//
+xkb_geometry "type4" {
+
+ // This is an approximate layout for a (US/ASCII) Sun Type4 US
+ // keyboard.
+
+ description= "Sun Type4 keyboard";
+
+ width= 452;
+ height= 185;
+
+ shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "DELE" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [28,37] },
+ { [ 0, 0], [28, 0], [28,37],
+ [ 5,37], [ 5,19], [ 0,19] },
+ { [ 1, 1], [26, 1], [26,36],
+ [ 7,36], [ 7,18], [ 1,18] }
+ };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } };
+ shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [170,18] }, { [2,1], [168,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 17;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+
+ section "Alpha" {
+ top= 58;
+ row {
+ top= 1;
+ keys { <STOP>, <AGAI>,
+ { <FK01>, 9 }, <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>, <FK11>, <FK12>,
+ <BKSL>, { <DELE>, "DELE" },
+ { <PAUS>, 9 }, <PRSC>, <SCLK>, <NMLK>
+ };
+ };
+ row {
+ top= 20;
+ keys { <PROP>, <UNDO>, { <ESC>, 9 },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>,
+ <AE06>, <AE07>, <AE08>, <AE09>, <AE10>,
+ <AE11>, <AE12>,
+ { <BKSP>, "BKSP" },
+ { <KPEQ>, 9 }, <KPDV>, <KPMU>, <KPSU>
+
+ };
+ };
+ row {
+ top= 39;
+ keys { <FRNT>, <COPY>,
+ { <TAB>, 9, shape="TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>, { <RTRN>, "RTRN" },
+ { <KP7>, 9 }, <KP8>, <KP9>, { <KPAD>, "KPAD" }
+ };
+ };
+ row {
+ top= 58;
+ keys { <OPEN>, <PAST>,
+ { <LCTL>, 9, shape="LCTL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <TLDE>,
+ { <KP4>, 33 }, <KP5>, <KP6>
+ };
+ };
+ row {
+ top= 77;
+ keys { <FIND>, <CUT>,
+ { <LFSH>, 9 , shape="LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH" }, <LNFD>,
+ { <KP1>, 9} , <KP2>, <KP3>, { <KPEN>, "KPAD" }
+ };
+ };
+ row {
+ top= 96;
+ keys { { <HELP>, "HELP" }, { <CAPS>, 9 },
+ <LALT>, <LMTA>, { <SPCE>, "SPCE" },
+ <RMTA>, <COMP>, <ALGR>,
+ { <KP0>, 9, shape="KP0" }, <KPDL>
+ };
+ };
+ }; // End of "Alpha" section
+
+ shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } };
+ shape "LED" { cornerRadius= 0, { [ 7, 4 ] } };
+ solid "LedPanel" {
+ shape= "LEDS";
+ top= 28;
+ left= 358;
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 43;
+ indicator.shape= "LED";
+ indicator "Caps Lock" { left= 364; };
+ indicator "Compose" { left= 383; };
+ indicator "Scroll Lock" { left= 402; };
+ indicator "Num Lock" { left= 421; };
+ text.top= 34;
+ text.color= "black";
+ text "CapsLockLabel" { left= 364; text="Caps\nLock"; };
+ text "ComposeLabel" { left= 380; text="Compose"; };
+ text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; };
+ text "NumLockLabel" { left= 421; text="Num\nLock"; };
+};
+
+default xkb_geometry "type5" {
+
+ // This is an approximate layout for a (US/ASCII) Sun Type5
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes.
+
+ description= "Sun Type5 keyboard";
+
+ width= 515;
+ height= 170;
+
+ shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } };
+ shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [157,18] }, { [2,1], [155,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 14;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 24;
+ row {
+ top= 1;
+ keys { { <HELP>, "HELP" }, { <ESC>, 9 },
+ { <FK01>, 19 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 9 }, <SCLK>, <PAUS>,
+ { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { <STOP>, <AGAI>,
+ { <TLDE>, 9}, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { <FRNT>, <COPY>, { <CAPS>, 9, shape="CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top= 58;
+ keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ keys { <FIND>, <CUT>, { <LCTL>, 9, shape="LCTL" },
+ <LALT>, <LMTA>,
+ { <SPCE>, "SPCE" },
+ <RMTA>, <COMP>, <ALGR>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 352;
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 420;
+ row {
+ top= 1;
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+};
+
+xkb_geometry "type5euro" {
+
+ // This is an approximate layout for a (US/ASCII) Sun Type5
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes.
+
+ description= "Sun Type5 keyboard";
+
+ width= 515;
+ height= 170;
+
+ shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "LFSH" { { [ 24,18] }, { [2,1], [22,17] } };
+ shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [157,18] }, { [2,1], [155,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 14;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 24;
+ row {
+ top= 1;
+ keys { { <HELP>, "HELP" }, { <ESC>, 9 },
+ { <FK01>, 19 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 9 }, <SCLK>, <PAUS>,
+ { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { <STOP>, <AGAI>,
+ { <TLDE>, 9}, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color="grey20" }
+ };
+ };
+ row {
+ top= 20;
+ keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <BKSL>, "BKSL" }
+ };
+ };
+ row {
+ top= 39;
+ keys { <FRNT>, <COPY>, { <CAPS>, 9, shape="CAPS" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top= 58;
+ keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, <LSGT>,
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ keys { <FIND>, <CUT>, { <LCTL>, 9, shape="LCTL" },
+ <LALT>, <LMTA>,
+ { <SPCE>, "SPCE" },
+ <RMTA>, <COMP>, <ALGR>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 352;
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 420;
+ row {
+ top= 1;
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+};
+
+
+xkb_geometry "type5unix" {
+
+ // This is an approximate layout for a (US/ASCII) Sun Type5
+ // keyboard. I just took a similar layout (101 key PC keyboard)
+ // and adjusted the sizes.
+
+ description= "Sun Type5 Unix keyboard";
+
+ width= 515;
+ height= 170;
+
+ shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } };
+ shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [157,18] }, { [2,1], [155,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "LOGO" { { [ 16,16] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 14;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+ section "Function" {
+ top= 24;
+ row {
+ top= 1;
+ keys { { <HELP>, "HELP" }, { <NONE>, 9 },
+ { <FK01>, 19 }, <FK02>, <FK03>, <FK04>,
+ { <FK05>, 11 }, <FK06>, <FK07>, <FK08>,
+ { <FK09>, 11 }, <FK10>, <FK11>, <FK12>,
+ { <PRSC>, 9 }, <SCLK>, <PAUS>,
+ { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR>
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ top= 61;
+ row {
+ top= 1;
+ keys { <STOP>, <AGAI>,
+ { <ESC>, 9}, <AE01>, <AE02>, <AE03>, <AE04>,
+ <AE05>, <AE06>, <AE07>, <AE08>, <AE09>,
+ <AE10>, <AE11>, <AE12>,
+ <BKSL>, <TLDE>
+ };
+ };
+ row {
+ top= 20;
+ keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <BKSP>, "BKSP" }
+ };
+ };
+ row {
+ top= 39;
+ keys { <FRNT>, <COPY>, { <LCTL>, 9, shape="LCTL" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>,
+ { <RTRN>, "RTRN" }
+ };
+ };
+ row {
+ top= 58;
+ keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color="grey20" }
+ };
+ };
+ row {
+ top= 77;
+ keys { <FIND>, <CUT>, { <CAPS>, 9, shape="CAPS" },
+ <LALT>, <LMTA>,
+ { <SPCE>, "SPCE" },
+ <RMTA>, <COMP>, <ALGR>
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ top= 61;
+ left= 352;
+ row {
+ top= 1;
+ keys { <INS>, <HOME>, <PGUP> };
+ };
+ row {
+ top= 20;
+ keys { <DELE>, <END>, <PGDN> };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys { <UP> };
+ };
+ row {
+ top= 77;
+ keys { <LEFT>, <DOWN>, <RGHT> };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ top= 61;
+ left= 420;
+ row {
+ top= 1;
+ keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> };
+ };
+ row {
+ top= 20;
+ keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 39;
+ keys { <KP4>, <KP5>, <KP6> };
+ };
+ row {
+ top= 58;
+ keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } };
+ };
+ row {
+ top= 77;
+ keys { { <KP0>, "KP0" }, <KPDL> };
+ };
+ }; // End of "Keypad" section
+};
+
+xkb_geometry "type5_se" {
+
+ // kbd: type = 4, layout = 43
+
+ description= "Sun Type5 keyboard (Sweden)";
+
+ width= 510;
+ height= 170;
+
+ baseColor= "grey";
+ labelColor= "black";
+
+ shape.cornerRadius= 1;
+
+ shape "EDGE" { cornerRadius= 2, { [ 510, 170 ] } };
+ shape "LOGO" { cornerRadius= 2,
+ { [ 0, 8], [ 8, 16], [ 16, 8], [ 8, 0] }
+ };
+
+ shape "NORM" { { [ 18, 18] }, { [ 2, 1], [ 16, 17] } };
+ shape "BKSP" { { [ 38, 18] }, { [ 2, 1], [ 36, 17] } };
+ shape "TABK" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } };
+ shape "RTRN" {
+ { [ 0, 0], [ 29, 0], [ 29, 37], [ 5, 37], [ 5, 18], [ 0, 18] },
+ { [ 2, 1], [ 27, 1], [ 27, 36], [ 7, 36], [ 7, 17], [ 2, 17] }
+ };
+ shape "CAPS" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } };
+ shape "LFSH" { { [ 24, 18] }, { [ 2, 1], [ 22, 17 ] } };
+ shape "RTSH" { { [ 51, 18] }, { [ 2, 1], [ 49, 17 ] } };
+ shape "LCTL" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } };
+ shape "MODK" { { [ 28, 18] }, { [ 2, 1], [ 26, 17 ] } };
+ shape "SPCE" { { [157, 18] }, { [ 2, 1], [155, 17 ] } };
+ shape "KP0" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } };
+ shape "KPAD" { { [ 18, 37] }, { [ 2, 1], [ 16, 36 ] } };
+ shape "HELP" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } };
+
+ section "Function" {
+ key.color= "grey10";
+ priority= 1;
+ top= 24;
+ left= 14;
+ width= 481;
+ height= 19;
+ row {
+ top= 1;
+ left= 1;
+ keys {
+ { <HELP>, "HELP", 1 }, { <ESC>, "NORM", 9 },
+ { <FK01>, "NORM", 19 }, { <FK02>, "NORM", 1 },
+ { <FK03>, "NORM", 1 }, { <FK04>, "NORM", 1 },
+ { <FK05>, "NORM", 11 }, { <FK06>, "NORM", 1 },
+ { <FK07>, "NORM", 1 }, { <FK08>, "NORM", 1 },
+ { <FK09>, "NORM", 11 }, { <FK10>, "NORM", 1 },
+ { <FK11>, "NORM", 1 }, { <FK12>, "NORM", 1 },
+ { <PRSC>, "NORM", 9 }, { <SCLK>, "NORM", 1 },
+ { <PAUS>, "NORM", 1 }, { <MUTE>, "NORM", 11 },
+ { <VOL->, "NORM", 1 }, { <VOL+>, "NORM", 1 },
+ { <POWR>, "NORM", 1, color= "white" }
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ key.color= "white";
+ priority= 2;
+ top= 61;
+ left= 14;
+ width= 333;
+ height= 95;
+ row {
+ top= 1;
+ left= 1;
+ keys {
+ { <STOP>, "NORM", 1, color= "grey10" },
+ { <AGAI>, "NORM", 1, color= "grey10" },
+ { <TLDE>, "NORM", 9 }, { <AE01>, "NORM", 1 },
+ { <AE02>, "NORM", 1 }, { <AE03>, "NORM", 1 },
+ { <AE04>, "NORM", 1 }, { <AE05>, "NORM", 1 },
+ { <AE06>, "NORM", 1 }, { <AE07>, "NORM", 1 },
+ { <AE08>, "NORM", 1 }, { <AE09>, "NORM", 1 },
+ { <AE10>, "NORM", 1 }, { <AE11>, "NORM", 1 },
+ { <AE12>, "NORM", 1 },
+ { <BKSP>, "BKSP", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 20;
+ left= 1;
+ keys {
+ { <PROP>, "NORM", 1, color= "grey10" },
+ { <UNDO>, "NORM", 1, color= "grey10" },
+ { <TAB>, "TABK", 9, color= "grey10" },
+ { <AD01>, "NORM", 1 },
+ { <AD02>, "NORM", 1 }, { <AD03>, "NORM", 1 },
+ { <AD04>, "NORM", 1 }, { <AD05>, "NORM", 1 },
+ { <AD06>, "NORM", 1 }, { <AD07>, "NORM", 1 },
+ { <AD08>, "NORM", 1 }, { <AD09>, "NORM", 1 },
+ { <AD10>, "NORM", 1 }, { <AD11>, "NORM", 1 },
+ { <AD12>, "NORM", 1 },
+ { <RTRN>, "RTRN", 1, color= "grey10" }
+ };
+ };
+ row {
+ top= 39;
+ left= 1;
+ keys {
+ { <FRNT>, "NORM", 1, color= "grey10" },
+ { <COPY>, "NORM", 1, color= "grey10" },
+ { <CAPS>, "CAPS", 9, color= "grey10" },
+ { <AC01>, "NORM", 1 },
+ { <AC02>, "NORM", 1 }, { <AC03>, "NORM", 1 },
+ { <AC04>, "NORM", 1 }, { <AC05>, "NORM", 1 },
+ { <AC06>, "NORM", 1 }, { <AC07>, "NORM", 1 },
+ { <AC08>, "NORM", 1 }, { <AC09>, "NORM", 1 },
+ { <AC10>, "NORM", 1 }, { <AC11>, "NORM", 1 },
+ { <AC12>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 58;
+ left= 1;
+ keys {
+ { <OPEN>, "NORM", 1, color= "grey10" },
+ { <PAST>, "NORM", 1, color= "grey10" },
+ { <LFSH>, "LFSH", 9, color= "grey10" },
+ { <AB00>, "NORM", 1 }, { <AB01>, "NORM", 1 },
+ { <AB02>, "NORM", 1 }, { <AB03>, "NORM", 1 },
+ { <AB04>, "NORM", 1 }, { <AB05>, "NORM", 1 },
+ { <AB06>, "NORM", 1 }, { <AB07>, "NORM", 1 },
+ { <AB08>, "NORM", 1 }, { <AB09>, "NORM", 1 },
+ { <AB10>, "NORM", 1 },
+ { <RTSH>, "RTSH", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 77;
+ left= 1;
+ key.color= "grey10";
+ keys {
+ { <FIND>, "NORM", 1 }, { <CUT>, "NORM", 1 },
+ { <LCTL>, "LCTL", 9 }, { <LALT>, "NORM", 1 },
+ { <LMTA>, "NORM", 1 },
+ { <SPCE>, "SPCE", 1, color= "white" },
+ { <RMTA>, "NORM", 1 }, { <COMP>, "NORM", 1 },
+ { <ALGR>, "NORM", 1 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ key.color= "grey10";
+ priority= 3;
+ top= 61;
+ left= 352;
+ width= 58;
+ height= 95;
+ row {
+ top= 1;
+ left= 1;
+ keys {
+ { <INS>, "NORM", 1 }, { <HOME>, "NORM", 1 },
+ { <PGUP>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 20;
+ left= 1;
+ keys {
+ { <DELE>, "NORM", 1 }, { <END>, "NORM", 1 },
+ { <PGDN>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys {
+ { <UP>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 77;
+ left= 1;
+ keys {
+ { <LEFT>, "NORM", 1 }, { <DOWN>, "NORM", 1 },
+ { <RGHT>, "NORM", 1 }
+ };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ key.color= "white";
+ priority= 4;
+ top= 61;
+ left= 420;
+ width= 77;
+ height= 95;
+ row {
+ top= 1;
+ left= 1;
+ key.color= "grey10";
+ keys {
+ { <NMLK>, "NORM", 1 }, { <KPDV>, "NORM", 1 },
+ { <KPMU>, "NORM", 1 }, { <KPSU>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 20;
+ left= 1;
+ keys {
+ { <KP7>, "NORM", 1 }, { <KP8>, "NORM", 1 },
+ { <KP9>, "NORM", 1 },
+ { <KPAD>, "KPAD", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 39;
+ left= 1;
+ keys {
+ { <KP4>, "NORM", 1 }, { <KP5>, "NORM", 1 },
+ { <KP6>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 58;
+ left= 1;
+ keys {
+ { <KP1>, "NORM", 1 }, { <KP2>, "NORM", 1 },
+ { <KP3>, "NORM", 1 },
+ { <KPEN>, "KPAD", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 77;
+ left= 1;
+ keys {
+ { <KP0>, "KP0", 1 }, { <KPDL>, "NORM", 1 }
+ };
+ };
+ }; // End of "Keypad" section
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ priority= 0;
+ shape= "EDGE";
+ };
+
+ solid "Logos" {
+ color= "blue";
+ top= 5;
+ left= 25;
+ priority= 0;
+ shape= "LOGO";
+ };
+
+ logo "SUNLogoImage" {
+ top= 5;
+ left= 25;
+ name= "SUN";
+ priority= 1;
+ shape= "LOGO";
+ };
+
+ shape "LED" { cornerRadius= 1,
+ { [ 0, 1.5], [ 1.5, 3], [ 3, 1.5], [ 1.5, 0] }
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.shape= "LED";
+ indicator "Caps Lock" { left= 75; top= 103; priority= 5; };
+ indicator "Compose" { left= 314; top= 142; priority= 5; };
+ indicator "Scroll Lock" { left= 378; top= 29; };
+ indicator "Num Lock" { left= 426; top= 66; };
+};
+
+xkb_geometry "type5c_se" {
+
+ // kbd: type = 4, layout = 43
+
+ description= "Sun Type5c keyboard (Sweden)";
+
+ width= 510;
+ height= 170;
+
+ baseColor= "grey";
+ labelColor= "black";
+
+ shape.cornerRadius= 1;
+
+ shape "EDGE" { cornerRadius= 2, { [ 510, 170 ] } };
+ shape "LOGO" { cornerRadius= 2,
+ { [ 0, 8], [ 8, 16], [ 16, 8], [ 8, 0] }
+ };
+
+ shape "NORM" { { [ 18, 18] }, { [ 2, 1], [ 16, 17] } };
+ shape "BKSP" { { [ 38, 18] }, { [ 2, 1], [ 36, 17] } };
+ shape "TABK" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } };
+ shape "META" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } };
+ shape "RTRN" {
+ { [ 0, 0], [ 29, 0], [ 29, 37], [ 5, 37], [ 5, 18], [ 0, 18] },
+ { [ 2, 1], [ 27, 1], [ 27, 36], [ 7, 36], [ 7, 17], [ 2, 17] }
+ };
+ shape "CAPS" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } };
+ shape "LFSH" { { [ 24, 18] }, { [ 2, 1], [ 22, 17 ] } };
+ shape "RTSH" { { [ 51, 18] }, { [ 2, 1], [ 49, 17 ] } };
+ shape "LCTL" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } };
+ shape "MODK" { { [ 28, 18] }, { [ 2, 1], [ 26, 17 ] } };
+ shape "SPCE" { { [139, 18] }, { [ 2, 1], [137, 17 ] } };
+ shape "KP0" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } };
+ shape "KPAD" { { [ 18, 37] }, { [ 2, 1], [ 16, 36 ] } };
+ shape "HELP" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } };
+
+ section "Function" {
+ key.color= "grey10";
+ priority= 1;
+ top= 24;
+ left= 14;
+ width= 481;
+ height= 19;
+ row {
+ top= 1;
+ left= 1;
+ keys {
+ { <HELP>, "HELP", 1 }, { <ESC>, "NORM", 9 },
+ { <FK01>, "NORM", 19 }, { <FK02>, "NORM", 1 },
+ { <FK03>, "NORM", 1 }, { <FK04>, "NORM", 1 },
+ { <FK05>, "NORM", 11 }, { <FK06>, "NORM", 1 },
+ { <FK07>, "NORM", 1 }, { <FK08>, "NORM", 1 },
+ { <FK09>, "NORM", 11 }, { <FK10>, "NORM", 1 },
+ { <FK11>, "NORM", 1 }, { <FK12>, "NORM", 1 },
+ { <PRSC>, "NORM", 9 }, { <SCLK>, "NORM", 1 },
+ { <PAUS>, "NORM", 1 }, { <MUTE>, "NORM", 11 },
+ { <VOL->, "NORM", 1 }, { <VOL+>, "NORM", 1 },
+ { <POWR>, "NORM", 1, color= "white" }
+ };
+ };
+ }; // End of "Function" section
+
+ section "Alpha" {
+ key.color= "white";
+ priority= 2;
+ top= 61;
+ left= 14;
+ width= 333;
+ height= 95;
+ row {
+ top= 1;
+ left= 1;
+ keys {
+ { <STOP>, "NORM", 1, color= "grey10" },
+ { <AGAI>, "NORM", 1, color= "grey10" },
+ { <TLDE>, "NORM", 9 }, { <AE01>, "NORM", 1 },
+ { <AE02>, "NORM", 1 }, { <AE03>, "NORM", 1 },
+ { <AE04>, "NORM", 1 }, { <AE05>, "NORM", 1 },
+ { <AE06>, "NORM", 1 }, { <AE07>, "NORM", 1 },
+ { <AE08>, "NORM", 1 }, { <AE09>, "NORM", 1 },
+ { <AE10>, "NORM", 1 }, { <AE11>, "NORM", 1 },
+ { <AE12>, "NORM", 1 },
+ { <BKSP>, "BKSP", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 20;
+ left= 1;
+ keys {
+ { <PROP>, "NORM", 1, color= "grey10" },
+ { <UNDO>, "NORM", 1, color= "grey10" },
+ { <TAB>, "TABK", 9, color= "grey10" },
+ { <AD01>, "NORM", 1 },
+ { <AD02>, "NORM", 1 }, { <AD03>, "NORM", 1 },
+ { <AD04>, "NORM", 1 }, { <AD05>, "NORM", 1 },
+ { <AD06>, "NORM", 1 }, { <AD07>, "NORM", 1 },
+ { <AD08>, "NORM", 1 }, { <AD09>, "NORM", 1 },
+ { <AD10>, "NORM", 1 }, { <AD11>, "NORM", 1 },
+ { <AD12>, "NORM", 1 },
+ { <RTRN>, "RTRN", 1, color= "grey10" }
+ };
+ };
+ row {
+ top= 39;
+ left= 1;
+ keys {
+ { <FRNT>, "NORM", 1, color= "grey10" },
+ { <COPY>, "NORM", 1, color= "grey10" },
+ { <CAPS>, "CAPS", 9, color= "grey10" },
+ { <AC01>, "NORM", 1 },
+ { <AC02>, "NORM", 1 }, { <AC03>, "NORM", 1 },
+ { <AC04>, "NORM", 1 }, { <AC05>, "NORM", 1 },
+ { <AC06>, "NORM", 1 }, { <AC07>, "NORM", 1 },
+ { <AC08>, "NORM", 1 }, { <AC09>, "NORM", 1 },
+ { <AC10>, "NORM", 1 }, { <AC11>, "NORM", 1 },
+ { <AC12>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 58;
+ left= 1;
+ keys {
+ { <OPEN>, "NORM", 1, color= "grey10" },
+ { <PAST>, "NORM", 1, color= "grey10" },
+ { <LFSH>, "LFSH", 9, color= "grey10" },
+ { <AB00>, "NORM", 1 }, { <AB01>, "NORM", 1 },
+ { <AB02>, "NORM", 1 }, { <AB03>, "NORM", 1 },
+ { <AB04>, "NORM", 1 }, { <AB05>, "NORM", 1 },
+ { <AB06>, "NORM", 1 }, { <AB07>, "NORM", 1 },
+ { <AB08>, "NORM", 1 }, { <AB09>, "NORM", 1 },
+ { <AB10>, "NORM", 1 },
+ { <RTSH>, "RTSH", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 77;
+ left= 1;
+ key.color= "grey10";
+ keys {
+ { <FIND>, "NORM", 1 }, { <CUT>, "NORM", 1 },
+ { <LCTL>, "LCTL", 9 }, { <LALT>, "NORM", 1 },
+ { <LMTA>, "META", 1 },
+ { <SPCE>, "SPCE", 1, color= "white" },
+ { <RMTA>, "META", 1 }, { <COMP>, "NORM", 1 },
+ { <ALGR>, "NORM", 1 }
+ };
+ };
+ }; // End of "Alpha" section
+
+ section "Editing" {
+ key.color= "grey10";
+ priority= 3;
+ top= 61;
+ left= 352;
+ width= 58;
+ height= 95;
+ row {
+ top= 1;
+ left= 1;
+ keys {
+ { <INS>, "NORM", 1 }, { <HOME>, "NORM", 1 },
+ { <PGUP>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 20;
+ left= 1;
+ keys {
+ { <DELE>, "NORM", 1 }, { <END>, "NORM", 1 },
+ { <PGDN>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 58;
+ left= 20;
+ keys {
+ { <UP>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 77;
+ left= 1;
+ keys {
+ { <LEFT>, "NORM", 1 }, { <DOWN>, "NORM", 1 },
+ { <RGHT>, "NORM", 1 }
+ };
+ };
+ }; // End of "Editing" section
+
+ section "Keypad" {
+ key.color= "white";
+ priority= 4;
+ top= 61;
+ left= 420;
+ width= 77;
+ height= 95;
+ row {
+ top= 1;
+ left= 1;
+ key.color= "grey10";
+ keys {
+ { <NMLK>, "NORM", 1 }, { <KPDV>, "NORM", 1 },
+ { <KPMU>, "NORM", 1 }, { <KPSU>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 20;
+ left= 1;
+ keys {
+ { <KP7>, "NORM", 1 }, { <KP8>, "NORM", 1 },
+ { <KP9>, "NORM", 1 },
+ { <KPAD>, "KPAD", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 39;
+ left= 1;
+ keys {
+ { <KP4>, "NORM", 1 }, { <KP5>, "NORM", 1 },
+ { <KP6>, "NORM", 1 }
+ };
+ };
+ row {
+ top= 58;
+ left= 1;
+ keys {
+ { <KP1>, "NORM", 1 }, { <KP2>, "NORM", 1 },
+ { <KP3>, "NORM", 1 },
+ { <KPEN>, "KPAD", 1, color="grey10" }
+ };
+ };
+ row {
+ top= 77;
+ left= 1;
+ keys {
+ { <KP0>, "KP0", 1 }, { <KPDL>, "NORM", 1 }
+ };
+ };
+ }; // End of "Keypad" section
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ priority= 0;
+ shape= "EDGE";
+ };
+
+ solid "Logos" {
+ color= "blue";
+ top= 5;
+ left= 15;
+ priority= 0;
+ shape= "LOGO";
+ };
+
+ logo "SUNLogoImage" {
+ top= 5;
+ left= 15;
+ name= "SUN";
+ priority= 1;
+ shape= "LOGO";
+ };
+
+ text.font= "charter";
+ text.weight= "medium";
+ text.slant= "i";
+ text.fontSize= 40;
+ text "SunLogoText" {
+ top= 5;
+ left= 32;
+ color= "blue";
+ text= "Sun";
+ };
+
+ shape "LED" { cornerRadius= 1,
+ { [ 0, 1.5], [ 1.5, 3], [ 3, 1.5], [ 1.5, 0] }
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.shape= "LED";
+ indicator "Caps Lock" { left= 75; top= 103; priority= 5; };
+ indicator "Compose" { left= 314; top= 142; priority= 5; };
+ indicator "Scroll Lock" { left= 378; top= 29; };
+ indicator "Num Lock" { left= 426; top= 66; };
+};
+
+xkb_geometry "type4_se" {
+
+ // kbd: type = 4, layout = 11
+
+ description= "Sun Type4 keyboard (Sweden)";
+
+
+ width= 453;
+ height= 183;
+
+ baseColor= "grey";
+ labelColor= "black";
+
+ shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } };
+ shape.cornerRadius= 1;
+ shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } };
+ shape "DELE" { { [ 18,18] }, { [2,1], [16,17] } };
+ shape "RTRN" {
+ approx = { [ 0, 0], [28,37] },
+ { [ 0, 0], [28, 0], [28,37],
+ [ 5,37], [ 5,19], [ 0,19] },
+ { [ 1, 1], [26, 1], [26,36],
+ [ 7,36], [ 7,18], [ 1,18] }
+ };
+ shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } };
+ shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } };
+ shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } };
+ shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } };
+ shape "SPCE" { { [170,18] }, { [2,1], [168,17] } };
+ shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } };
+ shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } };
+ shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } };
+
+ outline "Edges" {
+ top= 0;
+ left= 0;
+ shape= "EDGE";
+ };
+
+ section.left= 17;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 1;
+
+ section "Alpha" {
+ top= 58;
+ row {
+ top= 1;
+ key.color= "grey10";
+ keys { <STOP>, <AGAI>, { <FK01>, 9 },
+ <FK02>, <FK03>, <FK04>,
+ <FK05>, <FK06>, <FK07>, <FK08>,
+ <FK09>, <FK10>, <FK11>, <FK12>,
+ { <AF13>, color= "white"},
+ { <AF14>, color= "white"},
+ <DELE>, { <PAUS>, 9 },
+ <PRSC>, <SCLK>, <NMLK>
+ };
+ };
+ row {
+ top= 20;
+ key.color= "white";
+ keys {
+ { <PROP>, color= "grey10" },
+ { <UNDO>, color= "grey10" },
+ { <ESC>, 9, color= "grey10" },
+ <AE01>, <AE02>, <AE03>, <AE04>, <AE05>,
+ <AE06>, <AE07>, <AE08>, <AE09>, <AE10>,
+ <AE11>, <AE12>,
+ { <BKSP>, "BKSP", color= "grey10" },
+ { <KPEQ>, 9, color= "grey10" },
+ { <KPDV>, color= "grey10" },
+ { <KPMU>, color= "grey10" },
+ { <KPSU>, color= "grey10" }
+ };
+ };
+ row {
+ top= 39;
+ key.color= "white";
+ keys {
+ { <FRNT>, color= "grey10" },
+ { <COPY>, color= "grey10" },
+ { <TAB>, 9, "TABK", color= "grey10" },
+ <AD01>, <AD02>, <AD03>, <AD04>, <AD05>,
+ <AD06>, <AD07>, <AD08>, <AD09>, <AD10>,
+ <AD11>, <AD12>,
+ { <RTRN>, "RTRN", color= "grey10" },
+ { <KP7>, 9, color= "grey10" },
+ { <KP8>, color= "grey10" },
+ { <KP9>, color= "grey10" },
+ { <KPAD>, "KPAD", color= "grey10" }
+ };
+ };
+ row {
+ top= 58;
+ key.color= "white";
+ keys {
+ { <OPEN>, color= "grey10" },
+ { <PAST>, color= "grey10" },
+ { <CAPS>, 9, "LCTL", color= "grey10" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>, <AC12>,
+ { <KP4>, 33, color= "grey10" },
+ { <KP5>, color= "grey10" },
+ { <KP6>, color= "grey10" }
+ };
+ };
+ row {
+ top= 77;
+ key.color= "white";
+ keys {
+ { <FIND>, color= "grey10" },
+ { <CUT>, color= "grey10" },
+ { <LFSH>, 9 , "LFSH", color= "grey10" },
+ <AB00>, <AB01>, <AB02>, <AB03>,
+ <AB04>, <AB05>, <AB06>, <AB07>,
+ <AB08>, <AB09>, <AB10>,
+ { <RTSH>, "RTSH", color= "grey10" },
+ { <LNFD>, color= "grey10" },
+ { <KP1>, 9, color= "grey10" },
+ { <KP2>, color= "grey10" },
+ { <KP3>, color= "grey10" },
+ { <KPEN>, "KPAD", color= "grey10" }
+ };
+ };
+ row {
+ top= 96;
+ key.color= "grey10";
+ keys {
+ { <HELP>, "HELP" }, { <LCTL>, 9 },
+ <LALT>, <LMTA>,
+ { <SPCE>, "SPCE", color= "white" },
+ <RMTA>, <COMP>, <ALGR>,
+ { <KP0>, 9, "KP0" }, <KPDL>
+ };
+ };
+ }; // End of "Alpha" section
+
+ shape "RIDGE" { cornerRadius= 1, { [ 0, 1], [ 1, 0 ],
+ [330, 0], [331, 1],
+ [330, 2], [ 1, 2] } };
+ solid "Ridge" {
+ shape= "RIDGE";
+ top= 48;
+ left= 18;
+ };
+
+ shape "LEDS" { cornerRadius= 1, { [ 75 ,21 ] } };
+ shape "LED" { cornerRadius= 0, { [ 7, 4 ] } };
+ outline "LedPanel" {
+ shape= "LEDS";
+ top= 28;
+ left= 358;
+ };
+ indicator.onColor= "green";
+ indicator.offColor= "green30";
+ indicator.top= 43;
+ indicator.shape= "LED";
+ indicator "Caps Lock" { left= 364; };
+ indicator "Compose" { left= 383; };
+ indicator "Scroll Lock" { left= 402; };
+ indicator "Num Lock" { left= 421; };
+ text.top= 32;
+ text.color= "black";
+ text "CapsLockLabel" { left= 364; text="Caps\nLock"; };
+ text "ComposeLabel" { left= 380; text="\nCompose"; };
+ text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; };
+ text "NumLockLabel" { left= 421; text="Num\nLock"; };
+};
diff --git a/geometry/winbook b/geometry/winbook
new file mode 100644
index 0000000..e4de478
--- /dev/null
+++ b/geometry/winbook
@@ -0,0 +1,144 @@
+// $Xorg: winbook,v 1.3 2000/08/17 19:54:36 cpqbld Exp $
+default xkb_geometry "XP5" {
+
+ description= "WinBook XP5";
+ width= 281;
+ height= 180;
+
+ shape.cornerRadius= 1;
+
+ shape "NORM" {
+ { [17,17] },
+ { [ 2, 1], [ 15, 15 ] }
+ };
+ shape "FKEY" {
+ { [ 15, 10 ] },
+ { [ 1, 0 ], [ 14, 9.5 ] }
+ };
+ shape "ONE" {
+ { [ 28, 17 ] },
+ { [ 11, 0 ], [ 28, 17 ] },
+ { [ 13, 1 ], [ 26, 15 ] }
+ };
+ shape "WIDE" { // backspace, caps lock, ctrl alt ?
+ { [ 24.5, 17 ] },
+ { [ 2, 1 ], [ 22.5, 15 ] }
+ };
+ shape "WIDR" { // backslash, left shift
+ { [ 35, 17 ] },
+ { [ 2, 1 ], [ 33, 15 ] }
+ };
+ shape "RTRN" {
+ { [ 45, 17 ] },
+ { [ 2, 1 ], [ 43, 15 ] }
+ };
+ shape "SPCE" {
+ { [ 90, 17 ] },
+ { [ 2, 1 ], [ 88, 15 ] }
+ };
+ shape "STIK" {
+ cornerRadius= 4,
+ { [ 8, 8 ] }
+ };
+ shape "BTN" {
+ { [ 31, 6 ] }
+ };
+
+ section.left= 2;
+ row.left= 1;
+ key.shape= "NORM";
+ key.gap= 0.5;
+
+ key.color= "grey10";
+ labelColor= "white";
+ baseColor= "grey20";
+
+ section "Whole" {
+ top= 10;
+ row {
+ top= 11;
+ key.shape= "FKEY";
+ keys {
+ <ESC>,
+ <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, <FK06>,
+ <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12>,
+ <PAUS>, <HOME>, <END>, <PGUP>
+ };
+ };
+ row {
+ top= 22;
+ keys {
+ { <AEO1>, "ONE" },
+ <AE02>, <AE03>, <AE04>, <AE05>, <AE06>,
+ <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>,
+ { <BKSP>, shape="WIDE" },
+ <PGDN>
+ };
+ };
+ row {
+ top= 40;
+ keys {
+ <TAB>, <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>,
+ <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>,
+ { <BKSL>, "WIDR" }
+ };
+ };
+ row {
+ top= 58;
+ keys { { <CAPS>, shape="WIDE" },
+ <AC01>, <AC02>, <AC03>, <AC04>, <AC05>,
+ <AC06>, <AC07>, <AC08>, <AC09>, <AC10>,
+ <AC11>,
+ { <RTRN>, shape="RTRN" }
+ };
+ };
+ row {
+ top= 76;
+ keys {
+ { <LFSH>, shape="WIDR" },
+ <AB01>, <AB02>, <AB03>, <AB04>, <AB05>,
+ <AB06>, <AB07>, <AB08>, <AB09>, <AB10>,
+ <RTSH>, <UP>, <NMLK>
+ };
+ };
+ row {
+ top= 94;
+ keys {
+ { <LCTL>, "WIDE" }, <FUNC>, { <LALT>, "WIDE" },
+ <TLDE>, { <SPCE>, shape="SPCE" }, <INS>, <DELE>,
+ <LEFT>, <DOWN>, <RGHT>
+ };
+ };
+ overlay "KPAD" {
+ <AE07>=<KP7>, <AE08>=<KP8>, <AE09>=<KP9>, <AE10>=<KPMU>,
+ <AD07>=<KP4>, <AD08>=<KP5>, <AD09>=<KP6>, <AD10>=<KPSU>,
+ <AC07>=<KP1>, <AC08>=<KP2>, <AC09>=<KP3>, <AC10>=<KPAD>,
+ <AB07>=<KP0>, <AB09>=<KPDL>, <AB10>=<KPSL>
+ };
+ }; // End of "Whole" section
+
+ solid "STIK" {
+ color= "red";
+ shape= "STIK";
+ top= 81;
+ left= 112;
+ };
+
+ solid "BTN1" {
+ color= "red";
+ shape= "BTN";
+ top= 137;
+ left= 93;
+ };
+
+ solid "BTN2" {
+ color= "red";
+ shape= "BTN";
+ top= 137;
+ left= 127;
+ };
+
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+
+};
diff --git a/keycodes/README b/keycodes/README
new file mode 100644
index 0000000..b0ca78a
--- /dev/null
+++ b/keycodes/README
@@ -0,0 +1,10 @@
+The keycodes component of a keyboard mapping specifies the range and
+interpretation of the raw keycodes reported by the device. It sets the keycodes
+symbolic name, the minimum and maximum legal codes for the keyboard, and the
+symbolic name for each key. The keycodes component might also contain aliases
+for some keys, symbolic names for some indicators and a description of which
+indicators are physically present.
+
+
+
+/* $XFree86$ */
diff --git a/keycodes/aliases b/keycodes/aliases
new file mode 100644
index 0000000..7cfc25b
--- /dev/null
+++ b/keycodes/aliases
@@ -0,0 +1,101 @@
+
+// keycode aliases for phonetic keyboard maps
+//
+// $XFree86$
+
+default
+xkb_keycodes "qwerty" {
+
+ alias <LatQ> = <AD01>;
+ alias <LatW> = <AD02>;
+ alias <LatE> = <AD03>;
+ alias <LatR> = <AD04>;
+ alias <LatT> = <AD05>;
+ alias <LatY> = <AD06>;
+ alias <LatU> = <AD07>;
+ alias <LatI> = <AD08>;
+ alias <LatO> = <AD09>;
+ alias <LatP> = <AD10>;
+
+ alias <LatA> = <AC01>;
+ alias <LatS> = <AC02>;
+ alias <LatD> = <AC03>;
+ alias <LatF> = <AC04>;
+ alias <LatG> = <AC05>;
+ alias <LatH> = <AC06>;
+ alias <LatJ> = <AC07>;
+ alias <LatK> = <AC08>;
+ alias <LatL> = <AC09>;
+
+ alias <LatZ> = <AB01>;
+ alias <LatX> = <AB02>;
+ alias <LatC> = <AB03>;
+ alias <LatV> = <AB04>;
+ alias <LatB> = <AB05>;
+ alias <LatN> = <AB06>;
+ alias <LatM> = <AB07>;
+};
+
+xkb_keycodes "azerty" {
+
+ alias <LatA> = <AD01>;
+ alias <LatZ> = <AD02>;
+ alias <LatE> = <AD03>;
+ alias <LatR> = <AD04>;
+ alias <LatT> = <AD05>;
+ alias <LatY> = <AD06>;
+ alias <LatU> = <AD07>;
+ alias <LatI> = <AD08>;
+ alias <LatO> = <AD09>;
+ alias <LatP> = <AD10>;
+
+ alias <LatQ> = <AC01>;
+ alias <LatS> = <AC02>;
+ alias <LatD> = <AC03>;
+ alias <LatF> = <AC04>;
+ alias <LatG> = <AC05>;
+ alias <LatH> = <AC06>;
+ alias <LatJ> = <AC07>;
+ alias <LatK> = <AC08>;
+ alias <LatL> = <AC09>;
+ alias <LatM> = <AC10>;
+
+ alias <LatW> = <AB01>;
+ alias <LatX> = <AB02>;
+ alias <LatC> = <AB03>;
+ alias <LatV> = <AB04>;
+ alias <LatB> = <AB05>;
+ alias <LatN> = <AB06>;
+};
+
+xkb_keycodes "qwertz" {
+
+ alias <LatQ> = <AD01>;
+ alias <LatW> = <AD02>;
+ alias <LatE> = <AD03>;
+ alias <LatR> = <AD04>;
+ alias <LatT> = <AD05>;
+ alias <LatZ> = <AD06>;
+ alias <LatU> = <AD07>;
+ alias <LatI> = <AD08>;
+ alias <LatO> = <AD09>;
+ alias <LatP> = <AD10>;
+
+ alias <LatA> = <AC01>;
+ alias <LatS> = <AC02>;
+ alias <LatD> = <AC03>;
+ alias <LatF> = <AC04>;
+ alias <LatG> = <AC05>;
+ alias <LatH> = <AC06>;
+ alias <LatJ> = <AC07>;
+ alias <LatK> = <AC08>;
+ alias <LatL> = <AC09>;
+
+ alias <LatY> = <AB01>;
+ alias <LatX> = <AB02>;
+ alias <LatC> = <AB03>;
+ alias <LatV> = <AB04>;
+ alias <LatB> = <AB05>;
+ alias <LatN> = <AB06>;
+ alias <LatM> = <AB07>;
+};
diff --git a/keycodes/amiga b/keycodes/amiga
new file mode 100644
index 0000000..7b661a5
--- /dev/null
+++ b/keycodes/amiga
@@ -0,0 +1,231 @@
+// $Xorg: amiga,v 1.3 2000/08/17 19:54:37 cpqbld Exp $
+
+
+
+// $XFree86: xc/programs/xkbcomp/keycodes/amiga,v 3.2 1997/10/26 13:25:35 dawes Exp $
+
+default xkb_keycodes "usa1" {
+
+ minimum= 8;
+ maximum= 111;
+
+ <ESC> = 77;
+ <FK01> = 88;
+ <FK02> = 89;
+ <FK03> = 90;
+ <FK04> = 91;
+ <FK05> = 92;
+ <FK06> = 93;
+ <FK07> = 94;
+ <FK08> = 95;
+ <FK09> = 96;
+ <FK10> = 97;
+
+ <TLDE> = 8;
+ <AE01> = 9;
+ <AE02> = 10;
+ <AE03> = 11;
+ <AE04> = 12;
+ <AE05> = 13;
+ <AE06> = 14;
+ <AE07> = 15;
+ <AE08> = 16;
+ <AE09> = 17;
+ <AE10> = 18;
+ <AE11> = 19;
+ <AE12> = 20;
+ <BKSL> = 21;
+ <BKSP> = 73;
+
+ <TAB> = 74;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 76;
+
+ <LCTL> = 107;
+ <CAPS> = 106;
+ <AC01> = 40;
+ <AC02> = 41;
+ <AC03> = 42;
+ <AC04> = 43;
+ <AC05> = 44;
+ <AC06> = 45;
+ <AC07> = 46;
+ <AC08> = 47;
+ <AC09> = 48;
+ <AC10> = 49;
+ <AC11> = 50;
+
+ <LFSH> = 104;
+ <AB01> = 57;
+ <AB02> = 58;
+ <AB03> = 59;
+ <AB04> = 60;
+ <AB05> = 61;
+ <AB06> = 62;
+ <AB07> = 63;
+ <AB08> = 64;
+ <AB09> = 65;
+ <AB10> = 66;
+ <RTSH> = 105;
+
+ <LALT> = 108;
+ <LAMI> = 110;
+ <SPCE> = 72;
+ <RAMI> = 111;
+ <RALT> = 109;
+
+ <DELE> = 78;
+ <HELP> = 103;
+ <UP> = 84;
+ <LEFT> = 87;
+ <DOWN> = 85;
+ <RGHT> = 86;
+
+ <KPLP> = 98;
+ <KPRP> = 99;
+ <KPDV> = 100;
+ <KPMU> = 101;
+
+ <KP7> = 69;
+ <KP8> = 70;
+ <KP9> = 71;
+ <KPSU> = 82;
+
+ <KP4> = 53;
+ <KP5> = 54;
+ <KP6> = 55;
+ <KPAD> = 102;
+
+ <KP1> = 37;
+ <KP2> = 38;
+ <KP3> = 39;
+
+ <KP0> = 23;
+ <KPDC> = 68;
+ <KPEN> = 75;
+};
+
+xkb_keycodes "de" {
+
+ minimum= 8;
+ maximum= 111;
+
+ <ESC> = 77;
+ <FK01> = 88;
+ <FK02> = 89;
+ <FK03> = 90;
+ <FK04> = 91;
+ <FK05> = 92;
+ <FK06> = 93;
+ <FK07> = 94;
+ <FK08> = 95;
+ <FK09> = 96;
+ <FK10> = 97;
+
+ <TLDE> = 8;
+ <AE01> = 9;
+ <AE02> = 10;
+ <AE03> = 11;
+ <AE04> = 12;
+ <AE05> = 13;
+ <AE06> = 14;
+ <AE07> = 15;
+ <AE08> = 16;
+ <AE09> = 17;
+ <AE10> = 18;
+ <AE11> = 19;
+ <AE12> = 20;
+ <BKSL> = 21;
+ <BKSP> = 73;
+
+ <TAB> = 74;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 76;
+
+ <LCTL> = 107;
+ <CAPS> = 106;
+ <AC01> = 40;
+ <AC02> = 41;
+ <AC03> = 42;
+ <AC04> = 43;
+ <AC05> = 44;
+ <AC06> = 45;
+ <AC07> = 46;
+ <AC08> = 47;
+ <AC09> = 48;
+ <AC10> = 49;
+ <AC11> = 50;
+ <AC12> = 51;
+
+ <LFSH> = 104;
+ <LSGT> = 56;
+ <AB01> = 57;
+ <AB02> = 58;
+ <AB03> = 59;
+ <AB04> = 60;
+ <AB05> = 61;
+ <AB06> = 62;
+ <AB07> = 63;
+ <AB08> = 64;
+ <AB09> = 65;
+ <AB10> = 66;
+ <RTSH> = 105;
+
+ <LALT> = 108;
+ <LAMI> = 110;
+ <SPCE> = 72;
+ <RAMI> = 111;
+ <RALT> = 109;
+
+ <DELE> = 78;
+ <HELP> = 103;
+ <UP> = 84;
+ <LEFT> = 87;
+ <DOWN> = 85;
+ <RGHT> = 86;
+
+ <KPLP> = 98;
+ <KPRP> = 99;
+ <KPDV> = 100;
+ <KPMU> = 101;
+
+ <KP7> = 69;
+ <KP8> = 70;
+ <KP9> = 71;
+ <KPSU> = 82;
+
+ <KP4> = 53;
+ <KP5> = 54;
+ <KP6> = 55;
+ <KPAD> = 102;
+
+ <KP1> = 37;
+ <KP2> = 38;
+ <KP3> = 39;
+
+ <KP0> = 23;
+ <KPDC> = 68;
+ <KPEN> = 75;
+};
diff --git a/keycodes/ataritt b/keycodes/ataritt
new file mode 100644
index 0000000..3cfd503
--- /dev/null
+++ b/keycodes/ataritt
@@ -0,0 +1,123 @@
+// $Xorg: ataritt,v 1.3 2000/08/17 19:54:37 cpqbld Exp $
+
+
+
+// $XFree86: xc/programs/xkbcomp/keycodes/ataritt,v 3.1 1997/10/26 13:25:35 dawes Exp $
+
+default xkb_keycodes "us" {
+
+ minimum= 8;
+ maximum= 134;
+
+ <ESC> = 9;
+ <AE01> = 10;
+ <AE02> = 11;
+ <AE03> = 12;
+ <AE04> = 13;
+ <AE05> = 14;
+ <AE06> = 15;
+ <AE07> = 16;
+ <AE08> = 17;
+ <AE09> = 18;
+ <AE10> = 19;
+ <AE11> = 20;
+ <AE12> = 21;
+ <TLDE> = 49;
+ <BKSP> = 22;
+
+ <TAB> = 23;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 36;
+ <DELE> = 91;
+
+ <LCTL> = 37;
+ <AC01> = 38;
+ <AC02> = 39;
+ <AC03> = 40;
+ <AC04> = 41;
+ <AC05> = 42;
+ <AC06> = 43;
+ <AC07> = 44;
+ <AC08> = 45;
+ <AC09> = 46;
+ <AC10> = 47;
+ <AC11> = 48;
+ <BKSL> = 51;
+
+ <LFSH> = 50;
+ <AB01> = 52;
+ <AB02> = 53;
+ <AB03> = 54;
+ <AB04> = 55;
+ <AB05> = 56;
+ <AB06> = 57;
+ <AB07> = 58;
+ <AB08> = 59;
+ <AB09> = 60;
+ <AB10> = 61;
+ <RTSH> = 62;
+
+ <ALT> = 64;
+ <SPCE> = 65;
+ <CAPS> = 66;
+
+ <FK01> = 67;
+ <FK02> = 68;
+ <FK03> = 69;
+ <FK04> = 70;
+ <FK05> = 71;
+ <FK06> = 72;
+ <FK07> = 73;
+ <FK08> = 74;
+ <FK09> = 75;
+ <FK10> = 76;
+
+ <HELP> = 106;
+ <UNDO> = 105;
+ <INS> = 90;
+ <HOME> = 79;
+ <UP> = 80;
+ <LEFT> = 83;
+ <DOWN> = 88;
+ <RGHT> = 85;
+
+ <KPLP> = 107;
+ <KPRP> = 108;
+ <KPDV> = 109;
+ <KPMU> = 110;
+
+ <KP7> = 111;
+ <KP8> = 112;
+ <KP9> = 113;
+ <KPSU> = 82;
+
+ <KP4> = 114;
+ <KP5> = 115;
+ <KP6> = 116;
+ <KPAD> = 86;
+
+ <KP1> = 117;
+ <KP2> = 118;
+ <KP3> = 119;
+
+ <KP0> = 120;
+ <KPDC> = 121;
+ <KPEN> = 122;
+};
+
+xkb_keycodes "de" {
+ include "ataritt(us)"
+
+ <LSGT> = 104;
+};
diff --git a/keycodes/digital.vndr/lk b/keycodes/digital.vndr/lk
new file mode 100644
index 0000000..2d8c584
--- /dev/null
+++ b/keycodes/digital.vndr/lk
@@ -0,0 +1,271 @@
+// $Xorg: lk,v 1.3 2000/08/17 19:54:38 cpqbld Exp $
+//
+//Copyright (c) 1996 Digital Equipment Corporation
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be included
+//in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM,
+//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+//THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the Digital Equipment
+//Corporation shall not be used in advertising or otherwise to promote
+//the sale, use or other dealings in this Software without prior written
+//authorization from Digital Equipment Corporation.
+//
+// HISTORY
+// Log
+// Revision 1.2 1996/06/18 09:13:22 erik
+// use flags correctly, assorted cleanups and consortium fixes
+//
+// Revision 1.1.6.2 1995/08/07 17:40:34 William_Walker
+// Upgrade XKB to protocol 0.62 (dual submit from decx11)
+// [1995/08/06 14:06:25 William_Walker]
+//
+// Revision 1.1.2.4 1995/08/05 15:25:55 William_Walker
+// Upgrade to XKB protocol 0.62
+// [1995/08/05 14:39:58 William_Walker]
+//
+// Revision 1.1.2.3 1995/06/27 12:17:31 William_Walker
+// Rename <TLDE> to ISO9995 compliant <AE00>.
+// [1995/06/26 20:24:04 William_Walker]
+//
+// Revision 1.1.2.2 1995/06/05 19:21:28 William_Walker
+// New file. I love keymaps.
+// [1995/06/05 18:07:29 William_Walker]
+//
+// EndLog
+//
+// @(#)RCSfile: lk Revision: /main/3 (DEC) Date: 1996/01/24 12:13:31
+//
+xkb_keycodes "lk_common" {
+ // "Function" keys
+ <FK01> = 86;
+ <FK02> = 87;
+ <FK03> = 88;
+ <FK04> = 89;
+ <FK05> = 90;
+ <FK06> = 100;
+ <FK07> = 101;
+ <FK08> = 102;
+ <FK09> = 103;
+ <FK10> = 104;
+ <FK11> = 113;
+ <FK12> = 114;
+
+ <UP> = 170;
+ <LEFT> = 167;
+ <DOWN> = 169;
+ <RGHT> = 168;
+
+ // "Keypad" keys
+ <KP7> = 157;
+ <KP8> = 158;
+ <KP9> = 159;
+ <KP4> = 153;
+ <KP5> = 154;
+ <KP6> = 155;
+ <KP1> = 150;
+ <KP2> = 151;
+ <KP3> = 152;
+ <KPEN> = 149;
+ <KP0> = 146;
+ <KPDL> = 148;
+
+ // "Alphanumeric" keys
+ <AE00> = 191;
+ <AE01> = 192;
+ <AE02> = 197;
+ <AE03> = 203;
+ <AE04> = 208;
+ <AE05> = 214;
+ <AE06> = 219;
+ <AE07> = 224;
+ <AE08> = 229;
+ <AE09> = 234;
+ <AE10> = 239;
+ <AE11> = 249;
+ <AE12> = 245;
+ <BKSP> = 188;
+
+ <TAB> = 190;
+ <AD01> = 193;
+ <AD02> = 198;
+ <AD03> = 204;
+ <AD04> = 209;
+ <AD05> = 215;
+ <AD06> = 220;
+ <AD07> = 225;
+ <AD08> = 230;
+ <AD09> = 235;
+ <AD10> = 240;
+ <AD11> = 250;
+ <AD12> = 246;
+ <RTRN> = 189;
+
+ <LCTL> = 175;
+ <CAPS> = 176;
+ <AC01> = 194;
+ <AC02> = 199;
+ <AC03> = 205;
+ <AC04> = 210;
+ <AC05> = 216;
+ <AC06> = 221;
+ <AC07> = 226;
+ <AC08> = 231;
+ <AC09> = 236;
+ <AC10> = 242;
+ <AC11> = 251;
+
+ <LFSH> = 174;
+ <AB01> = 195;
+ <AB02> = 200;
+ <AB03> = 206;
+ <AB04> = 211;
+ <AB05> = 217;
+ <AB06> = 222;
+ <AB07> = 227;
+ <AB08> = 232;
+ <AB09> = 237;
+ <AB10> = 243;
+ <RTSH> = 171;
+
+ <SPCE> = 212;
+
+ <LDM> = 255; // Support R5 Lock Down Modifiers
+
+ alias <TLDE> = <AE00>;
+};
+
+xkb_keycodes "lkx01" {
+ include "digital/lk(lk_common)"
+ <AB00> = 201;
+ <FK13> = 115;
+ <FK14> = 116;
+ <FK17> = 128;
+ <FK18> = 129;
+ <FK19> = 130;
+ <FK20> = 131;
+ <HELP> = 124;
+ <DO> = 125;
+ <FIND> = 138;
+ <INS> = 139;
+ <DELE> = 140;
+ <SELE> = 141;
+ <PGUP> = 142;
+ <PGDN> = 143;
+ <KPF1> = 161;
+ <KPF2> = 162;
+ <KPF3> = 163;
+ <KPF4> = 164;
+ <KPSU> = 160;
+ <KPCO> = 156;
+ <BKSL> = 247;
+ <LCMP> = 177;
+};
+
+xkb_keycodes "lk201" {
+ include "digital/lk(lkx01)"
+ indicator 4 = "Scroll Lock";
+ indicator 3 = "Caps Lock";
+ indicator 2 = "Compose";
+ indicator 1 = "Wait";
+};
+
+xkb_keycodes "lk421" {
+ include "digital/lk(lkx01)"
+ <LALT> = 172;
+ <RALT> = 178;
+ <RCMP> = 173;
+};
+
+xkb_keycodes "lk401" {
+ include "digital/lk(lk421)"
+ indicator 4 = "Scroll Lock";
+ indicator 3 = "Caps Lock";
+};
+
+xkb_keycodes "lk44x" {
+ include "digital/lk(lk_common)"
+ <ESC> = 85;
+ <PRSC> = 115;
+ <SCLK> = 116;
+ <PAUS> = 124;
+ <INS> = 138;
+ <HOME> = 139;
+ <PGUP> = 140;
+ <DELE> = 141;
+ <END> = 142;
+ <PGDN> = 143;
+ <NMLK> = 161;
+ <KPDV> = 162;
+ <KPMU> = 163;
+ <KPSU> = 164;
+ <KPAD> = 156;
+ <LALT> = 172;
+ <RALT> = 178;
+ <RCTL> = 173;
+};
+
+xkb_keycodes "lk443" {
+ include "digital/lk(lk44x)"
+ <BKSL> = 247;
+ indicator 3 = "Caps Lock";
+ indicator 4 = "Scroll Lock";
+ indicator 5 = "Num Lock";
+};
+
+xkb_keycodes "lk444" {
+ include "digital/lk(lk44x)"
+ <BKSL> = 201;
+ <AC12> = 247;
+ indicator 3 = "Caps Lock";
+ indicator 4 = "Scroll Lock";
+ indicator 5 = "Num Lock";
+};
+
+// LK201-LT = lk201
+// LK421-AJ = lk421 +AB11
+// LK421-JJ = lk421aj+MUHE+KANJ+HIRA
+// LK401-AJ = lk401
+// LK401-BJ = lk401 +MUHE+KANJ+HIRA
+// LK401-JJ = lk401bj+AB11
+// LK401-LT = lk401
+// LK441-LT = lk443
+
+xkb_keycodes "lk421aj" {
+ include "digital/lk(lk421)"
+ <AB11> = 252;
+};
+
+xkb_keycodes "lk421jj" {
+ include "digital/lk(lk421aj)"
+ <MUHE> = 94;
+ <KANJ> = 95;
+ <HIRA> = 97;
+};
+
+xkb_keycodes "lk401bj" {
+ include "digital/lk(lk401)"
+ <MUHE> = 94;
+ <KANJ> = 95;
+ <HIRA> = 97;
+};
+
+xkb_keycodes "lk401jj" {
+ include "digital/lk(lk401bj)"
+ <AB11> = 252;
+};
diff --git a/keycodes/digital.vndr/pc b/keycodes/digital.vndr/pc
new file mode 100644
index 0000000..b0aebc3
--- /dev/null
+++ b/keycodes/digital.vndr/pc
@@ -0,0 +1,280 @@
+// $Xorg: pc,v 1.3 2000/08/17 19:54:38 cpqbld Exp $
+//
+//Copyright (c) 1996 Digital Equipment Corporation
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be included
+//in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM,
+//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+//THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the Digital Equipment
+//Corporation shall not be used in advertising or otherwise to promote
+//the sale, use or other dealings in this Software without prior written
+//authorization from Digital Equipment Corporation.
+//
+// HISTORY
+// Log
+// Revision 1.2 1996/06/18 09:13:25 erik
+// use flags correctly, assorted cleanups and consortium fixes
+//
+// Revision 1.1.6.3 1995/10/25 21:00:14 William_Walker
+// Add pc104-key support
+// [1995/10/23 15:46:21 William_Walker]
+//
+// Revision 1.1.6.2 1995/08/07 17:40:37 William_Walker
+// Upgrade XKB to protocol 0.62 (dual submit from decx11)
+// [1995/08/06 14:06:28 William_Walker]
+//
+// Revision 1.1.2.4 1995/08/05 15:25:56 William_Walker
+// Upgrade to XKB protocol 0.62
+// [1995/08/05 14:40:02 William_Walker]
+//
+// Revision 1.1.2.3 1995/06/27 12:17:32 William_Walker
+// Rename <TLDE> to ISO9995 compliant <AE00>.
+// [1995/06/26 20:24:07 William_Walker]
+//
+// Revision 1.1.2.2 1995/06/05 19:21:31 William_Walker
+// New file. I love keymaps.
+// [1995/06/05 18:07:34 William_Walker]
+//
+// EndLog
+//
+// @(#)RCSfile: pc Revision: /main/3 (DEC) Date: 1996/01/24 12:13:36
+//
+xkb_keycodes "pc_common" {
+ // "Function" keys
+ <FK01> = 9;
+ <FK02> = 15;
+ <FK03> = 23;
+ <FK04> = 31;
+ <FK05> = 39;
+ <FK06> = 47;
+ <FK07> = 55;
+ <FK08> = 63;
+ <FK09> = 71;
+ <FK10> = 79;
+ <FK11> = 86;
+ <FK12> = 94;
+
+ // "Editing" keys
+
+ <UP> = 99;
+ <LEFT> = 97;
+ <DOWN> = 96;
+ <RGHT> = 106;
+
+ // "Keypad" keys
+ <KP7> = 108;
+ <KP8> = 117;
+ <KP9> = 125;
+
+ <KP4> = 107;
+ <KP5> = 115;
+ <KP6> = 116;
+
+ <KP1> = 105;
+ <KP2> = 114;
+ <KP3> = 122;
+ <KPEN> = 121;
+
+ <KP0> = 112;
+ <KPDL> = 113;
+
+ // "Alphanumeric" keys
+ <AE01> = 22;
+ <AE02> = 30;
+ <AE03> = 38;
+ <AE04> = 37;
+ <AE05> = 46;
+ <AE06> = 54;
+ <AE07> = 61;
+ <AE08> = 62;
+ <AE09> = 70;
+ <AE10> = 69;
+ <AE11> = 78;
+ <AE12> = 85;
+ <BKSP> = 102;
+
+ <TAB> = 13;
+ <AD01> = 21;
+ <AD02> = 29;
+ <AD03> = 36;
+ <AD04> = 45;
+ <AD05> = 44;
+ <AD06> = 53;
+ <AD07> = 60;
+ <AD08> = 67;
+ <AD09> = 68;
+ <AD10> = 77;
+ <AD11> = 84;
+ <AD12> = 91;
+
+ <CAPS> = 20;
+ <AC01> = 28;
+ <AC02> = 27;
+ <AC03> = 35;
+ <AC04> = 43;
+ <AC05> = 52;
+ <AC06> = 51;
+ <AC07> = 59;
+ <AC08> = 66;
+ <AC09> = 75;
+ <AC10> = 76;
+ <AC11> = 82;
+ <RTRN> = 90;
+
+ <LFSH> = 18;
+ <AB01> = 26;
+ <AB02> = 34;
+ <AB03> = 33;
+ <AB04> = 42;
+ <AB05> = 50;
+ <AB06> = 49;
+ <AB07> = 58;
+ <AB08> = 65;
+ <AB09> = 73;
+ <AB10> = 74;
+ <RTSH> = 89;
+
+ <LCTL> = 17;
+ <LALT> = 25;
+ <SPCE> = 41;
+ <RALT> = 57;
+
+ <LDM> = 255; // Support R5 Lock Down Modifiers
+
+};
+
+xkb_keycodes "pc10x" {
+ include "digital/pc(pc_common)"
+ <ESC> = 8;
+ <AE00> = 14;
+ <PRSC> = 87;
+ <SCLK> = 95;
+ <PAUS> = 98;
+ <INS> = 103;
+ <HOME> = 110;
+ <PGUP> = 111;
+ <DELE> = 100;
+ <END> = 101;
+ <PGDN> = 109;
+ <NMLK> = 118;
+ <KPDV> = 119;
+ <KPMU> = 126;
+ <KPSU> = 132;
+ <KPAD> = 124;
+ <RCTL> = 88;
+
+ alias <TLDE> = <AE00>;
+
+ indicator 3 = "Caps Lock";
+ indicator 4 = "Scroll Lock";
+};
+
+xkb_keycodes "pc101" {
+ include "digital/pc(pc10x)"
+ <BKSL> = 92;
+ indicator 5 = "Num Lock";
+};
+
+
+xkb_keycodes "pc102" {
+ include "digital/pc(pc10x)"
+ <BKSL> = 19;
+ <AC12> = 83;
+ indicator 5 = "Num Lock";
+};
+
+xkb_keycodes "pc104" {
+ include "digital/pc(pc101)"
+ <LWIN> = 139;
+ <RWIN> = 140;
+ <MENU> = 141;
+};
+
+xkb_keycodes "lk411_common" {
+ include "digital/pc(pc_common)"
+ <AE00> = 8;
+ <AB00> = 14;
+ <FK13> = 24;
+ <FK14> = 10;
+ <FK17> = 16;
+ <FK18> = 87;
+ <FK19> = 95;
+ <FK20> = 98;
+ <HELP> = 11;
+ <DO> = 12;
+ <FIND> = 110;
+ <INS> = 103;
+ <DELE> = 100;
+ <SELE> = 101;
+ <PGUP> = 111;
+ <PGDN> = 109;
+ <KPF1> = 118;
+ <KPF2> = 119;
+ <KPF3> = 126;
+ <KPF4> = 132;
+ <KPSU> = 19;
+ <KPCO> = 124;
+ <LCMP> = 40;
+ <RCMP> = 88;
+
+ alias <TLDE> = <AE00>;
+
+ indicator 3 = "Caps Lock";
+ indicator 4 = "Scroll Lock";
+};
+
+xkb_keycodes "lk411" {
+ include "digital/pc(lk411_common)"
+ <BKSL> = 92;
+};
+
+xkb_keycodes "lk450" {
+ include "digital/pc(lk411)"
+ indicator 2 = "Compose";
+ indicator 1 = "Wait";
+};
+
+// Japanese variants
+//
+// PCXAJ-AA = pc+BKSL+AC12+AB11+MUHE+KANJ+HIRA+indicator
+// LK411-AJ = lk411+MUHE+KANJ+HIRA
+// LK411-JJ = lk411+BKSL+AZ01+MUHE+KANJ+HIRA
+// LK411-LT = lk411
+
+xkb_keycodes "pcxajaa" {
+ include "digital/pc(pc10x)"
+ <BKSL> = 93;
+ <AC12> = 83;
+ <AB11> = 81;
+ <MUHE> = 133;
+ <KANJ> = 134;
+ <HIRA> = 135;
+ indicator 5 = "Group 2";
+};
+
+xkb_keycodes "lk411jj" {
+ include "digital/pc(lk411_common)"
+ <AB11> = 81;
+ <BKSL> = 83;
+ <MUHE> = 133;
+ <KANJ> = 134;
+ <HIRA> = 135;
+};
+
+
diff --git a/keycodes/fujitsu b/keycodes/fujitsu
new file mode 100644
index 0000000..e0e63c6
--- /dev/null
+++ b/keycodes/fujitsu
@@ -0,0 +1,187 @@
+// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+default xkb_keycodes "138" {
+
+ minimum= 8;
+ maximum= 156;
+
+ <ESC> = 37;
+ <AE01> = 38;
+ <AE02> = 39;
+ <AE03> = 40;
+ <AE04> = 41;
+ <AE05> = 42;
+ <AE06> = 43;
+ <AE07> = 44;
+ <AE08> = 45;
+ <AE09> = 46;
+ <AE10> = 47;
+ <AE11> = 48;
+ <AE12> = 49;
+ <TLDE> = 50;
+ <BKSP> = 51;
+
+ <TAB> = 61;
+ <AD01> = 62;
+ <AD02> = 63;
+ <AD03> = 64;
+ <AD04> = 65;
+ <AD05> = 66;
+ <AD06> = 67;
+ <AD07> = 68;
+ <AD08> = 69;
+ <AD09> = 70;
+ <AD10> = 71;
+ <AD11> = 72;
+ <AD12> = 73;
+
+ <LCTL> = 84;
+ <AC01> = 85;
+ <AC02> = 86;
+ <AC03> = 87;
+ <AC04> = 88;
+ <AC05> = 89;
+ <AC06> = 90;
+ <AC07> = 91;
+ <AC08> = 92;
+ <AC09> = 93;
+ <AC10> = 94;
+ <AC11> = 95;
+ <BKSL> = 96;
+ <RTRN> = 97;
+
+ <LFSH> = 107;
+ <AB01> = 108;
+ <AB02> = 109;
+ <AB03> = 110;
+ <AB04> = 111;
+ <AB05> = 112;
+ <AB06> = 113;
+ <AB07> = 114;
+ <AB08> = 115;
+ <AB09> = 116;
+ <AB10> = 117;
+ <AB11> = 52;
+ <RTSH> = 118;
+
+ <CAPS> = 127;
+ <LALT> = 27;
+ <LMTA> = 128;
+ <UNK4> = 125;
+ <SPCE> = 129;
+ <UNK5> = 10;
+ <RMTA> = 130;
+ <RALT> = 23;
+ <COMP> = 75;
+ <LNFD> = 119;
+ <UNK6> = 56;
+
+ <FK01> = 13;
+ <FK02> = 14;
+ <FK03> = 16;
+ <FK04> = 18;
+ <FK05> = 20;
+ <FK06> = 22;
+ <FK07> = 24;
+ <FK08> = 25;
+ <FK09> = 26;
+ <FK10> = 15;
+ <FK11> = 17;
+ <FK12> = 19;
+ <FK13> = 137;
+ <FK14> = 138;
+ <FK15> = 139;
+ <FK16> = 140;
+ <FK17> = 141;
+ <FK18> = 142;
+ <FK19> = 143;
+ <FK20> = 144;
+ <FK21> = 145;
+ <FK22> = 146;
+ <FK23> = 147;
+ <FK24> = 148;
+ <FK25> = 153;
+ <FK26> = 154;
+ <FK27> = 155;
+ <FK28> = 156;
+ <FK29> = 149;
+ <FK30> = 150;
+ <FK31> = 151;
+ <FK32> = 152;
+
+ <UNDO> = 34;
+ <COPY> = 59;
+ <PAST> = 81;
+ <CUT> = 105;
+ <HELP> = 126;
+
+ <BREA> = 9;
+ <PRSC> = 30;
+ <KNJI> = 21;
+ <PAUS> = 29;
+
+ <UNK0> = 82;
+ <UNK1> = 83;
+ <UNK2> = 12;
+ <PGUP> = 35;
+ <HOME> = 32;
+ <PGDN> = 36;
+ <UNK3> = 28;
+ <DEL> = 74;
+ <INS> = 60;
+ <UP> = 33;
+ <DOWN> = 103;
+ <LEFT> = 57;
+ <RGHT> = 80;
+ <EXEC> = 11;
+
+ <KPMU> = 55;
+ <KPDV> = 54;
+ <KPAD> = 133;
+ <KPSU> = 79;
+
+ <KP7> = 76;
+ <KP8> = 77;
+ <KP9> = 78;
+ <KPEQ> = 53;
+
+ <KP4> = 99;
+ <KP5> = 100;
+ <KP6> = 101;
+ <KPDC> = 58;
+
+ <KP1> = 120;
+ <KP2> = 121;
+ <KP3> = 122;
+ <KPEN> = 98;
+
+ <KP0> = 102;
+ <KP00> = 31;
+
+ <UNK7> = 123;
+ <UNK8> = 124;
+};
diff --git a/keycodes/hp b/keycodes/hp
new file mode 100644
index 0000000..0c98072
--- /dev/null
+++ b/keycodes/hp
@@ -0,0 +1,271 @@
+// $Xorg: hp,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+default xkb_keycodes "hp-101" {
+
+ <TLDE> = 23;
+ <AE01> = 31;
+ <AE02> = 39;
+ <AE03> = 47;
+ <AE04> = 46;
+ <AE05> = 55;
+ <AE06> = 63;
+ <AE07> = 70;
+ <AE08> = 71;
+ <AE09> = 79;
+ <AE10> = 78;
+ <AE11> = 87;
+ <AE12> = 94;
+ <BKSP> = 111;
+
+ <TAB> = 22;
+ <AD01> = 30;
+ <AD02> = 38;
+ <AD03> = 45;
+ <AD04> = 54;
+ <AD05> = 53;
+ <AD06> = 62;
+ <AD07> = 69;
+ <AD08> = 76;
+ <AD09> = 77;
+ <AD10> = 86;
+ <AD11> = 93;
+ <AD12> = 100;
+ <BKSL> = 101;
+
+ <CAPS> = 29;
+ <AC01> = 37;
+ <AC02> = 36;
+ <AC03> = 44;
+ <AC04> = 52;
+ <AC05> = 61;
+ <AC06> = 60;
+ <AC07> = 68;
+ <AC08> = 75;
+ <AC09> = 84;
+ <AC10> = 85;
+ <AC11> = 91;
+ <RTRN> = 99;
+
+ <LFSH> = 27;
+ <AB01> = 35;
+ <AB02> = 43;
+ <AB03> = 42;
+ <AB04> = 51;
+ <AB05> = 59;
+ <AB06> = 58;
+ <AB07> = 67;
+ <AB08> = 74;
+ <AB09> = 82;
+ <AB10> = 83;
+ <RTSH> = 98;
+
+ <LCTL> = 26;
+ <LALT> = 34;
+ <SPCE> = 50;
+ <RALT> = 66;
+ <RCTL> = 97;
+
+ <ESC> = 17;
+ <FK01> = 16;
+ <FK02> = 24;
+ <FK03> = 32;
+ <FK04> = 40;
+ <FK05> = 48;
+ <FK06> = 56;
+ <FK07> = 64;
+ <FK08> = 72;
+ <FK09> = 80;
+ <FK10> = 88;
+ <FK11> = 95;
+ <FK12> = 103;
+
+ <PRSC> = 96;
+ <SCLK> = 104;
+ <PAUS> = 107;
+
+ <INS> = 112;
+ <HOME> = 119;
+ <PGUP> = 120;
+ <DELE> = 109;
+ <END> = 110;
+ <PGDN> = 118;
+
+ <UP> = 108;
+ <LEFT> = 106;
+ <DOWN> = 105;
+ <RGHT> = 115;
+
+ <NMLK> = 127;
+ <KPDV> = 128;
+ <KPMU> = 135;
+ <KPSU> = 141;
+
+ <KP7> = 117;
+ <KP8> = 126;
+ <KP9> = 134;
+ <KPAD> = 133;
+
+ <KP4> = 116;
+ <KP5> = 124;
+ <KP6> = 125;
+
+ <KP1> = 114;
+ <KP2> = 123;
+ <KP3> = 131;
+ <KPEN> = 130;
+
+ <KP0> = 121;
+ <KPDL> = 122;
+
+ indicator 1 = "Caps Lock";
+ indicator 2 = "Num Lock";
+ indicator 3 = "Scroll Lock";
+};
+
+xkb_keycodes "hil" {
+
+ <TLDE> = 71;
+ <AE01> = 70;
+ <AE02> = 69;
+ <AE03> = 68;
+ <AE04> = 67;
+ <AE05> = 66;
+ <AE06> = 65;
+ <AE07> = 64;
+ <AE08> = 96;
+ <AE09> = 97;
+ <AE10> = 98;
+ <AE11> = 99;
+ <AE12> = 100;
+ <BKSP> = 101;
+
+ <TAB> = 63;
+ <AD01> = 62;
+ <AD02> = 61;
+ <AD03> = 60;
+ <AD04> = 59;
+ <AD05> = 58;
+ <AD06> = 57;
+ <AD07> = 56;
+ <AD08> = 104;
+ <AD09> = 105;
+ <AD10> = 106;
+ <AD11> = 107;
+ <AD12> = 108;
+ <BKSL> = 109;
+
+ <CAPS> = 55;
+ <AC01> = 53;
+ <AC02> = 52;
+ <AC03> = 51;
+ <AC04> = 50;
+ <AC05> = 49;
+ <AC06> = 48;
+ <AC07> = 112;
+ <AC08> = 113;
+ <AC09> = 114;
+ <AC10> = 115;
+ <AC11> = 116;
+ <RTRN> = 117;
+
+ <LFSH> = 13;
+ <AB01> = 36;
+ <AB02> = 35;
+ <AB03> = 34;
+ <AB04> = 33;
+ <AB05> = 32;
+ <AB06> = 128;
+ <AB07> = 120;
+ <AB08> = 121;
+ <AB09> = 122;
+ <AB10> = 123;
+ <RTSH> = 12;
+
+ <LCTL> = 14;
+ <LALT> = 11;
+ <SPCE> = 129;
+ <RALT> = 10;
+ <PRSC> = 87;
+
+ <ESC> = 39;
+ <BRK> = 15;
+ <STOP> = 86;
+ <FK01> = 84;
+ <FK02> = 83;
+ <FK03> = 82;
+ <FK04> = 81;
+ <MENU> = 80;
+ <SYST> = 88;
+ <FK05> = 89;
+ <FK06> = 90;
+ <FK07> = 91;
+ <FK08> = 92;
+ <FK09> = 45;
+ <FK10> = 41;
+ <FK11> = 43;
+ <FK12> = 47;
+ <CLRL> = 94;
+ <CLR> = 95;
+
+ <INSL> = 102;
+ <DELL> = 103;
+ <INSC> = 110;
+ <DELC> = 111;
+
+ <HOME> = 118;
+ <PGUP> = 119;
+ <PGDN> = 127;
+ <SELE> = 125;
+
+ <UP> = 134;
+ <LEFT> = 132;
+ <DOWN> = 133;
+ <RGHT> = 135;
+
+ <KPDV> = 25;
+ <KPMU> = 29;
+ <KPAD> = 27;
+ <KPSU> = 31;
+
+ <KP7> = 21;
+ <KP8> = 17;
+ <KP9> = 19;
+ <KPEN> = 23;
+
+ <KP4> = 16;
+ <KP5> = 18;
+ <KP6> = 20;
+ <KPSP> = 22;
+
+ <KP1> = 24;
+ <KP2> = 26;
+ <KP3> = 28;
+ <KPTB> = 46;
+
+ <KP0> = 30;
+ <KPDL> = 44;
+};
diff --git a/keycodes/ibm b/keycodes/ibm
new file mode 100644
index 0000000..303d4b3
--- /dev/null
+++ b/keycodes/ibm
@@ -0,0 +1,151 @@
+// $Xorg: ibm,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+xkb_keycodes "rs6k-101" {
+
+ <TLDE> = 9;
+ <AE01> = 10;
+ <AE02> = 11;
+ <AE03> = 12;
+ <AE04> = 13;
+ <AE05> = 14;
+ <AE06> = 15;
+ <AE07> = 16;
+ <AE08> = 17;
+ <AE09> = 18;
+ <AE10> = 19;
+ <AE11> = 20;
+ <AE12> = 21;
+ <BKSP> = 23;
+
+ <TAB> = 24;
+ <AD01> = 25;
+ <AD02> = 26;
+ <AD03> = 27;
+ <AD04> = 28;
+ <AD05> = 29;
+ <AD06> = 30;
+ <AD07> = 31;
+ <AD08> = 32;
+ <AD09> = 33;
+ <AD10> = 34;
+ <AD11> = 35;
+ <AD12> = 36;
+ <BKSL> = 37;
+
+ <CAPS> = 38;
+ <AC01> = 39;
+ <AC02> = 40;
+ <AC03> = 41;
+ <AC04> = 42;
+ <AC05> = 43;
+ <AC06> = 44;
+ <AC07> = 45;
+ <AC08> = 46;
+ <AC09> = 47;
+ <AC10> = 48;
+ <AC11> = 49;
+ <RTRN> = 51;
+
+ <LFSH> = 52;
+ <AB01> = 54;
+ <AB02> = 55;
+ <AB03> = 56;
+ <AB04> = 57;
+ <AB05> = 58;
+ <AB06> = 59;
+ <AB07> = 60;
+ <AB08> = 61;
+ <AB09> = 62;
+ <AB10> = 63;
+ <RTSH> = 65;
+
+ <LCTL> = 66;
+ <LALT> = 68;
+ <SPCE> = 69;
+ <RALT> = 70;
+ <RCTL> = 72;
+
+ <ESC> = 118;
+ <FK01> = 120;
+ <FK02> = 121;
+ <FK03> = 122;
+ <FK04> = 123;
+ <FK05> = 124;
+ <FK06> = 125;
+ <FK07> = 126;
+ <FK08> = 127;
+ <FK09> = 128;
+ <FK10> = 129;
+ <FK11> = 130;
+ <FK12> = 131;
+
+ <PRSC> = 132;
+ <SCLK> = 133;
+ <PAUS> = 134;
+
+ <INS> = 83;
+ <HOME> = 88;
+ <PGUP> = 93;
+ <DELE> = 84;
+ <END> = 89;
+ <PGDN> = 94;
+
+ <UP> = 91;
+ <LEFT> = 87;
+ <DOWN> = 92;
+ <RGHT> = 97;
+
+ <NMLK> = 98;
+ <KPDV> = 103;
+ <KPMU> = 108;
+ <KPSU> = 113;
+
+ <KP7> = 99;
+ <KP8> = 104;
+ <KP9> = 109;
+ <KPAD> = 114;
+
+ <KP4> = 100;
+ <KP5> = 105;
+ <KP6> = 110;
+
+ <KP1> = 101;
+ <KP2> = 106;
+ <KP3> = 111;
+ <KPEN> = 116;
+
+ <KP0> = 107;
+ <KPDL> = 112;
+
+ indicator 1 = "Caps Lock";
+ indicator 2 = "Num Lock";
+ indicator 3 = "Scroll Lock";
+};
+xkb_keycodes "rs6k-102" {
+ include "ibm(rs6k-101)"
+ <LSGT> = 53;
+};
diff --git a/keycodes/macintosh b/keycodes/macintosh
new file mode 100644
index 0000000..5ed575c
--- /dev/null
+++ b/keycodes/macintosh
@@ -0,0 +1,161 @@
+// $XConsortium: macintosh /main/10 1996/01/24 12:17:35 kaleb $
+//
+//Copyright (c) 1996 X Consortium
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and/or sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the X Consortium shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from the X Consortium.
+//
+// $XFree86: xc/programs/xkbcomp/keycodes/macintosh,v 1.4 2001/10/02 19:57:00 alanh Exp $
+//
+default xkb_keycodes "macintosh" {
+
+ minimum= 8;
+ maximum= 134;
+
+ <ESC> = 61;
+ <TLDE> = 58;
+ <AE01> = 26;
+ <AE02> = 27;
+ <AE03> = 28;
+ <AE04> = 29;
+ <AE05> = 31;
+ <AE06> = 30;
+ <AE07> = 34;
+ <AE08> = 36;
+ <AE09> = 33;
+ <AE10> = 37;
+ <AE11> = 35;
+ <AE12> = 32;
+ <BKSP> = 59;
+
+ <TAB> = 56;
+ <AD01> = 20;
+ <AD02> = 21;
+ <AD03> = 22;
+ <AD04> = 23;
+ <AD05> = 25;
+ <AD06> = 24;
+ <AD07> = 40;
+ <AD08> = 42;
+ <AD09> = 39;
+ <AD10> = 43;
+ <AD11> = 41;
+ <AD12> = 38;
+ <BKSL> = 50;
+
+ <CAPS> = 65;
+ <AC01> = 8;
+ <AC02> = 9;
+ <AC03> = 10;
+ <AC04> = 11;
+ <AC05> = 13;
+ <AC06> = 12;
+ <AC07> = 46;
+ <AC08> = 48;
+ <AC09> = 45;
+ <AC10> = 49;
+ <AC11> = 47;
+ <RTRN> = 44;
+
+ <LSGT> = 18;
+ <AB01> = 14;
+ <AB02> = 15;
+ <AB03> = 16;
+ <AB04> = 17;
+ <AB05> = 19;
+ <AB06> = 53;
+ <AB07> = 54;
+ <AB08> = 51;
+ <AB09> = 55;
+ <AB10> = 52;
+
+ <SPCE> = 57;
+
+ <LCTL> = 62; // Left Control
+ <LALT> = 63; // Left Option
+ <LFSH> = 64; // Left Shift
+ <RALT> = 66; // Left Command
+// <RTSH> = 131; // Right Shift
+// <RALT> = 132; // Right Command
+// <RCTL> = 133; // Right Control
+// <RMTA> = 134; // Right Option
+
+ <FK01> = 130;
+ <FK02> = 128;
+ <FK03> = 107;
+ <FK04> = 126;
+ <FK05> = 104;
+ <FK06> = 105;
+ <FK07> = 106;
+ <FK08> = 108;
+ <FK09> = 109;
+ <FK10> = 117;
+ <FK11> = 111;
+ <FK12> = 119;
+
+ <PRSC> = 113;
+ <SCLK> = 115;
+ <PAUS> = 121;
+
+ <INS> = 122;
+ <HOME> = 123;
+ <PGUP> = 124;
+ <DELE> = 125;
+ <END> = 127;
+ <PGDN> = 129;
+
+ <UP> = 70;
+ <LEFT> = 67;
+ <DOWN> = 69;
+ <RGHT> = 68;
+
+ <NMLK> = 79;
+ <KPEQ> = 89;
+ <KPDV> = 83;
+ <KPMU> = 75;
+
+ <KP7> = 97;
+ <KP8> = 99;
+ <KP9> = 100;
+ <KPSU> = 86;
+
+ <KP4> = 94;
+ <KP5> = 95;
+ <KP6> = 96;
+ <KPAD> = 77;
+
+ <KP1> = 91;
+ <KP2> = 92;
+ <KP3> = 93;
+ <KPEN> = 84;
+
+ <KP0> = 90;
+ <KPDL> = 73;
+
+ indicator 3 = "Scroll Lock";
+ indicator 2 = "Num Lock";
+ indicator 1 = "Caps Lock";
+
+ alias <ALGR> = <RALT>;
+};
diff --git a/keycodes/powerpcps2 b/keycodes/powerpcps2
new file mode 100644
index 0000000..a607036
--- /dev/null
+++ b/keycodes/powerpcps2
@@ -0,0 +1,134 @@
+// $XConsortium: xfree86 /main/4 1996/08/31 12:16:59 kaleb $
+// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.3.2.1 1999/06/21 09:45:28 hohndel Exp $
+default xkb_keycodes "powerpcps2" {
+
+ minimum= 8;
+ maximum= 135;
+
+ <TLDE> = 49;
+ <AE01> = 10;
+ <AE02> = 11;
+ <AE03> = 12;
+ <AE04> = 13;
+ <AE05> = 14;
+ <AE06> = 15;
+ <AE07> = 16;
+ <AE08> = 17;
+ <AE09> = 18;
+ <AE10> = 19;
+ <AE11> = 20;
+ <AE12> = 21;
+ <BKSP> = 22;
+
+ <TAB> = 23;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 36;
+
+ <CAPS> = 66;
+ <AC01> = 38;
+ <AC02> = 39;
+ <AC03> = 40;
+ <AC04> = 41;
+ <AC05> = 42;
+ <AC06> = 43;
+ <AC07> = 44;
+ <AC08> = 45;
+ <AC09> = 46;
+ <AC10> = 47;
+ <AC11> = 48;
+
+ <LFSH> = 50;
+ <AB01> = 52;
+ <AB02> = 53;
+ <AB03> = 54;
+ <AB04> = 55;
+ <AB05> = 56;
+ <AB06> = 57;
+ <AB07> = 58;
+ <AB08> = 59;
+ <AB09> = 60;
+ <AB10> = 61;
+ <RTSH> = 62;
+ <BKSL> = 51;
+ <LSGT> = 94;
+
+ <LALT> = 64;
+ <LCTL> = 37;
+ <SPCE> = 65;
+ <RCTL> = 105;
+ <RALT> = 108;
+ // Microsoft keyboard extra keys
+ <LWIN> = 133;
+ <RWIN> = 134;
+ <MENU> = 135;
+
+ <ESC> = 9;
+ <FK01> = 67;
+ <FK02> = 68;
+ <FK03> = 69;
+ <FK04> = 70;
+ <FK05> = 71;
+ <FK06> = 72;
+ <FK07> = 73;
+ <FK08> = 74;
+ <FK09> = 75;
+ <FK10> = 76;
+ <FK11> = 95;
+ <FK12> = 96;
+
+ <PRSC> = 107;
+ <SCLK> = 78;
+ <PAUS> = 127;
+
+ <INS> = 118;
+ <HOME> = 110;
+ <PGUP> = 112;
+ <DELE> = 119;
+ <END> = 115;
+ <PGDN> = 117;
+
+ <UP> = 111;
+ <LEFT> = 113;
+ <DOWN> = 116;
+ <RGHT> = 114;
+
+ <NMLK> = 77;
+ <KPDV> = 106;
+ <KPMU> = 63;
+ <KPSU> = 82;
+
+ <KP7> = 79;
+ <KP8> = 80;
+ <KP9> = 81;
+ <KPAD> = 86;
+
+ <KP4> = 83;
+ <KP5> = 84;
+ <KP6> = 85;
+
+ <KP1> = 87;
+ <KP2> = 88;
+ <KP3> = 89;
+ <KPEN> = 104;
+
+ <KP0> = 90;
+ <KPDL> = 91;
+
+ indicator 1 = "Caps Lock";
+ indicator 2 = "Num Lock";
+ indicator 3 = "Scroll Lock";
+
+ alias <ALGR> = <RALT>;
+};
+
diff --git a/keycodes/sgi.vndr/indigo b/keycodes/sgi.vndr/indigo
new file mode 100644
index 0000000..df86802
--- /dev/null
+++ b/keycodes/sgi.vndr/indigo
@@ -0,0 +1,140 @@
+// $Xorg: indigo,v 1.3 2000/08/17 19:54:39 cpqbld Exp $
+default xkb_keycodes "pc101" {
+ minimum= 10;
+ maximum= 118;
+
+ <TLDE> = 62;
+ <AE01> = 15;
+ <AE02> = 21;
+ <AE03> = 22;
+ <AE04> = 29;
+ <AE05> = 30;
+ <AE06> = 37;
+ <AE07> = 38;
+ <AE08> = 45;
+ <AE09> = 46;
+ <AE10> = 53;
+ <AE11> = 54;
+ <AE12> = 61;
+ <BKSP> = 68;
+
+ <TAB> = 16;
+ <AD01> = 17;
+ <AD02> = 23;
+ <AD03> = 24;
+ <AD04> = 31;
+ <AD05> = 32;
+ <AD06> = 39;
+ <AD07> = 40;
+ <AD08> = 47;
+ <AD09> = 48;
+ <AD10> = 55;
+ <AD11> = 56;
+ <AD12> = 63;
+ <RTRN> = 58;
+
+ <CAPS> = 11;
+ <AC01> = 18;
+ <AC02> = 19;
+ <AC03> = 25;
+ <AC04> = 26;
+ <AC05> = 33;
+ <AC06> = 34;
+ <AC07> = 41;
+ <AC08> = 42;
+ <AC09> = 49;
+ <AC10> = 50;
+ <AC11> = 57;
+
+ <LFSH> = 13;
+ <AB01> = 27;
+ <AB02> = 28;
+ <AB03> = 35;
+ <AB04> = 36;
+ <AB05> = 43;
+ <AB06> = 44;
+ <AB07> = 51;
+ <AB08> = 52;
+ <AB09> = 59;
+ <AB10> = 60;
+ <RTSH> = 12;
+ <BKSL> = 64;
+
+ <LALT> = 91;
+ <LCTL> = 10;
+ <SPCE> = 90;
+ <RCTL> = 93;
+ <RALT> = 92;
+
+ <ESC> = 14;
+ <FK01> = 94;
+ <FK02> = 95;
+ <FK03> = 96;
+ <FK04> = 97;
+ <FK05> = 98;
+ <FK06> = 99;
+ <FK07> = 100;
+ <FK08> = 101;
+ <FK09> = 102;
+ <FK10> = 103;
+ <FK11> = 104;
+ <FK12> = 105;
+
+ <PRSC> = 106;
+ <SCLK> = 107;
+ <PAUS> = 108;
+
+ <INS> = 109;
+ <HOME> = 110;
+ <PGUP> = 111;
+ <DELE> = 69;
+ <END> = 112;
+ <PGDN> = 113;
+
+ <UP> = 88;
+ <LEFT> = 80;
+ <DOWN> = 81;
+ <RGHT> = 87;
+
+ <NMLK> = 114;
+ <KPDV> = 115;
+ <KPMU> = 116;
+ <KPSU> = 83;
+
+ <KP7> = 74;
+ <KP8> = 75;
+ <KP9> = 82;
+ <KPAD> = 117;
+
+ <KP4> = 70;
+ <KP5> = 76;
+ <KP6> = 77;
+
+ <KP1> = 65;
+ <KP2> = 71;
+ <KP3> = 72;
+ <KPEN> = 89;
+
+ <KP0> = 66;
+ <KPDL> = 73;
+
+ alias <AE00> = <TLDE>;
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+ alias <AA01> = <LALT>;
+ alias <AA09> = <RALT>;
+ alias <ALGR> = <RALT>;
+ alias <AA12> = <RCTL>;
+
+ virtual indicator 1 = "L1";
+ virtual indicator 2 = "L2";
+ virtual indicator 3 = "L3";
+ virtual indicator 4 = "L4";
+ indicator 5 = "Caps Lock";
+ indicator 6 = "Num Lock";
+ indicator 7 = "Scroll Lock";
+};
+xkb_keycodes "pc102" {
+ include "sgi/indigo(pc101)"
+ <LSGT> = 118;
+};
diff --git a/keycodes/sgi.vndr/indy b/keycodes/sgi.vndr/indy
new file mode 100644
index 0000000..f59609d
--- /dev/null
+++ b/keycodes/sgi.vndr/indy
@@ -0,0 +1,203 @@
+// $Xorg: indy,v 1.3 2000/08/17 19:54:39 cpqbld Exp $
+default xkb_keycodes "universal" {
+ minimum= 15;
+ maximum= 149;
+ include "sgi/indy(pc105)"
+ alternate <BKSL> = 91;
+ alternate <BKSL> = 100;
+ alternate <BKSL> = 101;
+};
+xkb_keycodes "pc101" {
+ minimum= 15;
+ maximum= 149;
+
+ <TLDE> = 22;
+ <AE01> = 30;
+ <AE02> = 38;
+ <AE03> = 46;
+ <AE04> = 45;
+ <AE05> = 54;
+ <AE06> = 62;
+ <AE07> = 69;
+ <AE08> = 70;
+ <AE09> = 78;
+ <AE10> = 77;
+ <AE11> = 86;
+ <AE12> = 93;
+ <BKSP> = 110;
+
+ <TAB> = 21;
+ <AD01> = 29;
+ <AD02> = 37;
+ <AD03> = 44;
+ <AD04> = 53;
+ <AD05> = 52;
+ <AD06> = 61;
+ <AD07> = 68;
+ <AD08> = 75;
+ <AD09> = 76;
+ <AD10> = 85;
+ <AD11> = 92;
+ <AD12> = 99;
+ <RTRN> = 98;
+
+ <CAPS> = 28;
+ <AC01> = 36;
+ <AC02> = 35;
+ <AC03> = 43;
+ <AC04> = 51;
+ <AC05> = 60;
+ <AC06> = 59;
+ <AC07> = 67;
+ <AC08> = 74;
+ <AC09> = 83;
+ <AC10> = 84;
+ <AC11> = 90;
+
+ <LFSH> = 26;
+ <AB01> = 34;
+ <AB02> = 42;
+ <AB03> = 41;
+ <AB04> = 50;
+ <AB05> = 58;
+ <AB06> = 57;
+ <AB07> = 66;
+ <AB08> = 73;
+ <AB09> = 81;
+ <AB10> = 82;
+ <RTSH> = 97;
+ <BKSL> = 100;
+
+ <LALT> = 33;
+ <LCTL> = 25;
+ <SPCE> = 49;
+ <RCTL> = 96;
+ <RALT> = 65;
+
+ <ESC> = 16;
+ <FK01> = 15;
+ <FK02> = 23;
+ <FK03> = 31;
+ <FK04> = 39;
+ <FK05> = 47;
+ <FK06> = 55;
+ <FK07> = 63;
+ <FK08> = 71;
+ <FK09> = 79;
+ <FK10> = 87;
+ <FK11> = 94;
+ <FK12> = 102;
+
+ <PRSC> = 95;
+ <SCLK> = 103;
+ <PAUS> = 106;
+
+ <INS> = 111;
+ <HOME> = 118;
+ <PGUP> = 119;
+ <DELE> = 108;
+ <END> = 109;
+ <PGDN> = 117;
+
+ <UP> = 107;
+ <LEFT> = 105;
+ <DOWN> = 104;
+ <RGHT> = 114;
+
+ <NMLK> = 126;
+ <KPDV> = 127;
+ <KPMU> = 134;
+ <KPSU> = 140;
+
+ <KP7> = 116;
+ <KP8> = 125;
+ <KP9> = 133;
+ <KPAD> = 132;
+
+ <KP4> = 115;
+ <KP5> = 123;
+ <KP6> = 124;
+
+ <KP1> = 113;
+ <KP2> = 122;
+ <KP3> = 130;
+ <KPEN> = 129;
+
+ <KP0> = 120;
+ <KPDL> = 121;
+
+ alias <AE00> = <TLDE>;
+ alias <AC00> = <CAPS>;
+ alias <AA00> = <LCTL>;
+ alias <AA01> = <LALT>;
+ alias <AA09> = <RALT>;
+ alias <ALGR> = <RALT>;
+ alias <AA12> = <RCTL>;
+
+ virtual indicator 1 = "L1";
+ virtual indicator 2 = "L2";
+ virtual indicator 3 = "L3";
+ virtual indicator 4 = "L4";
+ indicator 5 = "Caps Lock";
+ indicator 6 = "Num Lock";
+ indicator 7 = "Scroll Lock";
+
+};
+xkb_keycodes "pc102" {
+ <BKSL> = 91;
+ <LSGT> = 27;
+ augment "sgi/indy(pc101)"
+ maximum= 149;
+ minimum= 15;
+};
+xkb_keycodes "pc104" {
+ include "sgi/indy(pc101)"
+ minimum= 15;
+ maximum= 149;
+
+ // These key names are here to support so-called "Windows95"
+ // keyboards like the Microsoft Natural keyboard.
+ <LWIN> = 147;
+ <RWIN> = 148;
+ <MENU> = 149;
+};
+xkb_keycodes "pc105" {
+ <LSGT> = 27;
+ augment "sgi/indy(pc104)"
+ minimum= 15;
+ maximum= 149;
+};
+xkb_keycodes "jp106" {
+ <HZTG> = 22;
+ <AB11> = 89;
+ <AC12> = 91;
+ <NFER> = 141;
+ <XFER> = 142;
+ <HKTG> = 143;
+ alias <TLDE> = <HZTG>;
+ alias <AE00> = <HZTG>;
+ alias <AE13> = <BKSL>;
+ augment "sgi/indy(pc101)"
+ minimum= 15;
+ maximum= 149;
+};
+// can be combined with any other "indy" keycode
+// description to add virtual keys which can be
+// used to implement an overlay-based numeric
+// keypad.
+partial hidden xkb_keycodes "overlayKeypad" {
+ <KO7> = 17;
+ <KO8> = 18;
+ <KO9> = 19;
+ <KO6> = 146;
+ <KO5> = 145;
+ <KO4> = 144;
+ <KO1> = 136;
+ <KO2> = 137;
+ <KO3> = 138;
+ <KO0> = 135;
+ <KODL> = 139;
+};
+partial hidden xkb_keycodes "shiftLock" {
+ indicator 5 = "Shift Lock";
+};
diff --git a/keycodes/sgi.vndr/iris b/keycodes/sgi.vndr/iris
new file mode 100644
index 0000000..30375e9
--- /dev/null
+++ b/keycodes/sgi.vndr/iris
@@ -0,0 +1,11 @@
+// $Xorg: iris,v 1.3 2000/08/17 19:54:39 cpqbld Exp $
+default xkb_keycodes "iris" {
+ include "sgi/indigo(pc101)"
+ indicator 1 = "L1";
+ indicator 2 = "L2";
+ indicator 3 = "L3";
+ indicator 4 = "L4";
+ indicator 5 = "Caps Lock";
+ indicator 6 = "Num Lock";
+ indicator 7 = "Scroll Lock";
+};
diff --git a/keycodes/sony b/keycodes/sony
new file mode 100644
index 0000000..0e720b4
--- /dev/null
+++ b/keycodes/sony
@@ -0,0 +1,142 @@
+// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+xkb_keycodes "nwp5461" {
+
+ <ESC> = 18;
+ <AE01> = 19;
+ <AE02> = 20;
+ <AE03> = 21;
+ <AE04> = 22;
+ <AE05> = 23;
+ <AE06> = 24;
+ <AE07> = 25;
+ <AE08> = 26;
+ <AE09> = 27;
+ <AE10> = 28;
+ <AE11> = 29;
+ <AE12> = 30;
+ <BKSL> = 31;
+ <BKSP> = 32;
+
+ <TAB> = 33;
+ <AD01> = 34;
+ <AD02> = 35;
+ <AD03> = 36;
+ <AD04> = 37;
+ <AD05> = 38;
+ <AD06> = 39;
+ <AD07> = 40;
+ <AD08> = 41;
+ <AD09> = 42;
+ <AD10> = 43;
+ <AD11> = 44;
+ <AD12> = 45;
+ <DELE> = 46;
+
+ <LCTL> = 47;
+ <AC01> = 48;
+ <AC02> = 49;
+ <AC03> = 50;
+ <AC04> = 51;
+ <AC05> = 52;
+ <AC06> = 53;
+ <AC07> = 54;
+ <AC08> = 55;
+ <AC09> = 56;
+ <AC10> = 57;
+ <AC11> = 58;
+ <TLDE> = 59;
+ <RTRN> = 60;
+
+ <LFSH> = 61;
+ <AB01> = 62;
+ <AB02> = 63;
+ <AB03> = 64;
+ <AB04> = 65;
+ <AB05> = 66;
+ <AB06> = 67;
+ <AB07> = 68;
+ <AB08> = 69;
+ <AB09> = 70;
+ <AB10> = 71;
+ <AB11> = 72;
+ <RTSH> = 73;
+
+ <LALT> = 74;
+ <CAPS> = 75;
+ <STOP> = 76;
+ <SPCE> = 77;
+ <CUT> = 78;
+ <EXEC> = 81;
+
+ <FK01> = 8;
+ <FK02> = 9;
+ <FK03> = 10;
+ <FK04> = 11;
+ <FK05> = 12;
+ <FK06> = 13;
+ <FK07> = 14;
+ <FK08> = 15;
+ <FK09> = 16;
+ <FK10> = 17;
+ <FK11> = 111;
+ <FK12> = 112;
+
+ <HELP> = 113;
+ <INS> = 114;
+ <CLR> = 115;
+ <PGUP> = 116;
+ <PGDN> = 117;
+
+ <KPTB> = 109;
+ <UP> = 95;
+ <LEFT> = 98;
+ <DOWN> = 99;
+ <RGHT> = 100;
+
+ <KPMU> = 107;
+ <KPDV> = 108;
+ <KPAD> = 89;
+
+ <KP7> = 82;
+ <KP8> = 83;
+ <KP9> = 84;
+ <KPSU> = 85;
+
+ <KP4> = 86;
+ <KP5> = 87;
+ <KP6> = 88;
+ <KPSP> = 93;
+
+ <KP1> = 90;
+ <KP2> = 91;
+ <KP3> = 92;
+ <KPEN> = 97;
+
+ <KP0> = 94;
+ <KPDC> = 96;
+};
diff --git a/keycodes/sun b/keycodes/sun
new file mode 100644
index 0000000..a74411a
--- /dev/null
+++ b/keycodes/sun
@@ -0,0 +1,819 @@
+// $Xorg: sun,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keycodes/sun,v 3.5 2001/12/14 20:02:00 dawes Exp $
+//
+default xkb_keycodes "type4" {
+
+ minimum= 8;
+ maximum= 132;
+
+ <ESC> = 36;
+ <AE01> = 37;
+ <AE02> = 38;
+ <AE03> = 39;
+ <AE04> = 40;
+ <AE05> = 41;
+ <AE06> = 42;
+ <AE07> = 43;
+ <AE08> = 44;
+ <AE09> = 45;
+ <AE10> = 46;
+ <AE11> = 47;
+ <AE12> = 48;
+ <TLDE> = 49;
+ <BKSP> = 50;
+
+ <TAB> = 60;
+ <AD01> = 61;
+ <AD02> = 62;
+ <AD03> = 63;
+ <AD04> = 64;
+ <AD05> = 65;
+ <AD06> = 66;
+ <AD07> = 67;
+ <AD08> = 68;
+ <AD09> = 69;
+ <AD10> = 70;
+ <AD11> = 71;
+ <AD12> = 72;
+ <DELE> = 73;
+
+ <LCTL> = 83;
+ <AC01> = 84;
+ <AC02> = 85;
+ <AC03> = 86;
+ <AC04> = 87;
+ <AC05> = 88;
+ <AC06> = 89;
+ <AC07> = 90;
+ <AC08> = 91;
+ <AC09> = 92;
+ <AC10> = 93;
+ <AC11> = 94;
+ <BKSL> = 95;
+ <RTRN> = 96;
+
+ <LFSH> = 106;
+ <AB01> = 107;
+ <AB02> = 108;
+ <AB03> = 109;
+ <AB04> = 110;
+ <AB05> = 111;
+ <AB06> = 112;
+ <AB07> = 113;
+ <AB08> = 114;
+ <AB09> = 115;
+ <AB10> = 116;
+ <RTSH> = 117;
+ <LNFD> = 118;
+
+ <HELP> = 125;
+ <CAPS> = 126;
+ <LALT> = 26;
+ <LMTA> = 127;
+ <SPCE> = 128;
+ <RMTA> = 129;
+ <COMP> = 74;
+ <ALGR> = 20;
+ alias <RALT> = <ALGR>;
+
+ <FK01> = 12;
+ <FK02> = 13;
+ <FK03> = 15;
+ <FK04> = 17;
+ <FK05> = 19;
+ <FK06> = 21;
+ <FK07> = 23;
+ <FK08> = 24;
+ <FK09> = 25;
+ <FK10> = 14;
+ <FK11> = 16;
+ <FK12> = 18;
+
+ <STOP> = 8;
+ <AGAI> = 10;
+ <PROP> = 32;
+ <UNDO> = 33;
+ <FRNT> = 56;
+ <COPY> = 58;
+ <OPEN> = 79;
+ <PAST> = 80;
+ <FIND> = 102;
+ <CUT> = 104;
+
+ <PRSC> = 29;
+ <SCLK> = 30;
+ <PAUS> = 28;
+
+ <NMLK> = 105;
+ <KPEQ> = 52;
+ <KPDV> = 53;
+ <KPMU> = 54;
+ <KPSU> = 78;
+
+ <KP7> = 75;
+ <KP8> = 76;
+ <KP9> = 77;
+ <KPAD> = 132;
+
+ <KP4> = 98;
+ <KP5> = 99;
+ <KP6> = 100;
+
+ <KP1> = 119;
+ <KP2> = 120;
+ <KP3> = 121;
+ <KPEN> = 97;
+
+ <KP0> = 101;
+ <KPDL> = 57;
+ indicator 4 = "Caps Lock";
+ indicator 3 = "Compose";
+ indicator 2 = "Scroll Lock";
+ indicator 1 = "Num Lock";
+};
+
+xkb_keycodes "type5" {
+
+ minimum= 8;
+ maximum= 132;
+
+ <ESC> = 36;
+ <AE01> = 37;
+ <AE02> = 38;
+ <AE03> = 39;
+ <AE04> = 40;
+ <AE05> = 41;
+ <AE06> = 42;
+ <AE07> = 43;
+ <AE08> = 44;
+ <AE09> = 45;
+ <AE10> = 46;
+ <AE11> = 47;
+ <AE12> = 48;
+ <TLDE> = 49;
+ <BKSP> = 50;
+
+ <TAB> = 60;
+ <AD01> = 61;
+ <AD02> = 62;
+ <AD03> = 63;
+ <AD04> = 64;
+ <AD05> = 65;
+ <AD06> = 66;
+ <AD07> = 67;
+ <AD08> = 68;
+ <AD09> = 69;
+ <AD10> = 70;
+ <AD11> = 71;
+ <AD12> = 72;
+ <DELE> = 73;
+ <COMP> = 74;
+ <ALGR> = 20;
+ alias <RALT> = <ALGR>;
+
+ <LCTL> = 83;
+ <AC01> = 84;
+ <AC02> = 85;
+ <AC03> = 86;
+ <AC04> = 87;
+ <AC05> = 88;
+ <AC06> = 89;
+ <AC07> = 90;
+ <AC08> = 91;
+ <AC09> = 92;
+ <AC10> = 93;
+ <AC11> = 94;
+ <BKSL> = 95;
+ <RTRN> = 96;
+
+ <LFSH> = 106;
+ <AB01> = 107;
+ <AB02> = 108;
+ <AB03> = 109;
+ <AB04> = 110;
+ <AB05> = 111;
+ <AB06> = 112;
+ <AB07> = 113;
+ <AB08> = 114;
+ <AB09> = 115;
+ <AB10> = 116;
+ <RTSH> = 117;
+
+ <LALT> = 26;
+ <CAPS> = 126;
+ <LMTA> = 127;
+ <SPCE> = 128;
+ <RMTA> = 129;
+
+ <FK01> = 12;
+ <FK02> = 13;
+ <FK03> = 15;
+ <FK04> = 17;
+ <FK05> = 19;
+ <FK06> = 21;
+ <FK07> = 23;
+ <FK08> = 24;
+ <FK09> = 25;
+ <FK10> = 14;
+ <FK11> = 16;
+ <FK12> = 18;
+ <STOP> = 8;
+ <AGAI> = 10;
+ <PROP> = 32;
+ <UNDO> = 33;
+ <FRNT> = 56;
+ <COPY> = 58;
+ <OPEN> = 79;
+ <PAST> = 80;
+ <FIND> = 102;
+ <CUT> = 104;
+
+ <PRSC> = 29;
+ <SCLK> = 30;
+ <PAUS> = 28;
+
+ <NMLK> = 105;
+ <KPDV> = 53;
+ <KPMU> = 54;
+ <KPSU> = 78;
+
+ <KP7> = 75;
+ <KP8> = 76;
+ <KP9> = 77;
+ <KPAD> = 132;
+
+ <KP4> = 98;
+ <KP5> = 99;
+ <KP6> = 100;
+
+ <KP1> = 119;
+ <KP2> = 120;
+ <KP3> = 121;
+ <KPEN> = 97;
+
+ <KP0> = 101;
+ <KPDL> = 57;
+
+ <UP> = 27;
+ <LEFT> = 31;
+ <DOWN> = 34;
+ <RGHT> = 35;
+
+ <INS> = 51;
+ <HOME> = 59;
+ <END> = 81;
+ <PGUP> = 103;
+ <PGDN> = 130;
+ <HELP> = 125;
+
+ <MUTE> = 52;
+ <VOL-> = 9;
+ <VOL+> = 11;
+ <POWR> = 55;
+ indicator 4 = "Caps Lock";
+ indicator 3 = "Compose";
+ indicator 2 = "Scroll Lock";
+ indicator 1 = "Num Lock";
+};
+
+xkb_keycodes "type6" {
+ minimum= 8;
+ maximum= 255;
+
+ <TLDE> = 49;
+ <AE01> = 10;
+ <AE02> = 11;
+ <AE03> = 12;
+ <AE04> = 13;
+ <AE05> = 14;
+ <AE06> = 15;
+ <AE07> = 16;
+ <AE08> = 17;
+ <AE09> = 18;
+ <AE10> = 19;
+ <AE11> = 20;
+ <AE12> = 21;
+ <BKSP> = 22;
+
+ <TAB> = 23;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 36;
+
+ <CAPS> = 66;
+ <AC01> = 38;
+ <AC02> = 39;
+ <AC03> = 40;
+ <AC04> = 41;
+ <AC05> = 42;
+ <AC06> = 43;
+ <AC07> = 44;
+ <AC08> = 45;
+ <AC09> = 46;
+ <AC10> = 47;
+ <AC11> = 48;
+
+ <LFSH> = 50;
+ <AB01> = 52;
+ <AB02> = 53;
+ <AB03> = 54;
+ <AB04> = 55;
+ <AB05> = 56;
+ <AB06> = 57;
+ <AB07> = 58;
+ <AB08> = 59;
+ <AB09> = 60;
+ <AB10> = 61;
+ <RTSH> = 62;
+ <BKSL> = 51;
+
+ <LALT> = 64;
+ <LCTL> = 37;
+ <SPCE> = 65;
+ <ALGR> = 113;
+ alias <RALT> = <ALGR>;
+
+ <LMTA> = 115;
+ <RMTA> = 116;
+ <COMP> = 117;
+
+ <ESC> = 9;
+ <FK01> = 67;
+ <FK02> = 68;
+ <FK03> = 69;
+ <FK04> = 70;
+ <FK05> = 71;
+ <FK06> = 72;
+ <FK07> = 73;
+ <FK08> = 74;
+ <FK09> = 75;
+ <FK10> = 76;
+ <FK11> = 95;
+ <FK12> = 96;
+
+ <PRSC> = 111;
+ <SCLK> = 78;
+ <PAUS> = 110;
+
+ <INS> = 106;
+ <HOME> = 97;
+ <PGUP> = 99;
+ <DELE> = 107;
+ <END> = 103;
+ <PGDN> = 105;
+
+ <UP> = 98;
+ <LEFT> = 100;
+ <DOWN> = 104;
+ <RGHT> = 102;
+
+ <NMLK> = 77;
+ <KPDV> = 112;
+ <KPMU> = 63;
+ <KPSU> = 82;
+
+ <KP7> = 79;
+ <KP8> = 80;
+ <KP9> = 81;
+ <KPAD> = 86;
+
+ <KP4> = 83;
+ <KP5> = 84;
+ <KP6> = 85;
+
+ <KP1> = 87;
+ <KP2> = 88;
+ <KP3> = 89;
+ <KPEN> = 108;
+
+ <KP0> = 90;
+ <KPDL> = 91;
+
+ <STOP> = 222;
+ <AGAI> = 223;
+ <PROP> = 224;
+ <UNDO> = 225;
+ <FRNT> = 226;
+ <COPY> = 227;
+ <OPEN> = 228;
+ <PAST> = 229;
+ <FIND> = 230;
+ <CUT> = 231;
+
+ <HELP> = 232;
+
+ <MUTE> = 165;
+ <VOL-> = 159;
+ <VOL+> = 158;
+ <POWR> = 160;
+
+ indicator 1 = "Caps Lock";
+ indicator 2 = "Num Lock";
+ indicator 3 = "Scroll Lock";
+};
+
+xkb_keycodes "type4_euro" {
+ include "sun(type4)"
+ <LSGT> = 131;
+};
+
+xkb_keycodes "type5_euro" {
+ include "sun(type5)"
+ <LSGT> = 131;
+};
+
+xkb_keycodes "type6_euro" {
+ include "sun(type6)"
+ <LSGT> = 94;
+};
+
+xkb_keycodes "type5_se" {
+
+ minimum= 8;
+ maximum= 132;
+
+ // Row G
+ <HELP> = 125;
+ //
+ <ESC> = 36;
+ //
+ <FK01> = 12;
+ <FK02> = 13;
+ <FK03> = 15;
+ <FK04> = 17;
+ //
+ <FK05> = 19;
+ <FK06> = 21;
+ <FK07> = 23;
+ <FK08> = 24;
+ //
+ <FK09> = 25;
+ <FK10> = 14;
+ <FK11> = 16;
+ <FK12> = 18;
+ //
+ <PRSC> = 29;
+ <SCLK> = 30;
+ <PAUS> = 28;
+ //
+ <MUTE> = 52;
+ <VOL-> = 9;
+ <VOL+> = 11;
+ <POWR> = 55;
+ // End Row G
+
+ // Row F
+ //
+ // End Row F
+
+ // Row E
+ <STOP> = 8;
+ <AGAI> = 10;
+ //
+ <AE00> = 49;
+ alias <TLDE> = <AE00>;
+ <AE01> = 37;
+ <AE02> = 38;
+ <AE03> = 39;
+ <AE04> = 40;
+ <AE05> = 41;
+ <AE06> = 42;
+ <AE07> = 43;
+ <AE08> = 44;
+ <AE09> = 45;
+ <AE10> = 46;
+ <AE11> = 47;
+ <AE12> = 48;
+ <BKSP> = 50;
+ //
+ <INS> = 51;
+ <HOME> = 59;
+ <PGUP> = 103;
+ //
+ <NMLK> = 105;
+ <KPDV> = 53;
+ <KPMU> = 54;
+ <KPSU> = 78;
+ //End Row E
+
+ // Row D
+ <PROP> = 32;
+ <UNDO> = 33;
+ //
+ <AD00> = 60;
+ alias <TAB> = <AD00>;
+ <AD01> = 61;
+ <AD02> = 62;
+ <AD03> = 63;
+ <AD04> = 64;
+ <AD05> = 65;
+ <AD06> = 66;
+ <AD07> = 67;
+ <AD08> = 68;
+ <AD09> = 69;
+ <AD10> = 70;
+ <AD11> = 71;
+ <AD12> = 72;
+ //
+ <DELE> = 73;
+ <END> = 81;
+ <PGDN> = 130;
+ //
+ <KP7> = 75;
+ <KP8> = 76;
+ <KP9> = 77;
+ <KPAD> = 132;
+ // End Row D
+
+ // Row C
+ <FRNT> = 56;
+ <COPY> = 58;
+ //
+ <AC00> = 126;
+ alias <CAPS> = <AC00>;
+ <AC01> = 84;
+ <AC02> = 85;
+ <AC03> = 86;
+ <AC04> = 87;
+ <AC05> = 88;
+ <AC06> = 89;
+ <AC07> = 90;
+ <AC08> = 91;
+ <AC09> = 92;
+ <AC10> = 93;
+ <AC11> = 94;
+ <AC12> = 95;
+ alias <BKSL> = <AC12>;
+ <RTRN> = 96;
+ //
+ <KP4> = 98;
+ <KP5> = 99;
+ <KP6> = 100;
+ // End Row C
+
+ // Row B
+ <OPEN> = 79;
+ <PAST> = 80;
+ //
+ <LFSH> = 106;
+ <AB00> = 131;
+ alias <LSGT> = <AB00>;
+ <AB01> = 107;
+ <AB02> = 108;
+ <AB03> = 109;
+ <AB04> = 110;
+ <AB05> = 111;
+ <AB06> = 112;
+ <AB07> = 113;
+ <AB08> = 114;
+ <AB09> = 115;
+ <AB10> = 116;
+ <RTSH> = 117;
+ //
+ <UP> = 27;
+ //
+ <KP1> = 119;
+ <KP2> = 120;
+ <KP3> = 121;
+ <KPEN> = 97;
+ // End Row B
+
+ // Row A
+ <FIND> = 102;
+ <CUT> = 104;
+ //
+ <LCTL> = 83;
+ <LALT> = 26;
+ <LMTA> = 127;
+ <SPCE> = 128;
+ <RMTA> = 129;
+ <COMP> = 74;
+ <ALGR> = 20;
+ alias <RALT> = <ALGR>;
+ //
+ <LEFT> = 31;
+ <DOWN> = 34;
+ <RGHT> = 35;
+ //
+ <KP0> = 101;
+ <KPDL> = 57;
+ // End Row A
+
+ indicator 4 = "Caps Lock";
+ indicator 3 = "Compose";
+ indicator 2 = "Scroll Lock";
+ indicator 1 = "Num Lock";
+};
+
+xkb_keycodes "type5c_se" {
+ include "sun(type5_se)"
+};
+
+xkb_keycodes "type4__se" {
+
+ minimum= 8;
+ maximum= 132;
+
+ // Row F
+ <STOP> = 8;
+ <AGAI> = 10;
+ //
+ <FK01> = 12;
+ <FK02> = 13;
+ <FK03> = 15;
+ <FK04> = 17;
+ <FK05> = 19;
+ <FK06> = 21;
+ <FK07> = 23;
+ <FK08> = 24;
+ <FK09> = 25;
+ <FK10> = 14;
+ <FK11> = 16;
+ <FK12> = 18;
+ <AF13> = 95;
+ alias <TLDE> = <AF13>;
+ <AF14> = 22;
+ <DELE> = 73;
+ //
+ <PAUS> = 28;
+ <PRSC> = 29;
+ <SCLK> = 30;
+ <NMLK> = 105;
+ // End Row F
+
+ // Row E
+ <PROP> = 32;
+ <UNDO> = 33;
+ //
+ <AE00> = 36;
+ alias <ESC> = <AE00>;
+ <AE01> = 37;
+ <AE02> = 38;
+ <AE03> = 39;
+ <AE04> = 40;
+ <AE05> = 41;
+ <AE06> = 42;
+ <AE07> = 43;
+ <AE08> = 44;
+ <AE09> = 45;
+ <AE10> = 46;
+ <AE11> = 47;
+ <AE12> = 48;
+ <BKSP> = 50;
+ //
+ <KPEQ> = 52;
+ <KPDV> = 53;
+ <KPMU> = 54;
+ <KPSU> = 78;
+ // End Row E
+
+ // Row D
+ <FRNT> = 56;
+ <COPY> = 58;
+ //
+ <AD00> = 60;
+ alias <TAB> = <AD00>;
+ <AD01> = 61;
+ <AD02> = 62;
+ <AD03> = 63;
+ <AD04> = 64;
+ <AD05> = 65;
+ <AD06> = 66;
+ <AD07> = 67;
+ <AD08> = 68;
+ <AD09> = 69;
+ <AD10> = 70;
+ <AD11> = 71;
+ <AD12> = 72;
+ //
+ <KP7> = 75;
+ <KP8> = 76;
+ <KP9> = 77;
+ <KPAD> = 132;
+ // End Row D
+
+ // Row C
+ <OPEN> = 79;
+ <PAST> = 80;
+ //
+ <AC00> = 83;
+ // alias <CAPS> = <AC00>;
+ <AC01> = 84;
+ <AC02> = 85;
+ <AC03> = 86;
+ <AC04> = 87;
+ <AC05> = 88;
+ <AC06> = 89;
+ <AC07> = 90;
+ <AC08> = 91;
+ <AC09> = 92;
+ <AC10> = 93;
+ <AC11> = 94;
+ <AC12> = 49;
+ alias <BKSL> = <AC12>;
+ <RTRN> = 96;
+ //
+ <KP4> = 98;
+ <KP5> = 99;
+ <KP6> = 100;
+ // End Row C
+
+ // Row B
+ <FIND> = 102;
+ <CUT> = 104;
+ //
+ <LFSH> = 106;
+ <AB00> = 131;
+ alias <LSGT> = <AB00>;
+ <AB01> = 107;
+ <AB02> = 108;
+ <AB03> = 109;
+ <AB04> = 110;
+ <AB05> = 111;
+ <AB06> = 112;
+ <AB07> = 113;
+ <AB08> = 114;
+ <AB09> = 115;
+ <AB10> = 116;
+ <RTSH> = 117;
+ <LNFD> = 118;
+ //
+ <KP1> = 119;
+ <KP2> = 120;
+ <KP3> = 121;
+ <KPEN> = 97;
+ // End Row B
+
+ // Row A
+ <HELP> = 125;
+ //
+ <AA00> = 126;
+ // alias <LCTL> = <AA00>;
+ <LALT> = 26;
+ <LMTA> = 127;
+ <SPCE> = 128;
+ <RMTA> = 129;
+ <COMP> = 74;
+ <ALGR> = 20;
+ alias <RALT> = <ALGR>;
+ //
+ <KP0> = 101;
+ <KPDL> = 57;
+ // End Row A
+
+ indicator 4 = "Caps Lock";
+ indicator 3 = "Compose";
+ indicator 2 = "Scroll Lock";
+ indicator 1 = "Num Lock";
+};
+
+xkb_keycodes "type4_se" {
+
+ include "sun(type4__se)"
+
+ alias <LCTL> = <AA00>;
+ alias <CAPS> = <AC00>;
+};
+
+xkb_keycodes "type4_se_swapctl" {
+
+ include "sun(type4__se)"
+
+ alias <LCTL> = <AC00>;
+ alias <CAPS> = <AA00>;
+};
diff --git a/keycodes/xfree86 b/keycodes/xfree86
new file mode 100644
index 0000000..6b1387a
--- /dev/null
+++ b/keycodes/xfree86
@@ -0,0 +1,415 @@
+// $XdotOrg: xc/programs/xkbcomp/keycodes/xfree86,v 1.1.4.4 2004/03/05 13:41:30 eich Exp $
+// $Xorg: xfree86,v 1.3 2000/08/17 19:54:37 cpqbld Exp $
+
+
+
+
+// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.28 2003/11/21 04:46:42 dawes Exp $
+
+// "standard" XFree86 codes
+// It seems that the "default" must be the first entry in the file.
+
+default xkb_keycodes "xfree86" {
+ include "xfree86(basic)"
+ <BKSL> = 51;
+ <LSGT> = 94;
+};
+
+xkb_keycodes "basic" {
+
+ minimum= 8;
+ maximum= 255;
+
+ <TLDE> = 49;
+ <AE01> = 10;
+ <AE02> = 11;
+ <AE03> = 12;
+ <AE04> = 13;
+ <AE05> = 14;
+ <AE06> = 15;
+ <AE07> = 16;
+ <AE08> = 17;
+ <AE09> = 18;
+ <AE10> = 19;
+ <AE11> = 20;
+ <AE12> = 21;
+ <BKSP> = 22;
+
+ <TAB> = 23;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 36;
+
+ <CAPS> = 66;
+ <AC01> = 38;
+ <AC02> = 39;
+ <AC03> = 40;
+ <AC04> = 41;
+ <AC05> = 42;
+ <AC06> = 43;
+ <AC07> = 44;
+ <AC08> = 45;
+ <AC09> = 46;
+ <AC10> = 47;
+ <AC11> = 48;
+
+ <LFSH> = 50;
+ <AB01> = 52;
+ <AB02> = 53;
+ <AB03> = 54;
+ <AB04> = 55;
+ <AB05> = 56;
+ <AB06> = 57;
+ <AB07> = 58;
+ <AB08> = 59;
+ <AB09> = 60;
+ <AB10> = 61;
+ <RTSH> = 62;
+
+ <LALT> = 64;
+ <LCTL> = 37;
+ <SPCE> = 65;
+ <RCTL> = 109;
+ <RALT> = 113;
+ // Microsoft keyboard extra keys
+ <LWIN> = 115;
+ <RWIN> = 116;
+ <MENU> = 117;
+
+ <ESC> = 9;
+ <FK01> = 67;
+ <FK02> = 68;
+ <FK03> = 69;
+ <FK04> = 70;
+ <FK05> = 71;
+ <FK06> = 72;
+ <FK07> = 73;
+ <FK08> = 74;
+ <FK09> = 75;
+ <FK10> = 76;
+ <FK11> = 95;
+ <FK12> = 96;
+
+ <PRSC> = 111;
+ <SYRQ> = 92;
+ <SCLK> = 78;
+ <PAUS> = 110;
+ <BRK> = 114;
+
+ <INS> = 106;
+ <HOME> = 97;
+ <PGUP> = 99;
+ <DELE> = 107;
+ <END> = 103;
+ <PGDN> = 105;
+
+ <UP> = 98;
+ <LEFT> = 100;
+ <DOWN> = 104;
+ <RGHT> = 102;
+
+ <NMLK> = 77;
+ <KPDV> = 112;
+ <KPMU> = 63;
+ <KPSU> = 82;
+
+ <KP7> = 79;
+ <KP8> = 80;
+ <KP9> = 81;
+ <KPAD> = 86;
+
+ <KP4> = 83;
+ <KP5> = 84;
+ <KP6> = 85;
+
+ <KP1> = 87;
+ <KP2> = 88;
+ <KP3> = 89;
+ <KPEN> = 108;
+
+ <KP0> = 90;
+ <KPDL> = 91;
+ <KPEQ> = 126;
+
+ <FK13> = 118;
+ <FK14> = 119;
+ <FK15> = 120;
+ <FK16> = 121;
+ <FK17> = 122;
+ <KPDC> = 123;
+
+ // Keys that are generated on Japanese keyboards
+
+ alias <HZTG> = <TLDE>; // Hankaku_Zenkaku toggle
+ <HKTG> = 208; // Hiragana_Katakana toggle
+ <AB11> = 211; // backslash/underscore
+ <XFER> = 129; // Henkan
+ <NFER> = 131; // Muhenkan
+ <AE13> = 133; // Yen
+
+ // Keys that are generated on Korean keyboards
+
+ alias <HNGL> = <FK16>; // Hangul Latin toggle
+ alias <HJCV> = <FK17>; // Hangul to Hanja conversion
+
+ // Extended keys that may be generated on "Internet" keyboards.
+ // These are not standardised, hence the meaningless names.
+ // The entries commented out are never generated because the raw codes
+ // in those positions are already used for well-defined keys.
+
+ alias <I01> = <XFER>;
+ <I02> = 130;
+ alias <I03> = <NFER>;
+ <I04> = 132;
+ alias <I05> = <AE13>;
+ <I06> = 134;
+ <I07> = 135;
+ <I08> = 136;
+ <I09> = 137;
+ <I0A> = 138;
+ <I0B> = 139;
+ <I0C> = 140;
+ <I0D> = 141;
+ <I0E> = 142;
+ <I0F> = 143;
+ <I10> = 144;
+ <I11> = 145;
+ <I12> = 146;
+ <I13> = 147;
+ <I14> = 148;
+ <I15> = 149;
+ <I16> = 150;
+ <I17> = 151;
+ <I18> = 152;
+ <I19> = 153;
+ <I1A> = 154;
+ <I1B> = 155;
+ // <I1C> = 156; <META>
+ // <I1D> = 157; <K59>
+ <I1E> = 158;
+ <I1F> = 159;
+ <I20> = 160;
+ <I21> = 161;
+ <I22> = 162;
+ <I23> = 163;
+ <I24> = 164;
+ <I25> = 165;
+ <I26> = 166;
+ <I27> = 167;
+ <I28> = 168;
+ <I29> = 169;
+ // <I2A> = 170; <K5A>
+ <I2B> = 171;
+ <I2C> = 172;
+ <I2D> = 173;
+ <I2E> = 174;
+ <I2F> = 175;
+ <I30> = 176;
+ <I31> = 177;
+ <I32> = 178;
+ <I33> = 179;
+ <I34> = 180;
+ // <I35> = 181; <K5B>
+ // <I36> = 182; <K5D>
+ // <I37> = 183; <K5E>
+ // <I38> = 184; <K5F>
+ <I39> = 185;
+ <I3A> = 186;
+ <I3B> = 187;
+ <I3C> = 188;
+ // <I3D> = 189; <K62>
+ // <I3E> = 190; <K63>
+ // <I3F> = 191; <K64>
+ // <I40> = 192; <K65>
+ // <I41> = 193; <K66>
+ <I42> = 194;
+ <I43> = 195;
+ <I44> = 196;
+ <I45> = 197;
+ // <I46> = 198; <K67>
+ // <I47> = 199; <K68>
+ // <I48> = 200; <K69>
+ // <I49> = 201; <K6A>
+ <I4A> = 202;
+ // <I4B> = 203; <K6B>
+ // <I4C> = 204; <K6C>
+ // <I4D> = 205; <K6D>
+ // <I4E> = 206; <K6E>
+ // <I4F> = 207; <K6F>
+ // <I50> = 208; <K70>
+ // <I51> = 209; <K71>
+ // <I52> = 210; <K72>
+ // <I53> = 211; <K73>
+ <I54> = 212;
+ <I55> = 213;
+ <I56> = 214;
+ <I57> = 215;
+ <I58> = 216;
+ <I59> = 217;
+ <I5A> = 218;
+ // <I5B> = 219; <K74>
+ // <I5C> = 220; <K75>
+ // <I5D> = 221; <K76>
+ <I5E> = 222;
+ <I5F> = 223;
+ <I60> = 224;
+ <I61> = 225;
+ <I62> = 226;
+ <I63> = 227;
+ <I64> = 228;
+ <I65> = 229;
+ <I66> = 230;
+ <I67> = 231;
+ <I68> = 232;
+ <I69> = 233;
+ <I6A> = 234;
+ <I6B> = 235;
+ <I6C> = 236;
+ <I6D> = 237;
+ <I6E> = 238;
+ <I6F> = 239;
+ <I70> = 240;
+ <I71> = 241;
+ <I72> = 242;
+ <I73> = 243;
+ <I74> = 244;
+ <I75> = 245;
+ <I76> = 246;
+ <I77> = 247;
+ <I78> = 248;
+ <I79> = 249;
+ <I7A> = 250;
+ <I7B> = 251;
+ <I7C> = 252;
+ <I7D> = 253;
+ <I7E> = 254;
+ <I7F> = 255;
+
+ // Codes generated for scancodes 0x59-0x5f, 0x62-0x76
+ <K59> = 157; // <I1D>
+ <K5A> = 170; // <I2A>
+ <K5B> = 181; // <I35>
+ alias <K5C> = <KPEQ>;
+ <K5D> = 182; // <I36>
+ <K5E> = 183; // <I37>
+ <K5F> = 184; // <I38>
+ <K62> = 189; // <I3D>
+ <K63> = 190; // <I3E>
+ <K64> = 191; // <I3F>
+ <K65> = 192; // <I40>
+ <K66> = 193; // <I41>
+ <K67> = 198; // <I46>
+ <K68> = 199; // <I47>
+ <K69> = 200; // <I48>
+ <K6A> = 201; // <I49>
+ <K6B> = 203; // <I4B>
+ <K6C> = 204; // <I4C>
+ <K6D> = 205; // <I4D>
+ <K6E> = 206; // <I4E>
+ <K6F> = 207; // <I4F>
+ alias <K70> = <HKTG>; // <I50>
+ <K71> = 209; // <I51>
+ <K72> = 210; // <I52>
+ alias <K73> = <AB11>; // <I53>
+ <K74> = 219; // <I5B>
+ <K75> = 220; // <I5C>
+ <K76> = 221; // <I5D>
+
+ // Solaris compatibility
+
+ alias <LMTA> = <LWIN>;
+ alias <RMTA> = <RWIN>;
+ alias <COMP> = <MENU>;
+ alias <POWR> = <I0C>;
+ alias <MUTE> = <I0D>;
+ alias <VOL-> = <I0E>;
+ alias <VOL+> = <I0F>;
+ alias <HELP> = <I10>;
+ alias <STOP> = <I11>;
+ alias <AGAI> = <I12>;
+ alias <PROP> = <I13>;
+ alias <UNDO> = <I14>;
+ alias <FRNT> = <I15>;
+ alias <COPY> = <I16>;
+ alias <OPEN> = <I17>;
+ alias <PAST> = <I18>;
+ alias <FIND> = <I19>;
+ alias <CUT> = <I1A>;
+
+ // Other codes never generated. The XFree86 ddx never generates
+ // these codes.
+ // Thus we can use them as fake keys
+ <MDSW> = 93; // <U5D>
+ <LVL3> = 124; // <U7C>
+ <ALT> = 125; // <U7D>
+ <META> = 156; // <I1C>
+ <SUPR> = 127; // <U7F>
+ <HYPR> = 128; // <U80>
+
+ indicator 1 = "Caps Lock";
+ indicator 2 = "Num Lock";
+ indicator 3 = "Scroll Lock";
+
+ alias <ALGR> = <RALT>;
+};
+
+// What keyboard is this?
+
+xkb_keycodes "102" {
+ include "xfree86(xfree86)"
+
+ // There will be warnings from xkbcomp because of multiple definitions.
+
+ <RALT> = 122;
+ <RCTL> = 123;
+
+ <PRSC> = 121;
+ <PAUS> = 118;
+
+ <INS> = 131;
+ <HOME> = 135;
+ <PGUP> = 119;
+ <DELE> = 129;
+ <END> = 130;
+ <PGDN> = 134;
+
+ <UP> = 128;
+ <LEFT> = 132;
+ <DOWN> = 120;
+ <RGHT> = 133;
+
+ <KPDV> = 125;
+
+ <KPEN> = 124;
+};
+
+
+// For japanese 106 keyboard. by tsuka(tsuka@kawalab.dnj.ynu.ac.jp)
+//
+// All of the keycodes here are now in the basic "xfree86" set.
+//
+xkb_keycodes "jp106" {
+ include "xfree86(basic)"
+ <AC12> = 51;
+};
+
+
+// For brazilian ABNT2 keyboard. by Ricardo Y. Igarashi(iga@that.com.br)
+xkb_keycodes "abnt2" {
+ include "xfree86(basic)"
+ <BKSL> = 94;
+ <AC12> = 51;
+ <KPPT> = 134;
+};
+
+
diff --git a/keycodes/xfree98 b/keycodes/xfree98
new file mode 100644
index 0000000..6d34772
--- /dev/null
+++ b/keycodes/xfree98
@@ -0,0 +1,155 @@
+// $Xorg: xfree98,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keycodes/xfree98,v 3.6 2001/01/17 23:45:51 dawes Exp $
+//
+default xkb_keycodes "pc98" {
+
+ minimum= 8;
+ maximum= 134;
+
+ <ESC> = 8;
+ <AE01> = 9;
+ <AE02> = 10;
+ <AE03> = 11;
+ <AE04> = 12;
+ <AE05> = 13;
+ <AE06> = 14;
+ <AE07> = 15;
+ <AE08> = 16;
+ <AE09> = 17;
+ <AE10> = 18;
+ <AE11> = 19;
+ <AE12> = 20;
+ <BKSL> = 21;
+ <BKSP> = 22;
+
+ <TAB> = 23;
+ <AD01> = 24;
+ <AD02> = 25;
+ <AD03> = 26;
+ <AD04> = 27;
+ <AD05> = 28;
+ <AD06> = 29;
+ <AD07> = 30;
+ <AD08> = 31;
+ <AD09> = 32;
+ <AD10> = 33;
+ <AD11> = 34;
+ <AD12> = 35;
+ <RTRN> = 36;
+
+ <LCTL> = 124;
+ <CAPS> = 121;
+ <AC01> = 37;
+ <AC02> = 38;
+ <AC03> = 39;
+ <AC04> = 40;
+ <AC05> = 41;
+ <AC06> = 42;
+ <AC07> = 43;
+ <AC08> = 44;
+ <AC09> = 45;
+ <AC10> = 46;
+ <AC11> = 47;
+ <AC12> = 48;
+
+ <LFSH> = 120;
+ <AB01> = 49;
+ <AB02> = 50;
+ <AB03> = 51;
+ <AB04> = 52;
+ <AB05> = 53;
+ <AB06> = 54;
+ <AB07> = 55;
+ <AB08> = 56;
+ <AB09> = 57;
+ <AB10> = 58;
+ <AB11> = 59;
+
+ <ALGR> = 122;
+ <LALT> = 123;
+ <NFER> = 89;
+ <SPCE> = 60;
+ <XFER> = 61;
+
+ <BRK> = 104;
+ <PRSC> = 105;
+ <FK01> = 106;
+ <FK02> = 107;
+ <FK03> = 108;
+ <FK04> = 109;
+ <FK05> = 110;
+ <FK06> = 111;
+ <FK07> = 112;
+ <FK08> = 113;
+ <FK09> = 114;
+ <FK10> = 115;
+ <FK11> = 90;
+ <FK12> = 91;
+ <FK13> = 92;
+ <FK14> = 93;
+ <FK15> = 94;
+
+
+ <INS> = 64;
+ <DELE> = 65;
+ <PGUP> = 63;
+ <PGDN> = 62;
+ <UP> = 66;
+ <LEFT> = 67;
+ <RGHT> = 68;
+ <DOWN> = 69;
+
+ <HOME> = 70;
+ <HELP> = 71;
+
+ <KPSU> = 72;
+ <KPDV> = 73;
+
+ <KP7> = 74;
+ <KP8> = 75;
+ <KP9> = 76;
+ <KPMU> = 77;
+
+ <KP4> = 78;
+ <KP5> = 79;
+ <KP6> = 80;
+ <KPAD> = 81;
+
+ <KP1> = 82;
+ <KP2> = 83;
+ <KP3> = 84;
+ <KPEQ> = 85;
+
+ <KP0> = 86;
+ <KPSP> = 87;
+ <KPDC> = 88;
+
+ indicator 1 = "Caps Lock";
+ indicator 2 = "Kana";
+};
+
diff --git a/keymap/README b/keymap/README
new file mode 100644
index 0000000..adef966
--- /dev/null
+++ b/keymap/README
@@ -0,0 +1,8 @@
+The keymap component provides a way how to set up one pre-defined keyboard
+mapping from a given set. It has been obsoleted by 'rules' component which
+is simplier and more flexible. The directory is preserved for compatibility
+reasons. Avoid using it if it is possible.
+
+
+
+/* $XFree86$ */
diff --git a/keymap/amiga b/keymap/amiga
new file mode 100644
index 0000000..d697a98
--- /dev/null
+++ b/keymap/amiga
@@ -0,0 +1,22 @@
+// $Xorg: amiga,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+
+
+
+
+// $XFree86: xc/programs/xkbcomp/keymap/amiga,v 3.2 1997/10/26 13:25:36 dawes Exp $
+
+default xkb_keymap "usa1" {
+ xkb_keycodes { include "amiga(usa1)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "amiga(usa1)" };
+ xkb_geometry { include "amiga(usa1)" };
+};
+
+xkb_keymap "de" {
+ xkb_keycodes { include "amiga(de)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "amiga(de)" };
+ xkb_geometry { include "amiga(de)" };
+};
diff --git a/keymap/ataritt b/keymap/ataritt
new file mode 100644
index 0000000..b801ac2
--- /dev/null
+++ b/keymap/ataritt
@@ -0,0 +1,21 @@
+// $Xorg: ataritt,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+
+
+
+
+// $XFree86: xc/programs/xkbcomp/keymap/ataritt,v 3.1 1997/10/26 13:25:37 dawes Exp $
+
+default xkb_keymap "us" {
+ xkb_keycodes { include "ataritt(us)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "ataritt(us)" };
+ xkb_geometry { include "ataritt(us)" };
+};
+xkb_keymap "de" {
+ xkb_keycodes { include "ataritt(de)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "ataritt(de)" };
+ xkb_geometry { include "ataritt(de)" };
+};
diff --git a/keymap/digital.vndr/us b/keymap/digital.vndr/us
new file mode 100644
index 0000000..00058cd
--- /dev/null
+++ b/keymap/digital.vndr/us
@@ -0,0 +1,188 @@
+// $Xorg: us,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+//
+//Copyright (c) 1996 Digital Equipment Corporation
+//
+//Permission is hereby granted, free of charge, to any person obtaining
+//a copy of this software and associated documentation files (the
+//"Software"), to deal in the Software without restriction, including
+//without limitation the rights to use, copy, modify, merge, publish,
+//distribute, sublicense, and sell copies of the Software, and to
+//permit persons to whom the Software is furnished to do so, subject to
+//the following conditions:
+//
+//The above copyright notice and this permission notice shall be included
+//in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM,
+//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR
+//THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of the Digital Equipment
+//Corporation shall not be used in advertising or otherwise to promote
+//the sale, use or other dealings in this Software without prior written
+//authorization from Digital Equipment Corporation.
+//
+// HISTORY
+// Log: us,v
+// Revision 1.3 1996/06/18 09:14:51 erik
+// use flags correctly, assorted cleanups and consortium fixes
+//
+// Revision 1.1.6.2 1995/10/25 21:00:53 William_Walker
+// Add pc104-key support
+// [1995/10/23 15:46:24 William_Walker]
+//
+// Revision 1.1.2.6 1995/06/27 12:18:05 William_Walker
+// Add LK201 and LK450 support as well as TW and DP variants.
+// [1995/06/26 20:26:19 William_Walker]
+//
+// Revision 1.1.2.5 1995/06/05 19:23:12 William_Walker
+// New file. I love keymaps.
+// [1995/06/05 18:14:04 William_Walker]
+//
+// EndLog
+//
+// @(#)RCSfile: us,v Revision: 1.3 (DEC) Date: 1996/02/02 14:21:15
+//
+
+// **************************************************************
+// * *
+// * Keymaps for en_US.ISO8859-1 - English for U.S. *
+// * *
+// **************************************************************
+
+xkb_keymap "lk201" {
+ xkb_keycodes { include "digital/lk(lk201)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(vt105)" };
+ xkb_geometry { description = "Digital US LK201";
+ include "digital/lk(lk201)" };
+};
+
+xkb_keymap "lk401" {
+ xkb_keycodes { include "digital/lk(lk401)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(vt108)" };
+ xkb_geometry { description = "Digital US LK401";
+ include "digital/lk(lk401)" };
+};
+
+xkb_keymap "lk411" {
+ xkb_keycodes { include "digital/pc(lk411)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(vt108)" };
+ xkb_geometry { description = "Digital US LK411";
+ include "digital/lk(lk401)" };
+};
+
+xkb_keymap "lk421" {
+ xkb_keycodes { include "digital/lk(lk421)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(unix)" };
+ xkb_geometry { description = "Digital US LK421";
+ include "digital/unix(unix)" };
+};
+
+xkb_keymap "lk441" {
+ xkb_keycodes { include "digital/lk(lk443)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(lk44x)" };
+ xkb_geometry { description = "Digital US LK441";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "lk443" {
+ xkb_keycodes { include "digital/lk(lk443)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(lk44x)" };
+ xkb_geometry { description = "Digital US LK443";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "lk44x" {
+ xkb_keycodes { include "digital/lk(lk443)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(lk44x)" };
+ xkb_geometry { description = "Digital US LK443";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "lk450" {
+ xkb_keycodes { include "digital/pc(lk450)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(vt108)" };
+ xkb_geometry { description = "Digital US LK450";
+ include "digital/lk(lk450)" };
+};
+
+xkb_keymap "pcxalaa" {
+ xkb_keycodes { include "digital/pc(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(pcxalaa)" };
+ xkb_geometry { description = "Digital US PCXAL-AA";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "pcxalfa" {
+ xkb_keycodes { include "digital/pc(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(pcxalfa)" };
+ xkb_geometry { description = "Digital US PCXAL-FA";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_on_keys)" };
+};
+
+xkb_keymap "pcxalga" {
+ xkb_keycodes { include "digital/pc(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(pcxalga)" };
+ xkb_geometry { description = "Digital US PCXAL-GA";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "pcxalka" {
+ xkb_keycodes { include "digital/pc(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(pcxalka)" };
+ xkb_geometry { description = "Digital US PCXAL-KA";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "pcxal" {
+ xkb_keycodes { include "digital/pc(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(pcxal)" };
+ xkb_geometry { description = "Digital US PCXAL";
+ include "digital/pc(pc101)"
+ include "digital/pc(leds_alone)" };
+};
+
+xkb_keymap "mnk" {
+ xkb_keycodes { include "digital/pc(pc104)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "digital/us(pc104)" };
+ xkb_geometry { include "microsoft" };
+};
diff --git a/keymap/macintosh b/keymap/macintosh
new file mode 100644
index 0000000..d230dca
--- /dev/null
+++ b/keymap/macintosh
@@ -0,0 +1,17 @@
+// $XConsortium: macintosh /main/11 1996/03/07 13:42:13 kaleb $
+// $XFree86: xc/programs/xkbcomp/keymap/macintosh,v 1.1 1999/05/23 05:27:51 dawes Exp $
+default xkb_keymap "macintosh" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "macintosh/us(extended)" };
+ xkb_geometry { include "macintosh" };
+};
+
+xkb_keymap "macintosh_old" {
+ xkb_keycodes { include "macintosh" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "macintosh/us(extended)" };
+ xkb_geometry { include "macintosh" };
+};
diff --git a/keymap/sgi.vndr/be b/keymap/sgi.vndr/be
new file mode 100644
index 0000000..ef8c3dc
--- /dev/null
+++ b/keymap/sgi.vndr/be
@@ -0,0 +1,34 @@
+// $Xorg: be,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+be" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+be(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+be" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+be(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/bg b/keymap/sgi.vndr/bg
new file mode 100644
index 0000000..46cd545
--- /dev/null
+++ b/keymap/sgi.vndr/bg
@@ -0,0 +1,19 @@
+// $Xorg: bg,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "us(pc_universal)+bg+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "us(pc102)+bg+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
diff --git a/keymap/sgi.vndr/ca b/keymap/sgi.vndr/ca
new file mode 100644
index 0000000..9030e15
--- /dev/null
+++ b/keymap/sgi.vndr/ca
@@ -0,0 +1,33 @@
+// $Xorg: ca,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+ca" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+ca(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+ca" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+ca(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
diff --git a/keymap/sgi.vndr/cz b/keymap/sgi.vndr/cz
new file mode 100644
index 0000000..b1c8598
--- /dev/null
+++ b/keymap/sgi.vndr/cz
@@ -0,0 +1,21 @@
+// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+//
+//
+//
+// $XFree86$
+
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+cz" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc102)+cz" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/cz_qwerty b/keymap/sgi.vndr/cz_qwerty
new file mode 100644
index 0000000..a87e7d5
--- /dev/null
+++ b/keymap/sgi.vndr/cz_qwerty
@@ -0,0 +1,21 @@
+// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+//
+//
+//
+// $XFree86$
+
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+cz_qwerty" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc102)+cz_qwerty" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/de b/keymap/sgi.vndr/de
new file mode 100644
index 0000000..1e4cfe7
--- /dev/null
+++ b/keymap/sgi.vndr/de
@@ -0,0 +1,34 @@
+// $Xorg: de,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+de" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+de(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+de" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+de(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/de_CH b/keymap/sgi.vndr/de_CH
new file mode 100644
index 0000000..093a5b1
--- /dev/null
+++ b/keymap/sgi.vndr/de_CH
@@ -0,0 +1,34 @@
+// $Xorg: de_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+de_CH" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+de_CH(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+de_CH" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+de_CH(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/dk b/keymap/sgi.vndr/dk
new file mode 100644
index 0000000..9eceffd
--- /dev/null
+++ b/keymap/sgi.vndr/dk
@@ -0,0 +1,34 @@
+// $Xorg: dk,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+dk" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+dk(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+dk" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+dk(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/dvorak b/keymap/sgi.vndr/dvorak
new file mode 100644
index 0000000..a282cd1
--- /dev/null
+++ b/keymap/sgi.vndr/dvorak
@@ -0,0 +1,15 @@
+// $Xorg: dvorak,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+dvorak" };
+ xkb_geometry { include "sgi/indy(pc101)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc101)+dvorak" };
+ xkb_geometry { include "sgi/indigo(pc101)" };
+};
diff --git a/keymap/sgi.vndr/en_US b/keymap/sgi.vndr/en_US
new file mode 100644
index 0000000..446f563
--- /dev/null
+++ b/keymap/sgi.vndr/en_US
@@ -0,0 +1,58 @@
+// $Xorg: en_US,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal_nodeadkeys)" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy101" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)" };
+ xkb_geometry { include "sgi/indy(pc101)" };
+};
+xkb_keymap "indy101_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal_nodeadkeys)" };
+ xkb_geometry { include "sgi/indy(pc101)" };
+};
+xkb_keymap "indy104" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)" };
+ xkb_geometry { include "microsoft(natural)" };
+};
+xkb_keymap "indy104_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal_nodeadkeys)" };
+ xkb_geometry { include "microsoft(natural)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102_nodeadkeys)" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/es b/keymap/sgi.vndr/es
new file mode 100644
index 0000000..a57750c
--- /dev/null
+++ b/keymap/sgi.vndr/es
@@ -0,0 +1,34 @@
+// $Xorg: es,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+es" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+es(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+es" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+es(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/fi b/keymap/sgi.vndr/fi
new file mode 100644
index 0000000..bb0fd20
--- /dev/null
+++ b/keymap/sgi.vndr/fi
@@ -0,0 +1,34 @@
+// $Xorg: fi,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+fi" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+fi(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+fi" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+fi(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/fr b/keymap/sgi.vndr/fr
new file mode 100644
index 0000000..ecf615f
--- /dev/null
+++ b/keymap/sgi.vndr/fr
@@ -0,0 +1,34 @@
+// $Xorg: fr,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+fr" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+fr(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+fr" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+fr(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/fr_CH b/keymap/sgi.vndr/fr_CH
new file mode 100644
index 0000000..3f825e0
--- /dev/null
+++ b/keymap/sgi.vndr/fr_CH
@@ -0,0 +1,34 @@
+// $Xorg: fr_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+fr_CH" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+fr_CH(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+fr_CH" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+fr_CH(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/gb b/keymap/sgi.vndr/gb
new file mode 100644
index 0000000..5c7566c
--- /dev/null
+++ b/keymap/sgi.vndr/gb
@@ -0,0 +1,34 @@
+// $Xorg: gb,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+gb" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+gb(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+gb" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+gb(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/hu b/keymap/sgi.vndr/hu
new file mode 100644
index 0000000..92d31a8
--- /dev/null
+++ b/keymap/sgi.vndr/hu
@@ -0,0 +1,105 @@
+// $Xorg: hu,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+hu(basic)" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+hu(basic)+group(toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_shift_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+hu(basic)+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_ctrl_shift_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+hu(basic)+group(ctrl_shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_ctrl_alt_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+hu(basic)+group(ctrl_alt_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_caps_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+hu(basic)+group(caps_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+hu(basic)" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+hu(basic)+group(toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_shift_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+hu(basic)+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_ctrl_shift_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+hu(basic)+group(ctrl_shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_ctrl_alt_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+hu(basic)+group(ctrl_alt_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_caps_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+hu(basic)+group(caps_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
diff --git a/keymap/sgi.vndr/it b/keymap/sgi.vndr/it
new file mode 100644
index 0000000..17d6a10
--- /dev/null
+++ b/keymap/sgi.vndr/it
@@ -0,0 +1,34 @@
+// $Xorg: it,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+it" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+it(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+it" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+it(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/jp b/keymap/sgi.vndr/jp
new file mode 100644
index 0000000..c83900a
--- /dev/null
+++ b/keymap/sgi.vndr/jp
@@ -0,0 +1,8 @@
+// $Xorg: jp,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(jp106)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc101)+sgi/jp" };
+ xkb_geometry { include "sgi/indy(jp106)" };
+};
diff --git a/keymap/sgi.vndr/no b/keymap/sgi.vndr/no
new file mode 100644
index 0000000..ed293d2
--- /dev/null
+++ b/keymap/sgi.vndr/no
@@ -0,0 +1,34 @@
+// $Xorg: no,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+no" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+no(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+no" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+no(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/pl b/keymap/sgi.vndr/pl
new file mode 100644
index 0000000..b75f1f3
--- /dev/null
+++ b/keymap/sgi.vndr/pl
@@ -0,0 +1,29 @@
+// $Xorg: pl,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+pl" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+pl(nodeadkeys)" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc102)+pl" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc102)+pl(nodeadkeys)" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
diff --git a/keymap/sgi.vndr/pt b/keymap/sgi.vndr/pt
new file mode 100644
index 0000000..eda0035
--- /dev/null
+++ b/keymap/sgi.vndr/pt
@@ -0,0 +1,34 @@
+// $Xorg: pt,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+pt" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+pt(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+pt" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+pt(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/ru b/keymap/sgi.vndr/ru
new file mode 100644
index 0000000..6a2a189
--- /dev/null
+++ b/keymap/sgi.vndr/ru
@@ -0,0 +1,105 @@
+// $Xorg: ru,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+ru(basic)" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+ru(basic)+group(toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_shift_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+ru(basic)+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_ctrl_shift_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+ru(basic)+group(ctrl_shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_ctrl_alt_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+ru(basic)+group(ctrl_alt_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_caps_toggle" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+ru(basic)+group(caps_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+ru(basic)" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+ru(basic)+group(toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_shift_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+ru(basic)+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_ctrl_shift_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+ru(basic)+group(ctrl_shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_ctrl_alt_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+ru(basic)+group(ctrl_alt_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_caps_toggle" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102)+ru(basic)+group(caps_toggle)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
diff --git a/keymap/sgi.vndr/se b/keymap/sgi.vndr/se
new file mode 100644
index 0000000..3fe54e2
--- /dev/null
+++ b/keymap/sgi.vndr/se
@@ -0,0 +1,34 @@
+// $Xorg: se,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc_universal)+se" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indy_nodeadkeys" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal_nodeadkeys)+se(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+se" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+xkb_keymap "indigo_nodeadkeys" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc102_nodeadkeys)+se(nodeadkeys)"
+ };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/sk b/keymap/sgi.vndr/sk
new file mode 100644
index 0000000..89bd9b5
--- /dev/null
+++ b/keymap/sgi.vndr/sk
@@ -0,0 +1,21 @@
+// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+//
+//
+//
+// $XFree86$
+
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+sk" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc102)+sk" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/sk_qwerty b/keymap/sgi.vndr/sk_qwerty
new file mode 100644
index 0000000..9094cbc
--- /dev/null
+++ b/keymap/sgi.vndr/sk_qwerty
@@ -0,0 +1,21 @@
+// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $
+//
+//
+//
+// $XFree86$
+
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)+sk_qwerty" };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc102)+sk_qwerty" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
+
diff --git a/keymap/sgi.vndr/th b/keymap/sgi.vndr/th
new file mode 100644
index 0000000..b614913
--- /dev/null
+++ b/keymap/sgi.vndr/th
@@ -0,0 +1,17 @@
+// $Xorg: th,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "en_US(pc_universal)+th+group(shift_toggle)"
+ };
+ xkb_geometry { include "sgi/indy(pc102)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc102)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc102)+th+group(shift_toggle)" };
+ xkb_geometry { include "sgi/indigo(pc102)" };
+};
diff --git a/keymap/sgi.vndr/us b/keymap/sgi.vndr/us
new file mode 100644
index 0000000..2d704ca
--- /dev/null
+++ b/keymap/sgi.vndr/us
@@ -0,0 +1,43 @@
+// $Xorg: us,v 1.3 2000/08/17 19:54:41 cpqbld Exp $
+default xkb_keymap "indy" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)" };
+ xkb_geometry { include "sgi/indy(pc101)" };
+};
+xkb_keymap "indy101_euro" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)" };
+ xkb_geometry { include "sgi/indy(pc101)" };
+};
+xkb_keymap "indy_compose" {
+ xkb_keycodes { include "sgi/indy(universal)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc_universal)" };
+ xkb_geometry { include "sgi/indy(pc101)" };
+};
+xkb_keymap "indigo" {
+ xkb_keycodes { include "sgi/indigo(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc101)" };
+ xkb_geometry { include "sgi/indigo(pc101)" };
+};
+xkb_keymap "indigo_compose" {
+ xkb_keycodes { include "sgi/indigo(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc101compose)" };
+ xkb_geometry { include "sgi/indigo(pc101)" };
+};
+xkb_keymap "indigo101_compose" {
+ xkb_keycodes { include "sgi/indigo(pc101)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc101euro)" };
+ xkb_geometry { include "sgi/indigo(pc101)" };
+};
diff --git a/keymap/sony b/keymap/sony
new file mode 100644
index 0000000..5380c4e
--- /dev/null
+++ b/keymap/sony
@@ -0,0 +1,33 @@
+// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+xkb_keymap "news5000-nwp5461" {
+ xkb_keycodes { include "sony(nwp5461)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sony/us(nwp5461)" };
+ xkb_geometry { include "sony(nwp5461)" };
+};
diff --git a/keymap/sun.vndr/de b/keymap/sun.vndr/de
new file mode 100644
index 0000000..0b4bd53
--- /dev/null
+++ b/keymap/sun.vndr/de
@@ -0,0 +1,78 @@
+// $Xorg: de,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+xkb_keymap "type4_de" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+de"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_de_nodeadkeys" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(nodeadkeys)+de(nodeadkeys)"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_de_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+de"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_de" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+de"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_de_nodeadkeys" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(nodeadkeys)+de(nodeadkeys)"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_de_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+de" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/es b/keymap/sun.vndr/es
new file mode 100644
index 0000000..ab29c43
--- /dev/null
+++ b/keymap/sun.vndr/es
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/es,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_es" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+es"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_es_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+es"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_es" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+es"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_es_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+es" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/fi b/keymap/sun.vndr/fi
new file mode 100644
index 0000000..3ca6003
--- /dev/null
+++ b/keymap/sun.vndr/fi
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/fi,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_fi" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+fi"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_fi_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+fi"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_fi" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+fi"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_fi_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+fi" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/fr b/keymap/sun.vndr/fr
new file mode 100644
index 0000000..60be0d1
--- /dev/null
+++ b/keymap/sun.vndr/fr
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/fr,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_fr" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+fr"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_fr_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+fr"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_fr" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+fr"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_fr_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+fr" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/no b/keymap/sun.vndr/no
new file mode 100644
index 0000000..d57fc49
--- /dev/null
+++ b/keymap/sun.vndr/no
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/no,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_no" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+no"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_no_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+no"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_no" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+no"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_no_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+no" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/pl b/keymap/sun.vndr/pl
new file mode 100644
index 0000000..d672db7
--- /dev/null
+++ b/keymap/sun.vndr/pl
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/pl,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_pl" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+pl"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_pl_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+pl"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_pl" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+pl"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_pl_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+pl" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/ru b/keymap/sun.vndr/ru
new file mode 100644
index 0000000..9dead90
--- /dev/null
+++ b/keymap/sun.vndr/ru
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/ru,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_ru" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+ru"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_ru_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+ru"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_ru" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+ru"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_ru_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+ru" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/se b/keymap/sun.vndr/se
new file mode 100644
index 0000000..dd0a167
--- /dev/null
+++ b/keymap/sun.vndr/se
@@ -0,0 +1,56 @@
+// $XFree86: xc/programs/xkbcomp/keymap/sun/se,v 1.2 1998/12/20 09:34:42 dawes Exp $
+
+default xkb_keymap "type5c_se_fixdollar" {
+ xkb_keycodes { include "sun(type5_se)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/se(sun5)+se(fixdollar)"
+ };
+ xkb_geometry { include "sun(type5c_se)" };
+};
+xkb_keymap "type5c_se" {
+ xkb_keycodes { include "sun(type5_se)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/se(sun5)"
+ };
+ xkb_geometry { include "sun(type5c_se)" };
+};
+xkb_keymap "type5_se" {
+ xkb_keycodes { include "sun(type5_se)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/se(sun5)"
+ };
+ xkb_geometry { include "sun(type5_se)" };
+};
+xkb_keymap "type4_se_fixdollar_swapctl" {
+ xkb_keycodes { include "sun(type4_se_swapctl)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/se(sun4)+se(fixdollar)"
+ };
+ xkb_geometry { include "sun(type4_se)" };
+};
+xkb_keymap "type4_se_fixdollar" {
+ xkb_keycodes { include "sun(type4_se)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/se(sun4)+se(fixdollar)"
+ };
+ xkb_geometry { include "sun(type4_se)" };
+};
+xkb_keymap "type4_se" {
+ xkb_keycodes { include "sun(type4_se)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/se(sun4)"
+ };
+ xkb_geometry { include "sun(type4_se)" };
+};
diff --git a/keymap/sun.vndr/uk b/keymap/sun.vndr/uk
new file mode 100644
index 0000000..d99e2ff
--- /dev/null
+++ b/keymap/sun.vndr/uk
@@ -0,0 +1,62 @@
+// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+// $XFree86: xc/programs/xkbcomp/keymap/sun/uk,v 1.2 2000/10/28 00:34:05 dawes Exp $
+//
+xkb_keymap "type4_uk" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4)+iso9995-3(basic)+uk"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_uk_openlook" {
+ xkb_keycodes { include "sun(type4_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun4ol)+iso9995-3(basic)+uk"
+ };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_uk" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols {
+ include "sun/us(sun5)+iso9995-3(basic)+uk"
+ };
+ xkb_geometry { include "sun(type5euro)" };
+};
+xkb_keymap "type5_uk_openlook" {
+ xkb_keycodes { include "sun(type5_euro)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)+iso9995-3+uk" };
+ xkb_geometry { include "sun(type5euro)" };
+};
diff --git a/keymap/sun.vndr/us b/keymap/sun.vndr/us
new file mode 100644
index 0000000..2133c21
--- /dev/null
+++ b/keymap/sun.vndr/us
@@ -0,0 +1,68 @@
+// $Xorg: us,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $
+//
+//Copyright 1996, 1998 The Open Group
+//
+//Permission to use, copy, modify, distribute, and sell this software and its
+//documentation for any purpose is hereby granted without fee, provided that
+//the above copyright notice appear in all copies and that both that
+//copyright notice and this permission notice appear in supporting
+//documentation.
+//
+//The above copyright notice and this permission notice shall be
+//included in all copies or substantial portions of the Software.
+//
+//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+//OTHER DEALINGS IN THE SOFTWARE.
+//
+//Except as contained in this notice, the name of The Open Group shall
+//not be used in advertising or otherwise to promote the sale, use or
+//other dealings in this Software without prior written authorization
+//from The Open Group.
+//
+xkb_keymap "type4_us" {
+ xkb_keycodes { include "sun(type4)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun4)" };
+ xkb_geometry { include "sun(type4)" };
+};
+xkb_keymap "type4_us_openlook" {
+ xkb_keycodes { include "sun(type4)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun4ol)" };
+ xkb_geometry { include "sun(type4)" };
+};
+default xkb_keymap "type5_us" {
+ xkb_keycodes { include "sun(type5)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5)" };
+ xkb_geometry { include "sun(type5)" };
+};
+xkb_keymap "type5_us_openlook" {
+ xkb_keycodes { include "sun(type5)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)" };
+ xkb_geometry { include "sun(type5)" };
+};
+xkb_keymap "type5_unix" {
+ xkb_keycodes { include "sun(type5)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5)" };
+ xkb_geometry { include "sun(type5unix)" };
+};
+xkb_keymap "type5_unix_openlook" {
+ xkb_keycodes { include "sun(type5)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "sun/us(sun5ol)" };
+ xkb_geometry { include "sun(type5unix)" };
+};
diff --git a/keymap/xfree86 b/keymap/xfree86
new file mode 100644
index 0000000..e1967a1
--- /dev/null
+++ b/keymap/xfree86
@@ -0,0 +1,362 @@
+// $XFree86: xc/programs/xkbcomp/keymap/xfree86,v 3.30 2003/04/03 16:34:49 dawes Exp $
+
+
+default xkb_keymap "us" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc105)" };
+ xkb_geometry { include "pc" };
+};
+
+// "ar" addition by Arabeyes Team, <support@arabeyes.org>
+xkb_keymap "ar" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+ar" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "be" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+be" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "bg" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+bg" };
+ xkb_geometry { include "pc(pc102)" };
+};
+// us_intl and br by Ricardo Y. Igarashi (iga@that.com.br)
+xkb_keymap "br" {
+ xkb_keycodes { include "xfree86(abnt2)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "us(pc101)+br" };
+ xkb_geometry { include "pc(abnt2)" };
+};
+// cz and sk keymaps by Kamil Toman (ktoman@email.cz)
+// are designed to replace old czechoslovakian and czsk keyboards
+// and their prog variants. Those are now obsolete and should not be used anymore.
+xkb_keymap "cz" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+cz" };
+ xkb_geometry { include "pc" };
+};
+xkb_keymap "cz_qwerty" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+cz_qwerty" };
+ xkb_geometry { include "pc" };
+};
+xkb_keymap "de" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+de" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "de_CH" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+de_CH" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "dk" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+dk" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "dvorak" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+dvorak" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "en_US" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)" };
+ xkb_geometry { include "pc" };
+};
+xkb_keymap "es" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+es" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "fr" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+fr" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "fr-latin9" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+fr-latin9" };
+ xkb_geometry { include "pc" };
+};
+xkb_keymap "fr_CA" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+ca" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "fr_CH" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+fr_CH" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "gb" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+gb" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "hr" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+hr" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "it" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+it" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "jp106" {
+ xkb_keycodes { include "xfree86(jp106)" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "jp(jp106)" };
+ xkb_geometry { include "pc(jp106)" };
+};
+xkb_keymap "lt" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+lt" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "lt_std" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+lt_std" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "lv" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+lv" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "mk" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+mk" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "mt" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+mt" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "mt_us" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+mt_us" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "no" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+no" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "pl" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+pl" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "pt" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+pt" };
+ xkb_geometry { include "pc(pc102)" };
+};
+// ro: additions by Cristian Gafton, <gafton@redhat.com>
+xkb_keymap "ro" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc101)+ro(pc101)" };
+ xkb_geometry { include "pc(pc101)" };
+};
+xkb_keymap "ro_microsoft" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+ro(pc105)" };
+ xkb_geometry { include "pc(pc105)" };
+};
+xkb_keymap "ru" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+ru" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "se_FI" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+fi" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "se_SE" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+se" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "sl" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+si" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "sl_SI" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+si" };
+ xkb_geometry { include "pc(pc102)" };
+};
+// cz and sk keymaps by Kamil Toman (ktoman@email.cz)
+// are designed to replace old czechoslovakian and czsk keyboards
+// and their prog variants. Those are now obsolete and should not be used anymore.
+xkb_keymap "sk" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+sk" };
+ xkb_geometry { include "pc" };
+};
+xkb_keymap "sk_qwerty" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+sk_qwerty" };
+ xkb_geometry { include "pc" };
+};
+// Additions by Emil Soleyman-Zomalan, <emil@nishra.com>
+xkb_keymap "syr" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+syr" };
+ xkb_geometry { include "pc(pc102)" };
+};
+xkb_keymap "th" {
+ xkb_keycodes { include "xfree86" };
+ xkb_types { include "default" };
+ xkb_compatibility { include "default" };
+ xkb_symbols { include "en_US(pc105)+th" };
+ xkb_geometry { include "pc(pc102)" };
+};
+x